/*!
 * jQuery JavaScript Library v1.9.1
 * http://jquery.com/
 *
 * Includes Sizzle.js
 * http://sizzlejs.com/
 *
 * Copyright 2005, 2012 jQuery Foundation, Inc. and other contributors
 * Released under the MIT license
 * http://jquery.org/license
 *
 * Date: 2013-2-4
 */
(function(window, undefined) {

	// Can't do this because several apps including ASP.NET trace
	// the stack via arguments.caller.callee and Firefox dies if
	// you try to trace through "use strict" call chains. (#13335)
	// Support: Firefox 18+
	//"use strict";
	var
	// The deferred used on DOM ready
	readyList,

		// A central reference to the root jQuery(document)
		rootjQuery,

		// Support: IE<9
		// For `typeof node.method` instead of `node.method !== undefined`
		core_strundefined = typeof undefined,

		// Use the correct document accordingly with window argument (sandbox)
		document = window.document,
		location = window.location,

		// Map over jQuery in case of overwrite
		_jQuery = window.jQuery,

		// Map over the $ in case of overwrite
		_$ = window.$,

		// [[Class]] -> type pairs
		class2type = {},

		// List of deleted data cache ids, so we can reuse them
		core_deletedIds = [],

		core_version = "1.9.1",

		// Save a reference to some core methods
		core_concat = core_deletedIds.concat,
		core_push = core_deletedIds.push,
		core_slice = core_deletedIds.slice,
		core_indexOf = core_deletedIds.indexOf,
		core_toString = class2type.toString,
		core_hasOwn = class2type.hasOwnProperty,
		core_trim = core_version.trim,

		// Define a local copy of jQuery
		jQuery = function(selector, context) {
			// The jQuery object is actually just the init constructor 'enhanced'
			return new jQuery.fn.init(selector, context, rootjQuery);
		},

		// Used for matching numbers
		core_pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,

		// Used for splitting on whitespace
		core_rnotwhite = /\S+/g,

		// Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE)
		rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,

		// A simple way to check for HTML strings
		// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
		// Strict HTML recognition (#11290: must start with <)
		rquickExpr = /^(?:(<[\w\W]+>)[^>]*|#([\w-]*))$/,

		// Match a standalone tag
		rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/,

		// JSON RegExp
		rvalidchars = /^[\],:{}\s]*$/,
		rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
		rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,
		rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d+\.|)\d+(?:[eE][+-]?\d+|)/g,

		// Matches dashed string for camelizing
		rmsPrefix = /^-ms-/,
		rdashAlpha = /-([\da-z])/gi,

		// Used by jQuery.camelCase as callback to replace()
		fcamelCase = function(all, letter) {
			return letter.toUpperCase();
		},

		// The ready event handler
		completed = function(event) {

			// readyState === "complete" is good enough for us to call the dom ready in oldIE
			if (document.addEventListener || event.type === "load" || document.readyState === "complete") {
				detach();
				jQuery.ready();
			}
		},
		// Clean-up method for dom ready events
		detach = function() {
			if (document.addEventListener) {
				document.removeEventListener("DOMContentLoaded", completed, false);
				window.removeEventListener("load", completed, false);

			} else {
				document.detachEvent("onreadystatechange", completed);
				window.detachEvent("onload", completed);
			}
		};

	jQuery.fn = jQuery.prototype = {
		// The current version of jQuery being used
		jquery: core_version,

		constructor: jQuery,
		init: function(selector, context, rootjQuery) {
			var match, elem;

			// HANDLE: $(""), $(null), $(undefined), $(false)
			if (!selector) {
				return this;
			}

			// Handle HTML strings
			if (typeof selector === "string") {
				if (selector.charAt(0) === "<" && selector.charAt(selector.length - 1) === ">" && selector.length >= 3) {
					// Assume that strings that start and end with <> are HTML and skip the regex check
					match = [null, selector, null];

				} else {
					match = rquickExpr.exec(selector);
				}

				// Match html or make sure no context is specified for #id
				if (match && (match[1] || !context)) {

					// HANDLE: $(html) -> $(array)
					if (match[1]) {
						context = context instanceof jQuery ? context[0] : context;

						// scripts is true for back-compat
						jQuery.merge(this, jQuery.parseHTML(
							match[1],
							context && context.nodeType ? context.ownerDocument || context : document,
							true
						));

						// HANDLE: $(html, props)
						if (rsingleTag.test(match[1]) && jQuery.isPlainObject(context)) {
							for (match in context) {
								// Properties of context are called as methods if possible
								if (jQuery.isFunction(this[match])) {
									this[match](context[match]);

									// ...and otherwise set as attributes
								} else {
									this.attr(match, context[match]);
								}
							}
						}

						return this;

						// HANDLE: $(#id)
					} else {
						elem = document.getElementById(match[2]);

						// Check parentNode to catch when Blackberry 4.6 returns
						// nodes that are no longer in the document #6963
						if (elem && elem.parentNode) {
							// Handle the case where IE and Opera return items
							// by name instead of ID
							if (elem.id !== match[2]) {
								return rootjQuery.find(selector);
							}

							// Otherwise, we inject the element directly into the jQuery object
							this.length = 1;
							this[0] = elem;
						}

						this.context = document;
						this.selector = selector;
						return this;
					}

					// HANDLE: $(expr, $(...))
				} else if (!context || context.jquery) {
					return (context || rootjQuery).find(selector);

					// HANDLE: $(expr, context)
					// (which is just equivalent to: $(context).find(expr)
				} else {
					return this.constructor(context).find(selector);
				}

				// HANDLE: $(DOMElement)
			} else if (selector.nodeType) {
				this.context = this[0] = selector;
				this.length = 1;
				return this;

				// HANDLE: $(function)
				// Shortcut for document ready
			} else if (jQuery.isFunction(selector)) {
				return rootjQuery.ready(selector);
			}

			if (selector.selector !== undefined) {
				this.selector = selector.selector;
				this.context = selector.context;
			}

			return jQuery.makeArray(selector, this);
		},

		// Start with an empty selector
		selector: "",

		// The default length of a jQuery object is 0
		length: 0,

		// The number of elements contained in the matched element set
		size: function() {
			return this.length;
		},

		toArray: function() {
			return core_slice.call(this);
		},

		// Get the Nth element in the matched element set OR
		// Get the whole matched element set as a clean array
		get: function(num) {
			return num == null ?

			// Return a 'clean' array
			this.toArray() :

			// Return just the object
			(num < 0 ? this[this.length + num] : this[num]);
		},

		// Take an array of elements and push it onto the stack
		// (returning the new matched element set)
		pushStack: function(elems) {

			// Build a new jQuery matched element set
			var ret = jQuery.merge(this.constructor(), elems);

			// Add the old object onto the stack (as a reference)
			ret.prevObject = this;
			ret.context = this.context;

			// Return the newly-formed element set
			return ret;
		},

		// Execute a callback for every element in the matched set.
		// (You can seed the arguments with an array of args, but this is
		// only used internally.)
		each: function(callback, args) {
			return jQuery.each(this, callback, args);
		},

		ready: function(fn) {
			// Add the callback
			jQuery.ready.promise().done(fn);

			return this;
		},

		slice: function() {
			return this.pushStack(core_slice.apply(this, arguments));
		},

		first: function() {
			return this.eq(0);
		},

		last: function() {
			return this.eq(-1);
		},

		eq: function(i) {
			var len = this.length,
				j = +i + (i < 0 ? len : 0);
			return this.pushStack(j >= 0 && j < len ? [this[j]] : []);
		},

		map: function(callback) {
			return this.pushStack(jQuery.map(this, function(elem, i) {
				return callback.call(elem, i, elem);
			}));
		},

		end: function() {
			return this.prevObject || this.constructor(null);
		},

		// For internal use only.
		// Behaves like an Array's method, not like a jQuery method.
		push: core_push,
		sort: [].sort,
		splice: [].splice
	};

	// Give the init function the jQuery prototype for later instantiation
	jQuery.fn.init.prototype = jQuery.fn;

	jQuery.extend = jQuery.fn.extend = function() {
		var src, copyIsArray, copy, name, options, clone,
			target = arguments[0] || {},
			i = 1,
			length = arguments.length,
			deep = false;

		// Handle a deep copy situation
		if (typeof target === "boolean") {
			deep = target;
			target = arguments[1] || {};
			// skip the boolean and the target
			i = 2;
		}

		// Handle case when target is a string or something (possible in deep copy)
		if (typeof target !== "object" && !jQuery.isFunction(target)) {
			target = {};
		}

		// extend jQuery itself if only one argument is passed
		if (length === i) {
			target = this;
			--i;
		}

		for (i = 0; i < length; i++) {
			// Only deal with non-null/undefined values
			if ((options = arguments[i]) != null) {
				// Extend the base object
				for (name in options) {
					src = target[name];
					copy = options[name];

					// Prevent never-ending loop
					if (target === copy) {
						continue;
					}

					// Recurse if we're merging plain objects or arrays
					if (deep && copy && (jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)))) {
						if (copyIsArray) {
							copyIsArray = false;
							clone = src && jQuery.isArray(src) ? src : [];

						} else {
							clone = src && jQuery.isPlainObject(src) ? src : {};
						}

						// Never move original objects, clone them
						target[name] = jQuery.extend(deep, clone, copy);

						// Don't bring in undefined values
					} else if (copy !== undefined) {
						target[name] = copy;
					}
				}
			}
		}

		// Return the modified object
		return target;
	};

	jQuery.extend({
		noConflict: function(deep) {
			if (window.$ === jQuery) {
				window.$ = _$;
			}

			if (deep && window.jQuery === jQuery) {
				window.jQuery = _jQuery;
			}

			return jQuery;
		},

		// Is the DOM ready to be used? Set to true once it occurs.
		isReady: false,

		// A counter to track how many items to wait for before
		// the ready event fires. See #6781
		readyWait: 1,

		// Hold (or release) the ready event
		holdReady: function(hold) {
			if (hold) {
				jQuery.readyWait++;
			} else {
				jQuery.ready(true);
			}
		},

		// Handle when the DOM is ready
		ready: function(wait) {

			// Abort if there are pending holds or we're already ready
			if (wait === true ? --jQuery.readyWait : jQuery.isReady) {
				return;
			}

			// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
			if (!document.body) {
				return setTimeout(jQuery.ready);
			}

			// Remember that the DOM is ready
			jQuery.isReady = true;

			// If a normal DOM Ready event fired, decrement, and wait if need be
			if (wait !== true && --jQuery.readyWait > 0) {
				return;
			}

			// If there are functions bound, to execute
			readyList.resolveWith(document, [jQuery]);

			// Trigger any bound ready events
			if (jQuery.fn.trigger) {
				jQuery(document).trigger("ready").off("ready");
			}
		},

		// See test/unit/core.js for details concerning isFunction.
		// Since version 1.3, DOM methods and functions like alert
		// aren't supported. They return false on IE (#2968).
		isFunction: function(obj) {
			return jQuery.type(obj) === "function";
		},

		isArray: Array.isArray || function(obj) {
			return jQuery.type(obj) === "array";
		},

		isWindow: function(obj) {
			return obj != null && obj == obj.window;
		},

		isNumeric: function(obj) {
			return !isNaN(parseFloat(obj)) && isFinite(obj);
		},

		type: function(obj) {
			if (obj == null) {
				return String(obj);
			}
			return typeof obj === "object" || typeof obj === "function" ?
				class2type[core_toString.call(obj)] || "object" :
				typeof obj;
		},

		isPlainObject: function(obj) {
			// Must be an Object.
			// Because of IE, we also have to check the presence of the constructor property.
			// Make sure that DOM nodes and window objects don't pass through, as well
			if (!obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow(obj)) {
				return false;
			}

			try {
				// Not own constructor property must be Object
				if (obj.constructor && !core_hasOwn.call(obj, "constructor") && !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf")) {
					return false;
				}
			} catch (e) {
				// IE8,9 Will throw exceptions on certain host objects #9897
				return false;
			}

			// Own properties are enumerated firstly, so to speed up,
			// if last one is own, then all properties are own.

			var key;
			for (key in obj) {}

			return key === undefined || core_hasOwn.call(obj, key);
		},

		isEmptyObject: function(obj) {
			var name;
			for (name in obj) {
				return false;
			}
			return true;
		},

		error: function(msg) {
			throw new Error(msg);
		},

		// data: string of html
		// context (optional): If specified, the fragment will be created in this context, defaults to document
		// keepScripts (optional): If true, will include scripts passed in the html string
		parseHTML: function(data, context, keepScripts) {
			if (!data || typeof data !== "string") {
				return null;
			}
			if (typeof context === "boolean") {
				keepScripts = context;
				context = false;
			}
			context = context || document;

			var parsed = rsingleTag.exec(data),
				scripts = !keepScripts && [];

			// Single tag
			if (parsed) {
				return [context.createElement(parsed[1])];
			}

			parsed = jQuery.buildFragment([data], context, scripts);
			if (scripts) {
				jQuery(scripts).remove();
			}
			return jQuery.merge([], parsed.childNodes);
		},

		parseJSON: function(data) {
			// Attempt to parse using the native JSON parser first
			if (window.JSON && window.JSON.parse) {
				return window.JSON.parse(data);
			}

			if (data === null) {
				return data;
			}

			if (typeof data === "string") {

				// Make sure leading/trailing whitespace is removed (IE can't handle it)
				data = jQuery.trim(data);

				if (data) {
					// Make sure the incoming data is actual JSON
					// Logic borrowed from http://json.org/json2.js
					if (rvalidchars.test(data.replace(rvalidescape, "@")
						.replace(rvalidtokens, "]")
						.replace(rvalidbraces, ""))) {

						return (new Function("return " + data))();
					}
				}
			}

			jQuery.error("Invalid JSON: " + data);
		},

		// Cross-browser xml parsing
		parseXML: function(data) {
			var xml, tmp;
			if (!data || typeof data !== "string") {
				return null;
			}
			try {
				if (window.DOMParser) { // Standard
					tmp = new DOMParser();
					xml = tmp.parseFromString(data, "text/xml");
				} else { // IE
					xml = new ActiveXObject("Microsoft.XMLDOM");
					xml.async = "false";
					xml.loadXML(data);
				}
			} catch (e) {
				xml = undefined;
			}
			if (!xml || !xml.documentElement || xml.getElementsByTagName("parsererror").length) {
				jQuery.error("Invalid XML: " + data);
			}
			return xml;
		},

		noop: function() {},

		// Evaluates a script in a global context
		// Workarounds based on findings by Jim Driscoll
		// http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
		globalEval: function(data) {
			if (data && jQuery.trim(data)) {
				// We use execScript on Internet Explorer
				// We use an anonymous function so that context is window
				// rather than jQuery in Firefox
				(window.execScript || function(data) {
					window["eval"].call(window, data);
				})(data);
			}
		},

		// Convert dashed to camelCase; used by the css and data modules
		// Microsoft forgot to hump their vendor prefix (#9572)
		camelCase: function(string) {
			return string.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase);
		},

		nodeName: function(elem, name) {
			return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
		},

		// args is for internal usage only
		each: function(obj, callback, args) {
			var value,
				i = 0,
				length = obj.length,
				isArray = isArraylike(obj);

			if (args) {
				if (isArray) {
					for (; i < length; i++) {
						value = callback.apply(obj[i], args);

						if (value === false) {
							break;
						}
					}
				} else {
					for (i in obj) {
						value = callback.apply(obj[i], args);

						if (value === false) {
							break;
						}
					}
				}

				// A special, fast, case for the most common use of each
			} else {
				if (isArray) {
					for (; i < length; i++) {
						value = callback.call(obj[i], i, obj[i]);

						if (value === false) {
							break;
						}
					}
				} else {
					for (i in obj) {
						value = callback.call(obj[i], i, obj[i]);

						if (value === false) {
							break;
						}
					}
				}
			}

			return obj;
		},

		// Use native String.trim function wherever possible
		trim: core_trim && !core_trim.call("\uFEFF\xA0") ? function(text) {
			return text == null ?
				"" :
				core_trim.call(text);
		} :

		// Otherwise use our own trimming functionality

		function(text) {
			return text == null ?
				"" :
				(text + "").replace(rtrim, "");
		},

		// results is for internal usage only
		makeArray: function(arr, results) {
			var ret = results || [];

			if (arr != null) {
				if (isArraylike(Object(arr))) {
					jQuery.merge(ret,
						typeof arr === "string" ? [arr] : arr
					);
				} else {
					core_push.call(ret, arr);
				}
			}

			return ret;
		},

		inArray: function(elem, arr, i) {
			var len;

			if (arr) {
				if (core_indexOf) {
					return core_indexOf.call(arr, elem, i);
				}

				len = arr.length;
				i = i ? i < 0 ? Math.max(0, len + i) : i : 0;

				for (; i < len; i++) {
					// Skip accessing in sparse arrays
					if (i in arr && arr[i] === elem) {
						return i;
					}
				}
			}

			return -1;
		},

		merge: function(first, second) {
			var l = second.length,
				i = first.length,
				j = 0;

			if (typeof l === "number") {
				for (; j < l; j++) {
					first[i++] = second[j];
				}
			} else {
				while (second[j] !== undefined) {
					first[i++] = second[j++];
				}
			}

			first.length = i;

			return first;
		},

		grep: function(elems, callback, inv) {
			var retVal,
				ret = [],
				i = 0,
				length = elems.length;
			inv = !! inv;

			// Go through the array, only saving the items
			// that pass the validator function
			for (; i < length; i++) {
				retVal = !! callback(elems[i], i);
				if (inv !== retVal) {
					ret.push(elems[i]);
				}
			}

			return ret;
		},

		// arg is for internal usage only
		map: function(elems, callback, arg) {
			var value,
				i = 0,
				length = elems.length,
				isArray = isArraylike(elems),
				ret = [];

			// Go through the array, translating each of the items to their
			if (isArray) {
				for (; i < length; i++) {
					value = callback(elems[i], i, arg);

					if (value != null) {
						ret[ret.length] = value;
					}
				}

				// Go through every key on the object,
			} else {
				for (i in elems) {
					value = callback(elems[i], i, arg);

					if (value != null) {
						ret[ret.length] = value;
					}
				}
			}

			// Flatten any nested arrays
			return core_concat.apply([], ret);
		},

		// A global GUID counter for objects
		guid: 1,

		// Bind a function to a context, optionally partially applying any
		// arguments.
		proxy: function(fn, context) {
			var args, proxy, tmp;

			if (typeof context === "string") {
				tmp = fn[context];
				context = fn;
				fn = tmp;
			}

			// Quick check to determine if target is callable, in the spec
			// this throws a TypeError, but we will just return undefined.
			if (!jQuery.isFunction(fn)) {
				return undefined;
			}

			// Simulated bind
			args = core_slice.call(arguments, 2);
			proxy = function() {
				return fn.apply(context || this, args.concat(core_slice.call(arguments)));
			};

			// Set the guid of unique handler to the same of original handler, so it can be removed
			proxy.guid = fn.guid = fn.guid || jQuery.guid++;

			return proxy;
		},

		// Multifunctional method to get and set values of a collection
		// The value/s can optionally be executed if it's a function
		access: function(elems, fn, key, value, chainable, emptyGet, raw) {
			var i = 0,
				length = elems.length,
				bulk = key == null;

			// Sets many values
			if (jQuery.type(key) === "object") {
				chainable = true;
				for (i in key) {
					jQuery.access(elems, fn, i, key[i], true, emptyGet, raw);
				}

				// Sets one value
			} else if (value !== undefined) {
				chainable = true;

				if (!jQuery.isFunction(value)) {
					raw = true;
				}

				if (bulk) {
					// Bulk operations run against the entire set
					if (raw) {
						fn.call(elems, value);
						fn = null;

						// ...except when executing function values
					} else {
						bulk = fn;
						fn = function(elem, key, value) {
							return bulk.call(jQuery(elem), value);
						};
					}
				}

				if (fn) {
					for (; i < length; i++) {
						fn(elems[i], key, raw ? value : value.call(elems[i], i, fn(elems[i], key)));
					}
				}
			}

			return chainable ?
				elems :

			// Gets
			bulk ?
				fn.call(elems) :
				length ? fn(elems[0], key) : emptyGet;
		},

		now: function() {
			return (new Date()).getTime();
		}
	});

	jQuery.ready.promise = function(obj) {
		if (!readyList) {

			readyList = jQuery.Deferred();

			// Catch cases where $(document).ready() is called after the browser event has already occurred.
			// we once tried to use readyState "interactive" here, but it caused issues like the one
			// discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15
			if (document.readyState === "complete") {
				// Handle it asynchronously to allow scripts the opportunity to delay ready
				setTimeout(jQuery.ready);

				// Standards-based browsers support DOMContentLoaded
			} else if (document.addEventListener) {
				// Use the handy event callback
				document.addEventListener("DOMContentLoaded", completed, false);

				// A fallback to window.onload, that will always work
				window.addEventListener("load", completed, false);

				// If IE event model is used
			} else {
				// Ensure firing before onload, maybe late but safe also for iframes
				document.attachEvent("onreadystatechange", completed);

				// A fallback to window.onload, that will always work
				window.attachEvent("onload", completed);

				// If IE and not a frame
				// continually check to see if the document is ready
				var top = false;

				try {
					top = window.frameElement == null && document.documentElement;
				} catch (e) {}

				if (top && top.doScroll) {
					(function doScrollCheck() {
						if (!jQuery.isReady) {

							try {
								// Use the trick by Diego Perini
								// http://javascript.nwbox.com/IEContentLoaded/
								top.doScroll("left");
							} catch (e) {
								return setTimeout(doScrollCheck, 50);
							}

							// detach all dom ready events
							detach();

							// and execute any waiting functions
							jQuery.ready();
						}
					})();
				}
			}
		}
		return readyList.promise(obj);
	};

	// Populate the class2type map
	jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(i, name) {
		class2type["[object " + name + "]"] = name.toLowerCase();
	});

	function isArraylike(obj) {
		var length = obj.length,
			type = jQuery.type(obj);

		if (jQuery.isWindow(obj)) {
			return false;
		}

		if (obj.nodeType === 1 && length) {
			return true;
		}

		return type === "array" || type !== "function" &&
			(length === 0 ||
			typeof length === "number" && length > 0 && (length - 1) in obj);
	}

	// All jQuery objects should point back to these
	rootjQuery = jQuery(document);
	// String to Object options format cache
	var optionsCache = {};

	// Convert String-formatted options into Object-formatted ones and store in cache

	function createOptions(options) {
		var object = optionsCache[options] = {};
		jQuery.each(options.match(core_rnotwhite) || [], function(_, flag) {
			object[flag] = true;
		});
		return object;
	}

	/*
	 * Create a callback list using the following parameters:
	 *
	 *  options: an optional list of space-separated options that will change how
	 *          the callback list behaves or a more traditional option object
	 *
	 * By default a callback list will act like an event callback list and can be
	 * "fired" multiple times.
	 *
	 * Possible options:
	 *
	 *  once:           will ensure the callback list can only be fired once (like a Deferred)
	 *
	 *  memory:         will keep track of previous values and will call any callback added
	 *                  after the list has been fired right away with the latest "memorized"
	 *                  values (like a Deferred)
	 *
	 *  unique:         will ensure a callback can only be added once (no duplicate in the list)
	 *
	 *  stopOnFalse:    interrupt callings when a callback returns false
	 *
	 */
	jQuery.Callbacks = function(options) {

		// Convert options from String-formatted to Object-formatted if needed
		// (we check in cache first)
		options = typeof options === "string" ?
			(optionsCache[options] || createOptions(options)) :
			jQuery.extend({}, options);

		var // Flag to know if list is currently firing
		firing,
			// Last fire value (for non-forgettable lists)
			memory,
			// Flag to know if list was already fired
			fired,
			// End of the loop when firing
			firingLength,
			// Index of currently firing callback (modified by remove if needed)
			firingIndex,
			// First callback to fire (used internally by add and fireWith)
			firingStart,
			// Actual callback list
			list = [],
			// Stack of fire calls for repeatable lists
			stack = !options.once && [],
			// Fire callbacks
			fire = function(data) {
				memory = options.memory && data;
				fired = true;
				firingIndex = firingStart || 0;
				firingStart = 0;
				firingLength = list.length;
				firing = true;
				for (; list && firingIndex < firingLength; firingIndex++) {
					if (list[firingIndex].apply(data[0], data[1]) === false && options.stopOnFalse) {
						memory = false; // To prevent further calls using add
						break;
					}
				}
				firing = false;
				if (list) {
					if (stack) {
						if (stack.length) {
							fire(stack.shift());
						}
					} else if (memory) {
						list = [];
					} else {
						self.disable();
					}
				}
			},
			// Actual Callbacks object
			self = {
				// Add a callback or a collection of callbacks to the list
				add: function() {
					if (list) {
						// First, we save the current length
						var start = list.length;
						(function add(args) {
							jQuery.each(args, function(_, arg) {
								var type = jQuery.type(arg);
								if (type === "function") {
									if (!options.unique || !self.has(arg)) {
										list.push(arg);
									}
								} else if (arg && arg.length && type !== "string") {
									// Inspect recursively
									add(arg);
								}
							});
						})(arguments);
						// Do we need to add the callbacks to the
						// current firing batch?
						if (firing) {
							firingLength = list.length;
							// With memory, if we're not firing then
							// we should call right away
						} else if (memory) {
							firingStart = start;
							fire(memory);
						}
					}
					return this;
				},
				// Remove a callback from the list
				remove: function() {
					if (list) {
						jQuery.each(arguments, function(_, arg) {
							var index;
							while ((index = jQuery.inArray(arg, list, index)) > -1) {
								list.splice(index, 1);
								// Handle firing indexes
								if (firing) {
									if (index <= firingLength) {
										firingLength--;
									}
									if (index <= firingIndex) {
										firingIndex--;
									}
								}
							}
						});
					}
					return this;
				},
				// Check if a given callback is in the list.
				// If no argument is given, return whether or not list has callbacks attached.
				has: function(fn) {
					return fn ? jQuery.inArray(fn, list) > -1 : !! (list && list.length);
				},
				// Remove all callbacks from the list
				empty: function() {
					list = [];
					return this;
				},
				// Have the list do nothing anymore
				disable: function() {
					list = stack = memory = undefined;
					return this;
				},
				// Is it disabled?
				disabled: function() {
					return !list;
				},
				// Lock the list in its current state
				lock: function() {
					stack = undefined;
					if (!memory) {
						self.disable();
					}
					return this;
				},
				// Is it locked?
				locked: function() {
					return !stack;
				},
				// Call all callbacks with the given context and arguments
				fireWith: function(context, args) {
					args = args || [];
					args = [context, args.slice ? args.slice() : args];
					if (list && (!fired || stack)) {
						if (firing) {
							stack.push(args);
						} else {
							fire(args);
						}
					}
					return this;
				},
				// Call all the callbacks with the given arguments
				fire: function() {
					self.fireWith(this, arguments);
					return this;
				},
				// To know if the callbacks have already been called at least once
				fired: function() {
					return !!fired;
				}
			};

		return self;
	};
	jQuery.extend({

		Deferred: function(func) {
			var tuples = [
				// action, add listener, listener list, final state
				["resolve", "done", jQuery.Callbacks("once memory"), "resolved"],
				["reject", "fail", jQuery.Callbacks("once memory"), "rejected"],
				["notify", "progress", jQuery.Callbacks("memory")]
			],
				state = "pending",
				promise = {
					state: function() {
						return state;
					},
					always: function() {
						deferred.done(arguments).fail(arguments);
						return this;
					},
					then: function( /* fnDone, fnFail, fnProgress */ ) {
						var fns = arguments;
						return jQuery.Deferred(function(newDefer) {
							jQuery.each(tuples, function(i, tuple) {
								var action = tuple[0],
									fn = jQuery.isFunction(fns[i]) && fns[i];
								// deferred[ done | fail | progress ] for forwarding actions to newDefer
								deferred[tuple[1]](function() {
									var returned = fn && fn.apply(this, arguments);
									if (returned && jQuery.isFunction(returned.promise)) {
										returned.promise()
											.done(newDefer.resolve)
											.fail(newDefer.reject)
											.progress(newDefer.notify);
									} else {
										newDefer[action + "With"](this === promise ? newDefer.promise() : this, fn ? [returned] : arguments);
									}
								});
							});
							fns = null;
						}).promise();
					},
					// Get a promise for this deferred
					// If obj is provided, the promise aspect is added to the object
					promise: function(obj) {
						return obj != null ? jQuery.extend(obj, promise) : promise;
					}
				},
				deferred = {};

			// Keep pipe for back-compat
			promise.pipe = promise.then;

			// Add list-specific methods
			jQuery.each(tuples, function(i, tuple) {
				var list = tuple[2],
					stateString = tuple[3];

				// promise[ done | fail | progress ] = list.add
				promise[tuple[1]] = list.add;

				// Handle state
				if (stateString) {
					list.add(function() {
						// state = [ resolved | rejected ]
						state = stateString;

						// [ reject_list | resolve_list ].disable; progress_list.lock
					}, tuples[i ^ 1][2].disable, tuples[2][2].lock);
				}

				// deferred[ resolve | reject | notify ]
				deferred[tuple[0]] = function() {
					deferred[tuple[0] + "With"](this === deferred ? promise : this, arguments);
					return this;
				};
				deferred[tuple[0] + "With"] = list.fireWith;
			});

			// Make the deferred a promise
			promise.promise(deferred);

			// Call given func if any
			if (func) {
				func.call(deferred, deferred);
			}

			// All done!
			return deferred;
		},

		// Deferred helper
		when: function(subordinate /* , ..., subordinateN */ ) {
			var i = 0,
				resolveValues = core_slice.call(arguments),
				length = resolveValues.length,

				// the count of uncompleted subordinates
				remaining = length !== 1 || (subordinate && jQuery.isFunction(subordinate.promise)) ? length : 0,

				// the master Deferred. If resolveValues consist of only a single Deferred, just use that.
				deferred = remaining === 1 ? subordinate : jQuery.Deferred(),

				// Update function for both resolve and progress values
				updateFunc = function(i, contexts, values) {
					return function(value) {
						contexts[i] = this;
						values[i] = arguments.length > 1 ? core_slice.call(arguments) : value;
						if (values === progressValues) {
							deferred.notifyWith(contexts, values);
						} else if (!(--remaining)) {
							deferred.resolveWith(contexts, values);
						}
					};
				},

				progressValues, progressContexts, resolveContexts;

			// add listeners to Deferred subordinates; treat others as resolved
			if (length > 1) {
				progressValues = new Array(length);
				progressContexts = new Array(length);
				resolveContexts = new Array(length);
				for (; i < length; i++) {
					if (resolveValues[i] && jQuery.isFunction(resolveValues[i].promise)) {
						resolveValues[i].promise()
							.done(updateFunc(i, resolveContexts, resolveValues))
							.fail(deferred.reject)
							.progress(updateFunc(i, progressContexts, progressValues));
					} else {
						--remaining;
					}
				}
			}

			// if we're not waiting on anything, resolve the master
			if (!remaining) {
				deferred.resolveWith(resolveContexts, resolveValues);
			}

			return deferred.promise();
		}
	});
	jQuery.support = (function() {

		var support, all, a,
			input, select, fragment,
			opt, eventName, isSupported, i,
			div = document.createElement("div");

		// Setup
		div.setAttribute("className", "t");
		div.innerHTML = "  <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";

		// Support tests won't run in some limited or non-browser environments
		all = div.getElementsByTagName("*");
		a = div.getElementsByTagName("a")[0];
		if (!all || !a || !all.length) {
			return {};
		}

		// First batch of tests
		select = document.createElement("select");
		opt = select.appendChild(document.createElement("option"));
		input = div.getElementsByTagName("input")[0];

		a.style.cssText = "top:1px;float:left;opacity:.5";
		support = {
			// Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
			getSetAttribute: div.className !== "t",

			// IE strips leading whitespace when .innerHTML is used
			leadingWhitespace: div.firstChild.nodeType === 3,

			// Make sure that tbody elements aren't automatically inserted
			// IE will insert them into empty tables
			tbody: !div.getElementsByTagName("tbody").length,

			// Make sure that link elements get serialized correctly by innerHTML
			// This requires a wrapper element in IE
			htmlSerialize: !! div.getElementsByTagName("link").length,

			// Get the style information from getAttribute
			// (IE uses .cssText instead)
			style: /top/.test(a.getAttribute("style")),

			// Make sure that URLs aren't manipulated
			// (IE normalizes it by default)
			hrefNormalized: a.getAttribute("href") === "/a",

			// Make sure that element opacity exists
			// (IE uses filter instead)
			// Use a regex to work around a WebKit issue. See #5145
			opacity: /^0.5/.test(a.style.opacity),

			// Verify style float existence
			// (IE uses styleFloat instead of cssFloat)
			cssFloat: !! a.style.cssFloat,

			// Check the default checkbox/radio value ("" on WebKit; "on" elsewhere)
			checkOn: !! input.value,

			// Make sure that a selected-by-default option has a working selected property.
			// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
			optSelected: opt.selected,

			// Tests for enctype support on a form (#6743)
			enctype: !! document.createElement("form").enctype,

			// Makes sure cloning an html5 element does not cause problems
			// Where outerHTML is undefined, this still works
			html5Clone: document.createElement("nav").cloneNode(true).outerHTML !== "<:nav></:nav>",

			// jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode
			boxModel: document.compatMode === "CSS1Compat",

			// Will be defined later
			deleteExpando: true,
			noCloneEvent: true,
			inlineBlockNeedsLayout: false,
			shrinkWrapBlocks: false,
			reliableMarginRight: true,
			boxSizingReliable: true,
			pixelPosition: false
		};

		// Make sure checked status is properly cloned
		input.checked = true;
		support.noCloneChecked = input.cloneNode(true).checked;

		// Make sure that the options inside disabled selects aren't marked as disabled
		// (WebKit marks them as disabled)
		select.disabled = true;
		support.optDisabled = !opt.disabled;

		// Support: IE<9
		try {
			delete div.test;
		} catch (e) {
			support.deleteExpando = false;
		}

		// Check if we can trust getAttribute("value")
		input = document.createElement("input");
		input.setAttribute("value", "");
		support.input = input.getAttribute("value") === "";

		// Check if an input maintains its value after becoming a radio
		input.value = "t";
		input.setAttribute("type", "radio");
		support.radioValue = input.value === "t";

		// #11217 - WebKit loses check when the name is after the checked attribute
		input.setAttribute("checked", "t");
		input.setAttribute("name", "t");

		fragment = document.createDocumentFragment();
		fragment.appendChild(input);

		// Check if a disconnected checkbox will retain its checked
		// value of true after appended to the DOM (IE6/7)
		support.appendChecked = input.checked;

		// WebKit doesn't clone checked state correctly in fragments
		support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;

		// Support: IE<9
		// Opera does not clone events (and typeof div.attachEvent === undefined).
		// IE9-10 clones events bound via attachEvent, but they don't trigger with .click()
		if (div.attachEvent) {
			div.attachEvent("onclick", function() {
				support.noCloneEvent = false;
			});

			div.cloneNode(true).click();
		}

		// Support: IE<9 (lack submit/change bubble), Firefox 17+ (lack focusin event)
		// Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP), test/csp.php
		for (i in {
			submit: true,
			change: true,
			focusin: true
		}) {
			div.setAttribute(eventName = "on" + i, "t");

			support[i + "Bubbles"] = eventName in window || div.attributes[eventName].expando === false;
		}

		div.style.backgroundClip = "content-box";
		div.cloneNode(true).style.backgroundClip = "";
		support.clearCloneStyle = div.style.backgroundClip === "content-box";

		// Run tests that need a body at doc ready
		jQuery(function() {
			var container, marginDiv, tds,
				divReset = "padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;",
				body = document.getElementsByTagName("body")[0];

			if (!body) {
				// Return for frameset docs that don't have a body
				return;
			}

			container = document.createElement("div");
			container.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px";

			body.appendChild(container).appendChild(div);

			// Support: IE8
			// Check if table cells still have offsetWidth/Height when they are set
			// to display:none and there are still other visible table cells in a
			// table row; if so, offsetWidth/Height are not reliable for use when
			// determining if an element has been hidden directly using
			// display:none (it is still safe to use offsets if a parent element is
			// hidden; don safety goggles and see bug #4512 for more information).
			div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>";
			tds = div.getElementsByTagName("td");
			tds[0].style.cssText = "padding:0;margin:0;border:0;display:none";
			isSupported = (tds[0].offsetHeight === 0);

			tds[0].style.display = "";
			tds[1].style.display = "none";

			// Support: IE8
			// Check if empty table cells still have offsetWidth/Height
			support.reliableHiddenOffsets = isSupported && (tds[0].offsetHeight === 0);

			// Check box-sizing and margin behavior
			div.innerHTML = "";
			div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;";
			support.boxSizing = (div.offsetWidth === 4);
			support.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== 1);

			// Use window.getComputedStyle because jsdom on node.js will break without it.
			if (window.getComputedStyle) {
				support.pixelPosition = (window.getComputedStyle(div, null) || {}).top !== "1%";
				support.boxSizingReliable = (window.getComputedStyle(div, null) || {
					width: "4px"
				}).width === "4px";

				// Check if div with explicit width and no margin-right incorrectly
				// gets computed margin-right based on width of container. (#3333)
				// Fails in WebKit before Feb 2011 nightlies
				// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
				marginDiv = div.appendChild(document.createElement("div"));
				marginDiv.style.cssText = div.style.cssText = divReset;
				marginDiv.style.marginRight = marginDiv.style.width = "0";
				div.style.width = "1px";

				support.reliableMarginRight = !parseFloat((window.getComputedStyle(marginDiv, null) || {}).marginRight);
			}

			if (typeof div.style.zoom !== core_strundefined) {
				// Support: IE<8
				// Check if natively block-level elements act like inline-block
				// elements when setting their display to 'inline' and giving
				// them layout
				div.innerHTML = "";
				div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1";
				support.inlineBlockNeedsLayout = (div.offsetWidth === 3);

				// Support: IE6
				// Check if elements with layout shrink-wrap their children
				div.style.display = "block";
				div.innerHTML = "<div></div>";
				div.firstChild.style.width = "5px";
				support.shrinkWrapBlocks = (div.offsetWidth !== 3);

				if (support.inlineBlockNeedsLayout) {
					// Prevent IE 6 from affecting layout for positioned elements #11048
					// Prevent IE from shrinking the body in IE 7 mode #12869
					// Support: IE<8
					body.style.zoom = 1;
				}
			}

			body.removeChild(container);

			// Null elements to avoid leaks in IE
			container = div = tds = marginDiv = null;
		});

		// Null elements to avoid leaks in IE
		all = select = fragment = opt = a = input = null;

		return support;
	})();

	var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/,
		rmultiDash = /([A-Z])/g;

	function internalData(elem, name, data, pvt /* Internal Use Only */ ) {
		if (!jQuery.acceptData(elem)) {
			return;
		}

		var thisCache, ret,
			internalKey = jQuery.expando,
			getByName = typeof name === "string",

			// We have to handle DOM nodes and JS objects differently because IE6-7
			// can't GC object references properly across the DOM-JS boundary
			isNode = elem.nodeType,

			// Only DOM nodes need the global jQuery cache; JS object data is
			// attached directly to the object so GC can occur automatically
			cache = isNode ? jQuery.cache : elem,

			// Only defining an ID for JS objects if its cache already exists allows
			// the code to shortcut on the same path as a DOM node with no cache
			id = isNode ? elem[internalKey] : elem[internalKey] && internalKey;

		// Avoid doing any more work than we need to when trying to get data on an
		// object that has no data at all
		if ((!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined) {
			return;
		}

		if (!id) {
			// Only DOM nodes need a new unique ID for each element since their data
			// ends up in the global cache
			if (isNode) {
				elem[internalKey] = id = core_deletedIds.pop() || jQuery.guid++;
			} else {
				id = internalKey;
			}
		}

		if (!cache[id]) {
			cache[id] = {};

			// Avoids exposing jQuery metadata on plain JS objects when the object
			// is serialized using JSON.stringify
			if (!isNode) {
				cache[id].toJSON = jQuery.noop;
			}
		}

		// An object can be passed to jQuery.data instead of a key/value pair; this gets
		// shallow copied over onto the existing cache
		if (typeof name === "object" || typeof name === "function") {
			if (pvt) {
				cache[id] = jQuery.extend(cache[id], name);
			} else {
				cache[id].data = jQuery.extend(cache[id].data, name);
			}
		}

		thisCache = cache[id];

		// jQuery data() is stored in a separate object inside the object's internal data
		// cache in order to avoid key collisions between internal data and user-defined
		// data.
		if (!pvt) {
			if (!thisCache.data) {
				thisCache.data = {};
			}

			thisCache = thisCache.data;
		}

		if (data !== undefined) {
			thisCache[jQuery.camelCase(name)] = data;
		}

		// Check for both converted-to-camel and non-converted data property names
		// If a data property was specified
		if (getByName) {

			// First Try to find as-is property data
			ret = thisCache[name];

			// Test for null|undefined property data
			if (ret == null) {

				// Try to find the camelCased property
				ret = thisCache[jQuery.camelCase(name)];
			}
		} else {
			ret = thisCache;
		}

		return ret;
	}

	function internalRemoveData(elem, name, pvt) {
		if (!jQuery.acceptData(elem)) {
			return;
		}

		var i, l, thisCache,
			isNode = elem.nodeType,

			// See jQuery.data for more information
			cache = isNode ? jQuery.cache : elem,
			id = isNode ? elem[jQuery.expando] : jQuery.expando;

		// If there is already no cache entry for this object, there is no
		// purpose in continuing
		if (!cache[id]) {
			return;
		}

		if (name) {

			thisCache = pvt ? cache[id] : cache[id].data;

			if (thisCache) {

				// Support array or space separated string names for data keys
				if (!jQuery.isArray(name)) {

					// try the string as a key before any manipulation
					if (name in thisCache) {
						name = [name];
					} else {

						// split the camel cased version by spaces unless a key with the spaces exists
						name = jQuery.camelCase(name);
						if (name in thisCache) {
							name = [name];
						} else {
							name = name.split(" ");
						}
					}
				} else {
					// If "name" is an array of keys...
					// When data is initially created, via ("key", "val") signature,
					// keys will be converted to camelCase.
					// Since there is no way to tell _how_ a key was added, remove
					// both plain key and camelCase key. #12786
					// This will only penalize the array argument path.
					name = name.concat(jQuery.map(name, jQuery.camelCase));
				}

				for (i = 0, l = name.length; i < l; i++) {
					delete thisCache[name[i]];
				}

				// If there is no data left in the cache, we want to continue
				// and let the cache object itself get destroyed
				if (!(pvt ? isEmptyDataObject : jQuery.isEmptyObject)(thisCache)) {
					return;
				}
			}
		}

		// See jQuery.data for more information
		if (!pvt) {
			delete cache[id].data;

			// Don't destroy the parent cache unless the internal data object
			// had been the only thing left in it
			if (!isEmptyDataObject(cache[id])) {
				return;
			}
		}

		// Destroy the cache
		if (isNode) {
			jQuery.cleanData([elem], true);

			// Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)
		} else if (jQuery.support.deleteExpando || cache != cache.window) {
			delete cache[id];

			// When all else fails, null
		} else {
			cache[id] = null;
		}
	}

	jQuery.extend({
		cache: {},

		// Unique for each copy of jQuery on the page
		// Non-digits removed to match rinlinejQuery
		expando: "jQuery" + (core_version + Math.random()).replace(/\D/g, ""),

		// The following elements throw uncatchable exceptions if you
		// attempt to add expando properties to them.
		noData: {
			"embed": true,
			// Ban all objects except for Flash (which handle expandos)
			"object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
			"applet": true
		},

		hasData: function(elem) {
			elem = elem.nodeType ? jQuery.cache[elem[jQuery.expando]] : elem[jQuery.expando];
			return !!elem && !isEmptyDataObject(elem);
		},

		data: function(elem, name, data) {
			return internalData(elem, name, data);
		},

		removeData: function(elem, name) {
			return internalRemoveData(elem, name);
		},

		// For internal use only.
		_data: function(elem, name, data) {
			return internalData(elem, name, data, true);
		},

		_removeData: function(elem, name) {
			return internalRemoveData(elem, name, true);
		},

		// A method for determining if a DOM node can handle the data expando
		acceptData: function(elem) {
			// Do not set data on non-element because it will not be cleared (#8335).
			if (elem.nodeType && elem.nodeType !== 1 && elem.nodeType !== 9) {
				return false;
			}

			var noData = elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()];

			// nodes accept data unless otherwise specified; rejection can be conditional
			return !noData || noData !== true && elem.getAttribute("classid") === noData;
		}
	});

	jQuery.fn.extend({
		data: function(key, value) {
			var attrs, name,
				elem = this[0],
				i = 0,
				data = null;

			// Gets all values
			if (key === undefined) {
				if (this.length) {
					data = jQuery.data(elem);

					if (elem.nodeType === 1 && !jQuery._data(elem, "parsedAttrs")) {
						attrs = elem.attributes;
						for (; i < attrs.length; i++) {
							name = attrs[i].name;

							if (!name.indexOf("data-")) {
								name = jQuery.camelCase(name.slice(5));

								dataAttr(elem, name, data[name]);
							}
						}
						jQuery._data(elem, "parsedAttrs", true);
					}
				}

				return data;
			}

			// Sets multiple values
			if (typeof key === "object") {
				return this.each(function() {
					jQuery.data(this, key);
				});
			}

			return jQuery.access(this, function(value) {

				if (value === undefined) {
					// Try to fetch any internally stored data first
					return elem ? dataAttr(elem, key, jQuery.data(elem, key)) : null;
				}

				this.each(function() {
					jQuery.data(this, key, value);
				});
			}, null, value, arguments.length > 1, null, true);
		},

		removeData: function(key) {
			return this.each(function() {
				jQuery.removeData(this, key);
			});
		}
	});

	function dataAttr(elem, key, data) {
		// If nothing was found internally, try to fetch any
		// data from the HTML5 data-* attribute
		if (data === undefined && elem.nodeType === 1) {

			var name = "data-" + key.replace(rmultiDash, "-$1").toLowerCase();

			data = elem.getAttribute(name);

			if (typeof data === "string") {
				try {
					data = data === "true" ? true :
						data === "false" ? false :
						data === "null" ? null :
					// Only convert to a number if it doesn't change the string
					+data + "" === data ? +data :
						rbrace.test(data) ? jQuery.parseJSON(data) :
						data;
				} catch (e) {}

				// Make sure we set the data so it isn't changed later
				jQuery.data(elem, key, data);

			} else {
				data = undefined;
			}
		}

		return data;
	}

	// checks a cache object for emptiness

	function isEmptyDataObject(obj) {
		var name;
		for (name in obj) {

			// if the public data object is empty, the private is still empty
			if (name === "data" && jQuery.isEmptyObject(obj[name])) {
				continue;
			}
			if (name !== "toJSON") {
				return false;
			}
		}

		return true;
	}
	jQuery.extend({
		queue: function(elem, type, data) {
			var queue;

			if (elem) {
				type = (type || "fx") + "queue";
				queue = jQuery._data(elem, type);

				// Speed up dequeue by getting out quickly if this is just a lookup
				if (data) {
					if (!queue || jQuery.isArray(data)) {
						queue = jQuery._data(elem, type, jQuery.makeArray(data));
					} else {
						queue.push(data);
					}
				}
				return queue || [];
			}
		},

		dequeue: function(elem, type) {
			type = type || "fx";

			var queue = jQuery.queue(elem, type),
				startLength = queue.length,
				fn = queue.shift(),
				hooks = jQuery._queueHooks(elem, type),
				next = function() {
					jQuery.dequeue(elem, type);
				};

			// If the fx queue is dequeued, always remove the progress sentinel
			if (fn === "inprogress") {
				fn = queue.shift();
				startLength--;
			}

			hooks.cur = fn;
			if (fn) {

				// Add a progress sentinel to prevent the fx queue from being
				// automatically dequeued
				if (type === "fx") {
					queue.unshift("inprogress");
				}

				// clear up the last queue stop function
				delete hooks.stop;
				fn.call(elem, next, hooks);
			}

			if (!startLength && hooks) {
				hooks.empty.fire();
			}
		},

		// not intended for public consumption - generates a queueHooks object, or returns the current one
		_queueHooks: function(elem, type) {
			var key = type + "queueHooks";
			return jQuery._data(elem, key) || jQuery._data(elem, key, {
				empty: jQuery.Callbacks("once memory").add(function() {
					jQuery._removeData(elem, type + "queue");
					jQuery._removeData(elem, key);
				})
			});
		}
	});

	jQuery.fn.extend({
		queue: function(type, data) {
			var setter = 2;

			if (typeof type !== "string") {
				data = type;
				type = "fx";
				setter--;
			}

			if (arguments.length < setter) {
				return jQuery.queue(this[0], type);
			}

			return data === undefined ?
				this :
				this.each(function() {
					var queue = jQuery.queue(this, type, data);

					// ensure a hooks for this queue
					jQuery._queueHooks(this, type);

					if (type === "fx" && queue[0] !== "inprogress") {
						jQuery.dequeue(this, type);
					}
				});
		},
		dequeue: function(type) {
			return this.each(function() {
				jQuery.dequeue(this, type);
			});
		},
		// Based off of the plugin by Clint Helfers, with permission.
		// http://blindsignals.com/index.php/2009/07/jquery-delay/
		delay: function(time, type) {
			time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
			type = type || "fx";

			return this.queue(type, function(next, hooks) {
				var timeout = setTimeout(next, time);
				hooks.stop = function() {
					clearTimeout(timeout);
				};
			});
		},
		clearQueue: function(type) {
			return this.queue(type || "fx", []);
		},
		// Get a promise resolved when queues of a certain type
		// are emptied (fx is the type by default)
		promise: function(type, obj) {
			var tmp,
				count = 1,
				defer = jQuery.Deferred(),
				elements = this,
				i = this.length,
				resolve = function() {
					if (!(--count)) {
						defer.resolveWith(elements, [elements]);
					}
				};

			if (typeof type !== "string") {
				obj = type;
				type = undefined;
			}
			type = type || "fx";

			while (i--) {
				tmp = jQuery._data(elements[i], type + "queueHooks");
				if (tmp && tmp.empty) {
					count++;
					tmp.empty.add(resolve);
				}
			}
			resolve();
			return defer.promise(obj);
		}
	});
	var nodeHook, boolHook,
		rclass = /[\t\r\n]/g,
		rreturn = /\r/g,
		rfocusable = /^(?:input|select|textarea|button|object)$/i,
		rclickable = /^(?:a|area)$/i,
		rboolean = /^(?:checked|selected|autofocus|autoplay|async|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped)$/i,
		ruseDefault = /^(?:checked|selected)$/i,
		getSetAttribute = jQuery.support.getSetAttribute,
		getSetInput = jQuery.support.input;

	jQuery.fn.extend({
		attr: function(name, value) {
			return jQuery.access(this, jQuery.attr, name, value, arguments.length > 1);
		},

		removeAttr: function(name) {
			return this.each(function() {
				jQuery.removeAttr(this, name);
			});
		},

		prop: function(name, value) {
			return jQuery.access(this, jQuery.prop, name, value, arguments.length > 1);
		},

		removeProp: function(name) {
			name = jQuery.propFix[name] || name;
			return this.each(function() {
				// try/catch handles cases where IE balks (such as removing a property on window)
				try {
					this[name] = undefined;
					delete this[name];
				} catch (e) {}
			});
		},

		addClass: function(value) {
			var classes, elem, cur, clazz, j,
				i = 0,
				len = this.length,
				proceed = typeof value === "string" && value;

			if (jQuery.isFunction(value)) {
				return this.each(function(j) {
					jQuery(this).addClass(value.call(this, j, this.className));
				});
			}

			if (proceed) {
				// The disjunction here is for better compressibility (see removeClass)
				classes = (value || "").match(core_rnotwhite) || [];

				for (; i < len; i++) {
					elem = this[i];
					cur = elem.nodeType === 1 && (elem.className ?
						(" " + elem.className + " ").replace(rclass, " ") :
						" "
					);

					if (cur) {
						j = 0;
						while ((clazz = classes[j++])) {
							if (cur.indexOf(" " + clazz + " ") < 0) {
								cur += clazz + " ";
							}
						}
						elem.className = jQuery.trim(cur);

					}
				}
			}

			return this;
		},

		removeClass: function(value) {
			var classes, elem, cur, clazz, j,
				i = 0,
				len = this.length,
				proceed = arguments.length === 0 || typeof value === "string" && value;

			if (jQuery.isFunction(value)) {
				return this.each(function(j) {
					jQuery(this).removeClass(value.call(this, j, this.className));
				});
			}
			if (proceed) {
				classes = (value || "").match(core_rnotwhite) || [];

				for (; i < len; i++) {
					elem = this[i];
					// This expression is here for better compressibility (see addClass)
					cur = elem.nodeType === 1 && (elem.className ?
						(" " + elem.className + " ").replace(rclass, " ") :
						""
					);

					if (cur) {
						j = 0;
						while ((clazz = classes[j++])) {
							// Remove *all* instances
							while (cur.indexOf(" " + clazz + " ") >= 0) {
								cur = cur.replace(" " + clazz + " ", " ");
							}
						}
						elem.className = value ? jQuery.trim(cur) : "";
					}
				}
			}

			return this;
		},

		toggleClass: function(value, stateVal) {
			var type = typeof value,
				isBool = typeof stateVal === "boolean";

			if (jQuery.isFunction(value)) {
				return this.each(function(i) {
					jQuery(this).toggleClass(value.call(this, i, this.className, stateVal), stateVal);
				});
			}

			return this.each(function() {
				if (type === "string") {
					// toggle individual class names
					var className,
						i = 0,
						self = jQuery(this),
						state = stateVal,
						classNames = value.match(core_rnotwhite) || [];

					while ((className = classNames[i++])) {
						// check each className given, space separated list
						state = isBool ? state : !self.hasClass(className);
						self[state ? "addClass" : "removeClass"](className);
					}

					// Toggle whole class name
				} else if (type === core_strundefined || type === "boolean") {
					if (this.className) {
						// store className if set
						jQuery._data(this, "__className__", this.className);
					}

					// If the element has a class name or if we're passed "false",
					// then remove the whole classname (if there was one, the above saved it).
					// Otherwise bring back whatever was previously saved (if anything),
					// falling back to the empty string if nothing was stored.
					this.className = this.className || value === false ? "" : jQuery._data(this, "__className__") || "";
				}
			});
		},

		hasClass: function(selector) {
			var className = " " + selector + " ",
				i = 0,
				l = this.length;
			for (; i < l; i++) {
				if (this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf(className) >= 0) {
					return true;
				}
			}

			return false;
		},

		val: function(value) {
			var ret, hooks, isFunction,
				elem = this[0];

			if (!arguments.length) {
				if (elem) {
					hooks = jQuery.valHooks[elem.type] || jQuery.valHooks[elem.nodeName.toLowerCase()];

					if (hooks && "get" in hooks && (ret = hooks.get(elem, "value")) !== undefined) {
						return ret;
					}

					ret = elem.value;

					return typeof ret === "string" ?
					// handle most common string cases
					ret.replace(rreturn, "") :
					// handle cases where value is null/undef or number
					ret == null ? "" : ret;
				}

				return;
			}

			isFunction = jQuery.isFunction(value);

			return this.each(function(i) {
				var val,
					self = jQuery(this);

				if (this.nodeType !== 1) {
					return;
				}

				if (isFunction) {
					val = value.call(this, i, self.val());
				} else {
					val = value;
				}

				// Treat null/undefined as ""; convert numbers to string
				if (val == null) {
					val = "";
				} else if (typeof val === "number") {
					val += "";
				} else if (jQuery.isArray(val)) {
					val = jQuery.map(val, function(value) {
						return value == null ? "" : value + "";
					});
				}

				hooks = jQuery.valHooks[this.type] || jQuery.valHooks[this.nodeName.toLowerCase()];

				// If set returns undefined, fall back to normal setting
				if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === undefined) {
					this.value = val;
				}
			});
		}
	});

	jQuery.extend({
		valHooks: {
			option: {
				get: function(elem) {
					// attributes.value is undefined in Blackberry 4.7 but
					// uses .value. See #6932
					var val = elem.attributes.value;
					return !val || val.specified ? elem.value : elem.text;
				}
			},
			select: {
				get: function(elem) {
					var value, option,
						options = elem.options,
						index = elem.selectedIndex,
						one = elem.type === "select-one" || index < 0,
						values = one ? null : [],
						max = one ? index + 1 : options.length,
						i = index < 0 ?
							max :
							one ? index : 0;

					// Loop through all the selected options
					for (; i < max; i++) {
						option = options[i];

						// oldIE doesn't update selected after form reset (#2551)
						if ((option.selected || i === index) &&
							// Don't return options that are disabled or in a disabled optgroup
							(jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
							(!option.parentNode.disabled || !jQuery.nodeName(option.parentNode, "optgroup"))) {

							// Get the specific value for the option
							value = jQuery(option).val();

							// We don't need an array for one selects
							if (one) {
								return value;
							}

							// Multi-Selects return an array
							values.push(value);
						}
					}

					return values;
				},

				set: function(elem, value) {
					var values = jQuery.makeArray(value);

					jQuery(elem).find("option").each(function() {
						this.selected = jQuery.inArray(jQuery(this).val(), values) >= 0;
					});

					if (!values.length) {
						elem.selectedIndex = -1;
					}
					return values;
				}
			}
		},

		attr: function(elem, name, value) {
			var hooks, notxml, ret,
				nType = elem.nodeType;

			// don't get/set attributes on text, comment and attribute nodes
			if (!elem || nType === 3 || nType === 8 || nType === 2) {
				return;
			}

			// Fallback to prop when attributes are not supported
			if (typeof elem.getAttribute === core_strundefined) {
				return jQuery.prop(elem, name, value);
			}

			notxml = nType !== 1 || !jQuery.isXMLDoc(elem);

			// All attributes are lowercase
			// Grab necessary hook if one is defined
			if (notxml) {
				name = name.toLowerCase();
				hooks = jQuery.attrHooks[name] || (rboolean.test(name) ? boolHook : nodeHook);
			}

			if (value !== undefined) {

				if (value === null) {
					jQuery.removeAttr(elem, name);

				} else if (hooks && notxml && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined) {
					return ret;

				} else {
					elem.setAttribute(name, value + "");
					return value;
				}

			} else if (hooks && notxml && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
				return ret;

			} else {

				// In IE9+, Flash objects don't have .getAttribute (#12945)
				// Support: IE9+
				if (typeof elem.getAttribute !== core_strundefined) {
					ret = elem.getAttribute(name);
				}

				// Non-existent attributes return null, we normalize to undefined
				return ret == null ?
					undefined :
					ret;
			}
		},

		removeAttr: function(elem, value) {
			var name, propName,
				i = 0,
				attrNames = value && value.match(core_rnotwhite);

			if (attrNames && elem.nodeType === 1) {
				while ((name = attrNames[i++])) {
					propName = jQuery.propFix[name] || name;

					// Boolean attributes get special treatment (#10870)
					if (rboolean.test(name)) {
						// Set corresponding property to false for boolean attributes
						// Also clear defaultChecked/defaultSelected (if appropriate) for IE<8
						if (!getSetAttribute && ruseDefault.test(name)) {
							elem[jQuery.camelCase("default-" + name)] =
								elem[propName] = false;
						} else {
							elem[propName] = false;
						}

						// See #9699 for explanation of this approach (setting first, then removal)
					} else {
						jQuery.attr(elem, name, "");
					}

					elem.removeAttribute(getSetAttribute ? name : propName);
				}
			}
		},

		attrHooks: {
			type: {
				set: function(elem, value) {
					if (!jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input")) {
						// Setting the type on a radio button after the value resets the value in IE6-9
						// Reset value to default in case type is set after value during creation
						var val = elem.value;
						elem.setAttribute("type", value);
						if (val) {
							elem.value = val;
						}
						return value;
					}
				}
			}
		},

		propFix: {
			tabindex: "tabIndex",
			readonly: "readOnly",
			"for": "htmlFor",
			"class": "className",
			maxlength: "maxLength",
			cellspacing: "cellSpacing",
			cellpadding: "cellPadding",
			rowspan: "rowSpan",
			colspan: "colSpan",
			usemap: "useMap",
			frameborder: "frameBorder",
			contenteditable: "contentEditable"
		},

		prop: function(elem, name, value) {
			var ret, hooks, notxml,
				nType = elem.nodeType;

			// don't get/set properties on text, comment and attribute nodes
			if (!elem || nType === 3 || nType === 8 || nType === 2) {
				return;
			}

			notxml = nType !== 1 || !jQuery.isXMLDoc(elem);

			if (notxml) {
				// Fix name and attach hooks
				name = jQuery.propFix[name] || name;
				hooks = jQuery.propHooks[name];
			}

			if (value !== undefined) {
				if (hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined) {
					return ret;

				} else {
					return (elem[name] = value);
				}

			} else {
				if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
					return ret;

				} else {
					return elem[name];
				}
			}
		},

		propHooks: {
			tabIndex: {
				get: function(elem) {
					// elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
					// http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
					var attributeNode = elem.getAttributeNode("tabindex");

					return attributeNode && attributeNode.specified ?
						parseInt(attributeNode.value, 10) :
						rfocusable.test(elem.nodeName) || rclickable.test(elem.nodeName) && elem.href ?
						0 :
						undefined;
				}
			}
		}
	});

	// Hook for boolean attributes
	boolHook = {
		get: function(elem, name) {
			var
			// Use .prop to determine if this attribute is understood as boolean
			prop = jQuery.prop(elem, name),

				// Fetch it accordingly
				attr = typeof prop === "boolean" && elem.getAttribute(name),
				detail = typeof prop === "boolean" ?

				getSetInput && getSetAttribute ?
					attr != null :
				// oldIE fabricates an empty string for missing boolean attributes
				// and conflates checked/selected into attroperties
				ruseDefault.test(name) ?
					elem[jQuery.camelCase("default-" + name)] : !! attr :

				// fetch an attribute node for properties not recognized as boolean
				elem.getAttributeNode(name);

			return detail && detail.value !== false ?
				name.toLowerCase() :
				undefined;
		},
		set: function(elem, value, name) {
			if (value === false) {
				// Remove boolean attributes when set to false
				jQuery.removeAttr(elem, name);
			} else if (getSetInput && getSetAttribute || !ruseDefault.test(name)) {
				// IE<8 needs the *property* name
				elem.setAttribute(!getSetAttribute && jQuery.propFix[name] || name, name);

				// Use defaultChecked and defaultSelected for oldIE
			} else {
				elem[jQuery.camelCase("default-" + name)] = elem[name] = true;
			}

			return name;
		}
	};

	// fix oldIE value attroperty
	if (!getSetInput || !getSetAttribute) {
		jQuery.attrHooks.value = {
			get: function(elem, name) {
				var ret = elem.getAttributeNode(name);
				return jQuery.nodeName(elem, "input") ?

				// Ignore the value *property* by using defaultValue
				elem.defaultValue :

				ret && ret.specified ? ret.value : undefined;
			},
			set: function(elem, value, name) {
				if (jQuery.nodeName(elem, "input")) {
					// Does not return so that setAttribute is also used
					elem.defaultValue = value;
				} else {
					// Use nodeHook if defined (#1954); otherwise setAttribute is fine
					return nodeHook && nodeHook.set(elem, value, name);
				}
			}
		};
	}

	// IE6/7 do not support getting/setting some attributes with get/setAttribute
	if (!getSetAttribute) {

		// Use this for any attribute in IE6/7
		// This fixes almost every IE6/7 issue
		nodeHook = jQuery.valHooks.button = {
			get: function(elem, name) {
				var ret = elem.getAttributeNode(name);
				return ret && (name === "id" || name === "name" || name === "coords" ? ret.value !== "" : ret.specified) ?
					ret.value :
					undefined;
			},
			set: function(elem, value, name) {
				// Set the existing or create a new attribute node
				var ret = elem.getAttributeNode(name);
				if (!ret) {
					elem.setAttributeNode(
						(ret = elem.ownerDocument.createAttribute(name))
					);
				}

				ret.value = value += "";

				// Break association with cloned elements by also using setAttribute (#9646)
				return name === "value" || value === elem.getAttribute(name) ?
					value :
					undefined;
			}
		};

		// Set contenteditable to false on removals(#10429)
		// Setting to empty string throws an error as an invalid value
		jQuery.attrHooks.contenteditable = {
			get: nodeHook.get,
			set: function(elem, value, name) {
				nodeHook.set(elem, value === "" ? false : value, name);
			}
		};

		// Set width and height to auto instead of 0 on empty string( Bug #8150 )
		// This is for removals
		jQuery.each(["width", "height"], function(i, name) {
			jQuery.attrHooks[name] = jQuery.extend(jQuery.attrHooks[name], {
				set: function(elem, value) {
					if (value === "") {
						elem.setAttribute(name, "auto");
						return value;
					}
				}
			});
		});
	}


	// Some attributes require a special call on IE
	// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
	if (!jQuery.support.hrefNormalized) {
		jQuery.each(["href", "src", "width", "height"], function(i, name) {
			jQuery.attrHooks[name] = jQuery.extend(jQuery.attrHooks[name], {
				get: function(elem) {
					var ret = elem.getAttribute(name, 2);
					return ret == null ? undefined : ret;
				}
			});
		});

		// href/src property should get the full normalized URL (#10299/#12915)
		jQuery.each(["href", "src"], function(i, name) {
			jQuery.propHooks[name] = {
				get: function(elem) {
					return elem.getAttribute(name, 4);
				}
			};
		});
	}

	if (!jQuery.support.style) {
		jQuery.attrHooks.style = {
			get: function(elem) {
				// Return undefined in the case of empty string
				// Note: IE uppercases css property names, but if we were to .toLowerCase()
				// .cssText, that would destroy case senstitivity in URL's, like in "background"
				return elem.style.cssText || undefined;
			},
			set: function(elem, value) {
				return (elem.style.cssText = value + "");
			}
		};
	}

	// Safari mis-reports the default selected property of an option
	// Accessing the parent's selectedIndex property fixes it
	if (!jQuery.support.optSelected) {
		jQuery.propHooks.selected = jQuery.extend(jQuery.propHooks.selected, {
			get: function(elem) {
				var parent = elem.parentNode;

				if (parent) {
					parent.selectedIndex;

					// Make sure that it also works with optgroups, see #5701
					if (parent.parentNode) {
						parent.parentNode.selectedIndex;
					}
				}
				return null;
			}
		});
	}

	// IE6/7 call enctype encoding
	if (!jQuery.support.enctype) {
		jQuery.propFix.enctype = "encoding";
	}

	// Radios and checkboxes getter/setter
	if (!jQuery.support.checkOn) {
		jQuery.each(["radio", "checkbox"], function() {
			jQuery.valHooks[this] = {
				get: function(elem) {
					// Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
					return elem.getAttribute("value") === null ? "on" : elem.value;
				}
			};
		});
	}
	jQuery.each(["radio", "checkbox"], function() {
		jQuery.valHooks[this] = jQuery.extend(jQuery.valHooks[this], {
			set: function(elem, value) {
				if (jQuery.isArray(value)) {
					return (elem.checked = jQuery.inArray(jQuery(elem).val(), value) >= 0);
				}
			}
		});
	});
	var rformElems = /^(?:input|select|textarea)$/i,
		rkeyEvent = /^key/,
		rmouseEvent = /^(?:mouse|contextmenu)|click/,
		rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
		rtypenamespace = /^([^.]*)(?:\.(.+)|)$/;

	function returnTrue() {
		return true;
	}

	function returnFalse() {
		return false;
	}

	/*
	 * Helper functions for managing events -- not part of the public interface.
	 * Props to Dean Edwards' addEvent library for many of the ideas.
	 */
	jQuery.event = {

		global: {},

		add: function(elem, types, handler, data, selector) {
			var tmp, events, t, handleObjIn,
				special, eventHandle, handleObj,
				handlers, type, namespaces, origType,
				elemData = jQuery._data(elem);

			// Don't attach events to noData or text/comment nodes (but allow plain objects)
			if (!elemData) {
				return;
			}

			// Caller can pass in an object of custom data in lieu of the handler
			if (handler.handler) {
				handleObjIn = handler;
				handler = handleObjIn.handler;
				selector = handleObjIn.selector;
			}

			// Make sure that the handler has a unique ID, used to find/remove it later
			if (!handler.guid) {
				handler.guid = jQuery.guid++;
			}

			// Init the element's event structure and main handler, if this is the first
			if (!(events = elemData.events)) {
				events = elemData.events = {};
			}
			if (!(eventHandle = elemData.handle)) {
				eventHandle = elemData.handle = function(e) {
					// Discard the second event of a jQuery.event.trigger() and
					// when an event is called after a page has unloaded
					return typeof jQuery !== core_strundefined && (!e || jQuery.event.triggered !== e.type) ?
						jQuery.event.dispatch.apply(eventHandle.elem, arguments) :
						undefined;
				};
				// Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
				eventHandle.elem = elem;
			}

			// Handle multiple events separated by a space
			// jQuery(...).bind("mouseover mouseout", fn);
			types = (types || "").match(core_rnotwhite) || [""];
			t = types.length;
			while (t--) {
				tmp = rtypenamespace.exec(types[t]) || [];
				type = origType = tmp[1];
				namespaces = (tmp[2] || "").split(".").sort();

				// If event changes its type, use the special event handlers for the changed type
				special = jQuery.event.special[type] || {};

				// If selector defined, determine special event api type, otherwise given type
				type = (selector ? special.delegateType : special.bindType) || type;

				// Update special based on newly reset type
				special = jQuery.event.special[type] || {};

				// handleObj is passed to all event handlers
				handleObj = jQuery.extend({
					type: type,
					origType: origType,
					data: data,
					handler: handler,
					guid: handler.guid,
					selector: selector,
					needsContext: selector && jQuery.expr.match.needsContext.test(selector),
					namespace: namespaces.join(".")
				}, handleObjIn);

				// Init the event handler queue if we're the first
				if (!(handlers = events[type])) {
					handlers = events[type] = [];
					handlers.delegateCount = 0;

					// Only use addEventListener/attachEvent if the special events handler returns false
					if (!special.setup || special.setup.call(elem, data, namespaces, eventHandle) === false) {
						// Bind the global event handler to the element
						if (elem.addEventListener) {
							elem.addEventListener(type, eventHandle, false);

						} else if (elem.attachEvent) {
							elem.attachEvent("on" + type, eventHandle);
						}
					}
				}

				if (special.add) {
					special.add.call(elem, handleObj);

					if (!handleObj.handler.guid) {
						handleObj.handler.guid = handler.guid;
					}
				}

				// Add to the element's handler list, delegates in front
				if (selector) {
					handlers.splice(handlers.delegateCount++, 0, handleObj);
				} else {
					handlers.push(handleObj);
				}

				// Keep track of which events have ever been used, for event optimization
				jQuery.event.global[type] = true;
			}

			// Nullify elem to prevent memory leaks in IE
			elem = null;
		},

		// Detach an event or set of events from an element
		remove: function(elem, types, handler, selector, mappedTypes) {
			var j, handleObj, tmp,
				origCount, t, events,
				special, handlers, type,
				namespaces, origType,
				elemData = jQuery.hasData(elem) && jQuery._data(elem);

			if (!elemData || !(events = elemData.events)) {
				return;
			}

			// Once for each type.namespace in types; type may be omitted
			types = (types || "").match(core_rnotwhite) || [""];
			t = types.length;
			while (t--) {
				tmp = rtypenamespace.exec(types[t]) || [];
				type = origType = tmp[1];
				namespaces = (tmp[2] || "").split(".").sort();

				// Unbind all events (on this namespace, if provided) for the element
				if (!type) {
					for (type in events) {
						jQuery.event.remove(elem, type + types[t], handler, selector, true);
					}
					continue;
				}

				special = jQuery.event.special[type] || {};
				type = (selector ? special.delegateType : special.bindType) || type;
				handlers = events[type] || [];
				tmp = tmp[2] && new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");

				// Remove matching events
				origCount = j = handlers.length;
				while (j--) {
					handleObj = handlers[j];

					if ((mappedTypes || origType === handleObj.origType) &&
						(!handler || handler.guid === handleObj.guid) &&
						(!tmp || tmp.test(handleObj.namespace)) &&
						(!selector || selector === handleObj.selector || selector === "**" && handleObj.selector)) {
						handlers.splice(j, 1);

						if (handleObj.selector) {
							handlers.delegateCount--;
						}
						if (special.remove) {
							special.remove.call(elem, handleObj);
						}
					}
				}

				// Remove generic event handler if we removed something and no more handlers exist
				// (avoids potential for endless recursion during removal of special event handlers)
				if (origCount && !handlers.length) {
					if (!special.teardown || special.teardown.call(elem, namespaces, elemData.handle) === false) {
						jQuery.removeEvent(elem, type, elemData.handle);
					}

					delete events[type];
				}
			}

			// Remove the expando if it's no longer used
			if (jQuery.isEmptyObject(events)) {
				delete elemData.handle;

				// removeData also checks for emptiness and clears the expando if empty
				// so use it instead of delete
				jQuery._removeData(elem, "events");
			}
		},

		trigger: function(event, data, elem, onlyHandlers) {
			var handle, ontype, cur,
				bubbleType, special, tmp, i,
				eventPath = [elem || document],
				type = core_hasOwn.call(event, "type") ? event.type : event,
				namespaces = core_hasOwn.call(event, "namespace") ? event.namespace.split(".") : [];

			cur = tmp = elem = elem || document;

			// Don't do events on text and comment nodes
			if (elem.nodeType === 3 || elem.nodeType === 8) {
				return;
			}

			// focus/blur morphs to focusin/out; ensure we're not firing them right now
			if (rfocusMorph.test(type + jQuery.event.triggered)) {
				return;
			}

			if (type.indexOf(".") >= 0) {
				// Namespaced trigger; create a regexp to match event type in handle()
				namespaces = type.split(".");
				type = namespaces.shift();
				namespaces.sort();
			}
			ontype = type.indexOf(":") < 0 && "on" + type;

			// Caller can pass in a jQuery.Event object, Object, or just an event type string
			event = event[jQuery.expando] ?
				event :
				new jQuery.Event(type, typeof event === "object" && event);

			event.isTrigger = true;
			event.namespace = namespaces.join(".");
			event.namespace_re = event.namespace ?
				new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") :
				null;

			// Clean up the event in case it is being reused
			event.result = undefined;
			if (!event.target) {
				event.target = elem;
			}

			// Clone any incoming data and prepend the event, creating the handler arg list
			data = data == null ? [event] :
				jQuery.makeArray(data, [event]);

			// Allow special events to draw outside the lines
			special = jQuery.event.special[type] || {};
			if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) {
				return;
			}

			// Determine event propagation path in advance, per W3C events spec (#9951)
			// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
			if (!onlyHandlers && !special.noBubble && !jQuery.isWindow(elem)) {

				bubbleType = special.delegateType || type;
				if (!rfocusMorph.test(bubbleType + type)) {
					cur = cur.parentNode;
				}
				for (; cur; cur = cur.parentNode) {
					eventPath.push(cur);
					tmp = cur;
				}

				// Only add window if we got to document (e.g., not plain obj or detached DOM)
				if (tmp === (elem.ownerDocument || document)) {
					eventPath.push(tmp.defaultView || tmp.parentWindow || window);
				}
			}

			// Fire handlers on the event path
			i = 0;
			while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {

				event.type = i > 1 ?
					bubbleType :
					special.bindType || type;

				// jQuery handler
				handle = (jQuery._data(cur, "events") || {})[event.type] && jQuery._data(cur, "handle");
				if (handle) {
					handle.apply(cur, data);
				}

				// Native handler
				handle = ontype && cur[ontype];
				if (handle && jQuery.acceptData(cur) && handle.apply && handle.apply(cur, data) === false) {
					event.preventDefault();
				}
			}
			event.type = type;

			// If nobody prevented the default action, do it now
			if (!onlyHandlers && !event.isDefaultPrevented()) {

				if ((!special._default || special._default.apply(elem.ownerDocument, data) === false) && !(type === "click" && jQuery.nodeName(elem, "a")) && jQuery.acceptData(elem)) {

					// Call a native DOM method on the target with the same name name as the event.
					// Can't use an .isFunction() check here because IE6/7 fails that test.
					// Don't do default actions on window, that's where global variables be (#6170)
					if (ontype && elem[type] && !jQuery.isWindow(elem)) {

						// Don't re-trigger an onFOO event when we call its FOO() method
						tmp = elem[ontype];

						if (tmp) {
							elem[ontype] = null;
						}

						// Prevent re-triggering of the same event, since we already bubbled it above
						jQuery.event.triggered = type;
						try {
							elem[type]();
						} catch (e) {
							// IE<9 dies on focus/blur to hidden element (#1486,#12518)
							// only reproducible on winXP IE8 native, not IE9 in IE8 mode
						}
						jQuery.event.triggered = undefined;

						if (tmp) {
							elem[ontype] = tmp;
						}
					}
				}
			}

			return event.result;
		},

		dispatch: function(event) {

			// Make a writable jQuery.Event from the native event object
			event = jQuery.event.fix(event);

			var i, ret, handleObj, matched, j,
				handlerQueue = [],
				args = core_slice.call(arguments),
				handlers = (jQuery._data(this, "events") || {})[event.type] || [],
				special = jQuery.event.special[event.type] || {};

			// Use the fix-ed jQuery.Event rather than the (read-only) native event
			args[0] = event;
			event.delegateTarget = this;

			// Call the preDispatch hook for the mapped type, and let it bail if desired
			if (special.preDispatch && special.preDispatch.call(this, event) === false) {
				return;
			}

			// Determine handlers
			handlerQueue = jQuery.event.handlers.call(this, event, handlers);

			// Run delegates first; they may want to stop propagation beneath us
			i = 0;
			while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) {
				event.currentTarget = matched.elem;

				j = 0;
				while ((handleObj = matched.handlers[j++]) && !event.isImmediatePropagationStopped()) {

					// Triggered event must either 1) have no namespace, or
					// 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
					if (!event.namespace_re || event.namespace_re.test(handleObj.namespace)) {

						event.handleObj = handleObj;
						event.data = handleObj.data;

						ret = ((jQuery.event.special[handleObj.origType] || {}).handle || handleObj.handler)
							.apply(matched.elem, args);

						if (ret !== undefined) {
							if ((event.result = ret) === false) {
								event.preventDefault();
								event.stopPropagation();
							}
						}
					}
				}
			}

			// Call the postDispatch hook for the mapped type
			if (special.postDispatch) {
				special.postDispatch.call(this, event);
			}

			return event.result;
		},

		handlers: function(event, handlers) {
			var sel, handleObj, matches, i,
				handlerQueue = [],
				delegateCount = handlers.delegateCount,
				cur = event.target;

			// Find delegate handlers
			// Black-hole SVG <use> instance trees (#13180)
			// Avoid non-left-click bubbling in Firefox (#3861)
			if (delegateCount && cur.nodeType && (!event.button || event.type !== "click")) {

				for (; cur != this; cur = cur.parentNode || this) {

					// Don't check non-elements (#13208)
					// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
					if (cur.nodeType === 1 && (cur.disabled !== true || event.type !== "click")) {
						matches = [];
						for (i = 0; i < delegateCount; i++) {
							handleObj = handlers[i];

							// Don't conflict with Object.prototype properties (#13203)
							sel = handleObj.selector + " ";

							if (matches[sel] === undefined) {
								matches[sel] = handleObj.needsContext ?
									jQuery(sel, this).index(cur) >= 0 :
									jQuery.find(sel, this, null, [cur]).length;
							}
							if (matches[sel]) {
								matches.push(handleObj);
							}
						}
						if (matches.length) {
							handlerQueue.push({
								elem: cur,
								handlers: matches
							});
						}
					}
				}
			}

			// Add the remaining (directly-bound) handlers
			if (delegateCount < handlers.length) {
				handlerQueue.push({
					elem: this,
					handlers: handlers.slice(delegateCount)
				});
			}

			return handlerQueue;
		},

		fix: function(event) {
			if (event[jQuery.expando]) {
				return event;
			}

			// Create a writable copy of the event object and normalize some properties
			var i, prop, copy,
				type = event.type,
				originalEvent = event,
				fixHook = this.fixHooks[type];

			if (!fixHook) {
				this.fixHooks[type] = fixHook =
					rmouseEvent.test(type) ? this.mouseHooks :
					rkeyEvent.test(type) ? this.keyHooks : {};
			}
			copy = fixHook.props ? this.props.concat(fixHook.props) : this.props;

			event = new jQuery.Event(originalEvent);

			i = copy.length;
			while (i--) {
				prop = copy[i];
				event[prop] = originalEvent[prop];
			}

			// Support: IE<9
			// Fix target property (#1925)
			if (!event.target) {
				event.target = originalEvent.srcElement || document;
			}

			// Support: Chrome 23+, Safari?
			// Target should not be a text node (#504, #13143)
			if (event.target.nodeType === 3) {
				event.target = event.target.parentNode;
			}

			// Support: IE<9
			// For mouse/key events, metaKey==false if it's undefined (#3368, #11328)
			event.metaKey = !! event.metaKey;

			return fixHook.filter ? fixHook.filter(event, originalEvent) : event;
		},

		// Includes some event props shared by KeyEvent and MouseEvent
		props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),

		fixHooks: {},

		keyHooks: {
			props: "char charCode key keyCode".split(" "),
			filter: function(event, original) {

				// Add which for key events
				if (event.which == null) {
					event.which = original.charCode != null ? original.charCode : original.keyCode;
				}

				return event;
			}
		},

		mouseHooks: {
			props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
			filter: function(event, original) {
				var body, eventDoc, doc,
					button = original.button,
					fromElement = original.fromElement;

				// Calculate pageX/Y if missing and clientX/Y available
				if (event.pageX == null && original.clientX != null) {
					eventDoc = event.target.ownerDocument || document;
					doc = eventDoc.documentElement;
					body = eventDoc.body;

					event.pageX = original.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
					event.pageY = original.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0);
				}

				// Add relatedTarget, if necessary
				if (!event.relatedTarget && fromElement) {
					event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
				}

				// Add which for click: 1 === left; 2 === middle; 3 === right
				// Note: button is not normalized, so don't use it
				if (!event.which && button !== undefined) {
					event.which = (button & 1 ? 1 : (button & 2 ? 3 : (button & 4 ? 2 : 0)));
				}

				return event;
			}
		},

		special: {
			load: {
				// Prevent triggered image.load events from bubbling to window.load
				noBubble: true
			},
			click: {
				// For checkbox, fire native event so checked state will be right
				trigger: function() {
					if (jQuery.nodeName(this, "input") && this.type === "checkbox" && this.click) {
						this.click();
						return false;
					}
				}
			},
			focus: {
				// Fire native event if possible so blur/focus sequence is correct
				trigger: function() {
					if (this !== document.activeElement && this.focus) {
						try {
							this.focus();
							return false;
						} catch (e) {
							// Support: IE<9
							// If we error on focus to hidden element (#1486, #12518),
							// let .trigger() run the handlers
						}
					}
				},
				delegateType: "focusin"
			},
			blur: {
				trigger: function() {
					if (this === document.activeElement && this.blur) {
						this.blur();
						return false;
					}
				},
				delegateType: "focusout"
			},

			beforeunload: {
				postDispatch: function(event) {

					// Even when returnValue equals to undefined Firefox will still show alert
					if (event.result !== undefined) {
						event.originalEvent.returnValue = event.result;
					}
				}
			}
		},

		simulate: function(type, elem, event, bubble) {
			// Piggyback on a donor event to simulate a different one.
			// Fake originalEvent to avoid donor's stopPropagation, but if the
			// simulated event prevents default then we do the same on the donor.
			var e = jQuery.extend(
				new jQuery.Event(),
				event, {
					type: type,
					isSimulated: true,
					originalEvent: {}
				}
			);
			if (bubble) {
				jQuery.event.trigger(e, null, elem);
			} else {
				jQuery.event.dispatch.call(elem, e);
			}
			if (e.isDefaultPrevented()) {
				event.preventDefault();
			}
		}
	};

	jQuery.removeEvent = document.removeEventListener ?
		function(elem, type, handle) {
			if (elem.removeEventListener) {
				elem.removeEventListener(type, handle, false);
			}
	} :
		function(elem, type, handle) {
			var name = "on" + type;

			if (elem.detachEvent) {

				// #8545, #7054, preventing memory leaks for custom events in IE6-8
				// detachEvent needed property on element, by name of that event, to properly expose it to GC
				if (typeof elem[name] === core_strundefined) {
					elem[name] = null;
				}

				elem.detachEvent(name, handle);
			}
	};

	jQuery.Event = function(src, props) {
		// Allow instantiation without the 'new' keyword
		if (!(this instanceof jQuery.Event)) {
			return new jQuery.Event(src, props);
		}

		// Event object
		if (src && src.type) {
			this.originalEvent = src;
			this.type = src.type;

			// Events bubbling up the document may have been marked as prevented
			// by a handler lower down the tree; reflect the correct value.
			this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false ||
				src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse;

			// Event type
		} else {
			this.type = src;
		}

		// Put explicitly provided properties onto the event object
		if (props) {
			jQuery.extend(this, props);
		}

		// Create a timestamp if incoming event doesn't have one
		this.timeStamp = src && src.timeStamp || jQuery.now();

		// Mark it as fixed
		this[jQuery.expando] = true;
	};

	// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
	// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
	jQuery.Event.prototype = {
		isDefaultPrevented: returnFalse,
		isPropagationStopped: returnFalse,
		isImmediatePropagationStopped: returnFalse,

		preventDefault: function() {
			var e = this.originalEvent;

			this.isDefaultPrevented = returnTrue;
			if (!e) {
				return;
			}

			// If preventDefault exists, run it on the original event
			if (e.preventDefault) {
				e.preventDefault();

				// Support: IE
				// Otherwise set the returnValue property of the original event to false
			} else {
				e.returnValue = false;
			}
		},
		stopPropagation: function() {
			var e = this.originalEvent;

			this.isPropagationStopped = returnTrue;
			if (!e) {
				return;
			}
			// If stopPropagation exists, run it on the original event
			if (e.stopPropagation) {
				e.stopPropagation();
			}

			// Support: IE
			// Set the cancelBubble property of the original event to true
			e.cancelBubble = true;
		},
		stopImmediatePropagation: function() {
			this.isImmediatePropagationStopped = returnTrue;
			this.stopPropagation();
		}
	};

	// Create mouseenter/leave events using mouseover/out and event-time checks
	jQuery.each({
		mouseenter: "mouseover",
		mouseleave: "mouseout"
	}, function(orig, fix) {
		jQuery.event.special[orig] = {
			delegateType: fix,
			bindType: fix,

			handle: function(event) {
				var ret,
					target = this,
					related = event.relatedTarget,
					handleObj = event.handleObj;

				// For mousenter/leave call the handler if related is outside the target.
				// NB: No relatedTarget if the mouse left/entered the browser window
				if (!related || (related !== target && !jQuery.contains(target, related))) {
					event.type = handleObj.origType;
					ret = handleObj.handler.apply(this, arguments);
					event.type = fix;
				}
				return ret;
			}
		};
	});

	// IE submit delegation
	if (!jQuery.support.submitBubbles) {

		jQuery.event.special.submit = {
			setup: function() {
				// Only need this for delegated form submit events
				if (jQuery.nodeName(this, "form")) {
					return false;
				}

				// Lazy-add a submit handler when a descendant form may potentially be submitted
				jQuery.event.add(this, "click._submit keypress._submit", function(e) {
					// Node name check avoids a VML-related crash in IE (#9807)
					var elem = e.target,
						form = jQuery.nodeName(elem, "input") || jQuery.nodeName(elem, "button") ? elem.form : undefined;
					if (form && !jQuery._data(form, "submitBubbles")) {
						jQuery.event.add(form, "submit._submit", function(event) {
							event._submit_bubble = true;
						});
						jQuery._data(form, "submitBubbles", true);
					}
				});
				// return undefined since we don't need an event listener
			},

			postDispatch: function(event) {
				// If form was submitted by the user, bubble the event up the tree
				if (event._submit_bubble) {
					delete event._submit_bubble;
					if (this.parentNode && !event.isTrigger) {
						jQuery.event.simulate("submit", this.parentNode, event, true);
					}
				}
			},

			teardown: function() {
				// Only need this for delegated form submit events
				if (jQuery.nodeName(this, "form")) {
					return false;
				}

				// Remove delegated handlers; cleanData eventually reaps submit handlers attached above
				jQuery.event.remove(this, "._submit");
			}
		};
	}

	// IE change delegation and checkbox/radio fix
	if (!jQuery.support.changeBubbles) {

		jQuery.event.special.change = {

			setup: function() {

				if (rformElems.test(this.nodeName)) {
					// IE doesn't fire change on a check/radio until blur; trigger it on click
					// after a propertychange. Eat the blur-change in special.change.handle.
					// This still fires onchange a second time for check/radio after blur.
					if (this.type === "checkbox" || this.type === "radio") {
						jQuery.event.add(this, "propertychange._change", function(event) {
							if (event.originalEvent.propertyName === "checked") {
								this._just_changed = true;
							}
						});
						jQuery.event.add(this, "click._change", function(event) {
							if (this._just_changed && !event.isTrigger) {
								this._just_changed = false;
							}
							// Allow triggered, simulated change events (#11500)
							jQuery.event.simulate("change", this, event, true);
						});
					}
					return false;
				}
				// Delegated event; lazy-add a change handler on descendant inputs
				jQuery.event.add(this, "beforeactivate._change", function(e) {
					var elem = e.target;

					if (rformElems.test(elem.nodeName) && !jQuery._data(elem, "changeBubbles")) {
						jQuery.event.add(elem, "change._change", function(event) {
							if (this.parentNode && !event.isSimulated && !event.isTrigger) {
								jQuery.event.simulate("change", this.parentNode, event, true);
							}
						});
						jQuery._data(elem, "changeBubbles", true);
					}
				});
			},

			handle: function(event) {
				var elem = event.target;

				// Swallow native change events from checkbox/radio, we already triggered them above
				if (this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox")) {
					return event.handleObj.handler.apply(this, arguments);
				}
			},

			teardown: function() {
				jQuery.event.remove(this, "._change");

				return !rformElems.test(this.nodeName);
			}
		};
	}

	// Create "bubbling" focus and blur events
	if (!jQuery.support.focusinBubbles) {
		jQuery.each({
			focus: "focusin",
			blur: "focusout"
		}, function(orig, fix) {

			// Attach a single capturing handler while someone wants focusin/focusout
			var attaches = 0,
				handler = function(event) {
					jQuery.event.simulate(fix, event.target, jQuery.event.fix(event), true);
				};

			jQuery.event.special[fix] = {
				setup: function() {
					if (attaches++ === 0) {
						document.addEventListener(orig, handler, true);
					}
				},
				teardown: function() {
					if (--attaches === 0) {
						document.removeEventListener(orig, handler, true);
					}
				}
			};
		});
	}

	jQuery.fn.extend({

		on: function(types, selector, data, fn, /*INTERNAL*/ one) {
			var type, origFn;

			// Types can be a map of types/handlers
			if (typeof types === "object") {
				// ( types-Object, selector, data )
				if (typeof selector !== "string") {
					// ( types-Object, data )
					data = data || selector;
					selector = undefined;
				}
				for (type in types) {
					this.on(type, selector, data, types[type], one);
				}
				return this;
			}

			if (data == null && fn == null) {
				// ( types, fn )
				fn = selector;
				data = selector = undefined;
			} else if (fn == null) {
				if (typeof selector === "string") {
					// ( types, selector, fn )
					fn = data;
					data = undefined;
				} else {
					// ( types, data, fn )
					fn = data;
					data = selector;
					selector = undefined;
				}
			}
			if (fn === false) {
				fn = returnFalse;
			} else if (!fn) {
				return this;
			}

			if (one === 1) {
				origFn = fn;
				fn = function(event) {
					// Can use an empty set, since event contains the info
					jQuery().off(event);
					return origFn.apply(this, arguments);
				};
				// Use same guid so caller can remove using origFn
				fn.guid = origFn.guid || (origFn.guid = jQuery.guid++);
			}
			return this.each(function() {
				jQuery.event.add(this, types, fn, data, selector);
			});
		},
		one: function(types, selector, data, fn) {
			return this.on(types, selector, data, fn, 1);
		},
		off: function(types, selector, fn) {
			var handleObj, type;
			if (types && types.preventDefault && types.handleObj) {
				// ( event )  dispatched jQuery.Event
				handleObj = types.handleObj;
				jQuery(types.delegateTarget).off(
					handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
					handleObj.selector,
					handleObj.handler
				);
				return this;
			}
			if (typeof types === "object") {
				// ( types-object [, selector] )
				for (type in types) {
					this.off(type, selector, types[type]);
				}
				return this;
			}
			if (selector === false || typeof selector === "function") {
				// ( types [, fn] )
				fn = selector;
				selector = undefined;
			}
			if (fn === false) {
				fn = returnFalse;
			}
			return this.each(function() {
				jQuery.event.remove(this, types, fn, selector);
			});
		},

		bind: function(types, data, fn) {
			return this.on(types, null, data, fn);
		},
		unbind: function(types, fn) {
			return this.off(types, null, fn);
		},

		delegate: function(selector, types, data, fn) {
			return this.on(types, selector, data, fn);
		},
		undelegate: function(selector, types, fn) {
			// ( namespace ) or ( selector, types [, fn] )
			return arguments.length === 1 ? this.off(selector, "**") : this.off(types, selector || "**", fn);
		},

		trigger: function(type, data) {
			return this.each(function() {
				jQuery.event.trigger(type, data, this);
			});
		},
		triggerHandler: function(type, data) {
			var elem = this[0];
			if (elem) {
				return jQuery.event.trigger(type, data, elem, true);
			}
		}
	});
	/*!
	 * Sizzle CSS Selector Engine
	 * Copyright 2012 jQuery Foundation and other contributors
	 * Released under the MIT license
	 * http://sizzlejs.com/
	 */
	(function(window, undefined) {

		var i,
			cachedruns,
			Expr,
			getText,
			isXML,
			compile,
			hasDuplicate,
			outermostContext,

			// Local document vars
			setDocument,
			document,
			docElem,
			documentIsXML,
			rbuggyQSA,
			rbuggyMatches,
			matches,
			contains,
			sortOrder,

			// Instance-specific data
			expando = "sizzle" + -(new Date()),
			preferredDoc = window.document,
			support = {},
			dirruns = 0,
			done = 0,
			classCache = createCache(),
			tokenCache = createCache(),
			compilerCache = createCache(),

			// General-purpose constants
			strundefined = typeof undefined,
			MAX_NEGATIVE = 1 << 31,

			// Array methods
			arr = [],
			pop = arr.pop,
			push = arr.push,
			slice = arr.slice,
			// Use a stripped-down indexOf if we can't use a native one
			indexOf = arr.indexOf || function(elem) {
				var i = 0,
					len = this.length;
				for (; i < len; i++) {
					if (this[i] === elem) {
						return i;
					}
				}
				return -1;
			},


			// Regular expressions

			// Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
			whitespace = "[\\x20\\t\\r\\n\\f]",
			// http://www.w3.org/TR/css3-syntax/#characters
			characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",

			// Loosely modeled on CSS identifier characters
			// An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors
			// Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
			identifier = characterEncoding.replace("w", "w#"),

			// Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors
			operators = "([*^$|!~]?=)",
			attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace +
				"*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]",

			// Prefer arguments quoted,
			//   then not containing pseudos/brackets,
			//   then attribute selectors/non-parenthetical expressions,
			//   then anything else
			// These preferences are here to reduce the number of selectors
			//   needing tokenize in the PSEUDO preFilter
			pseudos = ":(" + characterEncoding + ")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + attributes.replace(3, 8) + ")*)|.*)\\)|)",

			// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
			rtrim = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g"),

			rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"),
			rcombinators = new RegExp("^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*"),
			rpseudo = new RegExp(pseudos),
			ridentifier = new RegExp("^" + identifier + "$"),

			matchExpr = {
				"ID": new RegExp("^#(" + characterEncoding + ")"),
				"CLASS": new RegExp("^\\.(" + characterEncoding + ")"),
				"NAME": new RegExp("^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]"),
				"TAG": new RegExp("^(" + characterEncoding.replace("w", "w*") + ")"),
				"ATTR": new RegExp("^" + attributes),
				"PSEUDO": new RegExp("^" + pseudos),
				"CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
					"*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
					"*(\\d+)|))" + whitespace + "*\\)|)", "i"),
				// For use in libraries implementing .is()
				// We use this for POS matching in `select`
				"needsContext": new RegExp("^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
					whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i")
			},

			rsibling = /[\x20\t\r\n\f]*[+~]/,

			rnative = /^[^{]+\{\s*\[native code/,

			// Easily-parseable/retrievable ID or TAG or CLASS selectors
			rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,

			rinputs = /^(?:input|select|textarea|button)$/i,
			rheader = /^h\d$/i,

			rescape = /'|\\/g,
			rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,

			// CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
			runescape = /\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g,
			funescape = function(_, escaped) {
				var high = "0x" + escaped - 0x10000;
				// NaN means non-codepoint
				return high !== high ?
					escaped :
				// BMP codepoint
				high < 0 ?
					String.fromCharCode(high + 0x10000) :
				// Supplemental Plane codepoint (surrogate pair)
				String.fromCharCode(high >> 10 | 0xD800, high & 0x3FF | 0xDC00);
			};

		// Use a stripped-down slice if we can't use a native one
		try {
			slice.call(preferredDoc.documentElement.childNodes, 0)[0].nodeType;
		} catch (e) {
			slice = function(i) {
				var elem,
					results = [];
				while ((elem = this[i++])) {
					results.push(elem);
				}
				return results;
			};
		}

		/**
		 * For feature detection
		 * @param {Function} fn The function to test for native support
		 */

		function isNative(fn) {
			return rnative.test(fn + "");
		}

		/**
		 * Create key-value caches of limited size
		 * @returns {Function(string, Object)} Returns the Object data after storing it on itself with
		 *  property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
		 *  deleting the oldest entry
		 */

		function createCache() {
			var cache,
				keys = [];

			return (cache = function(key, value) {
				// Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
				if (keys.push(key += " ") > Expr.cacheLength) {
					// Only keep the most recent entries
					delete cache[keys.shift()];
				}
				return (cache[key] = value);
			});
		}

		/**
		 * Mark a function for special use by Sizzle
		 * @param {Function} fn The function to mark
		 */

		function markFunction(fn) {
			fn[expando] = true;
			return fn;
		}

		/**
		 * Support testing using an element
		 * @param {Function} fn Passed the created div and expects a boolean result
		 */

		function assert(fn) {
			var div = document.createElement("div");

			try {
				return fn(div);
			} catch (e) {
				return false;
			} finally {
				// release memory in IE
				div = null;
			}
		}

		function Sizzle(selector, context, results, seed) {
			var match, elem, m, nodeType,
				// QSA vars
				i, groups, old, nid, newContext, newSelector;

			if ((context ? context.ownerDocument || context : preferredDoc) !== document) {
				setDocument(context);
			}

			context = context || document;
			results = results || [];

			if (!selector || typeof selector !== "string") {
				return results;
			}

			if ((nodeType = context.nodeType) !== 1 && nodeType !== 9) {
				return [];
			}

			if (!documentIsXML && !seed) {

				// Shortcuts
				if ((match = rquickExpr.exec(selector))) {
					// Speed-up: Sizzle("#ID")
					if ((m = match[1])) {
						if (nodeType === 9) {
							elem = context.getElementById(m);
							// Check parentNode to catch when Blackberry 4.6 returns
							// nodes that are no longer in the document #6963
							if (elem && elem.parentNode) {
								// Handle the case where IE, Opera, and Webkit return items
								// by name instead of ID
								if (elem.id === m) {
									results.push(elem);
									return results;
								}
							} else {
								return results;
							}
						} else {
							// Context is not a document
							if (context.ownerDocument && (elem = context.ownerDocument.getElementById(m)) &&
								contains(context, elem) && elem.id === m) {
								results.push(elem);
								return results;
							}
						}

						// Speed-up: Sizzle("TAG")
					} else if (match[2]) {
						push.apply(results, slice.call(context.getElementsByTagName(selector), 0));
						return results;

						// Speed-up: Sizzle(".CLASS")
					} else if ((m = match[3]) && support.getByClassName && context.getElementsByClassName) {
						push.apply(results, slice.call(context.getElementsByClassName(m), 0));
						return results;
					}
				}

				// QSA path
				if (support.qsa && !rbuggyQSA.test(selector)) {
					old = true;
					nid = expando;
					newContext = context;
					newSelector = nodeType === 9 && selector;

					// qSA works strangely on Element-rooted queries
					// We can work around this by specifying an extra ID on the root
					// and working up from there (Thanks to Andrew Dupont for the technique)
					// IE 8 doesn't work on object elements
					if (nodeType === 1 && context.nodeName.toLowerCase() !== "object") {
						groups = tokenize(selector);

						if ((old = context.getAttribute("id"))) {
							nid = old.replace(rescape, "\\$&");
						} else {
							context.setAttribute("id", nid);
						}
						nid = "[id='" + nid + "'] ";

						i = groups.length;
						while (i--) {
							groups[i] = nid + toSelector(groups[i]);
						}
						newContext = rsibling.test(selector) && context.parentNode || context;
						newSelector = groups.join(",");
					}

					if (newSelector) {
						try {
							push.apply(results, slice.call(newContext.querySelectorAll(
								newSelector
							), 0));
							return results;
						} catch (qsaError) {} finally {
							if (!old) {
								context.removeAttribute("id");
							}
						}
					}
				}
			}

			// All others
			return select(selector.replace(rtrim, "$1"), context, results, seed);
		}

		/**
		 * Detect xml
		 * @param {Element|Object} elem An element or a document
		 */
		isXML = Sizzle.isXML = function(elem) {
			// documentElement is verified for cases where it doesn't yet exist
			// (such as loading iframes in IE - #4833)
			var documentElement = elem && (elem.ownerDocument || elem).documentElement;
			return documentElement ? documentElement.nodeName !== "HTML" : false;
		};

		/**
		 * Sets document-related variables once based on the current document
		 * @param {Element|Object} [doc] An element or document object to use to set the document
		 * @returns {Object} Returns the current document
		 */
		setDocument = Sizzle.setDocument = function(node) {
			var doc = node ? node.ownerDocument || node : preferredDoc;

			// If no document and documentElement is available, return
			if (doc === document || doc.nodeType !== 9 || !doc.documentElement) {
				return document;
			}

			// Set our document
			document = doc;
			docElem = doc.documentElement;

			// Support tests
			documentIsXML = isXML(doc);

			// Check if getElementsByTagName("*") returns only elements
			support.tagNameNoComments = assert(function(div) {
				div.appendChild(doc.createComment(""));
				return !div.getElementsByTagName("*").length;
			});

			// Check if attributes should be retrieved by attribute nodes
			support.attributes = assert(function(div) {
				div.innerHTML = "<select></select>";
				var type = typeof div.lastChild.getAttribute("multiple");
				// IE8 returns a string for some attributes even when not present
				return type !== "boolean" && type !== "string";
			});

			// Check if getElementsByClassName can be trusted
			support.getByClassName = assert(function(div) {
				// Opera can't find a second classname (in 9.6)
				div.innerHTML = "<div class='hidden e'></div><div class='hidden'></div>";
				if (!div.getElementsByClassName || !div.getElementsByClassName("e").length) {
					return false;
				}

				// Safari 3.2 caches class attributes and doesn't catch changes
				div.lastChild.className = "e";
				return div.getElementsByClassName("e").length === 2;
			});

			// Check if getElementById returns elements by name
			// Check if getElementsByName privileges form controls or returns elements by ID
			support.getByName = assert(function(div) {
				// Inject content
				div.id = expando + 0;
				div.innerHTML = "<a name='" + expando + "'></a><div name='" + expando + "'></div>";
				docElem.insertBefore(div, docElem.firstChild);

				// Test
				var pass = doc.getElementsByName &&
				// buggy browsers will return fewer than the correct 2
				doc.getElementsByName(expando).length === 2 +
				// buggy browsers will return more than the correct 0
				doc.getElementsByName(expando + 0).length;
				support.getIdNotName = !doc.getElementById(expando);

				// Cleanup
				docElem.removeChild(div);

				return pass;
			});

			// IE6/7 return modified attributes
			Expr.attrHandle = assert(function(div) {
				div.innerHTML = "<a href='#'></a>";
				return div.firstChild && typeof div.firstChild.getAttribute !== strundefined &&
					div.firstChild.getAttribute("href") === "#";
			}) ? {} : {
				"href": function(elem) {
					return elem.getAttribute("href", 2);
				},
				"type": function(elem) {
					return elem.getAttribute("type");
				}
			};

			// ID find and filter
			if (support.getIdNotName) {
				Expr.find["ID"] = function(id, context) {
					if (typeof context.getElementById !== strundefined && !documentIsXML) {
						var m = context.getElementById(id);
						// Check parentNode to catch when Blackberry 4.6 returns
						// nodes that are no longer in the document #6963
						return m && m.parentNode ? [m] : [];
					}
				};
				Expr.filter["ID"] = function(id) {
					var attrId = id.replace(runescape, funescape);
					return function(elem) {
						return elem.getAttribute("id") === attrId;
					};
				};
			} else {
				Expr.find["ID"] = function(id, context) {
					if (typeof context.getElementById !== strundefined && !documentIsXML) {
						var m = context.getElementById(id);

						return m ?
							m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? [m] :
							undefined : [];
					}
				};
				Expr.filter["ID"] = function(id) {
					var attrId = id.replace(runescape, funescape);
					return function(elem) {
						var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
						return node && node.value === attrId;
					};
				};
			}

			// Tag
			Expr.find["TAG"] = support.tagNameNoComments ?
				function(tag, context) {
					if (typeof context.getElementsByTagName !== strundefined) {
						return context.getElementsByTagName(tag);
					}
			} :
				function(tag, context) {
					var elem,
						tmp = [],
						i = 0,
						results = context.getElementsByTagName(tag);

					// Filter out possible comments
					if (tag === "*") {
						while ((elem = results[i++])) {
							if (elem.nodeType === 1) {
								tmp.push(elem);
							}
						}

						return tmp;
					}
					return results;
			};

			// Name
			Expr.find["NAME"] = support.getByName && function(tag, context) {
				if (typeof context.getElementsByName !== strundefined) {
					return context.getElementsByName(name);
				}
			};

			// Class
			Expr.find["CLASS"] = support.getByClassName && function(className, context) {
				if (typeof context.getElementsByClassName !== strundefined && !documentIsXML) {
					return context.getElementsByClassName(className);
				}
			};

			// QSA and matchesSelector support

			// matchesSelector(:active) reports false when true (IE9/Opera 11.5)
			rbuggyMatches = [];

			// qSa(:focus) reports false when true (Chrome 21),
			// no need to also add to buggyMatches since matches checks buggyQSA
			// A support test would require too much code (would include document ready)
			rbuggyQSA = [":focus"];

			if ((support.qsa = isNative(doc.querySelectorAll))) {
				// Build QSA regex
				// Regex strategy adopted from Diego Perini
				assert(function(div) {
					// Select is set to empty string on purpose
					// This is to test IE's treatment of not explictly
					// setting a boolean content attribute,
					// since its presence should be enough
					// http://bugs.jquery.com/ticket/12359
					div.innerHTML = "<select><option selected=''></option></select>";

					// IE8 - Some boolean attributes are not treated correctly
					if (!div.querySelectorAll("[selected]").length) {
						rbuggyQSA.push("\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)");
					}

					// Webkit/Opera - :checked should return selected option elements
					// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
					// IE8 throws error here and will not see later tests
					if (!div.querySelectorAll(":checked").length) {
						rbuggyQSA.push(":checked");
					}
				});

				assert(function(div) {

					// Opera 10-12/IE8 - ^= $= *= and empty values
					// Should not select anything
					div.innerHTML = "<input type='hidden' i=''/>";
					if (div.querySelectorAll("[i^='']").length) {
						rbuggyQSA.push("[*^$]=" + whitespace + "*(?:\"\"|'')");
					}

					// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
					// IE8 throws error here and will not see later tests
					if (!div.querySelectorAll(":enabled").length) {
						rbuggyQSA.push(":enabled", ":disabled");
					}

					// Opera 10-11 does not throw on post-comma invalid pseudos
					div.querySelectorAll("*,:x");
					rbuggyQSA.push(",.*:");
				});
			}

			if ((support.matchesSelector = isNative((matches = docElem.matchesSelector ||
				docElem.mozMatchesSelector ||
				docElem.webkitMatchesSelector ||
				docElem.oMatchesSelector ||
				docElem.msMatchesSelector)))) {

				assert(function(div) {
					// Check to see if it's possible to do matchesSelector
					// on a disconnected node (IE 9)
					support.disconnectedMatch = matches.call(div, "div");

					// This should fail with an exception
					// Gecko does not error, returns false instead
					matches.call(div, "[s!='']:x");
					rbuggyMatches.push("!=", pseudos);
				});
			}

			rbuggyQSA = new RegExp(rbuggyQSA.join("|"));
			rbuggyMatches = new RegExp(rbuggyMatches.join("|"));

			// Element contains another
			// Purposefully does not implement inclusive descendent
			// As in, an element does not contain itself
			contains = isNative(docElem.contains) || docElem.compareDocumentPosition ?
				function(a, b) {
					var adown = a.nodeType === 9 ? a.documentElement : a,
						bup = b && b.parentNode;
					return a === bup || !! (bup && bup.nodeType === 1 && (
						adown.contains ?
						adown.contains(bup) :
						a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16
					));
			} :
				function(a, b) {
					if (b) {
						while ((b = b.parentNode)) {
							if (b === a) {
								return true;
							}
						}
					}
					return false;
			};

			// Document order sorting
			sortOrder = docElem.compareDocumentPosition ?
				function(a, b) {
					var compare;

					if (a === b) {
						hasDuplicate = true;
						return 0;
					}

					if ((compare = b.compareDocumentPosition && a.compareDocumentPosition && a.compareDocumentPosition(b))) {
						if (compare & 1 || a.parentNode && a.parentNode.nodeType === 11) {
							if (a === doc || contains(preferredDoc, a)) {
								return -1;
							}
							if (b === doc || contains(preferredDoc, b)) {
								return 1;
							}
							return 0;
						}
						return compare & 4 ? -1 : 1;
					}

					return a.compareDocumentPosition ? -1 : 1;
			} :
				function(a, b) {
					var cur,
						i = 0,
						aup = a.parentNode,
						bup = b.parentNode,
						ap = [a],
						bp = [b];

					// Exit early if the nodes are identical
					if (a === b) {
						hasDuplicate = true;
						return 0;

						// Parentless nodes are either documents or disconnected
					} else if (!aup || !bup) {
						return a === doc ? -1 :
							b === doc ? 1 :
							aup ? -1 :
							bup ? 1 :
							0;

						// If the nodes are siblings, we can do a quick check
					} else if (aup === bup) {
						return siblingCheck(a, b);
					}

					// Otherwise we need full lists of their ancestors for comparison
					cur = a;
					while ((cur = cur.parentNode)) {
						ap.unshift(cur);
					}
					cur = b;
					while ((cur = cur.parentNode)) {
						bp.unshift(cur);
					}

					// Walk down the tree looking for a discrepancy
					while (ap[i] === bp[i]) {
						i++;
					}

					return i ?
					// Do a sibling check if the nodes have a common ancestor
					siblingCheck(ap[i], bp[i]) :

					// Otherwise nodes in our document sort first
					ap[i] === preferredDoc ? -1 :
						bp[i] === preferredDoc ? 1 :
						0;
			};

			// Always assume the presence of duplicates if sort doesn't
			// pass them to our comparison function (as in Google Chrome).
			hasDuplicate = false;
			[0, 0].sort(sortOrder);
			support.detectDuplicates = hasDuplicate;

			return document;
		};

		Sizzle.matches = function(expr, elements) {
			return Sizzle(expr, null, null, elements);
		};

		Sizzle.matchesSelector = function(elem, expr) {
			// Set document vars if needed
			if ((elem.ownerDocument || elem) !== document) {
				setDocument(elem);
			}

			// Make sure that attribute selectors are quoted
			expr = expr.replace(rattributeQuotes, "='$1']");

			// rbuggyQSA always contains :focus, so no need for an existence check
			if (support.matchesSelector && !documentIsXML && (!rbuggyMatches || !rbuggyMatches.test(expr)) && !rbuggyQSA.test(expr)) {
				try {
					var ret = matches.call(elem, expr);

					// IE 9's matchesSelector returns false on disconnected nodes
					if (ret || support.disconnectedMatch ||
						// As well, disconnected nodes are said to be in a document
						// fragment in IE 9
						elem.document && elem.document.nodeType !== 11) {
						return ret;
					}
				} catch (e) {}
			}

			return Sizzle(expr, document, null, [elem]).length > 0;
		};

		Sizzle.contains = function(context, elem) {
			// Set document vars if needed
			if ((context.ownerDocument || context) !== document) {
				setDocument(context);
			}
			return contains(context, elem);
		};

		Sizzle.attr = function(elem, name) {
			var val;

			// Set document vars if needed
			if ((elem.ownerDocument || elem) !== document) {
				setDocument(elem);
			}

			if (!documentIsXML) {
				name = name.toLowerCase();
			}
			if ((val = Expr.attrHandle[name])) {
				return val(elem);
			}
			if (documentIsXML || support.attributes) {
				return elem.getAttribute(name);
			}
			return ((val = elem.getAttributeNode(name)) || elem.getAttribute(name)) && elem[name] === true ?
				name :
				val && val.specified ? val.value : null;
		};

		Sizzle.error = function(msg) {
			throw new Error("Syntax error, unrecognized expression: " + msg);
		};

		// Document sorting and removing duplicates
		Sizzle.uniqueSort = function(results) {
			var elem,
				duplicates = [],
				i = 1,
				j = 0;

			// Unless we *know* we can detect duplicates, assume their presence
			hasDuplicate = !support.detectDuplicates;
			results.sort(sortOrder);

			if (hasDuplicate) {
				for (;
					(elem = results[i]); i++) {
					if (elem === results[i - 1]) {
						j = duplicates.push(i);
					}
				}
				while (j--) {
					results.splice(duplicates[j], 1);
				}
			}

			return results;
		};

		function siblingCheck(a, b) {
			var cur = b && a,
				diff = cur && (~b.sourceIndex || MAX_NEGATIVE) - (~a.sourceIndex || MAX_NEGATIVE);

			// Use IE sourceIndex if available on both nodes
			if (diff) {
				return diff;
			}

			// Check if b follows a
			if (cur) {
				while ((cur = cur.nextSibling)) {
					if (cur === b) {
						return -1;
					}
				}
			}

			return a ? 1 : -1;
		}

		// Returns a function to use in pseudos for input types

		function createInputPseudo(type) {
			return function(elem) {
				var name = elem.nodeName.toLowerCase();
				return name === "input" && elem.type === type;
			};
		}

		// Returns a function to use in pseudos for buttons

		function createButtonPseudo(type) {
			return function(elem) {
				var name = elem.nodeName.toLowerCase();
				return (name === "input" || name === "button") && elem.type === type;
			};
		}

		// Returns a function to use in pseudos for positionals

		function createPositionalPseudo(fn) {
			return markFunction(function(argument) {
				argument = +argument;
				return markFunction(function(seed, matches) {
					var j,
						matchIndexes = fn([], seed.length, argument),
						i = matchIndexes.length;

					// Match elements found at the specified indexes
					while (i--) {
						if (seed[(j = matchIndexes[i])]) {
							seed[j] = !(matches[j] = seed[j]);
						}
					}
				});
			});
		}

		/**
		 * Utility function for retrieving the text value of an array of DOM nodes
		 * @param {Array|Element} elem
		 */
		getText = Sizzle.getText = function(elem) {
			var node,
				ret = "",
				i = 0,
				nodeType = elem.nodeType;

			if (!nodeType) {
				// If no nodeType, this is expected to be an array
				for (;
					(node = elem[i]); i++) {
					// Do not traverse comment nodes
					ret += getText(node);
				}
			} else if (nodeType === 1 || nodeType === 9 || nodeType === 11) {
				// Use textContent for elements
				// innerText usage removed for consistency of new lines (see #11153)
				if (typeof elem.textContent === "string") {
					return elem.textContent;
				} else {
					// Traverse its children
					for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
						ret += getText(elem);
					}
				}
			} else if (nodeType === 3 || nodeType === 4) {
				return elem.nodeValue;
			}
			// Do not include comment or processing instruction nodes

			return ret;
		};

		Expr = Sizzle.selectors = {

			// Can be adjusted by the user
			cacheLength: 50,

			createPseudo: markFunction,

			match: matchExpr,

			find: {},

			relative: {
				">": {
					dir: "parentNode",
					first: true
				},
				" ": {
					dir: "parentNode"
				},
				"+": {
					dir: "previousSibling",
					first: true
				},
				"~": {
					dir: "previousSibling"
				}
			},

			preFilter: {
				"ATTR": function(match) {
					match[1] = match[1].replace(runescape, funescape);

					// Move the given value to match[3] whether quoted or unquoted
					match[3] = (match[4] || match[5] || "").replace(runescape, funescape);

					if (match[2] === "~=") {
						match[3] = " " + match[3] + " ";
					}

					return match.slice(0, 4);
				},

				"CHILD": function(match) {
					/* matches from matchExpr["CHILD"]
                1 type (only|nth|...)
                2 what (child|of-type)
                3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
                4 xn-component of xn+y argument ([+-]?\d*n|)
                5 sign of xn-component
                6 x of xn-component
                7 sign of y-component
                8 y of y-component
            */
					match[1] = match[1].toLowerCase();

					if (match[1].slice(0, 3) === "nth") {
						// nth-* requires argument
						if (!match[3]) {
							Sizzle.error(match[0]);
						}

						// numeric x and y parameters for Expr.filter.CHILD
						// remember that false/true cast respectively to 0/1
						match[4] = +(match[4] ? match[5] + (match[6] || 1) : 2 * (match[3] === "even" || match[3] === "odd"));
						match[5] = +((match[7] + match[8]) || match[3] === "odd");

						// other types prohibit arguments
					} else if (match[3]) {
						Sizzle.error(match[0]);
					}

					return match;
				},

				"PSEUDO": function(match) {
					var excess,
						unquoted = !match[5] && match[2];

					if (matchExpr["CHILD"].test(match[0])) {
						return null;
					}

					// Accept quoted arguments as-is
					if (match[4]) {
						match[2] = match[4];

						// Strip excess characters from unquoted arguments
					} else if (unquoted && rpseudo.test(unquoted) &&
						// Get excess from tokenize (recursively)
						(excess = tokenize(unquoted, true)) &&
						// advance to the next closing parenthesis
						(excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) {

						// excess is a negative index
						match[0] = match[0].slice(0, excess);
						match[2] = unquoted.slice(0, excess);
					}

					// Return only captures needed by the pseudo filter method (type and argument)
					return match.slice(0, 3);
				}
			},

			filter: {

				"TAG": function(nodeName) {
					if (nodeName === "*") {
						return function() {
							return true;
						};
					}

					nodeName = nodeName.replace(runescape, funescape).toLowerCase();
					return function(elem) {
						return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
					};
				},

				"CLASS": function(className) {
					var pattern = classCache[className + " "];

					return pattern ||
						(pattern = new RegExp("(^|" + whitespace + ")" + className + "(" + whitespace + "|$)")) &&
						classCache(className, function(elem) {
							return pattern.test(elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "");
						});
				},

				"ATTR": function(name, operator, check) {
					return function(elem) {
						var result = Sizzle.attr(elem, name);

						if (result == null) {
							return operator === "!=";
						}
						if (!operator) {
							return true;
						}

						result += "";

						return operator === "=" ? result === check :
							operator === "!=" ? result !== check :
							operator === "^=" ? check && result.indexOf(check) === 0 :
							operator === "*=" ? check && result.indexOf(check) > -1 :
							operator === "$=" ? check && result.slice(-check.length) === check :
							operator === "~=" ? (" " + result + " ").indexOf(check) > -1 :
							operator === "|=" ? result === check || result.slice(0, check.length + 1) === check + "-" :
							false;
					};
				},

				"CHILD": function(type, what, argument, first, last) {
					var simple = type.slice(0, 3) !== "nth",
						forward = type.slice(-4) !== "last",
						ofType = what === "of-type";

					return first === 1 && last === 0 ?

					// Shortcut for :nth-*(n)

					function(elem) {
						return !!elem.parentNode;
					} :

					function(elem, context, xml) {
						var cache, outerCache, node, diff, nodeIndex, start,
							dir = simple !== forward ? "nextSibling" : "previousSibling",
							parent = elem.parentNode,
							name = ofType && elem.nodeName.toLowerCase(),
							useCache = !xml && !ofType;

						if (parent) {

							// :(first|last|only)-(child|of-type)
							if (simple) {
								while (dir) {
									node = elem;
									while ((node = node[dir])) {
										if (ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) {
											return false;
										}
									}
									// Reverse direction for :only-* (if we haven't yet done so)
									start = dir = type === "only" && !start && "nextSibling";
								}
								return true;
							}

							start = [forward ? parent.firstChild : parent.lastChild];

							// non-xml :nth-child(...) stores cache data on `parent`
							if (forward && useCache) {
								// Seek `elem` from a previously-cached index
								outerCache = parent[expando] || (parent[expando] = {});
								cache = outerCache[type] || [];
								nodeIndex = cache[0] === dirruns && cache[1];
								diff = cache[0] === dirruns && cache[2];
								node = nodeIndex && parent.childNodes[nodeIndex];

								while ((node = ++nodeIndex && node && node[dir] ||

									// Fallback to seeking `elem` from the start
									(diff = nodeIndex = 0) || start.pop())) {

									// When found, cache indexes on `parent` and break
									if (node.nodeType === 1 && ++diff && node === elem) {
										outerCache[type] = [dirruns, nodeIndex, diff];
										break;
									}
								}

								// Use previously-cached element index if available
							} else if (useCache && (cache = (elem[expando] || (elem[expando] = {}))[type]) && cache[0] === dirruns) {
								diff = cache[1];

								// xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...)
							} else {
								// Use the same loop as above to seek `elem` from the start
								while ((node = ++nodeIndex && node && node[dir] ||
									(diff = nodeIndex = 0) || start.pop())) {

									if ((ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) && ++diff) {
										// Cache the index of each encountered element
										if (useCache) {
											(node[expando] || (node[expando] = {}))[type] = [dirruns, diff];
										}

										if (node === elem) {
											break;
										}
									}
								}
							}

							// Incorporate the offset, then check against cycle size
							diff -= last;
							return diff === first || (diff % first === 0 && diff / first >= 0);
						}
					};
				},

				"PSEUDO": function(pseudo, argument) {
					// pseudo-class names are case-insensitive
					// http://www.w3.org/TR/selectors/#pseudo-classes
					// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
					// Remember that setFilters inherits from pseudos
					var args,
						fn = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] ||
							Sizzle.error("unsupported pseudo: " + pseudo);

					// The user may use createPseudo to indicate that
					// arguments are needed to create the filter function
					// just as Sizzle does
					if (fn[expando]) {
						return fn(argument);
					}

					// But maintain support for old signatures
					if (fn.length > 1) {
						args = [pseudo, pseudo, "", argument];
						return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ?
							markFunction(function(seed, matches) {
								var idx,
									matched = fn(seed, argument),
									i = matched.length;
								while (i--) {
									idx = indexOf.call(seed, matched[i]);
									seed[idx] = !(matches[idx] = matched[i]);
								}
							}) :
							function(elem) {
								return fn(elem, 0, args);
						};
					}

					return fn;
				}
			},

			pseudos: {
				// Potentially complex pseudos
				"not": markFunction(function(selector) {
					// Trim the selector passed to compile
					// to avoid treating leading and trailing
					// spaces as combinators
					var input = [],
						results = [],
						matcher = compile(selector.replace(rtrim, "$1"));

					return matcher[expando] ?
						markFunction(function(seed, matches, context, xml) {
							var elem,
								unmatched = matcher(seed, null, xml, []),
								i = seed.length;

							// Match elements unmatched by `matcher`
							while (i--) {
								if ((elem = unmatched[i])) {
									seed[i] = !(matches[i] = elem);
								}
							}
						}) :
						function(elem, context, xml) {
							input[0] = elem;
							matcher(input, null, xml, results);
							return !results.pop();
					};
				}),

				"has": markFunction(function(selector) {
					return function(elem) {
						return Sizzle(selector, elem).length > 0;
					};
				}),

				"contains": markFunction(function(text) {
					return function(elem) {
						return (elem.textContent || elem.innerText || getText(elem)).indexOf(text) > -1;
					};
				}),

				// "Whether an element is represented by a :lang() selector
				// is based solely on the element's language value
				// being equal to the identifier C,
				// or beginning with the identifier C immediately followed by "-".
				// The matching of C against the element's language value is performed case-insensitively.
				// The identifier C does not have to be a valid language name."
				// http://www.w3.org/TR/selectors/#lang-pseudo
				"lang": markFunction(function(lang) {
					// lang value must be a valid identifider
					if (!ridentifier.test(lang || "")) {
						Sizzle.error("unsupported lang: " + lang);
					}
					lang = lang.replace(runescape, funescape).toLowerCase();
					return function(elem) {
						var elemLang;
						do {
							if ((elemLang = documentIsXML ?
								elem.getAttribute("xml:lang") || elem.getAttribute("lang") :
								elem.lang)) {

								elemLang = elemLang.toLowerCase();
								return elemLang === lang || elemLang.indexOf(lang + "-") === 0;
							}
						} while ((elem = elem.parentNode) && elem.nodeType === 1);
						return false;
					};
				}),

				// Miscellaneous
				"target": function(elem) {
					var hash = window.location && window.location.hash;
					return hash && hash.slice(1) === elem.id;
				},

				"root": function(elem) {
					return elem === docElem;
				},

				"focus": function(elem) {
					return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !! (elem.type || elem.href || ~elem.tabIndex);
				},

				// Boolean properties
				"enabled": function(elem) {
					return elem.disabled === false;
				},

				"disabled": function(elem) {
					return elem.disabled === true;
				},

				"checked": function(elem) {
					// In CSS3, :checked should return both checked and selected elements
					// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
					var nodeName = elem.nodeName.toLowerCase();
					return (nodeName === "input" && !! elem.checked) || (nodeName === "option" && !! elem.selected);
				},

				"selected": function(elem) {
					// Accessing this property makes selected-by-default
					// options in Safari work properly
					if (elem.parentNode) {
						elem.parentNode.selectedIndex;
					}

					return elem.selected === true;
				},

				// Contents
				"empty": function(elem) {
					// http://www.w3.org/TR/selectors/#empty-pseudo
					// :empty is only affected by element nodes and content nodes(including text(3), cdata(4)),
					//   not comment, processing instructions, or others
					// Thanks to Diego Perini for the nodeName shortcut
					//   Greater than "@" means alpha characters (specifically not starting with "#" or "?")
					for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
						if (elem.nodeName > "@" || elem.nodeType === 3 || elem.nodeType === 4) {
							return false;
						}
					}
					return true;
				},

				"parent": function(elem) {
					return !Expr.pseudos["empty"](elem);
				},

				// Element/input types
				"header": function(elem) {
					return rheader.test(elem.nodeName);
				},

				"input": function(elem) {
					return rinputs.test(elem.nodeName);
				},

				"button": function(elem) {
					var name = elem.nodeName.toLowerCase();
					return name === "input" && elem.type === "button" || name === "button";
				},

				"text": function(elem) {
					var attr;
					// IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
					// use getAttribute instead to test this case
					return elem.nodeName.toLowerCase() === "input" &&
						elem.type === "text" &&
						((attr = elem.getAttribute("type")) == null || attr.toLowerCase() === elem.type);
				},

				// Position-in-collection
				"first": createPositionalPseudo(function() {
					return [0];
				}),

				"last": createPositionalPseudo(function(matchIndexes, length) {
					return [length - 1];
				}),

				"eq": createPositionalPseudo(function(matchIndexes, length, argument) {
					return [argument < 0 ? argument + length : argument];
				}),

				"even": createPositionalPseudo(function(matchIndexes, length) {
					var i = 0;
					for (; i < length; i += 2) {
						matchIndexes.push(i);
					}
					return matchIndexes;
				}),

				"odd": createPositionalPseudo(function(matchIndexes, length) {
					var i = 1;
					for (; i < length; i += 2) {
						matchIndexes.push(i);
					}
					return matchIndexes;
				}),

				"lt": createPositionalPseudo(function(matchIndexes, length, argument) {
					var i = argument < 0 ? argument + length : argument;
					for (; --i >= 0;) {
						matchIndexes.push(i);
					}
					return matchIndexes;
				}),

				"gt": createPositionalPseudo(function(matchIndexes, length, argument) {
					var i = argument < 0 ? argument + length : argument;
					for (; ++i < length;) {
						matchIndexes.push(i);
					}
					return matchIndexes;
				})
			}
		};

		// Add button/input type pseudos
		for (i in {
			radio: true,
			checkbox: true,
			file: true,
			password: true,
			image: true
		}) {
			Expr.pseudos[i] = createInputPseudo(i);
		}
		for (i in {
			submit: true,
			reset: true
		}) {
			Expr.pseudos[i] = createButtonPseudo(i);
		}

		function tokenize(selector, parseOnly) {
			var matched, match, tokens, type,
				soFar, groups, preFilters,
				cached = tokenCache[selector + " "];

			if (cached) {
				return parseOnly ? 0 : cached.slice(0);
			}

			soFar = selector;
			groups = [];
			preFilters = Expr.preFilter;

			while (soFar) {

				// Comma and first run
				if (!matched || (match = rcomma.exec(soFar))) {
					if (match) {
						// Don't consume trailing commas as valid
						soFar = soFar.slice(match[0].length) || soFar;
					}
					groups.push(tokens = []);
				}

				matched = false;

				// Combinators
				if ((match = rcombinators.exec(soFar))) {
					matched = match.shift();
					tokens.push({
						value: matched,
						// Cast descendant combinators to space
						type: match[0].replace(rtrim, " ")
					});
					soFar = soFar.slice(matched.length);
				}

				// Filters
				for (type in Expr.filter) {
					if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] ||
						(match = preFilters[type](match)))) {
						matched = match.shift();
						tokens.push({
							value: matched,
							type: type,
							matches: match
						});
						soFar = soFar.slice(matched.length);
					}
				}

				if (!matched) {
					break;
				}
			}

			// Return the length of the invalid excess
			// if we're just parsing
			// Otherwise, throw an error or return tokens
			return parseOnly ?
				soFar.length :
				soFar ?
				Sizzle.error(selector) :
			// Cache the tokens
			tokenCache(selector, groups).slice(0);
		}

		function toSelector(tokens) {
			var i = 0,
				len = tokens.length,
				selector = "";
			for (; i < len; i++) {
				selector += tokens[i].value;
			}
			return selector;
		}

		function addCombinator(matcher, combinator, base) {
			var dir = combinator.dir,
				checkNonElements = base && dir === "parentNode",
				doneName = done++;

			return combinator.first ?
			// Check against closest ancestor/preceding element

			function(elem, context, xml) {
				while ((elem = elem[dir])) {
					if (elem.nodeType === 1 || checkNonElements) {
						return matcher(elem, context, xml);
					}
				}
			} :

			// Check against all ancestor/preceding elements

			function(elem, context, xml) {
				var data, cache, outerCache,
					dirkey = dirruns + " " + doneName;

				// We can't set arbitrary data on XML nodes, so they don't benefit from dir caching
				if (xml) {
					while ((elem = elem[dir])) {
						if (elem.nodeType === 1 || checkNonElements) {
							if (matcher(elem, context, xml)) {
								return true;
							}
						}
					}
				} else {
					while ((elem = elem[dir])) {
						if (elem.nodeType === 1 || checkNonElements) {
							outerCache = elem[expando] || (elem[expando] = {});
							if ((cache = outerCache[dir]) && cache[0] === dirkey) {
								if ((data = cache[1]) === true || data === cachedruns) {
									return data === true;
								}
							} else {
								cache = outerCache[dir] = [dirkey];
								cache[1] = matcher(elem, context, xml) || cachedruns;
								if (cache[1] === true) {
									return true;
								}
							}
						}
					}
				}
			};
		}

		function elementMatcher(matchers) {
			return matchers.length > 1 ?
				function(elem, context, xml) {
					var i = matchers.length;
					while (i--) {
						if (!matchers[i](elem, context, xml)) {
							return false;
						}
					}
					return true;
			} :
				matchers[0];
		}

		function condense(unmatched, map, filter, context, xml) {
			var elem,
				newUnmatched = [],
				i = 0,
				len = unmatched.length,
				mapped = map != null;

			for (; i < len; i++) {
				if ((elem = unmatched[i])) {
					if (!filter || filter(elem, context, xml)) {
						newUnmatched.push(elem);
						if (mapped) {
							map.push(i);
						}
					}
				}
			}

			return newUnmatched;
		}

		function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) {
			if (postFilter && !postFilter[expando]) {
				postFilter = setMatcher(postFilter);
			}
			if (postFinder && !postFinder[expando]) {
				postFinder = setMatcher(postFinder, postSelector);
			}
			return markFunction(function(seed, results, context, xml) {
				var temp, i, elem,
					preMap = [],
					postMap = [],
					preexisting = results.length,

					// Get initial elements from seed or context
					elems = seed || multipleContexts(selector || "*", context.nodeType ? [context] : context, []),

					// Prefilter to get matcher input, preserving a map for seed-results synchronization
					matcherIn = preFilter && (seed || !selector) ?
						condense(elems, preMap, preFilter, context, xml) :
						elems,

					matcherOut = matcher ?
					// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
					postFinder || (seed ? preFilter : preexisting || postFilter) ?

					// ...intermediate processing is necessary
					[] :

					// ...otherwise use results directly
					results :
						matcherIn;

				// Find primary matches
				if (matcher) {
					matcher(matcherIn, matcherOut, context, xml);
				}

				// Apply postFilter
				if (postFilter) {
					temp = condense(matcherOut, postMap);
					postFilter(temp, [], context, xml);

					// Un-match failing elements by moving them back to matcherIn
					i = temp.length;
					while (i--) {
						if ((elem = temp[i])) {
							matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem);
						}
					}
				}

				if (seed) {
					if (postFinder || preFilter) {
						if (postFinder) {
							// Get the final matcherOut by condensing this intermediate into postFinder contexts
							temp = [];
							i = matcherOut.length;
							while (i--) {
								if ((elem = matcherOut[i])) {
									// Restore matcherIn since elem is not yet a final match
									temp.push((matcherIn[i] = elem));
								}
							}
							postFinder(null, (matcherOut = []), temp, xml);
						}

						// Move matched elements from seed to results to keep them synchronized
						i = matcherOut.length;
						while (i--) {
							if ((elem = matcherOut[i]) &&
								(temp = postFinder ? indexOf.call(seed, elem) : preMap[i]) > -1) {

								seed[temp] = !(results[temp] = elem);
							}
						}
					}

					// Add elements to results, through postFinder if defined
				} else {
					matcherOut = condense(
						matcherOut === results ?
						matcherOut.splice(preexisting, matcherOut.length) :
						matcherOut
					);
					if (postFinder) {
						postFinder(null, results, matcherOut, xml);
					} else {
						push.apply(results, matcherOut);
					}
				}
			});
		}

		function matcherFromTokens(tokens) {
			var checkContext, matcher, j,
				len = tokens.length,
				leadingRelative = Expr.relative[tokens[0].type],
				implicitRelative = leadingRelative || Expr.relative[" "],
				i = leadingRelative ? 1 : 0,

				// The foundational matcher ensures that elements are reachable from top-level context(s)
				matchContext = addCombinator(function(elem) {
					return elem === checkContext;
				}, implicitRelative, true),
				matchAnyContext = addCombinator(function(elem) {
					return indexOf.call(checkContext, elem) > -1;
				}, implicitRelative, true),
				matchers = [
					function(elem, context, xml) {
						return (!leadingRelative && (xml || context !== outermostContext)) || (
							(checkContext = context).nodeType ?
							matchContext(elem, context, xml) :
							matchAnyContext(elem, context, xml));
					}
				];

			for (; i < len; i++) {
				if ((matcher = Expr.relative[tokens[i].type])) {
					matchers = [addCombinator(elementMatcher(matchers), matcher)];
				} else {
					matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches);

					// Return special upon seeing a positional matcher
					if (matcher[expando]) {
						// Find the next relative operator (if any) for proper handling
						j = ++i;
						for (; j < len; j++) {
							if (Expr.relative[tokens[j].type]) {
								break;
							}
						}
						return setMatcher(
							i > 1 && elementMatcher(matchers),
							i > 1 && toSelector(tokens.slice(0, i - 1)).replace(rtrim, "$1"),
							matcher,
							i < j && matcherFromTokens(tokens.slice(i, j)),
							j < len && matcherFromTokens((tokens = tokens.slice(j))),
							j < len && toSelector(tokens)
						);
					}
					matchers.push(matcher);
				}
			}

			return elementMatcher(matchers);
		}

		function matcherFromGroupMatchers(elementMatchers, setMatchers) {
			// A counter to specify which element is currently being matched
			var matcherCachedRuns = 0,
				bySet = setMatchers.length > 0,
				byElement = elementMatchers.length > 0,
				superMatcher = function(seed, context, xml, results, expandContext) {
					var elem, j, matcher,
						setMatched = [],
						matchedCount = 0,
						i = "0",
						unmatched = seed && [],
						outermost = expandContext != null,
						contextBackup = outermostContext,
						// We must always have either seed elements or context
						elems = seed || byElement && Expr.find["TAG"]("*", expandContext && context.parentNode || context),
						// Use integer dirruns iff this is the outermost matcher
						dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1);

					if (outermost) {
						outermostContext = context !== document && context;
						cachedruns = matcherCachedRuns;
					}

					// Add elements passing elementMatchers directly to results
					// Keep `i` a string if there are no elements so `matchedCount` will be "00" below
					for (;
						(elem = elems[i]) != null; i++) {
						if (byElement && elem) {
							j = 0;
							while ((matcher = elementMatchers[j++])) {
								if (matcher(elem, context, xml)) {
									results.push(elem);
									break;
								}
							}
							if (outermost) {
								dirruns = dirrunsUnique;
								cachedruns = ++matcherCachedRuns;
							}
						}

						// Track unmatched elements for set filters
						if (bySet) {
							// They will have gone through all possible matchers
							if ((elem = !matcher && elem)) {
								matchedCount--;
							}

							// Lengthen the array for every element, matched or not
							if (seed) {
								unmatched.push(elem);
							}
						}
					}

					// Apply set filters to unmatched elements
					matchedCount += i;
					if (bySet && i !== matchedCount) {
						j = 0;
						while ((matcher = setMatchers[j++])) {
							matcher(unmatched, setMatched, context, xml);
						}

						if (seed) {
							// Reintegrate element matches to eliminate the need for sorting
							if (matchedCount > 0) {
								while (i--) {
									if (!(unmatched[i] || setMatched[i])) {
										setMatched[i] = pop.call(results);
									}
								}
							}

							// Discard index placeholder values to get only actual matches
							setMatched = condense(setMatched);
						}

						// Add matches to results
						push.apply(results, setMatched);

						// Seedless set matches succeeding multiple successful matchers stipulate sorting
						if (outermost && !seed && setMatched.length > 0 &&
							(matchedCount + setMatchers.length) > 1) {

							Sizzle.uniqueSort(results);
						}
					}

					// Override manipulation of globals by nested matchers
					if (outermost) {
						dirruns = dirrunsUnique;
						outermostContext = contextBackup;
					}

					return unmatched;
				};

			return bySet ?
				markFunction(superMatcher) :
				superMatcher;
		}

		compile = Sizzle.compile = function(selector, group /* Internal Use Only */ ) {
			var i,
				setMatchers = [],
				elementMatchers = [],
				cached = compilerCache[selector + " "];

			if (!cached) {
				// Generate a function of recursive functions that can be used to check each element
				if (!group) {
					group = tokenize(selector);
				}
				i = group.length;
				while (i--) {
					cached = matcherFromTokens(group[i]);
					if (cached[expando]) {
						setMatchers.push(cached);
					} else {
						elementMatchers.push(cached);
					}
				}

				// Cache the compiled function
				cached = compilerCache(selector, matcherFromGroupMatchers(elementMatchers, setMatchers));
			}
			return cached;
		};

		function multipleContexts(selector, contexts, results) {
			var i = 0,
				len = contexts.length;
			for (; i < len; i++) {
				Sizzle(selector, contexts[i], results);
			}
			return results;
		}

		function select(selector, context, results, seed) {
			var i, tokens, token, type, find,
				match = tokenize(selector);

			if (!seed) {
				// Try to minimize operations if there is only one group
				if (match.length === 1) {

					// Take a shortcut and set the context if the root selector is an ID
					tokens = match[0] = match[0].slice(0);
					if (tokens.length > 2 && (token = tokens[0]).type === "ID" &&
						context.nodeType === 9 && !documentIsXML &&
						Expr.relative[tokens[1].type]) {

						context = Expr.find["ID"](token.matches[0].replace(runescape, funescape), context)[0];
						if (!context) {
							return results;
						}

						selector = selector.slice(tokens.shift().value.length);
					}

					// Fetch a seed set for right-to-left matching
					i = matchExpr["needsContext"].test(selector) ? 0 : tokens.length;
					while (i--) {
						token = tokens[i];

						// Abort if we hit a combinator
						if (Expr.relative[(type = token.type)]) {
							break;
						}
						if ((find = Expr.find[type])) {
							// Search, expanding context for leading sibling combinators
							if ((seed = find(
								token.matches[0].replace(runescape, funescape),
								rsibling.test(tokens[0].type) && context.parentNode || context
							))) {

								// If seed is empty or no tokens remain, we can return early
								tokens.splice(i, 1);
								selector = seed.length && toSelector(tokens);
								if (!selector) {
									push.apply(results, slice.call(seed, 0));
									return results;
								}

								break;
							}
						}
					}
				}
			}

			// Compile and execute a filtering function
			// Provide `match` to avoid retokenization if we modified the selector above
			compile(selector, match)(
				seed,
				context,
				documentIsXML,
				results,
				rsibling.test(selector)
			);
			return results;
		}

		// Deprecated
		Expr.pseudos["nth"] = Expr.pseudos["eq"];

		// Easy API for creating new setFilters

		function setFilters() {}
		Expr.filters = setFilters.prototype = Expr.pseudos;
		Expr.setFilters = new setFilters();

		// Initialize with the default document
		setDocument();

		// Override sizzle attribute retrieval
		Sizzle.attr = jQuery.attr;
		jQuery.find = Sizzle;
		jQuery.expr = Sizzle.selectors;
		jQuery.expr[":"] = jQuery.expr.pseudos;
		jQuery.unique = Sizzle.uniqueSort;
		jQuery.text = Sizzle.getText;
		jQuery.isXMLDoc = Sizzle.isXML;
		jQuery.contains = Sizzle.contains;


	})(window);
	var runtil = /Until$/,
		rparentsprev = /^(?:parents|prev(?:Until|All))/,
		isSimple = /^.[^:#\[\.,]*$/,
		rneedsContext = jQuery.expr.match.needsContext,
		// methods guaranteed to produce a unique set when starting from a unique set
		guaranteedUnique = {
			children: true,
			contents: true,
			next: true,
			prev: true
		};

	jQuery.fn.extend({
		find: function(selector) {
			var i, ret, self,
				len = this.length;

			if (typeof selector !== "string") {
				self = this;
				return this.pushStack(jQuery(selector).filter(function() {
					for (i = 0; i < len; i++) {
						if (jQuery.contains(self[i], this)) {
							return true;
						}
					}
				}));
			}

			ret = [];
			for (i = 0; i < len; i++) {
				jQuery.find(selector, this[i], ret);
			}

			// Needed because $( selector, context ) becomes $( context ).find( selector )
			ret = this.pushStack(len > 1 ? jQuery.unique(ret) : ret);
			ret.selector = (this.selector ? this.selector + " " : "") + selector;
			return ret;
		},

		has: function(target) {
			var i,
				targets = jQuery(target, this),
				len = targets.length;

			return this.filter(function() {
				for (i = 0; i < len; i++) {
					if (jQuery.contains(this, targets[i])) {
						return true;
					}
				}
			});
		},

		not: function(selector) {
			return this.pushStack(winnow(this, selector, false));
		},

		filter: function(selector) {
			return this.pushStack(winnow(this, selector, true));
		},

		is: function(selector) {
			return !!selector && (
				typeof selector === "string" ?
				// If this is a positional/relative selector, check membership in the returned set
				// so $("p:first").is("p:last") won't return true for a doc with two "p".
				rneedsContext.test(selector) ?
				jQuery(selector, this.context).index(this[0]) >= 0 :
				jQuery.filter(selector, this).length > 0 :
				this.filter(selector).length > 0);
		},

		closest: function(selectors, context) {
			var cur,
				i = 0,
				l = this.length,
				ret = [],
				pos = rneedsContext.test(selectors) || typeof selectors !== "string" ?
					jQuery(selectors, context || this.context) :
					0;

			for (; i < l; i++) {
				cur = this[i];

				while (cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11) {
					if (pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors)) {
						ret.push(cur);
						break;
					}
					cur = cur.parentNode;
				}
			}

			return this.pushStack(ret.length > 1 ? jQuery.unique(ret) : ret);
		},

		// Determine the position of an element within
		// the matched set of elements
		index: function(elem) {

			// No argument, return index in parent
			if (!elem) {
				return (this[0] && this[0].parentNode) ? this.first().prevAll().length : -1;
			}

			// index in selector
			if (typeof elem === "string") {
				return jQuery.inArray(this[0], jQuery(elem));
			}

			// Locate the position of the desired element
			return jQuery.inArray(
				// If it receives a jQuery object, the first element is used
				elem.jquery ? elem[0] : elem, this);
		},

		add: function(selector, context) {
			var set = typeof selector === "string" ?
				jQuery(selector, context) :
				jQuery.makeArray(selector && selector.nodeType ? [selector] : selector),
				all = jQuery.merge(this.get(), set);

			return this.pushStack(jQuery.unique(all));
		},

		addBack: function(selector) {
			return this.add(selector == null ?
				this.prevObject : this.prevObject.filter(selector)
			);
		}
	});

	jQuery.fn.andSelf = jQuery.fn.addBack;

	function sibling(cur, dir) {
		do {
			cur = cur[dir];
		} while (cur && cur.nodeType !== 1);

		return cur;
	}

	jQuery.each({
		parent: function(elem) {
			var parent = elem.parentNode;
			return parent && parent.nodeType !== 11 ? parent : null;
		},
		parents: function(elem) {
			return jQuery.dir(elem, "parentNode");
		},
		parentsUntil: function(elem, i, until) {
			return jQuery.dir(elem, "parentNode", until);
		},
		next: function(elem) {
			return sibling(elem, "nextSibling");
		},
		prev: function(elem) {
			return sibling(elem, "previousSibling");
		},
		nextAll: function(elem) {
			return jQuery.dir(elem, "nextSibling");
		},
		prevAll: function(elem) {
			return jQuery.dir(elem, "previousSibling");
		},
		nextUntil: function(elem, i, until) {
			return jQuery.dir(elem, "nextSibling", until);
		},
		prevUntil: function(elem, i, until) {
			return jQuery.dir(elem, "previousSibling", until);
		},
		siblings: function(elem) {
			return jQuery.sibling((elem.parentNode || {}).firstChild, elem);
		},
		children: function(elem) {
			return jQuery.sibling(elem.firstChild);
		},
		contents: function(elem) {
			return jQuery.nodeName(elem, "iframe") ?
				elem.contentDocument || elem.contentWindow.document :
				jQuery.merge([], elem.childNodes);
		}
	}, function(name, fn) {
		jQuery.fn[name] = function(until, selector) {
			var ret = jQuery.map(this, fn, until);

			if (!runtil.test(name)) {
				selector = until;
			}

			if (selector && typeof selector === "string") {
				ret = jQuery.filter(selector, ret);
			}

			ret = this.length > 1 && !guaranteedUnique[name] ? jQuery.unique(ret) : ret;

			if (this.length > 1 && rparentsprev.test(name)) {
				ret = ret.reverse();
			}

			return this.pushStack(ret);
		};
	});

	jQuery.extend({
		filter: function(expr, elems, not) {
			if (not) {
				expr = ":not(" + expr + ")";
			}

			return elems.length === 1 ?
				jQuery.find.matchesSelector(elems[0], expr) ? [elems[0]] : [] :
				jQuery.find.matches(expr, elems);
		},

		dir: function(elem, dir, until) {
			var matched = [],
				cur = elem[dir];

			while (cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery(cur).is(until))) {
				if (cur.nodeType === 1) {
					matched.push(cur);
				}
				cur = cur[dir];
			}
			return matched;
		},

		sibling: function(n, elem) {
			var r = [];

			for (; n; n = n.nextSibling) {
				if (n.nodeType === 1 && n !== elem) {
					r.push(n);
				}
			}

			return r;
		}
	});

	// Implement the identical functionality for filter and not

	function winnow(elements, qualifier, keep) {

		// Can't pass null or undefined to indexOf in Firefox 4
		// Set to 0 to skip string check
		qualifier = qualifier || 0;

		if (jQuery.isFunction(qualifier)) {
			return jQuery.grep(elements, function(elem, i) {
				var retVal = !! qualifier.call(elem, i, elem);
				return retVal === keep;
			});

		} else if (qualifier.nodeType) {
			return jQuery.grep(elements, function(elem) {
				return (elem === qualifier) === keep;
			});

		} else if (typeof qualifier === "string") {
			var filtered = jQuery.grep(elements, function(elem) {
				return elem.nodeType === 1;
			});

			if (isSimple.test(qualifier)) {
				return jQuery.filter(qualifier, filtered, !keep);
			} else {
				qualifier = jQuery.filter(qualifier, filtered);
			}
		}

		return jQuery.grep(elements, function(elem) {
			return (jQuery.inArray(elem, qualifier) >= 0) === keep;
		});
	}

	function createSafeFragment(document) {
		var list = nodeNames.split("|"),
			safeFrag = document.createDocumentFragment();

		if (safeFrag.createElement) {
			while (list.length) {
				safeFrag.createElement(
					list.pop()
				);
			}
		}
		return safeFrag;
	}

	var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
		"header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
		rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g,
		rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"),
		rleadingWhitespace = /^\s+/,
		rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,
		rtagName = /<([\w:]+)/,
		rtbody = /<tbody/i,
		rhtml = /<|&#?\w+;/,
		rnoInnerhtml = /<(?:script|style|link)/i,
		manipulation_rcheckableType = /^(?:checkbox|radio)$/i,
		// checked="checked" or checked
		rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
		rscriptType = /^$|\/(?:java|ecma)script/i,
		rscriptTypeMasked = /^true\/(.*)/,
		rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,

		// We have to close these tags to support XHTML (#13200)
		wrapMap = {
			option: [1, "<select multiple='multiple'>", "</select>"],
			legend: [1, "<fieldset>", "</fieldset>"],
			area: [1, "<map>", "</map>"],
			param: [1, "<object>", "</object>"],
			thead: [1, "<table>", "</table>"],
			tr: [2, "<table><tbody>", "</tbody></table>"],
			col: [2, "<table><tbody></tbody><colgroup>", "</colgroup></table>"],
			td: [3, "<table><tbody><tr>", "</tr></tbody></table>"],

			// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,
			// unless wrapped in a div with non-breaking characters in front of it.
			_default: jQuery.support.htmlSerialize ? [0, "", ""] : [1, "X<div>", "</div>"]
		},
		safeFragment = createSafeFragment(document),
		fragmentDiv = safeFragment.appendChild(document.createElement("div"));

	wrapMap.optgroup = wrapMap.option;
	wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
	wrapMap.th = wrapMap.td;

	jQuery.fn.extend({
		text: function(value) {
			return jQuery.access(this, function(value) {
				return value === undefined ?
					jQuery.text(this) :
					this.empty().append((this[0] && this[0].ownerDocument || document).createTextNode(value));
			}, null, value, arguments.length);
		},

		wrapAll: function(html) {
			if (jQuery.isFunction(html)) {
				return this.each(function(i) {
					jQuery(this).wrapAll(html.call(this, i));
				});
			}

			if (this[0]) {
				// The elements to wrap the target around
				var wrap = jQuery(html, this[0].ownerDocument).eq(0).clone(true);

				if (this[0].parentNode) {
					wrap.insertBefore(this[0]);
				}

				wrap.map(function() {
					var elem = this;

					while (elem.firstChild && elem.firstChild.nodeType === 1) {
						elem = elem.firstChild;
					}

					return elem;
				}).append(this);
			}

			return this;
		},

		wrapInner: function(html) {
			if (jQuery.isFunction(html)) {
				return this.each(function(i) {
					jQuery(this).wrapInner(html.call(this, i));
				});
			}

			return this.each(function() {
				var self = jQuery(this),
					contents = self.contents();

				if (contents.length) {
					contents.wrapAll(html);

				} else {
					self.append(html);
				}
			});
		},

		wrap: function(html) {
			var isFunction = jQuery.isFunction(html);

			return this.each(function(i) {
				jQuery(this).wrapAll(isFunction ? html.call(this, i) : html);
			});
		},

		unwrap: function() {
			return this.parent().each(function() {
				if (!jQuery.nodeName(this, "body")) {
					jQuery(this).replaceWith(this.childNodes);
				}
			}).end();
		},

		append: function() {
			return this.domManip(arguments, true, function(elem) {
				if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
					this.appendChild(elem);
				}
			});
		},

		prepend: function() {
			return this.domManip(arguments, true, function(elem) {
				if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
					this.insertBefore(elem, this.firstChild);
				}
			});
		},

		before: function() {
			return this.domManip(arguments, false, function(elem) {
				if (this.parentNode) {
					this.parentNode.insertBefore(elem, this);
				}
			});
		},

		after: function() {
			return this.domManip(arguments, false, function(elem) {
				if (this.parentNode) {
					this.parentNode.insertBefore(elem, this.nextSibling);
				}
			});
		},

		// keepData is for internal use only--do not document
		remove: function(selector, keepData) {
			var elem,
				i = 0;

			for (;
				(elem = this[i]) != null; i++) {
				if (!selector || jQuery.filter(selector, [elem]).length > 0) {
					if (!keepData && elem.nodeType === 1) {
						jQuery.cleanData(getAll(elem));
					}

					if (elem.parentNode) {
						if (keepData && jQuery.contains(elem.ownerDocument, elem)) {
							setGlobalEval(getAll(elem, "script"));
						}
						elem.parentNode.removeChild(elem);
					}
				}
			}

			return this;
		},

		empty: function() {
			var elem,
				i = 0;

			for (;
				(elem = this[i]) != null; i++) {
				// Remove element nodes and prevent memory leaks
				if (elem.nodeType === 1) {
					jQuery.cleanData(getAll(elem, false));
				}

				// Remove any remaining nodes
				while (elem.firstChild) {
					elem.removeChild(elem.firstChild);
				}

				// If this is a select, ensure that it displays empty (#12336)
				// Support: IE<9
				if (elem.options && jQuery.nodeName(elem, "select")) {
					elem.options.length = 0;
				}
			}

			return this;
		},

		clone: function(dataAndEvents, deepDataAndEvents) {
			dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
			deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;

			return this.map(function() {
				return jQuery.clone(this, dataAndEvents, deepDataAndEvents);
			});
		},

		html: function(value) {
			return jQuery.access(this, function(value) {
				var elem = this[0] || {},
					i = 0,
					l = this.length;

				if (value === undefined) {
					return elem.nodeType === 1 ?
						elem.innerHTML.replace(rinlinejQuery, "") :
						undefined;
				}

				// See if we can take a shortcut and just use innerHTML
				if (typeof value === "string" && !rnoInnerhtml.test(value) &&
					(jQuery.support.htmlSerialize || !rnoshimcache.test(value)) &&
					(jQuery.support.leadingWhitespace || !rleadingWhitespace.test(value)) && !wrapMap[(rtagName.exec(value) || ["", ""])[1].toLowerCase()]) {

					value = value.replace(rxhtmlTag, "<$1></$2>");

					try {
						for (; i < l; i++) {
							// Remove element nodes and prevent memory leaks
							elem = this[i] || {};
							if (elem.nodeType === 1) {
								jQuery.cleanData(getAll(elem, false));
								elem.innerHTML = value;
							}
						}

						elem = 0;

						// If using innerHTML throws an exception, use the fallback method
					} catch (e) {}
				}

				if (elem) {
					this.empty().append(value);
				}
			}, null, value, arguments.length);
		},

		replaceWith: function(value) {
			var isFunc = jQuery.isFunction(value);

			// Make sure that the elements are removed from the DOM before they are inserted
			// this can help fix replacing a parent with child elements
			if (!isFunc && typeof value !== "string") {
				value = jQuery(value).not(this).detach();
			}

			return this.domManip([value], true, function(elem) {
				var next = this.nextSibling,
					parent = this.parentNode;

				if (parent) {
					jQuery(this).remove();
					parent.insertBefore(elem, next);
				}
			});
		},

		detach: function(selector) {
			return this.remove(selector, true);
		},

		domManip: function(args, table, callback) {

			// Flatten any nested arrays
			args = core_concat.apply([], args);

			var first, node, hasScripts,
				scripts, doc, fragment,
				i = 0,
				l = this.length,
				set = this,
				iNoClone = l - 1,
				value = args[0],
				isFunction = jQuery.isFunction(value);

			// We can't cloneNode fragments that contain checked, in WebKit
			if (isFunction || !(l <= 1 || typeof value !== "string" || jQuery.support.checkClone || !rchecked.test(value))) {
				return this.each(function(index) {
					var self = set.eq(index);
					if (isFunction) {
						args[0] = value.call(this, index, table ? self.html() : undefined);
					}
					self.domManip(args, table, callback);
				});
			}

			if (l) {
				fragment = jQuery.buildFragment(args, this[0].ownerDocument, false, this);
				first = fragment.firstChild;

				if (fragment.childNodes.length === 1) {
					fragment = first;
				}

				if (first) {
					table = table && jQuery.nodeName(first, "tr");
					scripts = jQuery.map(getAll(fragment, "script"), disableScript);
					hasScripts = scripts.length;

					// Use the original fragment for the last item instead of the first because it can end up
					// being emptied incorrectly in certain situations (#8070).
					for (; i < l; i++) {
						node = fragment;

						if (i !== iNoClone) {
							node = jQuery.clone(node, true, true);

							// Keep references to cloned scripts for later restoration
							if (hasScripts) {
								jQuery.merge(scripts, getAll(node, "script"));
							}
						}

						callback.call(
							table && jQuery.nodeName(this[i], "table") ?
							findOrAppend(this[i], "tbody") :
							this[i],
							node,
							i
						);
					}

					if (hasScripts) {
						doc = scripts[scripts.length - 1].ownerDocument;

						// Reenable scripts
						jQuery.map(scripts, restoreScript);

						// Evaluate executable scripts on first document insertion
						for (i = 0; i < hasScripts; i++) {
							node = scripts[i];
							if (rscriptType.test(node.type || "") && !jQuery._data(node, "globalEval") && jQuery.contains(doc, node)) {

								if (node.src) {
									// Hope ajax is available...
									jQuery.ajax({
										url: node.src,
										type: "GET",
										dataType: "script",
										async: false,
										global: false,
										"throws": true
									});
								} else {
									jQuery.globalEval((node.text || node.textContent || node.innerHTML || "").replace(rcleanScript, ""));
								}
							}
						}
					}

					// Fix #11809: Avoid leaking memory
					fragment = first = null;
				}
			}

			return this;
		}
	});

	function findOrAppend(elem, tag) {
		return elem.getElementsByTagName(tag)[0] || elem.appendChild(elem.ownerDocument.createElement(tag));
	}

	// Replace/restore the type attribute of script elements for safe DOM manipulation

	function disableScript(elem) {
		var attr = elem.getAttributeNode("type");
		elem.type = (attr && attr.specified) + "/" + elem.type;
		return elem;
	}

	function restoreScript(elem) {
		var match = rscriptTypeMasked.exec(elem.type);
		if (match) {
			elem.type = match[1];
		} else {
			elem.removeAttribute("type");
		}
		return elem;
	}

	// Mark scripts as having already been evaluated

	function setGlobalEval(elems, refElements) {
		var elem,
			i = 0;
		for (;
			(elem = elems[i]) != null; i++) {
			jQuery._data(elem, "globalEval", !refElements || jQuery._data(refElements[i], "globalEval"));
		}
	}

	function cloneCopyEvent(src, dest) {

		if (dest.nodeType !== 1 || !jQuery.hasData(src)) {
			return;
		}

		var type, i, l,
			oldData = jQuery._data(src),
			curData = jQuery._data(dest, oldData),
			events = oldData.events;

		if (events) {
			delete curData.handle;
			curData.events = {};

			for (type in events) {
				for (i = 0, l = events[type].length; i < l; i++) {
					jQuery.event.add(dest, type, events[type][i]);
				}
			}
		}

		// make the cloned public data object a copy from the original
		if (curData.data) {
			curData.data = jQuery.extend({}, curData.data);
		}
	}

	function fixCloneNodeIssues(src, dest) {
		var nodeName, e, data;

		// We do not need to do anything for non-Elements
		if (dest.nodeType !== 1) {
			return;
		}

		nodeName = dest.nodeName.toLowerCase();

		// IE6-8 copies events bound via attachEvent when using cloneNode.
		if (!jQuery.support.noCloneEvent && dest[jQuery.expando]) {
			data = jQuery._data(dest);

			for (e in data.events) {
				jQuery.removeEvent(dest, e, data.handle);
			}

			// Event data gets referenced instead of copied if the expando gets copied too
			dest.removeAttribute(jQuery.expando);
		}

		// IE blanks contents when cloning scripts, and tries to evaluate newly-set text
		if (nodeName === "script" && dest.text !== src.text) {
			disableScript(dest).text = src.text;
			restoreScript(dest);

			// IE6-10 improperly clones children of object elements using classid.
			// IE10 throws NoModificationAllowedError if parent is null, #12132.
		} else if (nodeName === "object") {
			if (dest.parentNode) {
				dest.outerHTML = src.outerHTML;
			}

			// This path appears unavoidable for IE9. When cloning an object
			// element in IE9, the outerHTML strategy above is not sufficient.
			// If the src has innerHTML and the destination does not,
			// copy the src.innerHTML into the dest.innerHTML. #10324
			if (jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML))) {
				dest.innerHTML = src.innerHTML;
			}

		} else if (nodeName === "input" && manipulation_rcheckableType.test(src.type)) {
			// IE6-8 fails to persist the checked state of a cloned checkbox
			// or radio button. Worse, IE6-7 fail to give the cloned element
			// a checked appearance if the defaultChecked value isn't also set

			dest.defaultChecked = dest.checked = src.checked;

			// IE6-7 get confused and end up setting the value of a cloned
			// checkbox/radio button to an empty string instead of "on"
			if (dest.value !== src.value) {
				dest.value = src.value;
			}

			// IE6-8 fails to return the selected option to the default selected
			// state when cloning options
		} else if (nodeName === "option") {
			dest.defaultSelected = dest.selected = src.defaultSelected;

			// IE6-8 fails to set the defaultValue to the correct value when
			// cloning other types of input fields
		} else if (nodeName === "input" || nodeName === "textarea") {
			dest.defaultValue = src.defaultValue;
		}
	}

	jQuery.each({
		appendTo: "append",
		prependTo: "prepend",
		insertBefore: "before",
		insertAfter: "after",
		replaceAll: "replaceWith"
	}, function(name, original) {
		jQuery.fn[name] = function(selector) {
			var elems,
				i = 0,
				ret = [],
				insert = jQuery(selector),
				last = insert.length - 1;

			for (; i <= last; i++) {
				elems = i === last ? this : this.clone(true);
				jQuery(insert[i])[original](elems);

				// Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get()
				core_push.apply(ret, elems.get());
			}

			return this.pushStack(ret);
		};
	});

	function getAll(context, tag) {
		var elems, elem,
			i = 0,
			found = typeof context.getElementsByTagName !== core_strundefined ? context.getElementsByTagName(tag || "*") :
				typeof context.querySelectorAll !== core_strundefined ? context.querySelectorAll(tag || "*") :
				undefined;

		if (!found) {
			for (found = [], elems = context.childNodes || context;
				(elem = elems[i]) != null; i++) {
				if (!tag || jQuery.nodeName(elem, tag)) {
					found.push(elem);
				} else {
					jQuery.merge(found, getAll(elem, tag));
				}
			}
		}

		return tag === undefined || tag && jQuery.nodeName(context, tag) ?
			jQuery.merge([context], found) :
			found;
	}

	// Used in buildFragment, fixes the defaultChecked property

	function fixDefaultChecked(elem) {
		if (manipulation_rcheckableType.test(elem.type)) {
			elem.defaultChecked = elem.checked;
		}
	}

	jQuery.extend({
		clone: function(elem, dataAndEvents, deepDataAndEvents) {
			var destElements, node, clone, i, srcElements,
				inPage = jQuery.contains(elem.ownerDocument, elem);

			if (jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test("<" + elem.nodeName + ">")) {
				clone = elem.cloneNode(true);

				// IE<=8 does not properly clone detached, unknown element nodes
			} else {
				fragmentDiv.innerHTML = elem.outerHTML;
				fragmentDiv.removeChild(clone = fragmentDiv.firstChild);
			}

			if ((!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
				(elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem)) {

				// We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2
				destElements = getAll(clone);
				srcElements = getAll(elem);

				// Fix all IE cloning issues
				for (i = 0;
					(node = srcElements[i]) != null; ++i) {
					// Ensure that the destination node is not null; Fixes #9587
					if (destElements[i]) {
						fixCloneNodeIssues(node, destElements[i]);
					}
				}
			}

			// Copy the events from the original to the clone
			if (dataAndEvents) {
				if (deepDataAndEvents) {
					srcElements = srcElements || getAll(elem);
					destElements = destElements || getAll(clone);

					for (i = 0;
						(node = srcElements[i]) != null; i++) {
						cloneCopyEvent(node, destElements[i]);
					}
				} else {
					cloneCopyEvent(elem, clone);
				}
			}

			// Preserve script evaluation history
			destElements = getAll(clone, "script");
			if (destElements.length > 0) {
				setGlobalEval(destElements, !inPage && getAll(elem, "script"));
			}

			destElements = srcElements = node = null;

			// Return the cloned set
			return clone;
		},

		buildFragment: function(elems, context, scripts, selection) {
			var j, elem, contains,
				tmp, tag, tbody, wrap,
				l = elems.length,

				// Ensure a safe fragment
				safe = createSafeFragment(context),

				nodes = [],
				i = 0;

			for (; i < l; i++) {
				elem = elems[i];

				if (elem || elem === 0) {

					// Add nodes directly
					if (jQuery.type(elem) === "object") {
						jQuery.merge(nodes, elem.nodeType ? [elem] : elem);

						// Convert non-html into a text node
					} else if (!rhtml.test(elem)) {
						nodes.push(context.createTextNode(elem));

						// Convert html into DOM nodes
					} else {
						tmp = tmp || safe.appendChild(context.createElement("div"));

						// Deserialize a standard representation
						tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase();
						wrap = wrapMap[tag] || wrapMap._default;

						tmp.innerHTML = wrap[1] + elem.replace(rxhtmlTag, "<$1></$2>") + wrap[2];

						// Descend through wrappers to the right content
						j = wrap[0];
						while (j--) {
							tmp = tmp.lastChild;
						}

						// Manually add leading whitespace removed by IE
						if (!jQuery.support.leadingWhitespace && rleadingWhitespace.test(elem)) {
							nodes.push(context.createTextNode(rleadingWhitespace.exec(elem)[0]));
						}

						// Remove IE's autoinserted <tbody> from table fragments
						if (!jQuery.support.tbody) {

							// String was a <table>, *may* have spurious <tbody>
							elem = tag === "table" && !rtbody.test(elem) ?
								tmp.firstChild :

							// String was a bare <thead> or <tfoot>
							wrap[1] === "<table>" && !rtbody.test(elem) ?
								tmp :
								0;

							j = elem && elem.childNodes.length;
							while (j--) {
								if (jQuery.nodeName((tbody = elem.childNodes[j]), "tbody") && !tbody.childNodes.length) {
									elem.removeChild(tbody);
								}
							}
						}

						jQuery.merge(nodes, tmp.childNodes);

						// Fix #12392 for WebKit and IE > 9
						tmp.textContent = "";

						// Fix #12392 for oldIE
						while (tmp.firstChild) {
							tmp.removeChild(tmp.firstChild);
						}

						// Remember the top-level container for proper cleanup
						tmp = safe.lastChild;
					}
				}
			}

			// Fix #11356: Clear elements from fragment
			if (tmp) {
				safe.removeChild(tmp);
			}

			// Reset defaultChecked for any radios and checkboxes
			// about to be appended to the DOM in IE 6/7 (#8060)
			if (!jQuery.support.appendChecked) {
				jQuery.grep(getAll(nodes, "input"), fixDefaultChecked);
			}

			i = 0;
			while ((elem = nodes[i++])) {

				// #4087 - If origin and destination elements are the same, and this is
				// that element, do not do anything
				if (selection && jQuery.inArray(elem, selection) !== -1) {
					continue;
				}

				contains = jQuery.contains(elem.ownerDocument, elem);

				// Append to fragment
				tmp = getAll(safe.appendChild(elem), "script");

				// Preserve script evaluation history
				if (contains) {
					setGlobalEval(tmp);
				}

				// Capture executables
				if (scripts) {
					j = 0;
					while ((elem = tmp[j++])) {
						if (rscriptType.test(elem.type || "")) {
							scripts.push(elem);
						}
					}
				}
			}

			tmp = null;

			return safe;
		},

		cleanData: function(elems, /* internal */ acceptData) {
			var elem, type, id, data,
				i = 0,
				internalKey = jQuery.expando,
				cache = jQuery.cache,
				deleteExpando = jQuery.support.deleteExpando,
				special = jQuery.event.special;

			for (;
				(elem = elems[i]) != null; i++) {

				if (acceptData || jQuery.acceptData(elem)) {

					id = elem[internalKey];
					data = id && cache[id];

					if (data) {
						if (data.events) {
							for (type in data.events) {
								if (special[type]) {
									jQuery.event.remove(elem, type);

									// This is a shortcut to avoid jQuery.event.remove's overhead
								} else {
									jQuery.removeEvent(elem, type, data.handle);
								}
							}
						}

						// Remove cache only if it was not already removed by jQuery.event.remove
						if (cache[id]) {

							delete cache[id];

							// IE does not allow us to delete expando properties from nodes,
							// nor does it have a removeAttribute function on Document nodes;
							// we must handle all of these cases
							if (deleteExpando) {
								delete elem[internalKey];

							} else if (typeof elem.removeAttribute !== core_strundefined) {
								elem.removeAttribute(internalKey);

							} else {
								elem[internalKey] = null;
							}

							core_deletedIds.push(id);
						}
					}
				}
			}
		}
	});
	var iframe, getStyles, curCSS,
		ralpha = /alpha\([^)]*\)/i,
		ropacity = /opacity\s*=\s*([^)]*)/,
		rposition = /^(top|right|bottom|left)$/,
		// swappable if display is none or starts with table except "table", "table-cell", or "table-caption"
		// see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
		rdisplayswap = /^(none|table(?!-c[ea]).+)/,
		rmargin = /^margin/,
		rnumsplit = new RegExp("^(" + core_pnum + ")(.*)$", "i"),
		rnumnonpx = new RegExp("^(" + core_pnum + ")(?!px)[a-z%]+$", "i"),
		rrelNum = new RegExp("^([+-])=(" + core_pnum + ")", "i"),
		elemdisplay = {
			BODY: "block"
		},

		cssShow = {
			position: "absolute",
			visibility: "hidden",
			display: "block"
		},
		cssNormalTransform = {
			letterSpacing: 0,
			fontWeight: 400
		},

		cssExpand = ["Top", "Right", "Bottom", "Left"],
		cssPrefixes = ["Webkit", "O", "Moz", "ms"];

	// return a css property mapped to a potentially vendor prefixed property

	function vendorPropName(style, name) {

		// shortcut for names that are not vendor prefixed
		if (name in style) {
			return name;
		}

		// check for vendor prefixed names
		var capName = name.charAt(0).toUpperCase() + name.slice(1),
			origName = name,
			i = cssPrefixes.length;

		while (i--) {
			name = cssPrefixes[i] + capName;
			if (name in style) {
				return name;
			}
		}

		return origName;
	}

	function isHidden(elem, el) {
		// isHidden might be called from jQuery#filter function;
		// in that case, element will be second argument
		elem = el || elem;
		return jQuery.css(elem, "display") === "none" || !jQuery.contains(elem.ownerDocument, elem);
	}

	function showHide(elements, show) {
		var display, elem, hidden,
			values = [],
			index = 0,
			length = elements.length;

		for (; index < length; index++) {
			elem = elements[index];
			if (!elem.style) {
				continue;
			}

			values[index] = jQuery._data(elem, "olddisplay");
			display = elem.style.display;
			if (show) {
				// Reset the inline display of this element to learn if it is
				// being hidden by cascaded rules or not
				if (!values[index] && display === "none") {
					elem.style.display = "";
				}

				// Set elements which have been overridden with display: none
				// in a stylesheet to whatever the default browser style is
				// for such an element
				if (elem.style.display === "" && isHidden(elem)) {
					values[index] = jQuery._data(elem, "olddisplay", css_defaultDisplay(elem.nodeName));
				}
			} else {

				if (!values[index]) {
					hidden = isHidden(elem);

					if (display && display !== "none" || !hidden) {
						jQuery._data(elem, "olddisplay", hidden ? display : jQuery.css(elem, "display"));
					}
				}
			}
		}

		// Set the display of most of the elements in a second loop
		// to avoid the constant reflow
		for (index = 0; index < length; index++) {
			elem = elements[index];
			if (!elem.style) {
				continue;
			}
			if (!show || elem.style.display === "none" || elem.style.display === "") {
				elem.style.display = show ? values[index] || "" : "none";
			}
		}

		return elements;
	}

	jQuery.fn.extend({
		css: function(name, value) {
			return jQuery.access(this, function(elem, name, value) {
				var len, styles,
					map = {},
					i = 0;

				if (jQuery.isArray(name)) {
					styles = getStyles(elem);
					len = name.length;

					for (; i < len; i++) {
						map[name[i]] = jQuery.css(elem, name[i], false, styles);
					}

					return map;
				}

				return value !== undefined ?
					jQuery.style(elem, name, value) :
					jQuery.css(elem, name);
			}, name, value, arguments.length > 1);
		},
		show: function() {
			return showHide(this, true);
		},
		hide: function() {
			return showHide(this);
		},
		toggle: function(state) {
			var bool = typeof state === "boolean";

			return this.each(function() {
				if (bool ? state : isHidden(this)) {
					jQuery(this).show();
				} else {
					jQuery(this).hide();
				}
			});
		}
	});

	jQuery.extend({
		// Add in style property hooks for overriding the default
		// behavior of getting and setting a style property
		cssHooks: {
			opacity: {
				get: function(elem, computed) {
					if (computed) {
						// We should always get a number back from opacity
						var ret = curCSS(elem, "opacity");
						return ret === "" ? "1" : ret;
					}
				}
			}
		},

		// Exclude the following css properties to add px
		cssNumber: {
			"columnCount": true,
			"fillOpacity": true,
			"fontWeight": true,
			"lineHeight": true,
			"opacity": true,
			"orphans": true,
			"widows": true,
			"zIndex": true,
			"zoom": true
		},

		// Add in properties whose names you wish to fix before
		// setting or getting the value
		cssProps: {
			// normalize float css property
			"float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
		},

		// Get and set the style property on a DOM Node
		style: function(elem, name, value, extra) {
			// Don't set styles on text and comment nodes
			if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) {
				return;
			}

			// Make sure that we're working with the right name
			var ret, type, hooks,
				origName = jQuery.camelCase(name),
				style = elem.style;

			name = jQuery.cssProps[origName] || (jQuery.cssProps[origName] = vendorPropName(style, origName));

			// gets hook for the prefixed version
			// followed by the unprefixed version
			hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];

			// Check if we're setting a value
			if (value !== undefined) {
				type = typeof value;

				// convert relative number strings (+= or -=) to relative numbers. #7345
				if (type === "string" && (ret = rrelNum.exec(value))) {
					value = (ret[1] + 1) * ret[2] + parseFloat(jQuery.css(elem, name));
					// Fixes bug #9237
					type = "number";
				}

				// Make sure that NaN and null values aren't set. See: #7116
				if (value == null || type === "number" && isNaN(value)) {
					return;
				}

				// If a number was passed in, add 'px' to the (except for certain CSS properties)
				if (type === "number" && !jQuery.cssNumber[origName]) {
					value += "px";
				}

				// Fixes #8908, it can be done more correctly by specifing setters in cssHooks,
				// but it would mean to define eight (for every problematic property) identical functions
				if (!jQuery.support.clearCloneStyle && value === "" && name.indexOf("background") === 0) {
					style[name] = "inherit";
				}

				// If a hook was provided, use that value, otherwise just set the specified value
				if (!hooks || !("set" in hooks) || (value = hooks.set(elem, value, extra)) !== undefined) {

					// Wrapped to prevent IE from throwing errors when 'invalid' values are provided
					// Fixes bug #5509
					try {
						style[name] = value;
					} catch (e) {}
				}

			} else {
				// If a hook was provided get the non-computed value from there
				if (hooks && "get" in hooks && (ret = hooks.get(elem, false, extra)) !== undefined) {
					return ret;
				}

				// Otherwise just get the value from the style object
				return style[name];
			}
		},

		css: function(elem, name, extra, styles) {
			var num, val, hooks,
				origName = jQuery.camelCase(name);

			// Make sure that we're working with the right name
			name = jQuery.cssProps[origName] || (jQuery.cssProps[origName] = vendorPropName(elem.style, origName));

			// gets hook for the prefixed version
			// followed by the unprefixed version
			hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];

			// If a hook was provided get the computed value from there
			if (hooks && "get" in hooks) {
				val = hooks.get(elem, true, extra);
			}

			// Otherwise, if a way to get the computed value exists, use that
			if (val === undefined) {
				val = curCSS(elem, name, styles);
			}

			//convert "normal" to computed value
			if (val === "normal" && name in cssNormalTransform) {
				val = cssNormalTransform[name];
			}

			// Return, converting to number if forced or a qualifier was provided and val looks numeric
			if (extra === "" || extra) {
				num = parseFloat(val);
				return extra === true || jQuery.isNumeric(num) ? num || 0 : val;
			}
			return val;
		},

		// A method for quickly swapping in/out CSS properties to get correct calculations
		swap: function(elem, options, callback, args) {
			var ret, name,
				old = {};

			// Remember the old values, and insert the new ones
			for (name in options) {
				old[name] = elem.style[name];
				elem.style[name] = options[name];
			}

			ret = callback.apply(elem, args || []);

			// Revert the old values
			for (name in options) {
				elem.style[name] = old[name];
			}

			return ret;
		}
	});

	// NOTE: we've included the "window" in window.getComputedStyle
	// because jsdom on node.js will break without it.
	if (window.getComputedStyle) {
		getStyles = function(elem) {
			return window.getComputedStyle(elem, null);
		};

		curCSS = function(elem, name, _computed) {
			var width, minWidth, maxWidth,
				computed = _computed || getStyles(elem),

				// getPropertyValue is only needed for .css('filter') in IE9, see #12537
				ret = computed ? computed.getPropertyValue(name) || computed[name] : undefined,
				style = elem.style;

			if (computed) {

				if (ret === "" && !jQuery.contains(elem.ownerDocument, elem)) {
					ret = jQuery.style(elem, name);
				}

				// A tribute to the "awesome hack by Dean Edwards"
				// Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right
				// Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels
				// this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
				if (rnumnonpx.test(ret) && rmargin.test(name)) {

					// Remember the original values
					width = style.width;
					minWidth = style.minWidth;
					maxWidth = style.maxWidth;

					// Put in the new values to get a computed value out
					style.minWidth = style.maxWidth = style.width = ret;
					ret = computed.width;

					// Revert the changed values
					style.width = width;
					style.minWidth = minWidth;
					style.maxWidth = maxWidth;
				}
			}

			return ret;
		};
	} else if (document.documentElement.currentStyle) {
		getStyles = function(elem) {
			return elem.currentStyle;
		};

		curCSS = function(elem, name, _computed) {
			var left, rs, rsLeft,
				computed = _computed || getStyles(elem),
				ret = computed ? computed[name] : undefined,
				style = elem.style;

			// Avoid setting ret to empty string here
			// so we don't default to auto
			if (ret == null && style && style[name]) {
				ret = style[name];
			}

			// From the awesome hack by Dean Edwards
			// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291

			// If we're not dealing with a regular pixel number
			// but a number that has a weird ending, we need to convert it to pixels
			// but not position css attributes, as those are proportional to the parent element instead
			// and we can't measure the parent instead because it might trigger a "stacking dolls" problem
			if (rnumnonpx.test(ret) && !rposition.test(name)) {

				// Remember the original values
				left = style.left;
				rs = elem.runtimeStyle;
				rsLeft = rs && rs.left;

				// Put in the new values to get a computed value out
				if (rsLeft) {
					rs.left = elem.currentStyle.left;
				}
				style.left = name === "fontSize" ? "1em" : ret;
				ret = style.pixelLeft + "px";

				// Revert the changed values
				style.left = left;
				if (rsLeft) {
					rs.left = rsLeft;
				}
			}

			return ret === "" ? "auto" : ret;
		};
	}

	function setPositiveNumber(elem, value, subtract) {
		var matches = rnumsplit.exec(value);
		return matches ?
		// Guard against undefined "subtract", e.g., when used as in cssHooks
		Math.max(0, matches[1] - (subtract || 0)) + (matches[2] || "px") :
			value;
	}

	function augmentWidthOrHeight(elem, name, extra, isBorderBox, styles) {
		var i = extra === (isBorderBox ? "border" : "content") ?
		// If we already have the right measurement, avoid augmentation
		4 :
		// Otherwise initialize for horizontal or vertical properties
		name === "width" ? 1 : 0,

			val = 0;

		for (; i < 4; i += 2) {
			// both box models exclude margin, so add it if we want it
			if (extra === "margin") {
				val += jQuery.css(elem, extra + cssExpand[i], true, styles);
			}

			if (isBorderBox) {
				// border-box includes padding, so remove it if we want content
				if (extra === "content") {
					val -= jQuery.css(elem, "padding" + cssExpand[i], true, styles);
				}

				// at this point, extra isn't border nor margin, so remove border
				if (extra !== "margin") {
					val -= jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
				}
			} else {
				// at this point, extra isn't content, so add padding
				val += jQuery.css(elem, "padding" + cssExpand[i], true, styles);

				// at this point, extra isn't content nor padding, so add border
				if (extra !== "padding") {
					val += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
				}
			}
		}

		return val;
	}

	function getWidthOrHeight(elem, name, extra) {

		// Start with offset property, which is equivalent to the border-box value
		var valueIsBorderBox = true,
			val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
			styles = getStyles(elem),
			isBorderBox = jQuery.support.boxSizing && jQuery.css(elem, "boxSizing", false, styles) === "border-box";

		// some non-html elements return undefined for offsetWidth, so check for null/undefined
		// svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285
		// MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668
		if (val <= 0 || val == null) {
			// Fall back to computed then uncomputed css if necessary
			val = curCSS(elem, name, styles);
			if (val < 0 || val == null) {
				val = elem.style[name];
			}

			// Computed unit is not pixels. Stop here and return.
			if (rnumnonpx.test(val)) {
				return val;
			}

			// we need the check for style in case a browser which returns unreliable values
			// for getComputedStyle silently falls back to the reliable elem.style
			valueIsBorderBox = isBorderBox && (jQuery.support.boxSizingReliable || val === elem.style[name]);

			// Normalize "", auto, and prepare for extra
			val = parseFloat(val) || 0;
		}

		// use the active box-sizing model to add/subtract irrelevant styles
		return (val +
			augmentWidthOrHeight(
				elem,
				name,
				extra || (isBorderBox ? "border" : "content"),
				valueIsBorderBox,
				styles
			)
		) + "px";
	}

	// Try to determine the default display value of an element

	function css_defaultDisplay(nodeName) {
		var doc = document,
			display = elemdisplay[nodeName];

		if (!display) {
			display = actualDisplay(nodeName, doc);

			// If the simple way fails, read from inside an iframe
			if (display === "none" || !display) {
				// Use the already-created iframe if possible
				iframe = (iframe ||
					jQuery("<iframe frameborder='0' width='0' height='0'/>")
					.css("cssText", "display:block !important")
				).appendTo(doc.documentElement);

				// Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse
				doc = (iframe[0].contentWindow || iframe[0].contentDocument).document;
				doc.write("<!doctype html><html><body>");
				doc.close();

				display = actualDisplay(nodeName, doc);
				iframe.detach();
			}

			// Store the correct default display
			elemdisplay[nodeName] = display;
		}

		return display;
	}

	// Called ONLY from within css_defaultDisplay

	function actualDisplay(name, doc) {
		var elem = jQuery(doc.createElement(name)).appendTo(doc.body),
			display = jQuery.css(elem[0], "display");
		elem.remove();
		return display;
	}

	jQuery.each(["height", "width"], function(i, name) {
		jQuery.cssHooks[name] = {
			get: function(elem, computed, extra) {
				if (computed) {
					// certain elements can have dimension info if we invisibly show them
					// however, it must have a current display style that would benefit from this
					return elem.offsetWidth === 0 && rdisplayswap.test(jQuery.css(elem, "display")) ?
						jQuery.swap(elem, cssShow, function() {
							return getWidthOrHeight(elem, name, extra);
						}) :
						getWidthOrHeight(elem, name, extra);
				}
			},

			set: function(elem, value, extra) {
				var styles = extra && getStyles(elem);
				return setPositiveNumber(elem, value, extra ?
					augmentWidthOrHeight(
						elem,
						name,
						extra,
						jQuery.support.boxSizing && jQuery.css(elem, "boxSizing", false, styles) === "border-box",
						styles
					) : 0
				);
			}
		};
	});

	if (!jQuery.support.opacity) {
		jQuery.cssHooks.opacity = {
			get: function(elem, computed) {
				// IE uses filters for opacity
				return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ?
					(0.01 * parseFloat(RegExp.$1)) + "" :
					computed ? "1" : "";
			},

			set: function(elem, value) {
				var style = elem.style,
					currentStyle = elem.currentStyle,
					opacity = jQuery.isNumeric(value) ? "alpha(opacity=" + value * 100 + ")" : "",
					filter = currentStyle && currentStyle.filter || style.filter || "";

				// IE has trouble with opacity if it does not have layout
				// Force it by setting the zoom level
				style.zoom = 1;

				// if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
				// if value === "", then remove inline opacity #12685
				if ((value >= 1 || value === "") &&
					jQuery.trim(filter.replace(ralpha, "")) === "" &&
					style.removeAttribute) {

					// Setting style.filter to null, "" & " " still leave "filter:" in the cssText
					// if "filter:" is present at all, clearType is disabled, we want to avoid this
					// style.removeAttribute is IE Only, but so apparently is this code path...
					style.removeAttribute("filter");

					// if there is no filter style applied in a css rule or unset inline opacity, we are done
					if (value === "" || currentStyle && !currentStyle.filter) {
						return;
					}
				}

				// otherwise, set new filter values
				style.filter = ralpha.test(filter) ?
					filter.replace(ralpha, opacity) :
					filter + " " + opacity;
			}
		};
	}

	// These hooks cannot be added until DOM ready because the support test
	// for it is not run until after DOM ready
	jQuery(function() {
		if (!jQuery.support.reliableMarginRight) {
			jQuery.cssHooks.marginRight = {
				get: function(elem, computed) {
					if (computed) {
						// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
						// Work around by temporarily setting element display to inline-block
						return jQuery.swap(elem, {
								"display": "inline-block"
							},
							curCSS, [elem, "marginRight"]);
					}
				}
			};
		}

		// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
		// getComputedStyle returns percent when specified for top/left/bottom/right
		// rather than make the css module depend on the offset module, we just check for it here
		if (!jQuery.support.pixelPosition && jQuery.fn.position) {
			jQuery.each(["top", "left"], function(i, prop) {
				jQuery.cssHooks[prop] = {
					get: function(elem, computed) {
						if (computed) {
							computed = curCSS(elem, prop);
							// if curCSS returns percentage, fallback to offset
							return rnumnonpx.test(computed) ?
								jQuery(elem).position()[prop] + "px" :
								computed;
						}
					}
				};
			});
		}

	});

	if (jQuery.expr && jQuery.expr.filters) {
		jQuery.expr.filters.hidden = function(elem) {
			// Support: Opera <= 12.12
			// Opera reports offsetWidths and offsetHeights less than zero on some elements
			return elem.offsetWidth <= 0 && elem.offsetHeight <= 0 ||
				(!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css(elem, "display")) === "none");
		};

		jQuery.expr.filters.visible = function(elem) {
			return !jQuery.expr.filters.hidden(elem);
		};
	}

	// These hooks are used by animate to expand properties
	jQuery.each({
		margin: "",
		padding: "",
		border: "Width"
	}, function(prefix, suffix) {
		jQuery.cssHooks[prefix + suffix] = {
			expand: function(value) {
				var i = 0,
					expanded = {},

					// assumes a single number if not a string
					parts = typeof value === "string" ? value.split(" ") : [value];

				for (; i < 4; i++) {
					expanded[prefix + cssExpand[i] + suffix] =
						parts[i] || parts[i - 2] || parts[0];
				}

				return expanded;
			}
		};

		if (!rmargin.test(prefix)) {
			jQuery.cssHooks[prefix + suffix].set = setPositiveNumber;
		}
	});
	var r20 = /%20/g,
		rbracket = /\[\]$/,
		rCRLF = /\r?\n/g,
		rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
		rsubmittable = /^(?:input|select|textarea|keygen)/i;

	jQuery.fn.extend({
		serialize: function() {
			return jQuery.param(this.serializeArray());
		},
		serializeArray: function() {
			return this.map(function() {
				// Can add propHook for "elements" to filter or add form elements
				var elements = jQuery.prop(this, "elements");
				return elements ? jQuery.makeArray(elements) : this;
			})
				.filter(function() {
					var type = this.type;
					// Use .is(":disabled") so that fieldset[disabled] works
					return this.name && !jQuery(this).is(":disabled") &&
						rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) &&
						(this.checked || !manipulation_rcheckableType.test(type));
				})
				.map(function(i, elem) {
					var val = jQuery(this).val();

					return val == null ?
						null :
						jQuery.isArray(val) ?
						jQuery.map(val, function(val) {
							return {
								name: elem.name,
								value: val.replace(rCRLF, "\r\n")
							};
						}) : {
							name: elem.name,
							value: val.replace(rCRLF, "\r\n")
					};
				}).get();
		}
	});

	//Serialize an array of form elements or a set of
	//key/values into a query string
	jQuery.param = function(a, traditional) {
		var prefix,
			s = [],
			add = function(key, value) {
				// If value is a function, invoke it and return its value
				value = jQuery.isFunction(value) ? value() : (value == null ? "" : value);
				s[s.length] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
			};

		// Set traditional to true for jQuery <= 1.3.2 behavior.
		if (traditional === undefined) {
			traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
		}

		// If an array was passed in, assume that it is an array of form elements.
		if (jQuery.isArray(a) || (a.jquery && !jQuery.isPlainObject(a))) {
			// Serialize the form elements
			jQuery.each(a, function() {
				add(this.name, this.value);
			});

		} else {
			// If traditional, encode the "old" way (the way 1.3.2 or older
			// did it), otherwise encode params recursively.
			for (prefix in a) {
				buildParams(prefix, a[prefix], traditional, add);
			}
		}

		// Return the resulting serialization
		return s.join("&").replace(r20, "+");
	};

	function buildParams(prefix, obj, traditional, add) {
		var name;

		if (jQuery.isArray(obj)) {
			// Serialize array item.
			jQuery.each(obj, function(i, v) {
				if (traditional || rbracket.test(prefix)) {
					// Treat each array item as a scalar.
					add(prefix, v);

				} else {
					// Item is non-scalar (array or object), encode its numeric index.
					buildParams(prefix + "[" + (typeof v === "object" ? i : "") + "]", v, traditional, add);
				}
			});

		} else if (!traditional && jQuery.type(obj) === "object") {
			// Serialize object item.
			for (name in obj) {
				buildParams(prefix + "[" + name + "]", obj[name], traditional, add);
			}

		} else {
			// Serialize scalar item.
			add(prefix, obj);
		}
	}
	jQuery.each(("blur focus focusin focusout load resize scroll unload click dblclick " +
		"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
		"change select submit keydown keypress keyup error contextmenu").split(" "), function(i, name) {

		// Handle event binding
		jQuery.fn[name] = function(data, fn) {
			return arguments.length > 0 ?
				this.on(name, null, data, fn) :
				this.trigger(name);
		};
	});

	jQuery.fn.hover = function(fnOver, fnOut) {
		return this.mouseenter(fnOver).mouseleave(fnOut || fnOver);
	};
	var
	// Document location
	ajaxLocParts,
		ajaxLocation,
		ajax_nonce = jQuery.now(),

		ajax_rquery = /\?/,
		rhash = /#.*$/,
		rts = /([?&])_=[^&]*/,
		rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
		// #7653, #8125, #8152: local protocol detection
		rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
		rnoContent = /^(?:GET|HEAD)$/,
		rprotocol = /^\/\//,
		rurl = /^([\w.+-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,

		// Keep a copy of the old load method
		_load = jQuery.fn.load,

		/* Prefilters
		 * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
		 * 2) These are called:
		 *    - BEFORE asking for a transport
		 *    - AFTER param serialization (s.data is a string if s.processData is true)
		 * 3) key is the dataType
		 * 4) the catchall symbol "*" can be used
		 * 5) execution will start with transport dataType and THEN continue down to "*" if needed
		 */
		prefilters = {},

		/* Transports bindings
		 * 1) key is the dataType
		 * 2) the catchall symbol "*" can be used
		 * 3) selection will start with transport dataType and THEN go to "*" if needed
		 */
		transports = {},

		// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
		allTypes = "*/".concat("*");

	// #8138, IE may throw an exception when accessing
	// a field from window.location if document.domain has been set
	try {
		ajaxLocation = location.href;
	} catch (e) {
		// Use the href attribute of an A element
		// since IE will modify it given document.location
		ajaxLocation = document.createElement("a");
		ajaxLocation.href = "";
		ajaxLocation = ajaxLocation.href;
	}

	// Segment location into parts
	ajaxLocParts = rurl.exec(ajaxLocation.toLowerCase()) || [];

	// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport

	function addToPrefiltersOrTransports(structure) {

		// dataTypeExpression is optional and defaults to "*"
		return function(dataTypeExpression, func) {

			if (typeof dataTypeExpression !== "string") {
				func = dataTypeExpression;
				dataTypeExpression = "*";
			}

			var dataType,
				i = 0,
				dataTypes = dataTypeExpression.toLowerCase().match(core_rnotwhite) || [];

			if (jQuery.isFunction(func)) {
				// For each dataType in the dataTypeExpression
				while ((dataType = dataTypes[i++])) {
					// Prepend if requested
					if (dataType[0] === "+") {
						dataType = dataType.slice(1) || "*";
						(structure[dataType] = structure[dataType] || []).unshift(func);

						// Otherwise append
					} else {
						(structure[dataType] = structure[dataType] || []).push(func);
					}
				}
			}
		};
	}

	// Base inspection function for prefilters and transports

	function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) {

		var inspected = {},
			seekingTransport = (structure === transports);

		function inspect(dataType) {
			var selected;
			inspected[dataType] = true;
			jQuery.each(structure[dataType] || [], function(_, prefilterOrFactory) {
				var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR);
				if (typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[dataTypeOrTransport]) {
					options.dataTypes.unshift(dataTypeOrTransport);
					inspect(dataTypeOrTransport);
					return false;
				} else if (seekingTransport) {
					return !(selected = dataTypeOrTransport);
				}
			});
			return selected;
		}

		return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*");
	}

	// A special extend for ajax options
	// that takes "flat" options (not to be deep extended)
	// Fixes #9887

	function ajaxExtend(target, src) {
		var deep, key,
			flatOptions = jQuery.ajaxSettings.flatOptions || {};

		for (key in src) {
			if (src[key] !== undefined) {
				(flatOptions[key] ? target : (deep || (deep = {})))[key] = src[key];
			}
		}
		if (deep) {
			jQuery.extend(true, target, deep);
		}

		return target;
	}

	jQuery.fn.load = function(url, params, callback) {
		if (typeof url !== "string" && _load) {
			return _load.apply(this, arguments);
		}

		var selector, response, type,
			self = this,
			off = url.indexOf(" ");

		if (off >= 0) {
			selector = url.slice(off, url.length);
			url = url.slice(0, off);
		}

		// If it's a function
		if (jQuery.isFunction(params)) {

			// We assume that it's the callback
			callback = params;
			params = undefined;

			// Otherwise, build a param string
		} else if (params && typeof params === "object") {
			type = "POST";
		}

		// If we have elements to modify, make the request
		if (self.length > 0) {
			jQuery.ajax({
				url: url,

				// if "type" variable is undefined, then "GET" method will be used
				type: type,
				dataType: "html",
				data: params
			}).done(function(responseText) {

				// Save response for use in complete callback
				response = arguments;

				self.html(selector ?

					// If a selector was specified, locate the right elements in a dummy div
					// Exclude scripts to avoid IE 'Permission Denied' errors
					jQuery("<div>").append(jQuery.parseHTML(responseText)).find(selector) :

					// Otherwise use the full result
					responseText);

			}).complete(callback && function(jqXHR, status) {
				self.each(callback, response || [jqXHR.responseText, status, jqXHR]);
			});
		}

		return this;
	};

	// Attach a bunch of functions for handling common AJAX events
	jQuery.each(["ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend"], function(i, type) {
		jQuery.fn[type] = function(fn) {
			return this.on(type, fn);
		};
	});

	jQuery.each(["get", "post"], function(i, method) {
		jQuery[method] = function(url, data, callback, type) {
			// shift arguments if data argument was omitted
			if (jQuery.isFunction(data)) {
				type = type || callback;
				callback = data;
				data = undefined;
			}

			return jQuery.ajax({
				url: url,
				type: method,
				dataType: type,
				data: data,
				success: callback
			});
		};
	});

	jQuery.extend({

		// Counter for holding the number of active queries
		active: 0,

		// Last-Modified header cache for next request
		lastModified: {},
		etag: {},

		ajaxSettings: {
			url: ajaxLocation,
			type: "GET",
			isLocal: rlocalProtocol.test(ajaxLocParts[1]),
			global: true,
			processData: true,
			async: true,
			contentType: "application/x-www-form-urlencoded; charset=UTF-8",
			/*
        timeout: 0,
        data: null,
        dataType: null,
        username: null,
        password: null,
        cache: null,
        throws: false,
        traditional: false,
        headers: {},
        */

			accepts: {
				"*": allTypes,
				text: "text/plain",
				html: "text/html",
				xml: "application/xml, text/xml",
				json: "application/json, text/javascript"
			},

			contents: {
				xml: /xml/,
				html: /html/,
				json: /json/
			},

			responseFields: {
				xml: "responseXML",
				text: "responseText"
			},

			// Data converters
			// Keys separate source (or catchall "*") and destination types with a single space
			converters: {

				// Convert anything to text
				"* text": window.String,

				// Text to html (true = no transformation)
				"text html": true,

				// Evaluate text as a json expression
				"text json": jQuery.parseJSON,

				// Parse text as xml
				"text xml": jQuery.parseXML
			},

			// For options that shouldn't be deep extended:
			// you can add your own custom options here if
			// and when you create one that shouldn't be
			// deep extended (see ajaxExtend)
			flatOptions: {
				url: true,
				context: true
			}
		},

		// Creates a full fledged settings object into target
		// with both ajaxSettings and settings fields.
		// If target is omitted, writes into ajaxSettings.
		ajaxSetup: function(target, settings) {
			return settings ?

			// Building a settings object
			ajaxExtend(ajaxExtend(target, jQuery.ajaxSettings), settings) :

			// Extending ajaxSettings
			ajaxExtend(jQuery.ajaxSettings, target);
		},

		ajaxPrefilter: addToPrefiltersOrTransports(prefilters),
		ajaxTransport: addToPrefiltersOrTransports(transports),

		// Main method
		ajax: function(url, options) {

			// If url is an object, simulate pre-1.5 signature
			if (typeof url === "object") {
				options = url;
				url = undefined;
			}

			// Force options to be an object
			options = options || {};

			var // Cross-domain detection vars
			parts,
				// Loop variable
				i,
				// URL without anti-cache param
				cacheURL,
				// Response headers as string
				responseHeadersString,
				// timeout handle
				timeoutTimer,

				// To know if global events are to be dispatched
				fireGlobals,

				transport,
				// Response headers
				responseHeaders,
				// Create the final options object
				s = jQuery.ajaxSetup({}, options),
				// Callbacks context
				callbackContext = s.context || s,
				// Context for global events is callbackContext if it is a DOM node or jQuery collection
				globalEventContext = s.context && (callbackContext.nodeType || callbackContext.jquery) ?
					jQuery(callbackContext) :
					jQuery.event,
				// Deferreds
				deferred = jQuery.Deferred(),
				completeDeferred = jQuery.Callbacks("once memory"),
				// Status-dependent callbacks
				statusCode = s.statusCode || {},
				// Headers (they are sent all at once)
				requestHeaders = {},
				requestHeadersNames = {},
				// The jqXHR state
				state = 0,
				// Default abort message
				strAbort = "canceled",
				// Fake xhr
				jqXHR = {
					readyState: 0,

					// Builds headers hashtable if needed
					getResponseHeader: function(key) {
						var match;
						if (state === 2) {
							if (!responseHeaders) {
								responseHeaders = {};
								while ((match = rheaders.exec(responseHeadersString))) {
									responseHeaders[match[1].toLowerCase()] = match[2];
								}
							}
							match = responseHeaders[key.toLowerCase()];
						}
						return match == null ? null : match;
					},

					// Raw string
					getAllResponseHeaders: function() {
						return state === 2 ? responseHeadersString : null;
					},

					// Caches the header
					setRequestHeader: function(name, value) {
						var lname = name.toLowerCase();
						if (!state) {
							name = requestHeadersNames[lname] = requestHeadersNames[lname] || name;
							requestHeaders[name] = value;
						}
						return this;
					},

					// Overrides response content-type header
					overrideMimeType: function(type) {
						if (!state) {
							s.mimeType = type;
						}
						return this;
					},

					// Status-dependent callbacks
					statusCode: function(map) {
						var code;
						if (map) {
							if (state < 2) {
								for (code in map) {
									// Lazy-add the new callback in a way that preserves old ones
									statusCode[code] = [statusCode[code], map[code]];
								}
							} else {
								// Execute the appropriate callbacks
								jqXHR.always(map[jqXHR.status]);
							}
						}
						return this;
					},

					// Cancel the request
					abort: function(statusText) {
						var finalText = statusText || strAbort;
						if (transport) {
							transport.abort(finalText);
						}
						done(0, finalText);
						return this;
					}
				};

			// Attach deferreds
			deferred.promise(jqXHR).complete = completeDeferred.add;
			jqXHR.success = jqXHR.done;
			jqXHR.error = jqXHR.fail;

			// Remove hash character (#7531: and string promotion)
			// Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
			// Handle falsy url in the settings object (#10093: consistency with old signature)
			// We also use the url parameter if available
			s.url = ((url || s.url || ajaxLocation) + "").replace(rhash, "").replace(rprotocol, ajaxLocParts[1] + "//");

			// Alias method option to type as per ticket #12004
			s.type = options.method || options.type || s.method || s.type;

			// Extract dataTypes list
			s.dataTypes = jQuery.trim(s.dataType || "*").toLowerCase().match(core_rnotwhite) || [""];

			// A cross-domain request is in order when we have a protocol:host:port mismatch
			if (s.crossDomain == null) {
				parts = rurl.exec(s.url.toLowerCase());
				s.crossDomain = !! (parts &&
					(parts[1] !== ajaxLocParts[1] || parts[2] !== ajaxLocParts[2] ||
						(parts[3] || (parts[1] === "http:" ? 80 : 443)) !=
						(ajaxLocParts[3] || (ajaxLocParts[1] === "http:" ? 80 : 443)))
				);
			}

			// Convert data if not already a string
			if (s.data && s.processData && typeof s.data !== "string") {
				s.data = jQuery.param(s.data, s.traditional);
			}

			// Apply prefilters
			inspectPrefiltersOrTransports(prefilters, s, options, jqXHR);

			// If request was aborted inside a prefilter, stop there
			if (state === 2) {
				return jqXHR;
			}

			// We can fire global events as of now if asked to
			fireGlobals = s.global;

			// Watch for a new set of requests
			if (fireGlobals && jQuery.active++ === 0) {
				jQuery.event.trigger("ajaxStart");
			}

			// Uppercase the type
			s.type = s.type.toUpperCase();

			// Determine if request has content
			s.hasContent = !rnoContent.test(s.type);

			// Save the URL in case we're toying with the If-Modified-Since
			// and/or If-None-Match header later on
			cacheURL = s.url;

			// More options handling for requests with no content
			if (!s.hasContent) {

				// If data is available, append data to url
				if (s.data) {
					cacheURL = (s.url += (ajax_rquery.test(cacheURL) ? "&" : "?") + s.data);
					// #9682: remove data so that it's not used in an eventual retry
					delete s.data;
				}

				// Add anti-cache in url if needed
				if (s.cache === false) {
					s.url = rts.test(cacheURL) ?

					// If there is already a '_' parameter, set its value
					cacheURL.replace(rts, "$1_=" + ajax_nonce++) :

					// Otherwise add one to the end
					cacheURL + (ajax_rquery.test(cacheURL) ? "&" : "?") + "_=" + ajax_nonce++;
				}
			}

			// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
			if (s.ifModified) {
				if (jQuery.lastModified[cacheURL]) {
					jqXHR.setRequestHeader("If-Modified-Since", jQuery.lastModified[cacheURL]);
				}
				if (jQuery.etag[cacheURL]) {
					jqXHR.setRequestHeader("If-None-Match", jQuery.etag[cacheURL]);
				}
			}

			// Set the correct header, if data is being sent
			if (s.data && s.hasContent && s.contentType !== false || options.contentType) {
				jqXHR.setRequestHeader("Content-Type", s.contentType);
			}

			// Set the Accepts header for the server, depending on the dataType
			jqXHR.setRequestHeader(
				"Accept",
				s.dataTypes[0] && s.accepts[s.dataTypes[0]] ?
				s.accepts[s.dataTypes[0]] + (s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") :
				s.accepts["*"]
			);

			// Check for headers option
			for (i in s.headers) {
				jqXHR.setRequestHeader(i, s.headers[i]);
			}

			// Allow custom headers/mimetypes and early abort
			if (s.beforeSend && (s.beforeSend.call(callbackContext, jqXHR, s) === false || state === 2)) {
				// Abort if not done already and return
				return jqXHR.abort();
			}

			// aborting is no longer a cancellation
			strAbort = "abort";

			// Install callbacks on deferreds
			for (i in {
				success: 1,
				error: 1,
				complete: 1
			}) {
				jqXHR[i](s[i]);
			}

			// Get transport
			transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR);

			// If no transport, we auto-abort
			if (!transport) {
				done(-1, "No Transport");
			} else {
				jqXHR.readyState = 1;

				// Send global event
				if (fireGlobals) {
					globalEventContext.trigger("ajaxSend", [jqXHR, s]);
				}
				// Timeout
				if (s.async && s.timeout > 0) {
					timeoutTimer = setTimeout(function() {
						jqXHR.abort("timeout");
					}, s.timeout);
				}

				try {
					state = 1;
					transport.send(requestHeaders, done);
				} catch (e) {
					// Propagate exception as error if not done
					if (state < 2) {
						done(-1, e);
						// Simply rethrow otherwise
					} else {
						throw e;
					}
				}
			}

			// Callback for when everything is done

			function done(status, nativeStatusText, responses, headers) {
				var isSuccess, success, error, response, modified,
					statusText = nativeStatusText;

				// Called once
				if (state === 2) {
					return;
				}

				// State is "done" now
				state = 2;

				// Clear timeout if it exists
				if (timeoutTimer) {
					clearTimeout(timeoutTimer);
				}

				// Dereference transport for early garbage collection
				// (no matter how long the jqXHR object will be used)
				transport = undefined;

				// Cache response headers
				responseHeadersString = headers || "";

				// Set readyState
				jqXHR.readyState = status > 0 ? 4 : 0;

				// Get response data
				if (responses) {
					response = ajaxHandleResponses(s, jqXHR, responses);
				}

				// If successful, handle type chaining
				if (status >= 200 && status < 300 || status === 304) {

					// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
					if (s.ifModified) {
						modified = jqXHR.getResponseHeader("Last-Modified");
						if (modified) {
							jQuery.lastModified[cacheURL] = modified;
						}
						modified = jqXHR.getResponseHeader("etag");
						if (modified) {
							jQuery.etag[cacheURL] = modified;
						}
					}

					// if no content
					if (status === 204) {
						isSuccess = true;
						statusText = "nocontent";

						// if not modified
					} else if (status === 304) {
						isSuccess = true;
						statusText = "notmodified";

						// If we have data, let's convert it
					} else {
						isSuccess = ajaxConvert(s, response);
						statusText = isSuccess.state;
						success = isSuccess.data;
						error = isSuccess.error;
						isSuccess = !error;
					}
				} else {
					// We extract error from statusText
					// then normalize statusText and status for non-aborts
					error = statusText;
					if (status || !statusText) {
						statusText = "error";
						if (status < 0) {
							status = 0;
						}
					}
				}

				// Set data for the fake xhr object
				jqXHR.status = status;
				jqXHR.statusText = (nativeStatusText || statusText) + "";

				// Success/Error
				if (isSuccess) {
					deferred.resolveWith(callbackContext, [success, statusText, jqXHR]);
				} else {
					deferred.rejectWith(callbackContext, [jqXHR, statusText, error]);
				}

				// Status-dependent callbacks
				jqXHR.statusCode(statusCode);
				statusCode = undefined;

				if (fireGlobals) {
					globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError", [jqXHR, s, isSuccess ? success : error]);
				}

				// Complete
				completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);

				if (fireGlobals) {
					globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
					// Handle the global AJAX counter
					if (!(--jQuery.active)) {
						jQuery.event.trigger("ajaxStop");
					}
				}
			}

			return jqXHR;
		},

		getScript: function(url, callback) {
			return jQuery.get(url, undefined, callback, "script");
		},

		getJSON: function(url, data, callback) {
			return jQuery.get(url, data, callback, "json");
		}
	});

	/* Handles responses to an ajax request:
	 * - sets all responseXXX fields accordingly
	 * - finds the right dataType (mediates between content-type and expected dataType)
	 * - returns the corresponding response
	 */

	function ajaxHandleResponses(s, jqXHR, responses) {
		var firstDataType, ct, finalDataType, type,
			contents = s.contents,
			dataTypes = s.dataTypes,
			responseFields = s.responseFields;

		// Fill responseXXX fields
		for (type in responseFields) {
			if (type in responses) {
				jqXHR[responseFields[type]] = responses[type];
			}
		}

		// Remove auto dataType and get content-type in the process
		while (dataTypes[0] === "*") {
			dataTypes.shift();
			if (ct === undefined) {
				ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
			}
		}

		// Check if we're dealing with a known content-type
		if (ct) {
			for (type in contents) {
				if (contents[type] && contents[type].test(ct)) {
					dataTypes.unshift(type);
					break;
				}
			}
		}

		// Check to see if we have a response for the expected dataType
		if (dataTypes[0] in responses) {
			finalDataType = dataTypes[0];
		} else {
			// Try convertible dataTypes
			for (type in responses) {
				if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) {
					finalDataType = type;
					break;
				}
				if (!firstDataType) {
					firstDataType = type;
				}
			}
			// Or just use first one
			finalDataType = finalDataType || firstDataType;
		}

		// If we found a dataType
		// We add the dataType to the list if needed
		// and return the corresponding response
		if (finalDataType) {
			if (finalDataType !== dataTypes[0]) {
				dataTypes.unshift(finalDataType);
			}
			return responses[finalDataType];
		}
	}

	// Chain conversions given the request and the original response

	function ajaxConvert(s, response) {
		var conv2, current, conv, tmp,
			converters = {},
			i = 0,
			// Work with a copy of dataTypes in case we need to modify it for conversion
			dataTypes = s.dataTypes.slice(),
			prev = dataTypes[0];

		// Apply the dataFilter if provided
		if (s.dataFilter) {
			response = s.dataFilter(response, s.dataType);
		}

		// Create converters map with lowercased keys
		if (dataTypes[1]) {
			for (conv in s.converters) {
				converters[conv.toLowerCase()] = s.converters[conv];
			}
		}

		// Convert to each sequential dataType, tolerating list modification
		for (;
			(current = dataTypes[++i]);) {

			// There's only work to do if current dataType is non-auto
			if (current !== "*") {

				// Convert response if prev dataType is non-auto and differs from current
				if (prev !== "*" && prev !== current) {

					// Seek a direct converter
					conv = converters[prev + " " + current] || converters["* " + current];

					// If none found, seek a pair
					if (!conv) {
						for (conv2 in converters) {

							// If conv2 outputs current
							tmp = conv2.split(" ");
							if (tmp[1] === current) {

								// If prev can be converted to accepted input
								conv = converters[prev + " " + tmp[0]] ||
									converters["* " + tmp[0]];
								if (conv) {
									// Condense equivalence converters
									if (conv === true) {
										conv = converters[conv2];

										// Otherwise, insert the intermediate dataType
									} else if (converters[conv2] !== true) {
										current = tmp[0];
										dataTypes.splice(i--, 0, current);
									}

									break;
								}
							}
						}
					}

					// Apply converter (if not an equivalence)
					if (conv !== true) {

						// Unless errors are allowed to bubble, catch and return them
						if (conv && s["throws"]) {
							response = conv(response);
						} else {
							try {
								response = conv(response);
							} catch (e) {
								return {
									state: "parsererror",
									error: conv ? e : "No conversion from " + prev + " to " + current
								};
							}
						}
					}
				}

				// Update prev for next iteration
				prev = current;
			}
		}

		return {
			state: "success",
			data: response
		};
	}
	// Install script dataType
	jQuery.ajaxSetup({
		accepts: {
			script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
		},
		contents: {
			script: /(?:java|ecma)script/
		},
		converters: {
			"text script": function(text) {
				jQuery.globalEval(text);
				return text;
			}
		}
	});

	// Handle cache's special case and global
	jQuery.ajaxPrefilter("script", function(s) {
		if (s.cache === undefined) {
			s.cache = false;
		}
		if (s.crossDomain) {
			s.type = "GET";
			s.global = false;
		}
	});

	// Bind script tag hack transport
	jQuery.ajaxTransport("script", function(s) {

		// This transport only deals with cross domain requests
		if (s.crossDomain) {

			var script,
				head = document.head || jQuery("head")[0] || document.documentElement;

			return {

				send: function(_, callback) {

					script = document.createElement("script");

					script.async = true;

					if (s.scriptCharset) {
						script.charset = s.scriptCharset;
					}

					script.src = s.url;

					// Attach handlers for all browsers
					script.onload = script.onreadystatechange = function(_, isAbort) {

						if (isAbort || !script.readyState || /loaded|complete/.test(script.readyState)) {

							// Handle memory leak in IE
							script.onload = script.onreadystatechange = null;

							// Remove the script
							if (script.parentNode) {
								script.parentNode.removeChild(script);
							}

							// Dereference the script
							script = null;

							// Callback if not abort
							if (!isAbort) {
								callback(200, "success");
							}
						}
					};

					// Circumvent IE6 bugs with base elements (#2709 and #4378) by prepending
					// Use native DOM manipulation to avoid our domManip AJAX trickery
					head.insertBefore(script, head.firstChild);
				},

				abort: function() {
					if (script) {
						script.onload(undefined, true);
					}
				}
			};
		}
	});
	var oldCallbacks = [],
		rjsonp = /(=)\?(?=&|$)|\?\?/;

	// Default jsonp settings
	jQuery.ajaxSetup({
		jsonp: "callback",
		jsonpCallback: function() {
			var callback = oldCallbacks.pop() || (jQuery.expando + "_" + (ajax_nonce++));
			this[callback] = true;
			return callback;
		}
	});

	// Detect, normalize options and install callbacks for jsonp requests
	jQuery.ajaxPrefilter("json jsonp", function(s, originalSettings, jqXHR) {

		var callbackName, overwritten, responseContainer,
			jsonProp = s.jsonp !== false && (rjsonp.test(s.url) ?
				"url" :
				typeof s.data === "string" && !(s.contentType || "").indexOf("application/x-www-form-urlencoded") && rjsonp.test(s.data) && "data"
			);

		// Handle iff the expected data type is "jsonp" or we have a parameter to set
		if (jsonProp || s.dataTypes[0] === "jsonp") {

			// Get callback name, remembering preexisting value associated with it
			callbackName = s.jsonpCallback = jQuery.isFunction(s.jsonpCallback) ?
				s.jsonpCallback() :
				s.jsonpCallback;

			// Insert callback into url or form data
			if (jsonProp) {
				s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName);
			} else if (s.jsonp !== false) {
				s.url += (ajax_rquery.test(s.url) ? "&" : "?") + s.jsonp + "=" + callbackName;
			}

			// Use data converter to retrieve json after script execution
			s.converters["script json"] = function() {
				if (!responseContainer) {
					jQuery.error(callbackName + " was not called");
				}
				return responseContainer[0];
			};

			// force json dataType
			s.dataTypes[0] = "json";

			// Install callback
			overwritten = window[callbackName];
			window[callbackName] = function() {
				responseContainer = arguments;
			};

			// Clean-up function (fires after converters)
			jqXHR.always(function() {
				// Restore preexisting value
				window[callbackName] = overwritten;

				// Save back as free
				if (s[callbackName]) {
					// make sure that re-using the options doesn't screw things around
					s.jsonpCallback = originalSettings.jsonpCallback;

					// save the callback name for future use
					oldCallbacks.push(callbackName);
				}

				// Call if it was a function and we have a response
				if (responseContainer && jQuery.isFunction(overwritten)) {
					overwritten(responseContainer[0]);
				}

				responseContainer = overwritten = undefined;
			});

			// Delegate to script
			return "script";
		}
	});
	var xhrCallbacks, xhrSupported,
		xhrId = 0,
		// #5280: Internet Explorer will keep connections alive if we don't abort on unload
		xhrOnUnloadAbort = window.ActiveXObject && function() {
			// Abort all pending requests
			var key;
			for (key in xhrCallbacks) {
				xhrCallbacks[key](undefined, true);
			}
		};

	// Functions to create xhrs

	function createStandardXHR() {
		try {
			return new window.XMLHttpRequest();
		} catch (e) {}
	}

	function createActiveXHR() {
		try {
			return new window.ActiveXObject("Microsoft.XMLHTTP");
		} catch (e) {}
	}

	// Create the request object
	// (This is still attached to ajaxSettings for backward compatibility)
	jQuery.ajaxSettings.xhr = window.ActiveXObject ?
	/* Microsoft failed to properly
	 * implement the XMLHttpRequest in IE7 (can't request local files),
	 * so we use the ActiveXObject when it is available
	 * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
	 * we need a fallback.
	 */

	function() {
		return !this.isLocal && createStandardXHR() || createActiveXHR();
	} :
	// For all other browsers, use the standard XMLHttpRequest object
	createStandardXHR;

	// Determine support properties
	xhrSupported = jQuery.ajaxSettings.xhr();
	jQuery.support.cors = !! xhrSupported && ("withCredentials" in xhrSupported);
	xhrSupported = jQuery.support.ajax = !! xhrSupported;

	// Create transport if the browser can provide an xhr
	if (xhrSupported) {

		jQuery.ajaxTransport(function(s) {
			// Cross domain only allowed if supported through XMLHttpRequest
			if (!s.crossDomain || jQuery.support.cors) {

				var callback;

				return {
					send: function(headers, complete) {

						// Get a new xhr
						var handle, i,
							xhr = s.xhr();

						// Open the socket
						// Passing null username, generates a login popup on Opera (#2865)
						if (s.username) {
							xhr.open(s.type, s.url, s.async, s.username, s.password);
						} else {
							xhr.open(s.type, s.url, s.async);
						}

						// Apply custom fields if provided
						if (s.xhrFields) {
							for (i in s.xhrFields) {
								xhr[i] = s.xhrFields[i];
							}
						}

						// Override mime type if needed
						if (s.mimeType && xhr.overrideMimeType) {
							xhr.overrideMimeType(s.mimeType);
						}

						// X-Requested-With header
						// For cross-domain requests, seeing as conditions for a preflight are
						// akin to a jigsaw puzzle, we simply never set it to be sure.
						// (it can always be set on a per-request basis or even using ajaxSetup)
						// For same-domain requests, won't change header if already provided.
						if (!s.crossDomain && !headers["X-Requested-With"]) {
							headers["X-Requested-With"] = "XMLHttpRequest";
						}

						// Need an extra try/catch for cross domain requests in Firefox 3
						try {
							for (i in headers) {
								xhr.setRequestHeader(i, headers[i]);
							}
						} catch (err) {}

						// Do send the request
						// This may raise an exception which is actually
						// handled in jQuery.ajax (so no try/catch here)
						xhr.send((s.hasContent && s.data) || null);

						// Listener
						callback = function(_, isAbort) {
							var status, responseHeaders, statusText, responses;

							// Firefox throws exceptions when accessing properties
							// of an xhr when a network error occurred
							// http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
							try {

								// Was never called and is aborted or complete
								if (callback && (isAbort || xhr.readyState === 4)) {

									// Only called once
									callback = undefined;

									// Do not keep as active anymore
									if (handle) {
										xhr.onreadystatechange = jQuery.noop;
										if (xhrOnUnloadAbort) {
											delete xhrCallbacks[handle];
										}
									}

									// If it's an abort
									if (isAbort) {
										// Abort it manually if needed
										if (xhr.readyState !== 4) {
											xhr.abort();
										}
									} else {
										responses = {};
										status = xhr.status;
										responseHeaders = xhr.getAllResponseHeaders();

										// When requesting binary data, IE6-9 will throw an exception
										// on any attempt to access responseText (#11426)
										if (typeof xhr.responseText === "string") {
											responses.text = xhr.responseText;
										}

										// Firefox throws an exception when accessing
										// statusText for faulty cross-domain requests
										try {
											statusText = xhr.statusText;
										} catch (e) {
											// We normalize with Webkit giving an empty statusText
											statusText = "";
										}

										// Filter status for non standard behaviors

										// If the request is local and we have data: assume a success
										// (success with no data won't get notified, that's the best we
										// can do given current implementations)
										if (!status && s.isLocal && !s.crossDomain) {
											status = responses.text ? 200 : 404;
											// IE - #1450: sometimes returns 1223 when it should be 204
										} else if (status === 1223) {
											status = 204;
										}
									}
								}
							} catch (firefoxAccessException) {
								if (!isAbort) {
									complete(-1, firefoxAccessException);
								}
							}

							// Call complete if needed
							if (responses) {
								complete(status, statusText, responses, responseHeaders);
							}
						};

						if (!s.async) {
							// if we're in sync mode we fire the callback
							callback();
						} else if (xhr.readyState === 4) {
							// (IE6 & IE7) if it's in cache and has been
							// retrieved directly we need to fire the callback
							setTimeout(callback);
						} else {
							handle = ++xhrId;
							if (xhrOnUnloadAbort) {
								// Create the active xhrs callbacks list if needed
								// and attach the unload handler
								if (!xhrCallbacks) {
									xhrCallbacks = {};
									jQuery(window).unload(xhrOnUnloadAbort);
								}
								// Add to list of active xhrs callbacks
								xhrCallbacks[handle] = callback;
							}
							xhr.onreadystatechange = callback;
						}
					},

					abort: function() {
						if (callback) {
							callback(undefined, true);
						}
					}
				};
			}
		});
	}
	var fxNow, timerId,
		rfxtypes = /^(?:toggle|show|hide)$/,
		rfxnum = new RegExp("^(?:([+-])=|)(" + core_pnum + ")([a-z%]*)$", "i"),
		rrun = /queueHooks$/,
		animationPrefilters = [defaultPrefilter],
		tweeners = {
			"*": [
				function(prop, value) {
					var end, unit,
						tween = this.createTween(prop, value),
						parts = rfxnum.exec(value),
						target = tween.cur(),
						start = +target || 0,
						scale = 1,
						maxIterations = 20;

					if (parts) {
						end = +parts[2];
						unit = parts[3] || (jQuery.cssNumber[prop] ? "" : "px");

						// We need to compute starting value
						if (unit !== "px" && start) {
							// Iteratively approximate from a nonzero starting point
							// Prefer the current property, because this process will be trivial if it uses the same units
							// Fallback to end or a simple constant
							start = jQuery.css(tween.elem, prop, true) || end || 1;

							do {
								// If previous iteration zeroed out, double until we get *something*
								// Use a string for doubling factor so we don't accidentally see scale as unchanged below
								scale = scale || ".5";

								// Adjust and apply
								start = start / scale;
								jQuery.style(tween.elem, prop, start + unit);

								// Update scale, tolerating zero or NaN from tween.cur()
								// And breaking the loop if scale is unchanged or perfect, or if we've just had enough
							} while (scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations);
						}

						tween.unit = unit;
						tween.start = start;
						// If a +=/-= token was provided, we're doing a relative animation
						tween.end = parts[1] ? start + (parts[1] + 1) * end : end;
					}
					return tween;
				}
			]
		};

	// Animations created synchronously will run synchronously

	function createFxNow() {
		setTimeout(function() {
			fxNow = undefined;
		});
		return (fxNow = jQuery.now());
	}

	function createTweens(animation, props) {
		jQuery.each(props, function(prop, value) {
			var collection = (tweeners[prop] || []).concat(tweeners["*"]),
				index = 0,
				length = collection.length;
			for (; index < length; index++) {
				if (collection[index].call(animation, prop, value)) {

					// we're done with this property
					return;
				}
			}
		});
	}

	function Animation(elem, properties, options) {
		var result,
			stopped,
			index = 0,
			length = animationPrefilters.length,
			deferred = jQuery.Deferred().always(function() {
				// don't match elem in the :animated selector
				delete tick.elem;
			}),
			tick = function() {
				if (stopped) {
					return false;
				}
				var currentTime = fxNow || createFxNow(),
					remaining = Math.max(0, animation.startTime + animation.duration - currentTime),
					// archaic crash bug won't allow us to use 1 - ( 0.5 || 0 ) (#12497)
					temp = remaining / animation.duration || 0,
					percent = 1 - temp,
					index = 0,
					length = animation.tweens.length;

				for (; index < length; index++) {
					animation.tweens[index].run(percent);
				}

				deferred.notifyWith(elem, [animation, percent, remaining]);

				if (percent < 1 && length) {
					return remaining;
				} else {
					deferred.resolveWith(elem, [animation]);
					return false;
				}
			},
			animation = deferred.promise({
				elem: elem,
				props: jQuery.extend({}, properties),
				opts: jQuery.extend(true, {
					specialEasing: {}
				}, options),
				originalProperties: properties,
				originalOptions: options,
				startTime: fxNow || createFxNow(),
				duration: options.duration,
				tweens: [],
				createTween: function(prop, end) {
					var tween = jQuery.Tween(elem, animation.opts, prop, end,
						animation.opts.specialEasing[prop] || animation.opts.easing);
					animation.tweens.push(tween);
					return tween;
				},
				stop: function(gotoEnd) {
					var index = 0,
						// if we are going to the end, we want to run all the tweens
						// otherwise we skip this part
						length = gotoEnd ? animation.tweens.length : 0;
					if (stopped) {
						return this;
					}
					stopped = true;
					for (; index < length; index++) {
						animation.tweens[index].run(1);
					}

					// resolve when we played the last frame
					// otherwise, reject
					if (gotoEnd) {
						deferred.resolveWith(elem, [animation, gotoEnd]);
					} else {
						deferred.rejectWith(elem, [animation, gotoEnd]);
					}
					return this;
				}
			}),
			props = animation.props;

		propFilter(props, animation.opts.specialEasing);

		for (; index < length; index++) {
			result = animationPrefilters[index].call(animation, elem, props, animation.opts);
			if (result) {
				return result;
			}
		}

		createTweens(animation, props);

		if (jQuery.isFunction(animation.opts.start)) {
			animation.opts.start.call(elem, animation);
		}

		jQuery.fx.timer(
			jQuery.extend(tick, {
				elem: elem,
				anim: animation,
				queue: animation.opts.queue
			})
		);

		// attach callbacks from options
		return animation.progress(animation.opts.progress)
			.done(animation.opts.done, animation.opts.complete)
			.fail(animation.opts.fail)
			.always(animation.opts.always);
	}

	function propFilter(props, specialEasing) {
		var value, name, index, easing, hooks;

		// camelCase, specialEasing and expand cssHook pass
		for (index in props) {
			name = jQuery.camelCase(index);
			easing = specialEasing[name];
			value = props[index];
			if (jQuery.isArray(value)) {
				easing = value[1];
				value = props[index] = value[0];
			}

			if (index !== name) {
				props[name] = value;
				delete props[index];
			}

			hooks = jQuery.cssHooks[name];
			if (hooks && "expand" in hooks) {
				value = hooks.expand(value);
				delete props[name];

				// not quite $.extend, this wont overwrite keys already present.
				// also - reusing 'index' from above because we have the correct "name"
				for (index in value) {
					if (!(index in props)) {
						props[index] = value[index];
						specialEasing[index] = easing;
					}
				}
			} else {
				specialEasing[name] = easing;
			}
		}
	}

	jQuery.Animation = jQuery.extend(Animation, {

		tweener: function(props, callback) {
			if (jQuery.isFunction(props)) {
				callback = props;
				props = ["*"];
			} else {
				props = props.split(" ");
			}

			var prop,
				index = 0,
				length = props.length;

			for (; index < length; index++) {
				prop = props[index];
				tweeners[prop] = tweeners[prop] || [];
				tweeners[prop].unshift(callback);
			}
		},

		prefilter: function(callback, prepend) {
			if (prepend) {
				animationPrefilters.unshift(callback);
			} else {
				animationPrefilters.push(callback);
			}
		}
	});

	function defaultPrefilter(elem, props, opts) {
		/*jshint validthis:true */
		var prop, index, length,
			value, dataShow, toggle,
			tween, hooks, oldfire,
			anim = this,
			style = elem.style,
			orig = {},
			handled = [],
			hidden = elem.nodeType && isHidden(elem);

		// handle queue: false promises
		if (!opts.queue) {
			hooks = jQuery._queueHooks(elem, "fx");
			if (hooks.unqueued == null) {
				hooks.unqueued = 0;
				oldfire = hooks.empty.fire;
				hooks.empty.fire = function() {
					if (!hooks.unqueued) {
						oldfire();
					}
				};
			}
			hooks.unqueued++;

			anim.always(function() {
				// doing this makes sure that the complete handler will be called
				// before this completes
				anim.always(function() {
					hooks.unqueued--;
					if (!jQuery.queue(elem, "fx").length) {
						hooks.empty.fire();
					}
				});
			});
		}

		// height/width overflow pass
		if (elem.nodeType === 1 && ("height" in props || "width" in props)) {
			// Make sure that nothing sneaks out
			// Record all 3 overflow attributes because IE does not
			// change the overflow attribute when overflowX and
			// overflowY are set to the same value
			opts.overflow = [style.overflow, style.overflowX, style.overflowY];

			// Set display property to inline-block for height/width
			// animations on inline elements that are having width/height animated
			if (jQuery.css(elem, "display") === "inline" &&
				jQuery.css(elem, "float") === "none") {

				// inline-level elements accept inline-block;
				// block-level elements need to be inline with layout
				if (!jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay(elem.nodeName) === "inline") {
					style.display = "inline-block";

				} else {
					style.zoom = 1;
				}
			}
		}

		if (opts.overflow) {
			style.overflow = "hidden";
			if (!jQuery.support.shrinkWrapBlocks) {
				anim.always(function() {
					style.overflow = opts.overflow[0];
					style.overflowX = opts.overflow[1];
					style.overflowY = opts.overflow[2];
				});
			}
		}


		// show/hide pass
		for (index in props) {
			value = props[index];
			if (rfxtypes.exec(value)) {
				delete props[index];
				toggle = toggle || value === "toggle";
				if (value === (hidden ? "hide" : "show")) {
					continue;
				}
				handled.push(index);
			}
		}

		length = handled.length;
		if (length) {
			dataShow = jQuery._data(elem, "fxshow") || jQuery._data(elem, "fxshow", {});
			if ("hidden" in dataShow) {
				hidden = dataShow.hidden;
			}

			// store state if its toggle - enables .stop().toggle() to "reverse"
			if (toggle) {
				dataShow.hidden = !hidden;
			}
			if (hidden) {
				jQuery(elem).show();
			} else {
				anim.done(function() {
					jQuery(elem).hide();
				});
			}
			anim.done(function() {
				var prop;
				jQuery._removeData(elem, "fxshow");
				for (prop in orig) {
					jQuery.style(elem, prop, orig[prop]);
				}
			});
			for (index = 0; index < length; index++) {
				prop = handled[index];
				tween = anim.createTween(prop, hidden ? dataShow[prop] : 0);
				orig[prop] = dataShow[prop] || jQuery.style(elem, prop);

				if (!(prop in dataShow)) {
					dataShow[prop] = tween.start;
					if (hidden) {
						tween.end = tween.start;
						tween.start = prop === "width" || prop === "height" ? 1 : 0;
					}
				}
			}
		}
	}

	function Tween(elem, options, prop, end, easing) {
		return new Tween.prototype.init(elem, options, prop, end, easing);
	}
	jQuery.Tween = Tween;

	Tween.prototype = {
		constructor: Tween,
		init: function(elem, options, prop, end, easing, unit) {
			this.elem = elem;
			this.prop = prop;
			this.easing = easing || "swing";
			this.options = options;
			this.start = this.now = this.cur();
			this.end = end;
			this.unit = unit || (jQuery.cssNumber[prop] ? "" : "px");
		},
		cur: function() {
			var hooks = Tween.propHooks[this.prop];

			return hooks && hooks.get ?
				hooks.get(this) :
				Tween.propHooks._default.get(this);
		},
		run: function(percent) {
			var eased,
				hooks = Tween.propHooks[this.prop];

			if (this.options.duration) {
				this.pos = eased = jQuery.easing[this.easing](
					percent, this.options.duration * percent, 0, 1, this.options.duration
				);
			} else {
				this.pos = eased = percent;
			}
			this.now = (this.end - this.start) * eased + this.start;

			if (this.options.step) {
				this.options.step.call(this.elem, this.now, this);
			}

			if (hooks && hooks.set) {
				hooks.set(this);
			} else {
				Tween.propHooks._default.set(this);
			}
			return this;
		}
	};

	Tween.prototype.init.prototype = Tween.prototype;

	Tween.propHooks = {
		_default: {
			get: function(tween) {
				var result;

				if (tween.elem[tween.prop] != null &&
					(!tween.elem.style || tween.elem.style[tween.prop] == null)) {
					return tween.elem[tween.prop];
				}

				// passing an empty string as a 3rd parameter to .css will automatically
				// attempt a parseFloat and fallback to a string if the parse fails
				// so, simple values such as "10px" are parsed to Float.
				// complex values such as "rotate(1rad)" are returned as is.
				result = jQuery.css(tween.elem, tween.prop, "");
				// Empty strings, null, undefined and "auto" are converted to 0.
				return !result || result === "auto" ? 0 : result;
			},
			set: function(tween) {
				// use step hook for back compat - use cssHook if its there - use .style if its
				// available and use plain properties where available
				if (jQuery.fx.step[tween.prop]) {
					jQuery.fx.step[tween.prop](tween);
				} else if (tween.elem.style && (tween.elem.style[jQuery.cssProps[tween.prop]] != null || jQuery.cssHooks[tween.prop])) {
					jQuery.style(tween.elem, tween.prop, tween.now + tween.unit);
				} else {
					tween.elem[tween.prop] = tween.now;
				}
			}
		}
	};

	// Remove in 2.0 - this supports IE8's panic based approach
	// to setting things on disconnected nodes

	Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
		set: function(tween) {
			if (tween.elem.nodeType && tween.elem.parentNode) {
				tween.elem[tween.prop] = tween.now;
			}
		}
	};

	jQuery.each(["toggle", "show", "hide"], function(i, name) {
		var cssFn = jQuery.fn[name];
		jQuery.fn[name] = function(speed, easing, callback) {
			return speed == null || typeof speed === "boolean" ?
				cssFn.apply(this, arguments) :
				this.animate(genFx(name, true), speed, easing, callback);
		};
	});

	jQuery.fn.extend({
		fadeTo: function(speed, to, easing, callback) {

			// show any hidden elements after setting opacity to 0
			return this.filter(isHidden).css("opacity", 0).show()

			// animate to the value specified
			.end().animate({
				opacity: to
			}, speed, easing, callback);
		},
		animate: function(prop, speed, easing, callback) {
			var empty = jQuery.isEmptyObject(prop),
				optall = jQuery.speed(speed, easing, callback),
				doAnimation = function() {
					// Operate on a copy of prop so per-property easing won't be lost
					var anim = Animation(this, jQuery.extend({}, prop), optall);
					doAnimation.finish = function() {
						anim.stop(true);
					};
					// Empty animations, or finishing resolves immediately
					if (empty || jQuery._data(this, "finish")) {
						anim.stop(true);
					}
				};
			doAnimation.finish = doAnimation;

			return empty || optall.queue === false ?
				this.each(doAnimation) :
				this.queue(optall.queue, doAnimation);
		},
		stop: function(type, clearQueue, gotoEnd) {
			var stopQueue = function(hooks) {
				var stop = hooks.stop;
				delete hooks.stop;
				stop(gotoEnd);
			};

			if (typeof type !== "string") {
				gotoEnd = clearQueue;
				clearQueue = type;
				type = undefined;
			}
			if (clearQueue && type !== false) {
				this.queue(type || "fx", []);
			}

			return this.each(function() {
				var dequeue = true,
					index = type != null && type + "queueHooks",
					timers = jQuery.timers,
					data = jQuery._data(this);

				if (index) {
					if (data[index] && data[index].stop) {
						stopQueue(data[index]);
					}
				} else {
					for (index in data) {
						if (data[index] && data[index].stop && rrun.test(index)) {
							stopQueue(data[index]);
						}
					}
				}

				for (index = timers.length; index--;) {
					if (timers[index].elem === this && (type == null || timers[index].queue === type)) {
						timers[index].anim.stop(gotoEnd);
						dequeue = false;
						timers.splice(index, 1);
					}
				}

				// start the next in the queue if the last step wasn't forced
				// timers currently will call their complete callbacks, which will dequeue
				// but only if they were gotoEnd
				if (dequeue || !gotoEnd) {
					jQuery.dequeue(this, type);
				}
			});
		},
		finish: function(type) {
			if (type !== false) {
				type = type || "fx";
			}
			return this.each(function() {
				var index,
					data = jQuery._data(this),
					queue = data[type + "queue"],
					hooks = data[type + "queueHooks"],
					timers = jQuery.timers,
					length = queue ? queue.length : 0;

				// enable finishing flag on private data
				data.finish = true;

				// empty the queue first
				jQuery.queue(this, type, []);

				if (hooks && hooks.cur && hooks.cur.finish) {
					hooks.cur.finish.call(this);
				}

				// look for any active animations, and finish them
				for (index = timers.length; index--;) {
					if (timers[index].elem === this && timers[index].queue === type) {
						timers[index].anim.stop(true);
						timers.splice(index, 1);
					}
				}

				// look for any animations in the old queue and finish them
				for (index = 0; index < length; index++) {
					if (queue[index] && queue[index].finish) {
						queue[index].finish.call(this);
					}
				}

				// turn off finishing flag
				delete data.finish;
			});
		}
	});

	// Generate parameters to create a standard animation

	function genFx(type, includeWidth) {
		var which,
			attrs = {
				height: type
			},
			i = 0;

		// if we include width, step value is 1 to do all cssExpand values,
		// if we don't include width, step value is 2 to skip over Left and Right
		includeWidth = includeWidth ? 1 : 0;
		for (; i < 4; i += 2 - includeWidth) {
			which = cssExpand[i];
			attrs["margin" + which] = attrs["padding" + which] = type;
		}

		if (includeWidth) {
			attrs.opacity = attrs.width = type;
		}

		return attrs;
	}

	// Generate shortcuts for custom animations
	jQuery.each({
		slideDown: genFx("show"),
		slideUp: genFx("hide"),
		slideToggle: genFx("toggle"),
		fadeIn: {
			opacity: "show"
		},
		fadeOut: {
			opacity: "hide"
		},
		fadeToggle: {
			opacity: "toggle"
		}
	}, function(name, props) {
		jQuery.fn[name] = function(speed, easing, callback) {
			return this.animate(props, speed, easing, callback);
		};
	});

	jQuery.speed = function(speed, easing, fn) {
		var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
			complete: fn || !fn && easing || jQuery.isFunction(speed) && speed,
			duration: speed,
			easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
		};

		opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
			opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;

		// normalize opt.queue - true/undefined/null -> "fx"
		if (opt.queue == null || opt.queue === true) {
			opt.queue = "fx";
		}

		// Queueing
		opt.old = opt.complete;

		opt.complete = function() {
			if (jQuery.isFunction(opt.old)) {
				opt.old.call(this);
			}

			if (opt.queue) {
				jQuery.dequeue(this, opt.queue);
			}
		};

		return opt;
	};

	jQuery.easing = {
		linear: function(p) {
			return p;
		},
		swing: function(p) {
			return 0.5 - Math.cos(p * Math.PI) / 2;
		}
	};

	jQuery.timers = [];
	jQuery.fx = Tween.prototype.init;
	jQuery.fx.tick = function() {
		var timer,
			timers = jQuery.timers,
			i = 0;

		fxNow = jQuery.now();

		for (; i < timers.length; i++) {
			timer = timers[i];
			// Checks the timer has not already been removed
			if (!timer() && timers[i] === timer) {
				timers.splice(i--, 1);
			}
		}

		if (!timers.length) {
			jQuery.fx.stop();
		}
		fxNow = undefined;
	};

	jQuery.fx.timer = function(timer) {
		if (timer() && jQuery.timers.push(timer)) {
			jQuery.fx.start();
		}
	};

	jQuery.fx.interval = 13;

	jQuery.fx.start = function() {
		if (!timerId) {
			timerId = setInterval(jQuery.fx.tick, jQuery.fx.interval);
		}
	};

	jQuery.fx.stop = function() {
		clearInterval(timerId);
		timerId = null;
	};

	jQuery.fx.speeds = {
		slow: 600,
		fast: 200,
		// Default speed
		_default: 400
	};

	// Back Compat <1.8 extension point
	jQuery.fx.step = {};

	if (jQuery.expr && jQuery.expr.filters) {
		jQuery.expr.filters.animated = function(elem) {
			return jQuery.grep(jQuery.timers, function(fn) {
				return elem === fn.elem;
			}).length;
		};
	}
	jQuery.fn.offset = function(options) {
		if (arguments.length) {
			return options === undefined ?
				this :
				this.each(function(i) {
					jQuery.offset.setOffset(this, options, i);
				});
		}

		var docElem, win,
			box = {
				top: 0,
				left: 0
			},
			elem = this[0],
			doc = elem && elem.ownerDocument;

		if (!doc) {
			return;
		}

		docElem = doc.documentElement;

		// Make sure it's not a disconnected DOM node
		if (!jQuery.contains(docElem, elem)) {
			return box;
		}

		// If we don't have gBCR, just use 0,0 rather than error
		// BlackBerry 5, iOS 3 (original iPhone)
		if (typeof elem.getBoundingClientRect !== core_strundefined) {
			box = elem.getBoundingClientRect();
		}
		win = getWindow(doc);
		return {
			top: box.top + (win.pageYOffset || docElem.scrollTop) - (docElem.clientTop || 0),
			left: box.left + (win.pageXOffset || docElem.scrollLeft) - (docElem.clientLeft || 0)
		};
	};

	jQuery.offset = {

		setOffset: function(elem, options, i) {
			var position = jQuery.css(elem, "position");

			// set position first, in-case top/left are set even on static elem
			if (position === "static") {
				elem.style.position = "relative";
			}

			var curElem = jQuery(elem),
				curOffset = curElem.offset(),
				curCSSTop = jQuery.css(elem, "top"),
				curCSSLeft = jQuery.css(elem, "left"),
				calculatePosition = (position === "absolute" || position === "fixed") && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
				props = {}, curPosition = {}, curTop, curLeft;

			// need to be able to calculate position if either top or left is auto and position is either absolute or fixed
			if (calculatePosition) {
				curPosition = curElem.position();
				curTop = curPosition.top;
				curLeft = curPosition.left;
			} else {
				curTop = parseFloat(curCSSTop) || 0;
				curLeft = parseFloat(curCSSLeft) || 0;
			}

			if (jQuery.isFunction(options)) {
				options = options.call(elem, i, curOffset);
			}

			if (options.top != null) {
				props.top = (options.top - curOffset.top) + curTop;
			}
			if (options.left != null) {
				props.left = (options.left - curOffset.left) + curLeft;
			}

			if ("using" in options) {
				options.using.call(elem, props);
			} else {
				curElem.css(props);
			}
		}
	};


	jQuery.fn.extend({

		position: function() {
			if (!this[0]) {
				return;
			}

			var offsetParent, offset,
				parentOffset = {
					top: 0,
					left: 0
				},
				elem = this[0];

			// fixed elements are offset from window (parentOffset = {top:0, left: 0}, because it is it's only offset parent
			if (jQuery.css(elem, "position") === "fixed") {
				// we assume that getBoundingClientRect is available when computed position is fixed
				offset = elem.getBoundingClientRect();
			} else {
				// Get *real* offsetParent
				offsetParent = this.offsetParent();

				// Get correct offsets
				offset = this.offset();
				if (!jQuery.nodeName(offsetParent[0], "html")) {
					parentOffset = offsetParent.offset();
				}

				// Add offsetParent borders
				parentOffset.top += jQuery.css(offsetParent[0], "borderTopWidth", true);
				parentOffset.left += jQuery.css(offsetParent[0], "borderLeftWidth", true);
			}

			// Subtract parent offsets and element margins
			// note: when an element has margin: auto the offsetLeft and marginLeft
			// are the same in Safari causing offset.left to incorrectly be 0
			return {
				top: offset.top - parentOffset.top - jQuery.css(elem, "marginTop", true),
				left: offset.left - parentOffset.left - jQuery.css(elem, "marginLeft", true)
			};
		},

		offsetParent: function() {
			return this.map(function() {
				var offsetParent = this.offsetParent || document.documentElement;
				while (offsetParent && (!jQuery.nodeName(offsetParent, "html") && jQuery.css(offsetParent, "position") === "static")) {
					offsetParent = offsetParent.offsetParent;
				}
				return offsetParent || document.documentElement;
			});
		}
	});


	// Create scrollLeft and scrollTop methods
	jQuery.each({
		scrollLeft: "pageXOffset",
		scrollTop: "pageYOffset"
	}, function(method, prop) {
		var top = /Y/.test(prop);

		jQuery.fn[method] = function(val) {
			return jQuery.access(this, function(elem, method, val) {
				var win = getWindow(elem);

				if (val === undefined) {
					return win ? (prop in win) ? win[prop] :
						win.document.documentElement[method] :
						elem[method];
				}

				if (win) {
					win.scrollTo(!top ? val : jQuery(win).scrollLeft(),
						top ? val : jQuery(win).scrollTop()
					);

				} else {
					elem[method] = val;
				}
			}, method, val, arguments.length, null);
		};
	});

	function getWindow(elem) {
		return jQuery.isWindow(elem) ?
			elem :
			elem.nodeType === 9 ?
			elem.defaultView || elem.parentWindow :
			false;
	}
	// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
	jQuery.each({
		Height: "height",
		Width: "width"
	}, function(name, type) {
		jQuery.each({
			padding: "inner" + name,
			content: type,
			"": "outer" + name
		}, function(defaultExtra, funcName) {
			// margin is only for outerHeight, outerWidth
			jQuery.fn[funcName] = function(margin, value) {
				var chainable = arguments.length && (defaultExtra || typeof margin !== "boolean"),
					extra = defaultExtra || (margin === true || value === true ? "margin" : "border");

				return jQuery.access(this, function(elem, type, value) {
					var doc;

					if (jQuery.isWindow(elem)) {
						// As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
						// isn't a whole lot we can do. See pull request at this URL for discussion:
						// https://github.com/jquery/jquery/pull/764
						return elem.document.documentElement["client" + name];
					}

					// Get document width or height
					if (elem.nodeType === 9) {
						doc = elem.documentElement;

						// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest
						// unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it.
						return Math.max(
							elem.body["scroll" + name], doc["scroll" + name],
							elem.body["offset" + name], doc["offset" + name],
							doc["client" + name]
						);
					}

					return value === undefined ?
					// Get width or height on the element, requesting but not forcing parseFloat
					jQuery.css(elem, type, extra) :

					// Set width or height on the element
					jQuery.style(elem, type, value, extra);
				}, type, chainable ? margin : undefined, chainable, null);
			};
		});
	});
	// Limit scope pollution from any deprecated API
	// (function() {

	// })();
	// Expose jQuery to the global object
	window.jQuery = window.$ = jQuery;

	// Expose jQuery as an AMD module, but only for AMD loaders that
	// understand the issues with loading multiple versions of jQuery
	// in a page that all might call define(). The loader will indicate
	// they have special allowances for multiple jQuery versions by
	// specifying define.amd.jQuery = true. Register as a named module,
	// since jQuery can be concatenated with other files that may use define,
	// but not use a proper concatenation script that understands anonymous
	// AMD modules. A named AMD is safest and most robust way to register.
	// Lowercase jquery is used because AMD module names are derived from
	// file names, and jQuery is normally delivered in a lowercase file name.
	// Do this after creating the global so that if an AMD module wants to call
	// noConflict to hide this version of jQuery, it will work.
	if (typeof define === "function" && define.amd && define.amd.jQuery) {
		define("jquery", [], function() {
			return jQuery;
		});
	}

})(window);









/*! jQuery UI - v1.10.3 - 2013-05-03
 * http://jqueryui.com
 * Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.ui.effect.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js, jquery.ui.menu.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js
 * Copyright 2013 jQuery Foundation and other contributors; Licensed MIT */
(function($, undefined) {

	var uuid = 0,
		runiqueId = /^ui-id-\d+$/;

	// $.ui might exist from components with no dependencies, e.g., $.ui.position
	$.ui = $.ui || {};

	$.extend($.ui, {
		version: "1.10.3",

		keyCode: {
			BACKSPACE: 8,
			COMMA: 188,
			DELETE: 46,
			DOWN: 40,
			END: 35,
			ENTER: 13,
			ESCAPE: 27,
			HOME: 36,
			LEFT: 37,
			NUMPAD_ADD: 107,
			NUMPAD_DECIMAL: 110,
			NUMPAD_DIVIDE: 111,
			NUMPAD_ENTER: 108,
			NUMPAD_MULTIPLY: 106,
			NUMPAD_SUBTRACT: 109,
			PAGE_DOWN: 34,
			PAGE_UP: 33,
			PERIOD: 190,
			RIGHT: 39,
			SPACE: 32,
			TAB: 9,
			UP: 38
		}
	});

	// plugins
	$.fn.extend({
		focus: (function(orig) {
			return function(delay, fn) {
				return typeof delay === "number" ?
					this.each(function() {
						var elem = this;
						setTimeout(function() {
							$(elem).focus();
							if (fn) {
								fn.call(elem);
							}
						}, delay);
					}) :
					orig.apply(this, arguments);
			};
		})($.fn.focus),

		scrollParent: function() {
			var scrollParent;
			if (($.ui.ie && (/(static|relative)/).test(this.css("position"))) || (/absolute/).test(this.css("position"))) {
				scrollParent = this.parents().filter(function() {
					return (/(relative|absolute|fixed)/).test($.css(this, "position")) && (/(auto|scroll)/).test($.css(this, "overflow") + $.css(this, "overflow-y") + $.css(this, "overflow-x"));
				}).eq(0);
			} else {
				scrollParent = this.parents().filter(function() {
					return (/(auto|scroll)/).test($.css(this, "overflow") + $.css(this, "overflow-y") + $.css(this, "overflow-x"));
				}).eq(0);
			}

			return (/fixed/).test(this.css("position")) || !scrollParent.length ? $(document) : scrollParent;
		},

		zIndex: function(zIndex) {
			if (zIndex !== undefined) {
				return this.css("zIndex", zIndex);
			}

			if (this.length) {
				var elem = $(this[0]),
					position, value;
				while (elem.length && elem[0] !== document) {
					// Ignore z-index if position is set to a value where z-index is ignored by the browser
					// This makes behavior of this function consistent across browsers
					// WebKit always returns auto if the element is positioned
					position = elem.css("position");
					if (position === "absolute" || position === "relative" || position === "fixed") {
						// IE returns 0 when zIndex is not specified
						// other browsers return a string
						// we ignore the case of nested elements with an explicit value of 0
						// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
						value = parseInt(elem.css("zIndex"), 10);
						if (!isNaN(value) && value !== 0) {
							return value;
						}
					}
					elem = elem.parent();
				}
			}

			return 0;
		},

		uniqueId: function() {
			return this.each(function() {
				if (!this.id) {
					this.id = "ui-id-" + (++uuid);
				}
			});
		},

		removeUniqueId: function() {
			return this.each(function() {
				if (runiqueId.test(this.id)) {
					$(this).removeAttr("id");
				}
			});
		}
	});

	// selectors

	function focusable(element, isTabIndexNotNaN) {
		var map, mapName, img,
			nodeName = element.nodeName.toLowerCase();
		if ("area" === nodeName) {
			map = element.parentNode;
			mapName = map.name;
			if (!element.href || !mapName || map.nodeName.toLowerCase() !== "map") {
				return false;
			}
			img = $("img[usemap=#" + mapName + "]")[0];
			return !!img && visible(img);
		}
		return (/input|select|textarea|button|object/.test(nodeName) ? !element.disabled :
			"a" === nodeName ?
			element.href || isTabIndexNotNaN :
			isTabIndexNotNaN) &&
		// the element and all of its ancestors must be visible
		visible(element);
	}

	function visible(element) {
		return $.expr.filters.visible(element) && !$(element).parents().addBack().filter(function() {
			return $.css(this, "visibility") === "hidden";
		}).length;
	}

	$.extend($.expr[":"], {
		data: $.expr.createPseudo ? $.expr.createPseudo(function(dataName) {
			return function(elem) {
				return !!$.data(elem, dataName);
			};
		}) :
		// support: jQuery <1.8

		function(elem, i, match) {
			return !!$.data(elem, match[3]);
		},

		focusable: function(element) {
			return focusable(element, !isNaN($.attr(element, "tabindex")));
		},

		tabbable: function(element) {
			var tabIndex = $.attr(element, "tabindex"),
				isTabIndexNaN = isNaN(tabIndex);
			return (isTabIndexNaN || tabIndex >= 0) && focusable(element, !isTabIndexNaN);
		}
	});

	// support: jQuery <1.8
	if (!$("<a>").outerWidth(1).jquery) {
		$.each(["Width", "Height"], function(i, name) {
			var side = name === "Width" ? ["Left", "Right"] : ["Top", "Bottom"],
				type = name.toLowerCase(),
				orig = {
					innerWidth: $.fn.innerWidth,
					innerHeight: $.fn.innerHeight,
					outerWidth: $.fn.outerWidth,
					outerHeight: $.fn.outerHeight
				};

			function reduce(elem, size, border, margin) {
				$.each(side, function() {
					size -= parseFloat($.css(elem, "padding" + this)) || 0;
					if (border) {
						size -= parseFloat($.css(elem, "border" + this + "Width")) || 0;
					}
					if (margin) {
						size -= parseFloat($.css(elem, "margin" + this)) || 0;
					}
				});
				return size;
			}

			$.fn["inner" + name] = function(size) {
				if (size === undefined) {
					return orig["inner" + name].call(this);
				}

				return this.each(function() {
					$(this).css(type, reduce(this, size) + "px");
				});
			};

			$.fn["outer" + name] = function(size, margin) {
				if (typeof size !== "number") {
					return orig["outer" + name].call(this, size);
				}

				return this.each(function() {
					$(this).css(type, reduce(this, size, true, margin) + "px");
				});
			};
		});
	}

	// support: jQuery <1.8
	if (!$.fn.addBack) {
		$.fn.addBack = function(selector) {
			return this.add(selector == null ?
				this.prevObject : this.prevObject.filter(selector)
			);
		};
	}

	// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413)
	if ($("<a>").data("a-b", "a").removeData("a-b").data("a-b")) {
		$.fn.removeData = (function(removeData) {
			return function(key) {
				if (arguments.length) {
					return removeData.call(this, $.camelCase(key));
				} else {
					return removeData.call(this);
				}
			};
		})($.fn.removeData);
	}





	// deprecated
	$.ui.ie = !! /msie [\w.]+/.exec(navigator.userAgent.toLowerCase());

	$.support.selectstart = "onselectstart" in document.createElement("div");
	$.fn.extend({
		disableSelection: function() {
			return this.bind(($.support.selectstart ? "selectstart" : "mousedown") +
				".ui-disableSelection", function(event) {
					event.preventDefault();
				});
		},

		enableSelection: function() {
			return this.unbind(".ui-disableSelection");
		}
	});

	$.extend($.ui, {
		// $.ui.plugin is deprecated. Use $.widget() extensions instead.
		plugin: {
			add: function(module, option, set) {
				var i,
					proto = $.ui[module].prototype;
				for (i in set) {
					proto.plugins[i] = proto.plugins[i] || [];
					proto.plugins[i].push([option, set[i]]);
				}
			},
			call: function(instance, name, args) {
				var i,
					set = instance.plugins[name];
				if (!set || !instance.element[0].parentNode || instance.element[0].parentNode.nodeType === 11) {
					return;
				}

				for (i = 0; i < set.length; i++) {
					if (instance.options[set[i][0]]) {
						set[i][1].apply(instance.element, args);
					}
				}
			}
		},

		// only used by resizable
		hasScroll: function(el, a) {

			//If overflow is hidden, the element might have extra content, but the user wants to hide it
			if ($(el).css("overflow") === "hidden") {
				return false;
			}

			var scroll = (a && a === "left") ? "scrollLeft" : "scrollTop",
				has = false;

			if (el[scroll] > 0) {
				return true;
			}

			// TODO: determine which cases actually cause this to happen
			// if the element doesn't have the scroll set, see if it's possible to
			// set the scroll
			el[scroll] = 1;
			has = (el[scroll] > 0);
			el[scroll] = 0;
			return has;
		}
	});

})(jQuery);

(function($, undefined) {

	var uuid = 0,
		slice = Array.prototype.slice,
		_cleanData = $.cleanData;
	$.cleanData = function(elems) {
		for (var i = 0, elem;
			(elem = elems[i]) != null; i++) {
			try {
				$(elem).triggerHandler("remove");
				// http://bugs.jquery.com/ticket/8235
			} catch (e) {}
		}
		_cleanData(elems);
	};

	$.widget = function(name, base, prototype) {
		var fullName, existingConstructor, constructor, basePrototype,
			// proxiedPrototype allows the provided prototype to remain unmodified
			// so that it can be used as a mixin for multiple widgets (#8876)
			proxiedPrototype = {},
			namespace = name.split(".")[0];

		name = name.split(".")[1];
		fullName = namespace + "-" + name;

		if (!prototype) {
			prototype = base;
			base = $.Widget;
		}

		// create selector for plugin
		$.expr[":"][fullName.toLowerCase()] = function(elem) {
			return !!$.data(elem, fullName);
		};

		$[namespace] = $[namespace] || {};
		existingConstructor = $[namespace][name];
		constructor = $[namespace][name] = function(options, element) {
			// allow instantiation without "new" keyword
			if (!this._createWidget) {
				return new constructor(options, element);
			}

			// allow instantiation without initializing for simple inheritance
			// must use "new" keyword (the code above always passes args)
			if (arguments.length) {
				this._createWidget(options, element);
			}
		};
		// extend with the existing constructor to carry over any static properties
		$.extend(constructor, existingConstructor, {
			version: prototype.version,
			// copy the object used to create the prototype in case we need to
			// redefine the widget later
			_proto: $.extend({}, prototype),
			// track widgets that inherit from this widget in case this widget is
			// redefined after a widget inherits from it
			_childConstructors: []
		});

		basePrototype = new base();
		// we need to make the options hash a property directly on the new instance
		// otherwise we'll modify the options hash on the prototype that we're
		// inheriting from
		basePrototype.options = $.widget.extend({}, basePrototype.options);
		$.each(prototype, function(prop, value) {
			if (!$.isFunction(value)) {
				proxiedPrototype[prop] = value;
				return;
			}
			proxiedPrototype[prop] = (function() {
				var _super = function() {
					return base.prototype[prop].apply(this, arguments);
				},
					_superApply = function(args) {
						return base.prototype[prop].apply(this, args);
					};
				return function() {
					var __super = this._super,
						__superApply = this._superApply,
						returnValue;

					this._super = _super;
					this._superApply = _superApply;

					returnValue = value.apply(this, arguments);

					this._super = __super;
					this._superApply = __superApply;

					return returnValue;
				};
			})();
		});
		constructor.prototype = $.widget.extend(basePrototype, {
			// TODO: remove support for widgetEventPrefix
			// always use the name + a colon as the prefix, e.g., draggable:start
			// don't prefix for widgets that aren't DOM-based
			widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name
		}, proxiedPrototype, {
			constructor: constructor,
			namespace: namespace,
			widgetName: name,
			widgetFullName: fullName
		});

		// If this widget is being redefined then we need to find all widgets that
		// are inheriting from it and redefine all of them so that they inherit from
		// the new version of this widget. We're essentially trying to replace one
		// level in the prototype chain.
		if (existingConstructor) {
			$.each(existingConstructor._childConstructors, function(i, child) {
				var childPrototype = child.prototype;

				// redefine the child widget using the same prototype that was
				// originally used, but inherit from the new version of the base
				$.widget(childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto);
			});
			// remove the list of existing child constructors from the old constructor
			// so the old child constructors can be garbage collected
			delete existingConstructor._childConstructors;
		} else {
			base._childConstructors.push(constructor);
		}

		$.widget.bridge(name, constructor);
	};

	$.widget.extend = function(target) {
		var input = slice.call(arguments, 1),
			inputIndex = 0,
			inputLength = input.length,
			key,
			value;
		for (; inputIndex < inputLength; inputIndex++) {
			for (key in input[inputIndex]) {
				value = input[inputIndex][key];
				if (input[inputIndex].hasOwnProperty(key) && value !== undefined) {
					// Clone objects
					if ($.isPlainObject(value)) {
						target[key] = $.isPlainObject(target[key]) ?
							$.widget.extend({}, target[key], value) :
						// Don't extend strings, arrays, etc. with objects
						$.widget.extend({}, value);
						// Copy everything else by reference
					} else {
						target[key] = value;
					}
				}
			}
		}
		return target;
	};

	$.widget.bridge = function(name, object) {
		var fullName = object.prototype.widgetFullName || name;
		$.fn[name] = function(options) {
			var isMethodCall = typeof options === "string",
				args = slice.call(arguments, 1),
				returnValue = this;

			// allow multiple hashes to be passed on init
			options = !isMethodCall && args.length ?
				$.widget.extend.apply(null, [options].concat(args)) :
				options;

			if (isMethodCall) {
				this.each(function() {
					var methodValue,
						instance = $.data(this, fullName);
					if (!instance) {
						return $.error("cannot call methods on " + name + " prior to initialization; " +
							"attempted to call method '" + options + "'");
					}
					if (!$.isFunction(instance[options]) || options.charAt(0) === "_") {
						return $.error("no such method '" + options + "' for " + name + " widget instance");
					}
					methodValue = instance[options].apply(instance, args);
					if (methodValue !== instance && methodValue !== undefined) {
						returnValue = methodValue && methodValue.jquery ?
							returnValue.pushStack(methodValue.get()) :
							methodValue;
						return false;
					}
				});
			} else {
				this.each(function() {
					var instance = $.data(this, fullName);
					if (instance) {
						instance.option(options || {})._init();
					} else {
						$.data(this, fullName, new object(options, this));
					}
				});
			}

			return returnValue;
		};
	};

	$.Widget = function( /* options, element */ ) {};
	$.Widget._childConstructors = [];

	$.Widget.prototype = {
		widgetName: "widget",
		widgetEventPrefix: "",
		defaultElement: "<div>",
		options: {
			disabled: false,

			// callbacks
			create: null
		},
		_createWidget: function(options, element) {
			element = $(element || this.defaultElement || this)[0];
			this.element = $(element);
			this.uuid = uuid++;
			this.eventNamespace = "." + this.widgetName + this.uuid;
			this.options = $.widget.extend({},
				this.options,
				this._getCreateOptions(),
				options);

			this.bindings = $();
			this.hoverable = $();
			this.focusable = $();

			if (element !== this) {
				$.data(element, this.widgetFullName, this);
				this._on(true, this.element, {
					remove: function(event) {
						if (event.target === element) {
							this.destroy();
						}
					}
				});
				this.document = $(element.style ?
					// element within the document
					element.ownerDocument :
					// element is window or document
					element.document || element);
				this.window = $(this.document[0].defaultView || this.document[0].parentWindow);
			}

			this._create();
			this._trigger("create", null, this._getCreateEventData());
			this._init();
		},
		_getCreateOptions: $.noop,
		_getCreateEventData: $.noop,
		_create: $.noop,
		_init: $.noop,

		destroy: function() {
			this._destroy();
			// we can probably remove the unbind calls in 2.0
			// all event bindings should go through this._on()
			this.element
				.unbind(this.eventNamespace)
			// 1.9 BC for #7810
			// TODO remove dual storage
			.removeData(this.widgetName)
				.removeData(this.widgetFullName)
			// support: jquery <1.6.3
			// http://bugs.jquery.com/ticket/9413
			.removeData($.camelCase(this.widgetFullName));
			this.widget()
				.unbind(this.eventNamespace)
				.removeAttr("aria-disabled")
				.removeClass(
					this.widgetFullName + "-disabled " +
					"ui-state-disabled");

			// clean up events and states
			this.bindings.unbind(this.eventNamespace);
			this.hoverable.removeClass("ui-state-hover");
			this.focusable.removeClass("ui-state-focus");
		},
		_destroy: $.noop,

		widget: function() {
			return this.element;
		},

		option: function(key, value) {
			var options = key,
				parts,
				curOption,
				i;

			if (arguments.length === 0) {
				// don't return a reference to the internal hash
				return $.widget.extend({}, this.options);
			}

			if (typeof key === "string") {
				// handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
				options = {};
				parts = key.split(".");
				key = parts.shift();
				if (parts.length) {
					curOption = options[key] = $.widget.extend({}, this.options[key]);
					for (i = 0; i < parts.length - 1; i++) {
						curOption[parts[i]] = curOption[parts[i]] || {};
						curOption = curOption[parts[i]];
					}
					key = parts.pop();
					if (value === undefined) {
						return curOption[key] === undefined ? null : curOption[key];
					}
					curOption[key] = value;
				} else {
					if (value === undefined) {
						return this.options[key] === undefined ? null : this.options[key];
					}
					options[key] = value;
				}
			}

			this._setOptions(options);

			return this;
		},
		_setOptions: function(options) {
			var key;

			for (key in options) {
				this._setOption(key, options[key]);
			}

			return this;
		},
		_setOption: function(key, value) {
			this.options[key] = value;

			if (key === "disabled") {
				this.widget()
					.toggleClass(this.widgetFullName + "-disabled ui-state-disabled", !! value)
					.attr("aria-disabled", value);
				this.hoverable.removeClass("ui-state-hover");
				this.focusable.removeClass("ui-state-focus");
			}

			return this;
		},

		enable: function() {
			return this._setOption("disabled", false);
		},
		disable: function() {
			return this._setOption("disabled", true);
		},

		_on: function(suppressDisabledCheck, element, handlers) {
			var delegateElement,
				instance = this;

			// no suppressDisabledCheck flag, shuffle arguments
			if (typeof suppressDisabledCheck !== "boolean") {
				handlers = element;
				element = suppressDisabledCheck;
				suppressDisabledCheck = false;
			}

			// no element argument, shuffle and use this.element
			if (!handlers) {
				handlers = element;
				element = this.element;
				delegateElement = this.widget();
			} else {
				// accept selectors, DOM elements
				element = delegateElement = $(element);
				this.bindings = this.bindings.add(element);
			}

			$.each(handlers, function(event, handler) {
				function handlerProxy() {
					// allow widgets to customize the disabled handling
					// - disabled as an array instead of boolean
					// - disabled class as method for disabling individual parts
					if (!suppressDisabledCheck &&
						(instance.options.disabled === true ||
							$(this).hasClass("ui-state-disabled"))) {
						return;
					}
					return (typeof handler === "string" ? instance[handler] : handler)
						.apply(instance, arguments);
				}

				// copy the guid so direct unbinding works
				if (typeof handler !== "string") {
					handlerProxy.guid = handler.guid =
						handler.guid || handlerProxy.guid || $.guid++;
				}

				var match = event.match(/^(\w+)\s*(.*)$/),
					eventName = match[1] + instance.eventNamespace,
					selector = match[2];
				if (selector) {
					delegateElement.delegate(selector, eventName, handlerProxy);
				} else {
					element.bind(eventName, handlerProxy);
				}
			});
		},

		_off: function(element, eventName) {
			eventName = (eventName || "").split(" ").join(this.eventNamespace + " ") + this.eventNamespace;
			element.unbind(eventName).undelegate(eventName);
		},

		_delay: function(handler, delay) {
			function handlerProxy() {
				return (typeof handler === "string" ? instance[handler] : handler)
					.apply(instance, arguments);
			}
			var instance = this;
			return setTimeout(handlerProxy, delay || 0);
		},

		_hoverable: function(element) {
			this.hoverable = this.hoverable.add(element);
			this._on(element, {
				mouseenter: function(event) {
					$(event.currentTarget).addClass("ui-state-hover");
				},
				mouseleave: function(event) {
					$(event.currentTarget).removeClass("ui-state-hover");
				}
			});
		},

		_focusable: function(element) {
			this.focusable = this.focusable.add(element);
			this._on(element, {
				focusin: function(event) {
					$(event.currentTarget).addClass("ui-state-focus");
				},
				focusout: function(event) {
					$(event.currentTarget).removeClass("ui-state-focus");
				}
			});
		},

		_trigger: function(type, event, data) {
			var prop, orig,
				callback = this.options[type];

			data = data || {};
			event = $.Event(event);
			event.type = (type === this.widgetEventPrefix ?
				type :
				this.widgetEventPrefix + type).toLowerCase();
			// the original event may come from any element
			// so we need to reset the target on the new event
			event.target = this.element[0];

			// copy original event properties over to the new event
			orig = event.originalEvent;
			if (orig) {
				for (prop in orig) {
					if (!(prop in event)) {
						event[prop] = orig[prop];
					}
				}
			}

			this.element.trigger(event, data);
			return !($.isFunction(callback) &&
				callback.apply(this.element[0], [event].concat(data)) === false ||
				event.isDefaultPrevented());
		}
	};

	$.each({
		show: "fadeIn",
		hide: "fadeOut"
	}, function(method, defaultEffect) {
		$.Widget.prototype["_" + method] = function(element, options, callback) {
			if (typeof options === "string") {
				options = {
					effect: options
				};
			}
			var hasOptions,
				effectName = !options ?
					method :
					options === true || typeof options === "number" ?
					defaultEffect :
					options.effect || defaultEffect;
			options = options || {};
			if (typeof options === "number") {
				options = {
					duration: options
				};
			}
			hasOptions = !$.isEmptyObject(options);
			options.complete = callback;
			if (options.delay) {
				element.delay(options.delay);
			}
			if (hasOptions && $.effects && $.effects.effect[effectName]) {
				element[method](options);
			} else if (effectName !== method && element[effectName]) {
				element[effectName](options.duration, options.easing, callback);
			} else {
				element.queue(function(next) {
					$(this)[method]();
					if (callback) {
						callback.call(element[0]);
					}
					next();
				});
			}
		};
	});

})(jQuery);

(function($, undefined) {

	var mouseHandled = false;
	$(document).mouseup(function() {
		mouseHandled = false;
	});

	$.widget("ui.mouse", {
		version: "1.10.3",
		options: {
			cancel: "input,textarea,button,select,option",
			distance: 1,
			delay: 0
		},
		_mouseInit: function() {
			var that = this;

			this.element
				.bind("mousedown." + this.widgetName, function(event) {
					return that._mouseDown(event);
				})
				.bind("click." + this.widgetName, function(event) {
					if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) {
						$.removeData(event.target, that.widgetName + ".preventClickEvent");
						event.stopImmediatePropagation();
						return false;
					}
				});

			this.started = false;
		},

		// TODO: make sure destroying one instance of mouse doesn't mess with
		// other instances of mouse
		_mouseDestroy: function() {
			this.element.unbind("." + this.widgetName);
			if (this._mouseMoveDelegate) {
				$(document)
					.unbind("mousemove." + this.widgetName, this._mouseMoveDelegate)
					.unbind("mouseup." + this.widgetName, this._mouseUpDelegate);
			}
		},

		_mouseDown: function(event) {
			// don't let more than one widget handle mouseStart
			if (mouseHandled) {
				return;
			}

			// we may have missed mouseup (out of window)
			(this._mouseStarted && this._mouseUp(event));

			this._mouseDownEvent = event;

			var that = this,
				btnIsLeft = (event.which === 1),
				// event.target.nodeName works around a bug in IE 8 with
				// disabled inputs (#7620)
				elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
			if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
				return true;
			}

			this.mouseDelayMet = !this.options.delay;
			if (!this.mouseDelayMet) {
				this._mouseDelayTimer = setTimeout(function() {
					that.mouseDelayMet = true;
				}, this.options.delay);
			}

			if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
				this._mouseStarted = (this._mouseStart(event) !== false);
				if (!this._mouseStarted) {
					event.preventDefault();
					return true;
				}
			}

			// Click event may never have fired (Gecko & Opera)
			if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) {
				$.removeData(event.target, this.widgetName + ".preventClickEvent");
			}

			// these delegates are required to keep context
			this._mouseMoveDelegate = function(event) {
				return that._mouseMove(event);
			};
			this._mouseUpDelegate = function(event) {
				return that._mouseUp(event);
			};
			$(document)
				.bind("mousemove." + this.widgetName, this._mouseMoveDelegate)
				.bind("mouseup." + this.widgetName, this._mouseUpDelegate);

			event.preventDefault();

			mouseHandled = true;
			return true;
		},

		_mouseMove: function(event) {
			// IE mouseup check - mouseup happened when mouse was out of window
			if ($.ui.ie && (!document.documentMode || document.documentMode < 9) && !event.button) {
				return this._mouseUp(event);
			}

			if (this._mouseStarted) {
				this._mouseDrag(event);
				return event.preventDefault();
			}

			if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
				this._mouseStarted =
					(this._mouseStart(this._mouseDownEvent, event) !== false);
				(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
			}

			return !this._mouseStarted;
		},

		_mouseUp: function(event) {
			$(document)
				.unbind("mousemove." + this.widgetName, this._mouseMoveDelegate)
				.unbind("mouseup." + this.widgetName, this._mouseUpDelegate);

			if (this._mouseStarted) {
				this._mouseStarted = false;

				if (event.target === this._mouseDownEvent.target) {
					$.data(event.target, this.widgetName + ".preventClickEvent", true);
				}

				this._mouseStop(event);
			}

			return false;
		},

		_mouseDistanceMet: function(event) {
			return (Math.max(
				Math.abs(this._mouseDownEvent.pageX - event.pageX),
				Math.abs(this._mouseDownEvent.pageY - event.pageY)
			) >= this.options.distance);
		},

		_mouseDelayMet: function( /* event */ ) {
			return this.mouseDelayMet;
		},

		// These are placeholder methods, to be overriden by extending plugin
		_mouseStart: function( /* event */ ) {},
		_mouseDrag: function( /* event */ ) {},
		_mouseStop: function( /* event */ ) {},
		_mouseCapture: function( /* event */ ) {
			return true;
		}
	});

})(jQuery);

(function($, undefined) {

	$.widget("ui.draggable", $.ui.mouse, {
		version: "1.10.3",
		widgetEventPrefix: "drag",
		options: {
			addClasses: true,
			appendTo: "parent",
			axis: false,
			connectToSortable: false,
			containment: false,
			cursor: "auto",
			cursorAt: false,
			grid: false,
			handle: false,
			helper: "original",
			iframeFix: false,
			opacity: false,
			refreshPositions: false,
			revert: false,
			revertDuration: 500,
			scope: "default",
			scroll: true,
			scrollSensitivity: 20,
			scrollSpeed: 20,
			snap: false,
			snapMode: "both",
			snapTolerance: 20,
			stack: false,
			zIndex: false,

			// callbacks
			drag: null,
			start: null,
			stop: null
		},
		_create: function() {

			if (this.options.helper === "original" && !(/^(?:r|a|f)/).test(this.element.css("position"))) {
				this.element[0].style.position = "relative";
			}
			if (this.options.addClasses) {
				this.element.addClass("ui-draggable");
			}
			if (this.options.disabled) {
				this.element.addClass("ui-draggable-disabled");
			}

			this._mouseInit();

		},

		_destroy: function() {
			this.element.removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");
			this._mouseDestroy();
		},

		_mouseCapture: function(event) {

			var o = this.options;

			// among others, prevent a drag on a resizable-handle
			if (this.helper || o.disabled || $(event.target).closest(".ui-resizable-handle").length > 0) {
				return false;
			}

			//Quit if we're not on a valid handle
			this.handle = this._getHandle(event);
			if (!this.handle) {
				return false;
			}

			$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
				$("<div class='ui-draggable-iframeFix' style='background: #fff;'></div>")
					.css({
						width: this.offsetWidth + "px",
						height: this.offsetHeight + "px",
						position: "absolute",
						opacity: "0.001",
						zIndex: 1000
					})
					.css($(this).offset())
					.appendTo("body");
			});

			return true;

		},

		_mouseStart: function(event) {

			var o = this.options;

			//Create and append the visible helper
			this.helper = this._createHelper(event);

			this.helper.addClass("ui-draggable-dragging");

			//Cache the helper size
			this._cacheHelperProportions();

			//If ddmanager is used for droppables, set the global draggable
			if ($.ui.ddmanager) {
				$.ui.ddmanager.current = this;
			}

			/*
			 * - Position generation -
			 * This block generates everything position related - it's the core of draggables.
			 */

			//Cache the margins of the original element
			this._cacheMargins();

			//Store the helper's css position
			this.cssPosition = this.helper.css("position");
			this.scrollParent = this.helper.scrollParent();
			this.offsetParent = this.helper.offsetParent();
			this.offsetParentCssPosition = this.offsetParent.css("position");

			//The element's absolute position on the page minus margins
			this.offset = this.positionAbs = this.element.offset();
			this.offset = {
				top: this.offset.top - this.margins.top,
				left: this.offset.left - this.margins.left
			};

			//Reset scroll cache
			this.offset.scroll = false;

			$.extend(this.offset, {
				click: { //Where the click happened, relative to the element
					left: event.pageX - this.offset.left,
					top: event.pageY - this.offset.top
				},
				parent: this._getParentOffset(),
				relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
			});

			//Generate the original position
			this.originalPosition = this.position = this._generatePosition(event);
			this.originalPageX = event.pageX;
			this.originalPageY = event.pageY;

			//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
			(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));

			//Set a containment if given in the options
			this._setContainment();

			//Trigger event + callbacks
			if (this._trigger("start", event) === false) {
				this._clear();
				return false;
			}

			//Recache the helper size
			this._cacheHelperProportions();

			//Prepare the droppable offsets
			if ($.ui.ddmanager && !o.dropBehaviour) {
				$.ui.ddmanager.prepareOffsets(this, event);
			}


			this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position

			//If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
			if ($.ui.ddmanager) {
				$.ui.ddmanager.dragStart(this, event);
			}

			return true;
		},

		_mouseDrag: function(event, noPropagation) {
			// reset any necessary cached properties (see #5009)
			if (this.offsetParentCssPosition === "fixed") {
				this.offset.parent = this._getParentOffset();
			}

			//Compute the helpers position
			this.position = this._generatePosition(event);
			this.positionAbs = this._convertPositionTo("absolute");

			//Call plugins and callbacks and use the resulting position if something is returned
			if (!noPropagation) {
				var ui = this._uiHash();
				if (this._trigger("drag", event, ui) === false) {
					this._mouseUp({});
					return false;
				}
				this.position = ui.position;
			}

			if (!this.options.axis || this.options.axis !== "y") {
				this.helper[0].style.left = this.position.left + "px";
			}
			if (!this.options.axis || this.options.axis !== "x") {
				this.helper[0].style.top = this.position.top + "px";
			}
			if ($.ui.ddmanager) {
				$.ui.ddmanager.drag(this, event);
			}

			return false;
		},

		_mouseStop: function(event) {

			//If we are using droppables, inform the manager about the drop
			var that = this,
				dropped = false;
			if ($.ui.ddmanager && !this.options.dropBehaviour) {
				dropped = $.ui.ddmanager.drop(this, event);
			}

			//if a drop comes from outside (a sortable)
			if (this.dropped) {
				dropped = this.dropped;
				this.dropped = false;
			}

			//if the original element is no longer in the DOM don't bother to continue (see #8269)
			if (this.options.helper === "original" && !$.contains(this.element[0].ownerDocument, this.element[0])) {
				return false;
			}

			if ((this.options.revert === "invalid" && !dropped) || (this.options.revert === "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
				$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
					if (that._trigger("stop", event) !== false) {
						that._clear();
					}
				});
			} else {
				if (this._trigger("stop", event) !== false) {
					this._clear();
				}
			}

			return false;
		},

		_mouseUp: function(event) {
			//Remove frame helpers
			$("div.ui-draggable-iframeFix").each(function() {
				this.parentNode.removeChild(this);
			});

			//If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
			if ($.ui.ddmanager) {
				$.ui.ddmanager.dragStop(this, event);
			}

			return $.ui.mouse.prototype._mouseUp.call(this, event);
		},

		cancel: function() {

			if (this.helper.is(".ui-draggable-dragging")) {
				this._mouseUp({});
			} else {
				this._clear();
			}

			return this;

		},

		_getHandle: function(event) {
			return this.options.handle ? !! $(event.target).closest(this.element.find(this.options.handle)).length :
				true;
		},

		_createHelper: function(event) {

			var o = this.options,
				helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper === "clone" ? this.element.clone().removeAttr("id") : this.element);

			if (!helper.parents("body").length) {
				helper.appendTo((o.appendTo === "parent" ? this.element[0].parentNode : o.appendTo));
			}

			if (helper[0] !== this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) {
				helper.css("position", "absolute");
			}

			return helper;

		},

		_adjustOffsetFromHelper: function(obj) {
			if (typeof obj === "string") {
				obj = obj.split(" ");
			}
			if ($.isArray(obj)) {
				obj = {
					left: +obj[0],
					top: +obj[1] || 0
				};
			}
			if ("left" in obj) {
				this.offset.click.left = obj.left + this.margins.left;
			}
			if ("right" in obj) {
				this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
			}
			if ("top" in obj) {
				this.offset.click.top = obj.top + this.margins.top;
			}
			if ("bottom" in obj) {
				this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
			}
		},

		_getParentOffset: function() {

			//Get the offsetParent and cache its position
			var po = this.offsetParent.offset();

			// This is a special case where we need to modify a offset calculated on start, since the following happened:
			// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
			// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
			//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
			if (this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
				po.left += this.scrollParent.scrollLeft();
				po.top += this.scrollParent.scrollTop();
			}

			//This needs to be actually done for all browsers, since pageX/pageY includes this information
			//Ugly IE fix
			if ((this.offsetParent[0] === document.body) ||
				(this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
				po = {
					top: 0,
					left: 0
				};
			}

			return {
				top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
				left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
			};

		},

		_getRelativeOffset: function() {

			if (this.cssPosition === "relative") {
				var p = this.element.position();
				return {
					top: p.top - (parseInt(this.helper.css("top"), 10) || 0) + this.scrollParent.scrollTop(),
					left: p.left - (parseInt(this.helper.css("left"), 10) || 0) + this.scrollParent.scrollLeft()
				};
			} else {
				return {
					top: 0,
					left: 0
				};
			}

		},

		_cacheMargins: function() {
			this.margins = {
				left: (parseInt(this.element.css("marginLeft"), 10) || 0),
				top: (parseInt(this.element.css("marginTop"), 10) || 0),
				right: (parseInt(this.element.css("marginRight"), 10) || 0),
				bottom: (parseInt(this.element.css("marginBottom"), 10) || 0)
			};
		},

		_cacheHelperProportions: function() {
			this.helperProportions = {
				width: this.helper.outerWidth(),
				height: this.helper.outerHeight()
			};
		},

		_setContainment: function() {

			var over, c, ce,
				o = this.options;

			if (!o.containment) {
				this.containment = null;
				return;
			}

			if (o.containment === "window") {
				this.containment = [
					$(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
					$(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
					$(window).scrollLeft() + $(window).width() - this.helperProportions.width - this.margins.left,
					$(window).scrollTop() + ($(window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
				];
				return;
			}

			if (o.containment === "document") {
				this.containment = [
					0,
					0,
					$(document).width() - this.helperProportions.width - this.margins.left, ($(document).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
				];
				return;
			}

			if (o.containment.constructor === Array) {
				this.containment = o.containment;
				return;
			}

			if (o.containment === "parent") {
				o.containment = this.helper[0].parentNode;
			}

			c = $(o.containment);
			ce = c[0];

			if (!ce) {
				return;
			}

			over = c.css("overflow") !== "hidden";

			this.containment = [
				(parseInt(c.css("borderLeftWidth"), 10) || 0) + (parseInt(c.css("paddingLeft"), 10) || 0), (parseInt(c.css("borderTopWidth"), 10) || 0) + (parseInt(c.css("paddingTop"), 10) || 0), (over ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) - (parseInt(c.css("borderRightWidth"), 10) || 0) - (parseInt(c.css("paddingRight"), 10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, (over ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) - (parseInt(c.css("borderBottomWidth"), 10) || 0) - (parseInt(c.css("paddingBottom"), 10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
			];
			this.relative_container = c;
		},

		_convertPositionTo: function(d, pos) {

			if (!pos) {
				pos = this.position;
			}

			var mod = d === "absolute" ? 1 : -1,
				scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent;

			//Cache the scroll
			if (!this.offset.scroll) {
				this.offset.scroll = {
					top: scroll.scrollTop(),
					left: scroll.scrollLeft()
				};
			}

			return {
				top: (
					pos.top + // The absolute mouse position
					this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
					((this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : this.offset.scroll.top) * mod)
				),
				left: (
					pos.left + // The absolute mouse position
					this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
					((this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : this.offset.scroll.left) * mod)
				)
			};

		},

		_generatePosition: function(event) {

			var containment, co, top, left,
				o = this.options,
				scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
				pageX = event.pageX,
				pageY = event.pageY;

			//Cache the scroll
			if (!this.offset.scroll) {
				this.offset.scroll = {
					top: scroll.scrollTop(),
					left: scroll.scrollLeft()
				};
			}

			/*
			 * - Position constraining -
			 * Constrain the position to a mix of grid, containment.
			 */

			// If we are not dragging yet, we won't check for options
			if (this.originalPosition) {
				if (this.containment) {
					if (this.relative_container) {
						co = this.relative_container.offset();
						containment = [
							this.containment[0] + co.left,
							this.containment[1] + co.top,
							this.containment[2] + co.left,
							this.containment[3] + co.top
						];
					} else {
						containment = this.containment;
					}

					if (event.pageX - this.offset.click.left < containment[0]) {
						pageX = containment[0] + this.offset.click.left;
					}
					if (event.pageY - this.offset.click.top < containment[1]) {
						pageY = containment[1] + this.offset.click.top;
					}
					if (event.pageX - this.offset.click.left > containment[2]) {
						pageX = containment[2] + this.offset.click.left;
					}
					if (event.pageY - this.offset.click.top > containment[3]) {
						pageY = containment[3] + this.offset.click.top;
					}
				}

				if (o.grid) {
					//Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
					top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
					pageY = containment ? ((top - this.offset.click.top >= containment[1] || top - this.offset.click.top > containment[3]) ? top : ((top - this.offset.click.top >= containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;

					left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
					pageX = containment ? ((left - this.offset.click.left >= containment[0] || left - this.offset.click.left > containment[2]) ? left : ((left - this.offset.click.left >= containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
				}

			}

			return {
				top: (
					pageY - // The absolute mouse position
					this.offset.click.top - // Click offset (relative to the element)
					this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
					(this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : this.offset.scroll.top)
				),
				left: (
					pageX - // The absolute mouse position
					this.offset.click.left - // Click offset (relative to the element)
					this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
					(this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : this.offset.scroll.left)
				)
			};

		},

		_clear: function() {
			this.helper.removeClass("ui-draggable-dragging");
			if (this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) {
				this.helper.remove();
			}
			this.helper = null;
			this.cancelHelperRemoval = false;
		},

		// From now on bulk stuff - mainly helpers

		_trigger: function(type, event, ui) {
			ui = ui || this._uiHash();
			$.ui.plugin.call(this, type, [event, ui]);
			//The absolute position has to be recalculated after plugins
			if (type === "drag") {
				this.positionAbs = this._convertPositionTo("absolute");
			}
			return $.Widget.prototype._trigger.call(this, type, event, ui);
		},

		plugins: {},

		_uiHash: function() {
			return {
				helper: this.helper,
				position: this.position,
				originalPosition: this.originalPosition,
				offset: this.positionAbs
			};
		}

	});

	$.ui.plugin.add("draggable", "connectToSortable", {
		start: function(event, ui) {

			var inst = $(this).data("ui-draggable"),
				o = inst.options,
				uiSortable = $.extend({}, ui, {
					item: inst.element
				});
			inst.sortables = [];
			$(o.connectToSortable).each(function() {
				var sortable = $.data(this, "ui-sortable");
				if (sortable && !sortable.options.disabled) {
					inst.sortables.push({
						instance: sortable,
						shouldRevert: sortable.options.revert
					});
					sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
					sortable._trigger("activate", event, uiSortable);
				}
			});

		},
		stop: function(event, ui) {

			//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
			var inst = $(this).data("ui-draggable"),
				uiSortable = $.extend({}, ui, {
					item: inst.element
				});

			$.each(inst.sortables, function() {
				if (this.instance.isOver) {

					this.instance.isOver = 0;

					inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
					this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)

					//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: "valid/invalid"
					if (this.shouldRevert) {
						this.instance.options.revert = this.shouldRevert;
					}

					//Trigger the stop of the sortable
					this.instance._mouseStop(event);

					this.instance.options.helper = this.instance.options._helper;

					//If the helper has been the original item, restore properties in the sortable
					if (inst.options.helper === "original") {
						this.instance.currentItem.css({
							top: "auto",
							left: "auto"
						});
					}

				} else {
					this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
					this.instance._trigger("deactivate", event, uiSortable);
				}

			});

		},
		drag: function(event, ui) {

			var inst = $(this).data("ui-draggable"),
				that = this;

			$.each(inst.sortables, function() {

				var innermostIntersecting = false,
					thisSortable = this;

				//Copy over some variables to allow calling the sortable's native _intersectsWith
				this.instance.positionAbs = inst.positionAbs;
				this.instance.helperProportions = inst.helperProportions;
				this.instance.offset.click = inst.offset.click;

				if (this.instance._intersectsWith(this.instance.containerCache)) {
					innermostIntersecting = true;
					$.each(inst.sortables, function() {
						this.instance.positionAbs = inst.positionAbs;
						this.instance.helperProportions = inst.helperProportions;
						this.instance.offset.click = inst.offset.click;
						if (this !== thisSortable &&
							this.instance._intersectsWith(this.instance.containerCache) &&
							$.contains(thisSortable.instance.element[0], this.instance.element[0])
						) {
							innermostIntersecting = false;
						}
						return innermostIntersecting;
					});
				}


				if (innermostIntersecting) {
					//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
					if (!this.instance.isOver) {

						this.instance.isOver = 1;
						//Now we fake the start of dragging for the sortable instance,
						//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
						//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
						this.instance.currentItem = $(that).clone().removeAttr("id").appendTo(this.instance.element).data("ui-sortable-item", true);
						this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
						this.instance.options.helper = function() {
							return ui.helper[0];
						};

						event.target = this.instance.currentItem[0];
						this.instance._mouseCapture(event, true);
						this.instance._mouseStart(event, true, true);

						//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
						this.instance.offset.click.top = inst.offset.click.top;
						this.instance.offset.click.left = inst.offset.click.left;
						this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
						this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;

						inst._trigger("toSortable", event);
						inst.dropped = this.instance.element; //draggable revert needs that
						//hack so receive/update callbacks work (mostly)
						inst.currentItem = inst.element;
						this.instance.fromOutside = inst;

					}

					//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
					if (this.instance.currentItem) {
						this.instance._mouseDrag(event);
					}

				} else {

					//If it doesn't intersect with the sortable, and it intersected before,
					//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
					if (this.instance.isOver) {

						this.instance.isOver = 0;
						this.instance.cancelHelperRemoval = true;

						//Prevent reverting on this forced stop
						this.instance.options.revert = false;

						// The out event needs to be triggered independently
						this.instance._trigger("out", event, this.instance._uiHash(this.instance));

						this.instance._mouseStop(event, true);
						this.instance.options.helper = this.instance.options._helper;

						//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
						this.instance.currentItem.remove();
						if (this.instance.placeholder) {
							this.instance.placeholder.remove();
						}

						inst._trigger("fromSortable", event);
						inst.dropped = false; //draggable revert needs that
					}

				}

			});

		}
	});

	$.ui.plugin.add("draggable", "cursor", {
		start: function() {
			var t = $("body"),
				o = $(this).data("ui-draggable").options;
			if (t.css("cursor")) {
				o._cursor = t.css("cursor");
			}
			t.css("cursor", o.cursor);
		},
		stop: function() {
			var o = $(this).data("ui-draggable").options;
			if (o._cursor) {
				$("body").css("cursor", o._cursor);
			}
		}
	});

	$.ui.plugin.add("draggable", "opacity", {
		start: function(event, ui) {
			var t = $(ui.helper),
				o = $(this).data("ui-draggable").options;
			if (t.css("opacity")) {
				o._opacity = t.css("opacity");
			}
			t.css("opacity", o.opacity);
		},
		stop: function(event, ui) {
			var o = $(this).data("ui-draggable").options;
			if (o._opacity) {
				$(ui.helper).css("opacity", o._opacity);
			}
		}
	});

	$.ui.plugin.add("draggable", "scroll", {
		start: function() {
			var i = $(this).data("ui-draggable");
			if (i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") {
				i.overflowOffset = i.scrollParent.offset();
			}
		},
		drag: function(event) {

			var i = $(this).data("ui-draggable"),
				o = i.options,
				scrolled = false;

			if (i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") {

				if (!o.axis || o.axis !== "x") {
					if ((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) {
						i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
					} else if (event.pageY - i.overflowOffset.top < o.scrollSensitivity) {
						i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
					}
				}

				if (!o.axis || o.axis !== "y") {
					if ((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) {
						i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
					} else if (event.pageX - i.overflowOffset.left < o.scrollSensitivity) {
						i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
					}
				}

			} else {

				if (!o.axis || o.axis !== "x") {
					if (event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
						scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
					} else if ($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) {
						scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
					}
				}

				if (!o.axis || o.axis !== "y") {
					if (event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
						scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
					} else if ($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) {
						scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
					}
				}

			}

			if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
				$.ui.ddmanager.prepareOffsets(i, event);
			}

		}
	});

	$.ui.plugin.add("draggable", "snap", {
		start: function() {

			var i = $(this).data("ui-draggable"),
				o = i.options;

			i.snapElements = [];

			$(o.snap.constructor !== String ? (o.snap.items || ":data(ui-draggable)") : o.snap).each(function() {
				var $t = $(this),
					$o = $t.offset();
				if (this !== i.element[0]) {
					i.snapElements.push({
						item: this,
						width: $t.outerWidth(),
						height: $t.outerHeight(),
						top: $o.top,
						left: $o.left
					});
				}
			});

		},
		drag: function(event, ui) {

			var ts, bs, ls, rs, l, r, t, b, i, first,
				inst = $(this).data("ui-draggable"),
				o = inst.options,
				d = o.snapTolerance,
				x1 = ui.offset.left,
				x2 = x1 + inst.helperProportions.width,
				y1 = ui.offset.top,
				y2 = y1 + inst.helperProportions.height;

			for (i = inst.snapElements.length - 1; i >= 0; i--) {

				l = inst.snapElements[i].left;
				r = l + inst.snapElements[i].width;
				t = inst.snapElements[i].top;
				b = t + inst.snapElements[i].height;

				if (x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d || !$.contains(inst.snapElements[i].item.ownerDocument, inst.snapElements[i].item)) {
					if (inst.snapElements[i].snapping) {
						(inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), {
							snapItem: inst.snapElements[i].item
						})));
					}
					inst.snapElements[i].snapping = false;
					continue;
				}

				if (o.snapMode !== "inner") {
					ts = Math.abs(t - y2) <= d;
					bs = Math.abs(b - y1) <= d;
					ls = Math.abs(l - x2) <= d;
					rs = Math.abs(r - x1) <= d;
					if (ts) {
						ui.position.top = inst._convertPositionTo("relative", {
							top: t - inst.helperProportions.height,
							left: 0
						}).top - inst.margins.top;
					}
					if (bs) {
						ui.position.top = inst._convertPositionTo("relative", {
							top: b,
							left: 0
						}).top - inst.margins.top;
					}
					if (ls) {
						ui.position.left = inst._convertPositionTo("relative", {
							top: 0,
							left: l - inst.helperProportions.width
						}).left - inst.margins.left;
					}
					if (rs) {
						ui.position.left = inst._convertPositionTo("relative", {
							top: 0,
							left: r
						}).left - inst.margins.left;
					}
				}

				first = (ts || bs || ls || rs);

				if (o.snapMode !== "outer") {
					ts = Math.abs(t - y1) <= d;
					bs = Math.abs(b - y2) <= d;
					ls = Math.abs(l - x1) <= d;
					rs = Math.abs(r - x2) <= d;
					if (ts) {
						ui.position.top = inst._convertPositionTo("relative", {
							top: t,
							left: 0
						}).top - inst.margins.top;
					}
					if (bs) {
						ui.position.top = inst._convertPositionTo("relative", {
							top: b - inst.helperProportions.height,
							left: 0
						}).top - inst.margins.top;
					}
					if (ls) {
						ui.position.left = inst._convertPositionTo("relative", {
							top: 0,
							left: l
						}).left - inst.margins.left;
					}
					if (rs) {
						ui.position.left = inst._convertPositionTo("relative", {
							top: 0,
							left: r - inst.helperProportions.width
						}).left - inst.margins.left;
					}
				}

				if (!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) {
					(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), {
						snapItem: inst.snapElements[i].item
					})));
				}
				inst.snapElements[i].snapping = (ts || bs || ls || rs || first);

			}

		}
	});

	$.ui.plugin.add("draggable", "stack", {
		start: function() {
			var min,
				o = this.data("ui-draggable").options,
				group = $.makeArray($(o.stack)).sort(function(a, b) {
					return (parseInt($(a).css("zIndex"), 10) || 0) - (parseInt($(b).css("zIndex"), 10) || 0);
				});

			if (!group.length) {
				return;
			}

			min = parseInt($(group[0]).css("zIndex"), 10) || 0;
			$(group).each(function(i) {
				$(this).css("zIndex", min + i);
			});
			this.css("zIndex", (min + group.length));
		}
	});

	$.ui.plugin.add("draggable", "zIndex", {
		start: function(event, ui) {
			var t = $(ui.helper),
				o = $(this).data("ui-draggable").options;
			if (t.css("zIndex")) {
				o._zIndex = t.css("zIndex");
			}
			t.css("zIndex", o.zIndex);
		},
		stop: function(event, ui) {
			var o = $(this).data("ui-draggable").options;
			if (o._zIndex) {
				$(ui.helper).css("zIndex", o._zIndex);
			}
		}
	});

})(jQuery);

(function($, undefined) {

	function isOverAxis(x, reference, size) {
		return (x > reference) && (x < (reference + size));
	}

	$.widget("ui.droppable", {
		version: "1.10.3",
		widgetEventPrefix: "drop",
		options: {
			accept: "*",
			activeClass: false,
			addClasses: true,
			greedy: false,
			hoverClass: false,
			scope: "default",
			tolerance: "intersect",

			// callbacks
			activate: null,
			deactivate: null,
			drop: null,
			out: null,
			over: null
		},
		_create: function() {

			var o = this.options,
				accept = o.accept;

			this.isover = false;
			this.isout = true;

			this.accept = $.isFunction(accept) ? accept : function(d) {
				return d.is(accept);
			};

			//Store the droppable's proportions
			this.proportions = {
				width: this.element[0].offsetWidth,
				height: this.element[0].offsetHeight
			};

			// Add the reference and positions to the manager
			$.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
			$.ui.ddmanager.droppables[o.scope].push(this);

			(o.addClasses && this.element.addClass("ui-droppable"));

		},

		_destroy: function() {
			var i = 0,
				drop = $.ui.ddmanager.droppables[this.options.scope];

			for (; i < drop.length; i++) {
				if (drop[i] === this) {
					drop.splice(i, 1);
				}
			}

			this.element.removeClass("ui-droppable ui-droppable-disabled");
		},

		_setOption: function(key, value) {

			if (key === "accept") {
				this.accept = $.isFunction(value) ? value : function(d) {
					return d.is(value);
				};
			}
			$.Widget.prototype._setOption.apply(this, arguments);
		},

		_activate: function(event) {
			var draggable = $.ui.ddmanager.current;
			if (this.options.activeClass) {
				this.element.addClass(this.options.activeClass);
			}
			if (draggable) {
				this._trigger("activate", event, this.ui(draggable));
			}
		},

		_deactivate: function(event) {
			var draggable = $.ui.ddmanager.current;
			if (this.options.activeClass) {
				this.element.removeClass(this.options.activeClass);
			}
			if (draggable) {
				this._trigger("deactivate", event, this.ui(draggable));
			}
		},

		_over: function(event) {

			var draggable = $.ui.ddmanager.current;

			// Bail if draggable and droppable are same element
			if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
				return;
			}

			if (this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) {
				if (this.options.hoverClass) {
					this.element.addClass(this.options.hoverClass);
				}
				this._trigger("over", event, this.ui(draggable));
			}

		},

		_out: function(event) {

			var draggable = $.ui.ddmanager.current;

			// Bail if draggable and droppable are same element
			if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
				return;
			}

			if (this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) {
				if (this.options.hoverClass) {
					this.element.removeClass(this.options.hoverClass);
				}
				this._trigger("out", event, this.ui(draggable));
			}

		},

		_drop: function(event, custom) {

			var draggable = custom || $.ui.ddmanager.current,
				childrenIntersection = false;

			// Bail if draggable and droppable are same element
			if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
				return false;
			}

			this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function() {
				var inst = $.data(this, "ui-droppable");
				if (
					inst.options.greedy && !inst.options.disabled &&
					inst.options.scope === draggable.options.scope &&
					inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) &&
					$.ui.intersect(draggable, $.extend(inst, {
						offset: inst.element.offset()
					}), inst.options.tolerance)
				) {
					childrenIntersection = true;
					return false;
				}
			});
			if (childrenIntersection) {
				return false;
			}

			if (this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) {
				if (this.options.activeClass) {
					this.element.removeClass(this.options.activeClass);
				}
				if (this.options.hoverClass) {
					this.element.removeClass(this.options.hoverClass);
				}
				this._trigger("drop", event, this.ui(draggable));
				return this.element;
			}

			return false;

		},

		ui: function(c) {
			return {
				draggable: (c.currentItem || c.element),
				helper: c.helper,
				position: c.position,
				offset: c.positionAbs
			};
		}

	});

	$.ui.intersect = function(draggable, droppable, toleranceMode) {

		if (!droppable.offset) {
			return false;
		}

		var draggableLeft, draggableTop,
			x1 = (draggable.positionAbs || draggable.position.absolute).left,
			x2 = x1 + draggable.helperProportions.width,
			y1 = (draggable.positionAbs || draggable.position.absolute).top,
			y2 = y1 + draggable.helperProportions.height,
			l = droppable.offset.left,
			r = l + droppable.proportions.width,
			t = droppable.offset.top,
			b = t + droppable.proportions.height;

		switch (toleranceMode) {
			case "fit":
				return (l <= x1 && x2 <= r && t <= y1 && y2 <= b);
			case "intersect":
				return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half
					x2 - (draggable.helperProportions.width / 2) < r && // Left Half
					t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half
					y2 - (draggable.helperProportions.height / 2) < b); // Top Half
			case "pointer":
				draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left);
				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top);
				return isOverAxis(draggableTop, t, droppable.proportions.height) && isOverAxis(draggableLeft, l, droppable.proportions.width);
			case "touch":
				return (
					(y1 >= t && y1 <= b) || // Top edge touching
					(y2 >= t && y2 <= b) || // Bottom edge touching
					(y1 < t && y2 > b) // Surrounded vertically
				) && (
					(x1 >= l && x1 <= r) || // Left edge touching
					(x2 >= l && x2 <= r) || // Right edge touching
					(x1 < l && x2 > r) // Surrounded horizontally
				);
			default:
				return false;
		}

	};

	/*
    This manager tracks offsets of draggables and droppables
*/
	$.ui.ddmanager = {
		current: null,
		droppables: {
			"default": []
		},
		prepareOffsets: function(t, event) {

			var i, j,
				m = $.ui.ddmanager.droppables[t.options.scope] || [],
				type = event ? event.type : null, // workaround for #2317
				list = (t.currentItem || t.element).find(":data(ui-droppable)").addBack();

			droppablesLoop: for (i = 0; i < m.length; i++) {

				//No disabled and non-accepted
				if (m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0], (t.currentItem || t.element)))) {
					continue;
				}

				// Filter out elements in the current dragged item
				for (j = 0; j < list.length; j++) {
					if (list[j] === m[i].element[0]) {
						m[i].proportions.height = 0;
						continue droppablesLoop;
					}
				}

				m[i].visible = m[i].element.css("display") !== "none";
				if (!m[i].visible) {
					continue;
				}

				//Activate the droppable if used directly from draggables
				if (type === "mousedown") {
					m[i]._activate.call(m[i], event);
				}

				m[i].offset = m[i].element.offset();
				m[i].proportions = {
					width: m[i].element[0].offsetWidth,
					height: m[i].element[0].offsetHeight
				};

			}

		},
		drop: function(draggable, event) {

			var dropped = false;
			// Create a copy of the droppables in case the list changes during the drop (#9116)
			$.each(($.ui.ddmanager.droppables[draggable.options.scope] || []).slice(), function() {

				if (!this.options) {
					return;
				}
				if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) {
					dropped = this._drop.call(this, event) || dropped;
				}

				if (!this.options.disabled && this.visible && this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) {
					this.isout = true;
					this.isover = false;
					this._deactivate.call(this, event);
				}

			});
			return dropped;

		},
		dragStart: function(draggable, event) {
			//Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
			draggable.element.parentsUntil("body").bind("scroll.droppable", function() {
				if (!draggable.options.refreshPositions) {
					$.ui.ddmanager.prepareOffsets(draggable, event);
				}
			});
		},
		drag: function(draggable, event) {

			//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
			if (draggable.options.refreshPositions) {
				$.ui.ddmanager.prepareOffsets(draggable, event);
			}

			//Run through all droppables and check their positions based on specific tolerance options
			$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {

				if (this.options.disabled || this.greedyChild || !this.visible) {
					return;
				}

				var parentInstance, scope, parent,
					intersects = $.ui.intersect(draggable, this, this.options.tolerance),
					c = !intersects && this.isover ? "isout" : (intersects && !this.isover ? "isover" : null);
				if (!c) {
					return;
				}

				if (this.options.greedy) {
					// find droppable parents with same scope
					scope = this.options.scope;
					parent = this.element.parents(":data(ui-droppable)").filter(function() {
						return $.data(this, "ui-droppable").options.scope === scope;
					});

					if (parent.length) {
						parentInstance = $.data(parent[0], "ui-droppable");
						parentInstance.greedyChild = (c === "isover");
					}
				}

				// we just moved into a greedy child
				if (parentInstance && c === "isover") {
					parentInstance.isover = false;
					parentInstance.isout = true;
					parentInstance._out.call(parentInstance, event);
				}

				this[c] = true;
				this[c === "isout" ? "isover" : "isout"] = false;
				this[c === "isover" ? "_over" : "_out"].call(this, event);

				// we just moved out of a greedy child
				if (parentInstance && c === "isout") {
					parentInstance.isout = false;
					parentInstance.isover = true;
					parentInstance._over.call(parentInstance, event);
				}
			});

		},
		dragStop: function(draggable, event) {
			draggable.element.parentsUntil("body").unbind("scroll.droppable");
			//Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
			if (!draggable.options.refreshPositions) {
				$.ui.ddmanager.prepareOffsets(draggable, event);
			}
		}
	};

})(jQuery);

(function($, undefined) {

	function num(v) {
		return parseInt(v, 10) || 0;
	}

	function isNumber(value) {
		return !isNaN(parseInt(value, 10));
	}

	$.widget("ui.resizable", $.ui.mouse, {
		version: "1.10.3",
		widgetEventPrefix: "resize",
		options: {
			alsoResize: false,
			animate: false,
			animateDuration: "slow",
			animateEasing: "swing",
			aspectRatio: false,
			autoHide: false,
			containment: false,
			ghost: false,
			grid: false,
			handles: "e,s,se",
			helper: false,
			maxHeight: null,
			maxWidth: null,
			minHeight: 10,
			minWidth: 10,
			// See #7960
			zIndex: 90,

			// callbacks
			resize: null,
			start: null,
			stop: null
		},
		_create: function() {

			var n, i, handle, axis, hname,
				that = this,
				o = this.options;
			this.element.addClass("ui-resizable");

			$.extend(this, {
				_aspectRatio: !! (o.aspectRatio),
				aspectRatio: o.aspectRatio,
				originalElement: this.element,
				_proportionallyResizeElements: [],
				_helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null
			});

			//Wrap the element if it cannot hold child nodes
			if (this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {

				//Create a wrapper element and set the wrapper to the new current internal element
				this.element.wrap(
					$("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({
						position: this.element.css("position"),
						width: this.element.outerWidth(),
						height: this.element.outerHeight(),
						top: this.element.css("top"),
						left: this.element.css("left")
					})
				);

				//Overwrite the original this.element
				this.element = this.element.parent().data(
					"ui-resizable", this.element.data("ui-resizable")
				);

				this.elementIsWrapper = true;

				//Move margins to the wrapper
				this.element.css({
					marginLeft: this.originalElement.css("marginLeft"),
					marginTop: this.originalElement.css("marginTop"),
					marginRight: this.originalElement.css("marginRight"),
					marginBottom: this.originalElement.css("marginBottom")
				});
				this.originalElement.css({
					marginLeft: 0,
					marginTop: 0,
					marginRight: 0,
					marginBottom: 0
				});

				//Prevent Safari textarea resize
				this.originalResizeStyle = this.originalElement.css("resize");
				this.originalElement.css("resize", "none");

				//Push the actual element to our proportionallyResize internal array
				this._proportionallyResizeElements.push(this.originalElement.css({
					position: "static",
					zoom: 1,
					display: "block"
				}));

				// avoid IE jump (hard set the margin)
				this.originalElement.css({
					margin: this.originalElement.css("margin")
				});

				// fix handlers offset
				this._proportionallyResize();

			}

			this.handles = o.handles || (!$(".ui-resizable-handle", this.element).length ? "e,s,se" : {
				n: ".ui-resizable-n",
				e: ".ui-resizable-e",
				s: ".ui-resizable-s",
				w: ".ui-resizable-w",
				se: ".ui-resizable-se",
				sw: ".ui-resizable-sw",
				ne: ".ui-resizable-ne",
				nw: ".ui-resizable-nw"
			});
			if (this.handles.constructor === String) {

				if (this.handles === "all") {
					this.handles = "n,e,s,w,se,sw,ne,nw";
				}

				n = this.handles.split(",");
				this.handles = {};

				for (i = 0; i < n.length; i++) {

					handle = $.trim(n[i]);
					hname = "ui-resizable-" + handle;
					axis = $("<div class='ui-resizable-handle " + hname + "'></div>");

					// Apply zIndex to all handles - see #7960
					axis.css({
						zIndex: o.zIndex
					});

					//TODO : What's going on here?
					if ("se" === handle) {
						axis.addClass("ui-icon ui-icon-gripsmall-diagonal-se");
					}

					//Insert into internal handles object and append to element
					this.handles[handle] = ".ui-resizable-" + handle;
					this.element.append(axis);
				}

			}

			this._renderAxis = function(target) {

				var i, axis, padPos, padWrapper;

				target = target || this.element;

				for (i in this.handles) {

					if (this.handles[i].constructor === String) {
						this.handles[i] = $(this.handles[i], this.element).show();
					}

					//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
					if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {

						axis = $(this.handles[i], this.element);

						//Checking the correct pad and border
						padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();

						//The padding type i have to apply...
						padPos = ["padding",
							/ne|nw|n/.test(i) ? "Top" :
							/se|sw|s/.test(i) ? "Bottom" :
							/^e$/.test(i) ? "Right" : "Left"
						].join("");

						target.css(padPos, padWrapper);

						this._proportionallyResize();

					}

					//TODO: What's that good for? There's not anything to be executed left
					if (!$(this.handles[i]).length) {
						continue;
					}
				}
			};

			//TODO: make renderAxis a prototype function
			this._renderAxis(this.element);

			this._handles = $(".ui-resizable-handle", this.element)
				.disableSelection();

			//Matching axis name
			this._handles.mouseover(function() {
				if (!that.resizing) {
					if (this.className) {
						axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
					}
					//Axis, default = se
					that.axis = axis && axis[1] ? axis[1] : "se";
				}
			});

			//If we want to auto hide the elements
			if (o.autoHide) {
				this._handles.hide();
				$(this.element)
					.addClass("ui-resizable-autohide")
					.mouseenter(function() {
						if (o.disabled) {
							return;
						}
						$(this).removeClass("ui-resizable-autohide");
						that._handles.show();
					})
					.mouseleave(function() {
						if (o.disabled) {
							return;
						}
						if (!that.resizing) {
							$(this).addClass("ui-resizable-autohide");
							that._handles.hide();
						}
					});
			}

			//Initialize the mouse interaction
			this._mouseInit();

		},

		_destroy: function() {

			this._mouseDestroy();

			var wrapper,
				_destroy = function(exp) {
					$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
						.removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove();
				};

			//TODO: Unwrap at same DOM position
			if (this.elementIsWrapper) {
				_destroy(this.element);
				wrapper = this.element;
				this.originalElement.css({
					position: wrapper.css("position"),
					width: wrapper.outerWidth(),
					height: wrapper.outerHeight(),
					top: wrapper.css("top"),
					left: wrapper.css("left")
				}).insertAfter(wrapper);
				wrapper.remove();
			}

			this.originalElement.css("resize", this.originalResizeStyle);
			_destroy(this.originalElement);

			return this;
		},

		_mouseCapture: function(event) {
			var i, handle,
				capture = false;

			for (i in this.handles) {
				handle = $(this.handles[i])[0];
				if (handle === event.target || $.contains(handle, event.target)) {
					capture = true;
				}
			}

			return !this.options.disabled && capture;
		},

		_mouseStart: function(event) {

			var curleft, curtop, cursor,
				o = this.options,
				iniPos = this.element.position(),
				el = this.element;

			this.resizing = true;

			// bugfix for http://dev.jquery.com/ticket/1749
			if ((/absolute/).test(el.css("position"))) {
				el.css({
					position: "absolute",
					top: el.css("top"),
					left: el.css("left")
				});
			} else if (el.is(".ui-draggable")) {
				el.css({
					position: "absolute",
					top: iniPos.top,
					left: iniPos.left
				});
			}

			this._renderProxy();

			curleft = num(this.helper.css("left"));
			curtop = num(this.helper.css("top"));

			if (o.containment) {
				curleft += $(o.containment).scrollLeft() || 0;
				curtop += $(o.containment).scrollTop() || 0;
			}

			//Store needed variables
			this.offset = this.helper.offset();
			this.position = {
				left: curleft,
				top: curtop
			};
			this.size = this._helper ? {
				width: el.outerWidth(),
				height: el.outerHeight()
			} : {
				width: el.width(),
				height: el.height()
			};
			this.originalSize = this._helper ? {
				width: el.outerWidth(),
				height: el.outerHeight()
			} : {
				width: el.width(),
				height: el.height()
			};
			this.originalPosition = {
				left: curleft,
				top: curtop
			};
			this.sizeDiff = {
				width: el.outerWidth() - el.width(),
				height: el.outerHeight() - el.height()
			};
			this.originalMousePosition = {
				left: event.pageX,
				top: event.pageY
			};

			//Aspect Ratio
			this.aspectRatio = (typeof o.aspectRatio === "number") ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);

			cursor = $(".ui-resizable-" + this.axis).css("cursor");
			$("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor);

			el.addClass("ui-resizable-resizing");
			this._propagate("start", event);
			return true;
		},

		_mouseDrag: function(event) {

			//Increase performance, avoid regex
			var data,
				el = this.helper,
				props = {},
				smp = this.originalMousePosition,
				a = this.axis,
				prevTop = this.position.top,
				prevLeft = this.position.left,
				prevWidth = this.size.width,
				prevHeight = this.size.height,
				dx = (event.pageX - smp.left) || 0,
				dy = (event.pageY - smp.top) || 0,
				trigger = this._change[a];

			if (!trigger) {
				return false;
			}

			// Calculate the attrs that will be change
			data = trigger.apply(this, [event, dx, dy]);

			// Put this in the mouseDrag handler since the user can start pressing shift while resizing
			this._updateVirtualBoundaries(event.shiftKey);
			if (this._aspectRatio || event.shiftKey) {
				data = this._updateRatio(data, event);
			}

			data = this._respectSize(data, event);

			this._updateCache(data);

			// plugins callbacks need to be called first
			this._propagate("resize", event);

			if (this.position.top !== prevTop) {
				props.top = this.position.top + "px";
			}
			if (this.position.left !== prevLeft) {
				props.left = this.position.left + "px";
			}
			if (this.size.width !== prevWidth) {
				props.width = this.size.width + "px";
			}
			if (this.size.height !== prevHeight) {
				props.height = this.size.height + "px";
			}
			el.css(props);

			if (!this._helper && this._proportionallyResizeElements.length) {
				this._proportionallyResize();
			}

			// Call the user callback if the element was resized
			if (!$.isEmptyObject(props)) {
				this._trigger("resize", event, this.ui());
			}

			return false;
		},

		_mouseStop: function(event) {

			this.resizing = false;
			var pr, ista, soffseth, soffsetw, s, left, top,
				o = this.options,
				that = this;

			if (this._helper) {

				pr = this._proportionallyResizeElements;
				ista = pr.length && (/textarea/i).test(pr[0].nodeName);
				soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height;
				soffsetw = ista ? 0 : that.sizeDiff.width;

				s = {
					width: (that.helper.width() - soffsetw),
					height: (that.helper.height() - soffseth)
				};
				left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null;
				top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null;

				if (!o.animate) {
					this.element.css($.extend(s, {
						top: top,
						left: left
					}));
				}

				that.helper.height(that.size.height);
				that.helper.width(that.size.width);

				if (this._helper && !o.animate) {
					this._proportionallyResize();
				}
			}

			$("body").css("cursor", "auto");

			this.element.removeClass("ui-resizable-resizing");

			this._propagate("stop", event);

			if (this._helper) {
				this.helper.remove();
			}

			return false;

		},

		_updateVirtualBoundaries: function(forceAspectRatio) {
			var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
				o = this.options;

			b = {
				minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
				maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
				minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
				maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
			};

			if (this._aspectRatio || forceAspectRatio) {
				// We want to create an enclosing box whose aspect ration is the requested one
				// First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
				pMinWidth = b.minHeight * this.aspectRatio;
				pMinHeight = b.minWidth / this.aspectRatio;
				pMaxWidth = b.maxHeight * this.aspectRatio;
				pMaxHeight = b.maxWidth / this.aspectRatio;

				if (pMinWidth > b.minWidth) {
					b.minWidth = pMinWidth;
				}
				if (pMinHeight > b.minHeight) {
					b.minHeight = pMinHeight;
				}
				if (pMaxWidth < b.maxWidth) {
					b.maxWidth = pMaxWidth;
				}
				if (pMaxHeight < b.maxHeight) {
					b.maxHeight = pMaxHeight;
				}
			}
			this._vBoundaries = b;
		},

		_updateCache: function(data) {
			this.offset = this.helper.offset();
			if (isNumber(data.left)) {
				this.position.left = data.left;
			}
			if (isNumber(data.top)) {
				this.position.top = data.top;
			}
			if (isNumber(data.height)) {
				this.size.height = data.height;
			}
			if (isNumber(data.width)) {
				this.size.width = data.width;
			}
		},

		_updateRatio: function(data) {

			var cpos = this.position,
				csize = this.size,
				a = this.axis;

			if (isNumber(data.height)) {
				data.width = (data.height * this.aspectRatio);
			} else if (isNumber(data.width)) {
				data.height = (data.width / this.aspectRatio);
			}

			if (a === "sw") {
				data.left = cpos.left + (csize.width - data.width);
				data.top = null;
			}
			if (a === "nw") {
				data.top = cpos.top + (csize.height - data.height);
				data.left = cpos.left + (csize.width - data.width);
			}

			return data;
		},

		_respectSize: function(data) {

			var o = this._vBoundaries,
				a = this.axis,
				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width),
				ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
				isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width),
				isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height),
				dw = this.originalPosition.left + this.originalSize.width,
				dh = this.position.top + this.size.height,
				cw = /sw|nw|w/.test(a),
				ch = /nw|ne|n/.test(a);
			if (isminw) {
				data.width = o.minWidth;
			}
			if (isminh) {
				data.height = o.minHeight;
			}
			if (ismaxw) {
				data.width = o.maxWidth;
			}
			if (ismaxh) {
				data.height = o.maxHeight;
			}

			if (isminw && cw) {
				data.left = dw - o.minWidth;
			}
			if (ismaxw && cw) {
				data.left = dw - o.maxWidth;
			}
			if (isminh && ch) {
				data.top = dh - o.minHeight;
			}
			if (ismaxh && ch) {
				data.top = dh - o.maxHeight;
			}

			// fixing jump error on top/left - bug #2330
			if (!data.width && !data.height && !data.left && data.top) {
				data.top = null;
			} else if (!data.width && !data.height && !data.top && data.left) {
				data.left = null;
			}

			return data;
		},

		_proportionallyResize: function() {

			if (!this._proportionallyResizeElements.length) {
				return;
			}

			var i, j, borders, paddings, prel,
				element = this.helper || this.element;

			for (i = 0; i < this._proportionallyResizeElements.length; i++) {

				prel = this._proportionallyResizeElements[i];

				if (!this.borderDif) {
					this.borderDif = [];
					borders = [prel.css("borderTopWidth"), prel.css("borderRightWidth"), prel.css("borderBottomWidth"), prel.css("borderLeftWidth")];
					paddings = [prel.css("paddingTop"), prel.css("paddingRight"), prel.css("paddingBottom"), prel.css("paddingLeft")];

					for (j = 0; j < borders.length; j++) {
						this.borderDif[j] = (parseInt(borders[j], 10) || 0) + (parseInt(paddings[j], 10) || 0);
					}
				}

				prel.css({
					height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
					width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
				});

			}

		},

		_renderProxy: function() {

			var el = this.element,
				o = this.options;
			this.elementOffset = el.offset();

			if (this._helper) {

				this.helper = this.helper || $("<div style='overflow:hidden;'></div>");

				this.helper.addClass(this._helper).css({
					width: this.element.outerWidth() - 1,
					height: this.element.outerHeight() - 1,
					position: "absolute",
					left: this.elementOffset.left + "px",
					top: this.elementOffset.top + "px",
					zIndex: ++o.zIndex //TODO: Don't modify option
				});

				this.helper
					.appendTo("body")
					.disableSelection();

			} else {
				this.helper = this.element;
			}

		},

		_change: {
			e: function(event, dx) {
				return {
					width: this.originalSize.width + dx
				};
			},
			w: function(event, dx) {
				var cs = this.originalSize,
					sp = this.originalPosition;
				return {
					left: sp.left + dx,
					width: cs.width - dx
				};
			},
			n: function(event, dx, dy) {
				var cs = this.originalSize,
					sp = this.originalPosition;
				return {
					top: sp.top + dy,
					height: cs.height - dy
				};
			},
			s: function(event, dx, dy) {
				return {
					height: this.originalSize.height + dy
				};
			},
			se: function(event, dx, dy) {
				return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
			},
			sw: function(event, dx, dy) {
				return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
			},
			ne: function(event, dx, dy) {
				return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
			},
			nw: function(event, dx, dy) {
				return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
			}
		},

		_propagate: function(n, event) {
			$.ui.plugin.call(this, n, [event, this.ui()]);
			(n !== "resize" && this._trigger(n, event, this.ui()));
		},

		plugins: {},

		ui: function() {
			return {
				originalElement: this.originalElement,
				element: this.element,
				helper: this.helper,
				position: this.position,
				size: this.size,
				originalSize: this.originalSize,
				originalPosition: this.originalPosition
			};
		}

	});

	/*
	 * Resizable Extensions
	 */

	$.ui.plugin.add("resizable", "animate", {

		stop: function(event) {
			var that = $(this).data("ui-resizable"),
				o = that.options,
				pr = that._proportionallyResizeElements,
				ista = pr.length && (/textarea/i).test(pr[0].nodeName),
				soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height,
				soffsetw = ista ? 0 : that.sizeDiff.width,
				style = {
					width: (that.size.width - soffsetw),
					height: (that.size.height - soffseth)
				},
				left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null,
				top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null;

			that.element.animate(
				$.extend(style, top && left ? {
					top: top,
					left: left
				} : {}), {
					duration: o.animateDuration,
					easing: o.animateEasing,
					step: function() {

						var data = {
							width: parseInt(that.element.css("width"), 10),
							height: parseInt(that.element.css("height"), 10),
							top: parseInt(that.element.css("top"), 10),
							left: parseInt(that.element.css("left"), 10)
						};

						if (pr && pr.length) {
							$(pr[0]).css({
								width: data.width,
								height: data.height
							});
						}

						// propagating resize, and updating values for each animation step
						that._updateCache(data);
						that._propagate("resize", event);

					}
				}
			);
		}

	});

	$.ui.plugin.add("resizable", "containment", {

		start: function() {
			var element, p, co, ch, cw, width, height,
				that = $(this).data("ui-resizable"),
				o = that.options,
				el = that.element,
				oc = o.containment,
				ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;

			if (!ce) {
				return;
			}

			that.containerElement = $(ce);

			if (/document/.test(oc) || oc === document) {
				that.containerOffset = {
					left: 0,
					top: 0
				};
				that.containerPosition = {
					left: 0,
					top: 0
				};

				that.parentData = {
					element: $(document),
					left: 0,
					top: 0,
					width: $(document).width(),
					height: $(document).height() || document.body.parentNode.scrollHeight
				};
			}

			// i'm a node, so compute top, left, right, bottom
			else {
				element = $(ce);
				p = [];
				$(["Top", "Right", "Left", "Bottom"]).each(function(i, name) {
					p[i] = num(element.css("padding" + name));
				});

				that.containerOffset = element.offset();
				that.containerPosition = element.position();
				that.containerSize = {
					height: (element.innerHeight() - p[3]),
					width: (element.innerWidth() - p[1])
				};

				co = that.containerOffset;
				ch = that.containerSize.height;
				cw = that.containerSize.width;
				width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw);
				height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);

				that.parentData = {
					element: ce,
					left: co.left,
					top: co.top,
					width: width,
					height: height
				};
			}
		},

		resize: function(event) {
			var woset, hoset, isParent, isOffsetRelative,
				that = $(this).data("ui-resizable"),
				o = that.options,
				co = that.containerOffset,
				cp = that.position,
				pRatio = that._aspectRatio || event.shiftKey,
				cop = {
					top: 0,
					left: 0
				}, ce = that.containerElement;

			if (ce[0] !== document && (/static/).test(ce.css("position"))) {
				cop = co;
			}

			if (cp.left < (that._helper ? co.left : 0)) {
				that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left));
				if (pRatio) {
					that.size.height = that.size.width / that.aspectRatio;
				}
				that.position.left = o.helper ? co.left : 0;
			}

			if (cp.top < (that._helper ? co.top : 0)) {
				that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top);
				if (pRatio) {
					that.size.width = that.size.height * that.aspectRatio;
				}
				that.position.top = that._helper ? co.top : 0;
			}

			that.offset.left = that.parentData.left + that.position.left;
			that.offset.top = that.parentData.top + that.position.top;

			woset = Math.abs((that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width);
			hoset = Math.abs((that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height);

			isParent = that.containerElement.get(0) === that.element.parent().get(0);
			isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position"));

			if (isParent && isOffsetRelative) {
				woset -= that.parentData.left;
			}

			if (woset + that.size.width >= that.parentData.width) {
				that.size.width = that.parentData.width - woset;
				if (pRatio) {
					that.size.height = that.size.width / that.aspectRatio;
				}
			}

			if (hoset + that.size.height >= that.parentData.height) {
				that.size.height = that.parentData.height - hoset;
				if (pRatio) {
					that.size.width = that.size.height * that.aspectRatio;
				}
			}
		},

		stop: function() {
			var that = $(this).data("ui-resizable"),
				o = that.options,
				co = that.containerOffset,
				cop = that.containerPosition,
				ce = that.containerElement,
				helper = $(that.helper),
				ho = helper.offset(),
				w = helper.outerWidth() - that.sizeDiff.width,
				h = helper.outerHeight() - that.sizeDiff.height;

			if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) {
				$(this).css({
					left: ho.left - cop.left - co.left,
					width: w,
					height: h
				});
			}

			if (that._helper && !o.animate && (/static/).test(ce.css("position"))) {
				$(this).css({
					left: ho.left - cop.left - co.left,
					width: w,
					height: h
				});
			}

		}
	});

	$.ui.plugin.add("resizable", "alsoResize", {

		start: function() {
			var that = $(this).data("ui-resizable"),
				o = that.options,
				_store = function(exp) {
					$(exp).each(function() {
						var el = $(this);
						el.data("ui-resizable-alsoresize", {
							width: parseInt(el.width(), 10),
							height: parseInt(el.height(), 10),
							left: parseInt(el.css("left"), 10),
							top: parseInt(el.css("top"), 10)
						});
					});
				};

			if (typeof(o.alsoResize) === "object" && !o.alsoResize.parentNode) {
				if (o.alsoResize.length) {
					o.alsoResize = o.alsoResize[0];
					_store(o.alsoResize);
				} else {
					$.each(o.alsoResize, function(exp) {
						_store(exp);
					});
				}
			} else {
				_store(o.alsoResize);
			}
		},

		resize: function(event, ui) {
			var that = $(this).data("ui-resizable"),
				o = that.options,
				os = that.originalSize,
				op = that.originalPosition,
				delta = {
					height: (that.size.height - os.height) || 0,
					width: (that.size.width - os.width) || 0,
					top: (that.position.top - op.top) || 0,
					left: (that.position.left - op.left) || 0
				},

				_alsoResize = function(exp, c) {
					$(exp).each(function() {
						var el = $(this),
							start = $(this).data("ui-resizable-alsoresize"),
							style = {},
							css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ["width", "height"] : ["width", "height", "top", "left"];

						$.each(css, function(i, prop) {
							var sum = (start[prop] || 0) + (delta[prop] || 0);
							if (sum && sum >= 0) {
								style[prop] = sum || null;
							}
						});

						el.css(style);
					});
				};

			if (typeof(o.alsoResize) === "object" && !o.alsoResize.nodeType) {
				$.each(o.alsoResize, function(exp, c) {
					_alsoResize(exp, c);
				});
			} else {
				_alsoResize(o.alsoResize);
			}
		},

		stop: function() {
			$(this).removeData("resizable-alsoresize");
		}
	});

	$.ui.plugin.add("resizable", "ghost", {

		start: function() {

			var that = $(this).data("ui-resizable"),
				o = that.options,
				cs = that.size;

			that.ghost = that.originalElement.clone();
			that.ghost
				.css({
					opacity: 0.25,
					display: "block",
					position: "relative",
					height: cs.height,
					width: cs.width,
					margin: 0,
					left: 0,
					top: 0
				})
				.addClass("ui-resizable-ghost")
				.addClass(typeof o.ghost === "string" ? o.ghost : "");

			that.ghost.appendTo(that.helper);

		},

		resize: function() {
			var that = $(this).data("ui-resizable");
			if (that.ghost) {
				that.ghost.css({
					position: "relative",
					height: that.size.height,
					width: that.size.width
				});
			}
		},

		stop: function() {
			var that = $(this).data("ui-resizable");
			if (that.ghost && that.helper) {
				that.helper.get(0).removeChild(that.ghost.get(0));
			}
		}

	});

	$.ui.plugin.add("resizable", "grid", {

		resize: function() {
			var that = $(this).data("ui-resizable"),
				o = that.options,
				cs = that.size,
				os = that.originalSize,
				op = that.originalPosition,
				a = that.axis,
				grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid,
				gridX = (grid[0] || 1),
				gridY = (grid[1] || 1),
				ox = Math.round((cs.width - os.width) / gridX) * gridX,
				oy = Math.round((cs.height - os.height) / gridY) * gridY,
				newWidth = os.width + ox,
				newHeight = os.height + oy,
				isMaxWidth = o.maxWidth && (o.maxWidth < newWidth),
				isMaxHeight = o.maxHeight && (o.maxHeight < newHeight),
				isMinWidth = o.minWidth && (o.minWidth > newWidth),
				isMinHeight = o.minHeight && (o.minHeight > newHeight);

			o.grid = grid;

			if (isMinWidth) {
				newWidth = newWidth + gridX;
			}
			if (isMinHeight) {
				newHeight = newHeight + gridY;
			}
			if (isMaxWidth) {
				newWidth = newWidth - gridX;
			}
			if (isMaxHeight) {
				newHeight = newHeight - gridY;
			}

			if (/^(se|s|e)$/.test(a)) {
				that.size.width = newWidth;
				that.size.height = newHeight;
			} else if (/^(ne)$/.test(a)) {
				that.size.width = newWidth;
				that.size.height = newHeight;
				that.position.top = op.top - oy;
			} else if (/^(sw)$/.test(a)) {
				that.size.width = newWidth;
				that.size.height = newHeight;
				that.position.left = op.left - ox;
			} else {
				that.size.width = newWidth;
				that.size.height = newHeight;
				that.position.top = op.top - oy;
				that.position.left = op.left - ox;
			}
		}

	});

})(jQuery);

(function($, undefined) {

	$.widget("ui.selectable", $.ui.mouse, {
		version: "1.10.3",
		options: {
			appendTo: "body",
			autoRefresh: true,
			distance: 0,
			filter: "*",
			tolerance: "touch",

			// callbacks
			selected: null,
			selecting: null,
			start: null,
			stop: null,
			unselected: null,
			unselecting: null
		},
		_create: function() {
			var selectees,
				that = this;

			this.element.addClass("ui-selectable");

			this.dragged = false;

			// cache selectee children based on filter
			this.refresh = function() {
				selectees = $(that.options.filter, that.element[0]);
				selectees.addClass("ui-selectee");
				selectees.each(function() {
					var $this = $(this),
						pos = $this.offset();
					$.data(this, "selectable-item", {
						element: this,
						$element: $this,
						left: pos.left,
						top: pos.top,
						right: pos.left + $this.outerWidth(),
						bottom: pos.top + $this.outerHeight(),
						startselected: false,
						selected: $this.hasClass("ui-selected"),
						selecting: $this.hasClass("ui-selecting"),
						unselecting: $this.hasClass("ui-unselecting")
					});
				});
			};
			this.refresh();

			this.selectees = selectees.addClass("ui-selectee");

			this._mouseInit();

			this.helper = $("<div class='ui-selectable-helper'></div>");
		},

		_destroy: function() {
			this.selectees
				.removeClass("ui-selectee")
				.removeData("selectable-item");
			this.element
				.removeClass("ui-selectable ui-selectable-disabled");
			this._mouseDestroy();
		},

		_mouseStart: function(event) {
			var that = this,
				options = this.options;

			this.opos = [event.pageX, event.pageY];

			if (this.options.disabled) {
				return;
			}

			this.selectees = $(options.filter, this.element[0]);

			this._trigger("start", event);

			$(options.appendTo).append(this.helper);
			// position helper (lasso)
			this.helper.css({
				"left": event.pageX,
				"top": event.pageY,
				"width": 0,
				"height": 0
			});

			if (options.autoRefresh) {
				this.refresh();
			}

			this.selectees.filter(".ui-selected").each(function() {
				var selectee = $.data(this, "selectable-item");
				selectee.startselected = true;
				if (!event.metaKey && !event.ctrlKey) {
					selectee.$element.removeClass("ui-selected");
					selectee.selected = false;
					selectee.$element.addClass("ui-unselecting");
					selectee.unselecting = true;
					// selectable UNSELECTING callback
					that._trigger("unselecting", event, {
						unselecting: selectee.element
					});
				}
			});

			$(event.target).parents().addBack().each(function() {
				var doSelect,
					selectee = $.data(this, "selectable-item");
				if (selectee) {
					doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass("ui-selected");
					selectee.$element
						.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
						.addClass(doSelect ? "ui-selecting" : "ui-unselecting");
					selectee.unselecting = !doSelect;
					selectee.selecting = doSelect;
					selectee.selected = doSelect;
					// selectable (UN)SELECTING callback
					if (doSelect) {
						that._trigger("selecting", event, {
							selecting: selectee.element
						});
					} else {
						that._trigger("unselecting", event, {
							unselecting: selectee.element
						});
					}
					return false;
				}
			});

		},

		_mouseDrag: function(event) {

			this.dragged = true;

			if (this.options.disabled) {
				return;
			}

			var tmp,
				that = this,
				options = this.options,
				x1 = this.opos[0],
				y1 = this.opos[1],
				x2 = event.pageX,
				y2 = event.pageY;

			if (x1 > x2) {
				tmp = x2;
				x2 = x1;
				x1 = tmp;
			}
			if (y1 > y2) {
				tmp = y2;
				y2 = y1;
				y1 = tmp;
			}
			this.helper.css({
				left: x1,
				top: y1,
				width: x2 - x1,
				height: y2 - y1
			});

			this.selectees.each(function() {
				var selectee = $.data(this, "selectable-item"),
					hit = false;

				//prevent helper from being selected if appendTo: selectable
				if (!selectee || selectee.element === that.element[0]) {
					return;
				}

				if (options.tolerance === "touch") {
					hit = (!(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1));
				} else if (options.tolerance === "fit") {
					hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
				}

				if (hit) {
					// SELECT
					if (selectee.selected) {
						selectee.$element.removeClass("ui-selected");
						selectee.selected = false;
					}
					if (selectee.unselecting) {
						selectee.$element.removeClass("ui-unselecting");
						selectee.unselecting = false;
					}
					if (!selectee.selecting) {
						selectee.$element.addClass("ui-selecting");
						selectee.selecting = true;
						// selectable SELECTING callback
						that._trigger("selecting", event, {
							selecting: selectee.element
						});
					}
				} else {
					// UNSELECT
					if (selectee.selecting) {
						if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
							selectee.$element.removeClass("ui-selecting");
							selectee.selecting = false;
							selectee.$element.addClass("ui-selected");
							selectee.selected = true;
						} else {
							selectee.$element.removeClass("ui-selecting");
							selectee.selecting = false;
							if (selectee.startselected) {
								selectee.$element.addClass("ui-unselecting");
								selectee.unselecting = true;
							}
							// selectable UNSELECTING callback
							that._trigger("unselecting", event, {
								unselecting: selectee.element
							});
						}
					}
					if (selectee.selected) {
						if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
							selectee.$element.removeClass("ui-selected");
							selectee.selected = false;

							selectee.$element.addClass("ui-unselecting");
							selectee.unselecting = true;
							// selectable UNSELECTING callback
							that._trigger("unselecting", event, {
								unselecting: selectee.element
							});
						}
					}
				}
			});

			return false;
		},

		_mouseStop: function(event) {
			var that = this;

			this.dragged = false;

			$(".ui-unselecting", this.element[0]).each(function() {
				var selectee = $.data(this, "selectable-item");
				selectee.$element.removeClass("ui-unselecting");
				selectee.unselecting = false;
				selectee.startselected = false;
				that._trigger("unselected", event, {
					unselected: selectee.element
				});
			});
			$(".ui-selecting", this.element[0]).each(function() {
				var selectee = $.data(this, "selectable-item");
				selectee.$element.removeClass("ui-selecting").addClass("ui-selected");
				selectee.selecting = false;
				selectee.selected = true;
				selectee.startselected = true;
				that._trigger("selected", event, {
					selected: selectee.element
				});
			});
			this._trigger("stop", event);

			this.helper.remove();

			return false;
		}

	});

})(jQuery);

(function($, undefined) {

	/*jshint loopfunc: true */

	function isOverAxis(x, reference, size) {
		return (x > reference) && (x < (reference + size));
	}

	function isFloating(item) {
		return (/left|right/).test(item.css("float")) || (/inline|table-cell/).test(item.css("display"));
	}

	$.widget("ui.sortable", $.ui.mouse, {
		version: "1.10.3",
		widgetEventPrefix: "sort",
		ready: false,
		options: {
			appendTo: "parent",
			axis: false,
			connectWith: false,
			containment: false,
			cursor: "auto",
			cursorAt: false,
			dropOnEmpty: true,
			forcePlaceholderSize: false,
			forceHelperSize: false,
			grid: false,
			handle: false,
			helper: "original",
			items: "> *",
			opacity: false,
			placeholder: false,
			revert: false,
			scroll: true,
			scrollSensitivity: 20,
			scrollSpeed: 20,
			scope: "default",
			tolerance: "intersect",
			zIndex: 1000,

			// callbacks
			activate: null,
			beforeStop: null,
			change: null,
			deactivate: null,
			out: null,
			over: null,
			receive: null,
			remove: null,
			sort: null,
			start: null,
			stop: null,
			update: null
		},
		_create: function() {

			var o = this.options;
			this.containerCache = {};
			this.element.addClass("ui-sortable");

			//Get the items
			this.refresh();

			//Let's determine if the items are being displayed horizontally
			this.floating = this.items.length ? o.axis === "x" || isFloating(this.items[0].item) : false;

			//Let's determine the parent's offset
			this.offset = this.element.offset();

			//Initialize mouse events for interaction
			this._mouseInit();

			//We're ready to go
			this.ready = true;

		},

		_destroy: function() {
			this.element
				.removeClass("ui-sortable ui-sortable-disabled");
			this._mouseDestroy();

			for (var i = this.items.length - 1; i >= 0; i--) {
				this.items[i].item.removeData(this.widgetName + "-item");
			}

			return this;
		},

		_setOption: function(key, value) {
			if (key === "disabled") {
				this.options[key] = value;

				this.widget().toggleClass("ui-sortable-disabled", !! value);
			} else {
				// Don't call widget base _setOption for disable as it adds ui-state-disabled class
				$.Widget.prototype._setOption.apply(this, arguments);
			}
		},

		_mouseCapture: function(event, overrideHandle) {
			var currentItem = null,
				validHandle = false,
				that = this;

			if (this.reverting) {
				return false;
			}

			if (this.options.disabled || this.options.type === "static") {
				return false;
			}

			//We have to refresh the items data once first
			this._refreshItems(event);

			//Find out if the clicked node (or one of its parents) is a actual item in this.items
			$(event.target).parents().each(function() {
				if ($.data(this, that.widgetName + "-item") === that) {
					currentItem = $(this);
					return false;
				}
			});
			if ($.data(event.target, that.widgetName + "-item") === that) {
				currentItem = $(event.target);
			}

			if (!currentItem) {
				return false;
			}
			if (this.options.handle && !overrideHandle) {
				$(this.options.handle, currentItem).find("*").addBack().each(function() {
					if (this === event.target) {
						validHandle = true;
					}
				});
				if (!validHandle) {
					return false;
				}
			}

			this.currentItem = currentItem;
			this._removeCurrentsFromItems();
			return true;

		},

		_mouseStart: function(event, overrideHandle, noActivation) {

			var i, body,
				o = this.options;

			this.currentContainer = this;

			//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
			this.refreshPositions();

			//Create and append the visible helper
			this.helper = this._createHelper(event);

			//Cache the helper size
			this._cacheHelperProportions();

			/*
			 * - Position generation -
			 * This block generates everything position related - it's the core of draggables.
			 */

			//Cache the margins of the original element
			this._cacheMargins();

			//Get the next scrolling parent
			this.scrollParent = this.helper.scrollParent();

			//The element's absolute position on the page minus margins
			this.offset = this.currentItem.offset();
			this.offset = {
				top: this.offset.top - this.margins.top,
				left: this.offset.left - this.margins.left
			};

			$.extend(this.offset, {
				click: { //Where the click happened, relative to the element
					left: event.pageX - this.offset.left,
					top: event.pageY - this.offset.top
				},
				parent: this._getParentOffset(),
				relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
			});

			// Only after we got the offset, we can change the helper's position to absolute
			// TODO: Still need to figure out a way to make relative sorting possible
			this.helper.css("position", "absolute");
			this.cssPosition = this.helper.css("position");

			//Generate the original position
			this.originalPosition = this._generatePosition(event);
			this.originalPageX = event.pageX;
			this.originalPageY = event.pageY;

			//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
			(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));

			//Cache the former DOM position
			this.domPosition = {
				prev: this.currentItem.prev()[0],
				parent: this.currentItem.parent()[0]
			};

			//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
			if (this.helper[0] !== this.currentItem[0]) {
				this.currentItem.hide();
			}

			//Create the placeholder
			this._createPlaceholder();

			//Set a containment if given in the options
			if (o.containment) {
				this._setContainment();
			}

			if (o.cursor && o.cursor !== "auto") { // cursor option
				body = this.document.find("body");

				// support: IE
				this.storedCursor = body.css("cursor");
				body.css("cursor", o.cursor);

				this.storedStylesheet = $("<style>*{ cursor: " + o.cursor + " !important; }</style>").appendTo(body);
			}

			if (o.opacity) { // opacity option
				if (this.helper.css("opacity")) {
					this._storedOpacity = this.helper.css("opacity");
				}
				this.helper.css("opacity", o.opacity);
			}

			if (o.zIndex) { // zIndex option
				if (this.helper.css("zIndex")) {
					this._storedZIndex = this.helper.css("zIndex");
				}
				this.helper.css("zIndex", o.zIndex);
			}

			//Prepare scrolling
			if (this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") {
				this.overflowOffset = this.scrollParent.offset();
			}

			//Call callbacks
			this._trigger("start", event, this._uiHash());

			//Recache the helper size
			if (!this._preserveHelperProportions) {
				this._cacheHelperProportions();
			}


			//Post "activate" events to possible containers
			if (!noActivation) {
				for (i = this.containers.length - 1; i >= 0; i--) {
					this.containers[i]._trigger("activate", event, this._uiHash(this));
				}
			}

			//Prepare possible droppables
			if ($.ui.ddmanager) {
				$.ui.ddmanager.current = this;
			}

			if ($.ui.ddmanager && !o.dropBehaviour) {
				$.ui.ddmanager.prepareOffsets(this, event);
			}

			this.dragging = true;

			this.helper.addClass("ui-sortable-helper");
			this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
			return true;

		},

		_mouseDrag: function(event) {
			var i, item, itemElement, intersection,
				o = this.options,
				scrolled = false;

			//Compute the helpers position
			this.position = this._generatePosition(event);
			this.positionAbs = this._convertPositionTo("absolute");

			if (!this.lastPositionAbs) {
				this.lastPositionAbs = this.positionAbs;
			}

			//Do scrolling
			if (this.options.scroll) {
				if (this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") {

					if ((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) {
						this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
					} else if (event.pageY - this.overflowOffset.top < o.scrollSensitivity) {
						this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
					}

					if ((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) {
						this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
					} else if (event.pageX - this.overflowOffset.left < o.scrollSensitivity) {
						this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
					}

				} else {

					if (event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
						scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
					} else if ($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) {
						scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
					}

					if (event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
						scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
					} else if ($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) {
						scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
					}

				}

				if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
					$.ui.ddmanager.prepareOffsets(this, event);
				}
			}

			//Regenerate the absolute position used for position checks
			this.positionAbs = this._convertPositionTo("absolute");

			//Set the helper position
			if (!this.options.axis || this.options.axis !== "y") {
				this.helper[0].style.left = this.position.left + "px";
			}
			if (!this.options.axis || this.options.axis !== "x") {
				this.helper[0].style.top = this.position.top + "px";
			}

			//Rearrange
			for (i = this.items.length - 1; i >= 0; i--) {

				//Cache variables and intersection, continue if no intersection
				item = this.items[i];
				itemElement = item.item[0];
				intersection = this._intersectsWithPointer(item);
				if (!intersection) {
					continue;
				}

				// Only put the placeholder inside the current Container, skip all
				// items form other containers. This works because when moving
				// an item from one container to another the
				// currentContainer is switched before the placeholder is moved.
				//
				// Without this moving items in "sub-sortables" can cause the placeholder to jitter
				// beetween the outer and inner container.
				if (item.instance !== this.currentContainer) {
					continue;
				}

				// cannot intersect with itself
				// no useless actions that have been done before
				// no action if the item moved is the parent of the item checked
				if (itemElement !== this.currentItem[0] &&
					this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement && !$.contains(this.placeholder[0], itemElement) &&
					(this.options.type === "semi-dynamic" ? !$.contains(this.element[0], itemElement) : true)
				) {

					this.direction = intersection === 1 ? "down" : "up";

					if (this.options.tolerance === "pointer" || this._intersectsWithSides(item)) {
						this._rearrange(event, item);
					} else {
						break;
					}

					this._trigger("change", event, this._uiHash());
					break;
				}
			}

			//Post events to containers
			this._contactContainers(event);

			//Interconnect with droppables
			if ($.ui.ddmanager) {
				$.ui.ddmanager.drag(this, event);
			}

			//Call callbacks
			this._trigger("sort", event, this._uiHash());

			this.lastPositionAbs = this.positionAbs;
			return false;

		},

		_mouseStop: function(event, noPropagation) {

			if (!event) {
				return;
			}

			//If we are using droppables, inform the manager about the drop
			if ($.ui.ddmanager && !this.options.dropBehaviour) {
				$.ui.ddmanager.drop(this, event);
			}

			if (this.options.revert) {
				var that = this,
					cur = this.placeholder.offset(),
					axis = this.options.axis,
					animation = {};

				if (!axis || axis === "x") {
					animation.left = cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollLeft);
				}
				if (!axis || axis === "y") {
					animation.top = cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollTop);
				}
				this.reverting = true;
				$(this.helper).animate(animation, parseInt(this.options.revert, 10) || 500, function() {
					that._clear(event);
				});
			} else {
				this._clear(event, noPropagation);
			}

			return false;

		},

		cancel: function() {

			if (this.dragging) {

				this._mouseUp({
					target: null
				});

				if (this.options.helper === "original") {
					this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
				} else {
					this.currentItem.show();
				}

				//Post deactivating events to containers
				for (var i = this.containers.length - 1; i >= 0; i--) {
					this.containers[i]._trigger("deactivate", null, this._uiHash(this));
					if (this.containers[i].containerCache.over) {
						this.containers[i]._trigger("out", null, this._uiHash(this));
						this.containers[i].containerCache.over = 0;
					}
				}

			}

			if (this.placeholder) {
				//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
				if (this.placeholder[0].parentNode) {
					this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
				}
				if (this.options.helper !== "original" && this.helper && this.helper[0].parentNode) {
					this.helper.remove();
				}

				$.extend(this, {
					helper: null,
					dragging: false,
					reverting: false,
					_noFinalSort: null
				});

				if (this.domPosition.prev) {
					$(this.domPosition.prev).after(this.currentItem);
				} else {
					$(this.domPosition.parent).prepend(this.currentItem);
				}
			}

			return this;

		},

		serialize: function(o) {

			var items = this._getItemsAsjQuery(o && o.connected),
				str = [];
			o = o || {};

			$(items).each(function() {
				var res = ($(o.item || this).attr(o.attribute || "id") || "").match(o.expression || (/(.+)[\-=_](.+)/));
				if (res) {
					str.push((o.key || res[1] + "[]") + "=" + (o.key && o.expression ? res[1] : res[2]));
				}
			});

			if (!str.length && o.key) {
				str.push(o.key + "=");
			}

			return str.join("&");

		},

		toArray: function(o) {

			var items = this._getItemsAsjQuery(o && o.connected),
				ret = [];

			o = o || {};

			items.each(function() {
				ret.push($(o.item || this).attr(o.attribute || "id") || "");
			});
			return ret;

		},

		/* Be careful with the following core functions */
		_intersectsWith: function(item) {

			var x1 = this.positionAbs.left,
				x2 = x1 + this.helperProportions.width,
				y1 = this.positionAbs.top,
				y2 = y1 + this.helperProportions.height,
				l = item.left,
				r = l + item.width,
				t = item.top,
				b = t + item.height,
				dyClick = this.offset.click.top,
				dxClick = this.offset.click.left,
				isOverElementHeight = (this.options.axis === "x") || ((y1 + dyClick) > t && (y1 + dyClick) < b),
				isOverElementWidth = (this.options.axis === "y") || ((x1 + dxClick) > l && (x1 + dxClick) < r),
				isOverElement = isOverElementHeight && isOverElementWidth;

			if (this.options.tolerance === "pointer" ||
				this.options.forcePointerForContainers ||
				(this.options.tolerance !== "pointer" && this.helperProportions[this.floating ? "width" : "height"] > item[this.floating ? "width" : "height"])
			) {
				return isOverElement;
			} else {

				return (l < x1 + (this.helperProportions.width / 2) && // Right Half
					x2 - (this.helperProportions.width / 2) < r && // Left Half
					t < y1 + (this.helperProportions.height / 2) && // Bottom Half
					y2 - (this.helperProportions.height / 2) < b); // Top Half

			}
		},

		_intersectsWithPointer: function(item) {

			var isOverElementHeight = (this.options.axis === "x") || isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
				isOverElementWidth = (this.options.axis === "y") || isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
				isOverElement = isOverElementHeight && isOverElementWidth,
				verticalDirection = this._getDragVerticalDirection(),
				horizontalDirection = this._getDragHorizontalDirection();

			if (!isOverElement) {
				return false;
			}

			return this.floating ?
				(((horizontalDirection && horizontalDirection === "right") || verticalDirection === "down") ? 2 : 1) : (verticalDirection && (verticalDirection === "down" ? 2 : 1));

		},

		_intersectsWithSides: function(item) {

			var isOverBottomHalf = isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height / 2), item.height),
				isOverRightHalf = isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width / 2), item.width),
				verticalDirection = this._getDragVerticalDirection(),
				horizontalDirection = this._getDragHorizontalDirection();

			if (this.floating && horizontalDirection) {
				return ((horizontalDirection === "right" && isOverRightHalf) || (horizontalDirection === "left" && !isOverRightHalf));
			} else {
				return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) || (verticalDirection === "up" && !isOverBottomHalf));
			}

		},

		_getDragVerticalDirection: function() {
			var delta = this.positionAbs.top - this.lastPositionAbs.top;
			return delta !== 0 && (delta > 0 ? "down" : "up");
		},

		_getDragHorizontalDirection: function() {
			var delta = this.positionAbs.left - this.lastPositionAbs.left;
			return delta !== 0 && (delta > 0 ? "right" : "left");
		},

		refresh: function(event) {
			this._refreshItems(event);
			this.refreshPositions();
			return this;
		},

		_connectWith: function() {
			var options = this.options;
			return options.connectWith.constructor === String ? [options.connectWith] : options.connectWith;
		},

		_getItemsAsjQuery: function(connected) {

			var i, j, cur, inst,
				items = [],
				queries = [],
				connectWith = this._connectWith();

			if (connectWith && connected) {
				for (i = connectWith.length - 1; i >= 0; i--) {
					cur = $(connectWith[i]);
					for (j = cur.length - 1; j >= 0; j--) {
						inst = $.data(cur[j], this.widgetFullName);
						if (inst && inst !== this && !inst.options.disabled) {
							queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), inst]);
						}
					}
				}
			}

			queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, {
				options: this.options,
				item: this.currentItem
			}) : $(this.options.items, this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), this]);

			for (i = queries.length - 1; i >= 0; i--) {
				queries[i][0].each(function() {
					items.push(this);
				});
			}

			return $(items);

		},

		_removeCurrentsFromItems: function() {

			var list = this.currentItem.find(":data(" + this.widgetName + "-item)");

			this.items = $.grep(this.items, function(item) {
				for (var j = 0; j < list.length; j++) {
					if (list[j] === item.item[0]) {
						return false;
					}
				}
				return true;
			});

		},

		_refreshItems: function(event) {

			this.items = [];
			this.containers = [this];

			var i, j, cur, inst, targetData, _queries, item, queriesLength,
				items = this.items,
				queries = [
					[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, {
						item: this.currentItem
					}) : $(this.options.items, this.element), this]
				],
				connectWith = this._connectWith();

			if (connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
				for (i = connectWith.length - 1; i >= 0; i--) {
					cur = $(connectWith[i]);
					for (j = cur.length - 1; j >= 0; j--) {
						inst = $.data(cur[j], this.widgetFullName);
						if (inst && inst !== this && !inst.options.disabled) {
							queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, {
								item: this.currentItem
							}) : $(inst.options.items, inst.element), inst]);
							this.containers.push(inst);
						}
					}
				}
			}

			for (i = queries.length - 1; i >= 0; i--) {
				targetData = queries[i][1];
				_queries = queries[i][0];

				for (j = 0, queriesLength = _queries.length; j < queriesLength; j++) {
					item = $(_queries[j]);

					item.data(this.widgetName + "-item", targetData); // Data for target checking (mouse manager)

					items.push({
						item: item,
						instance: targetData,
						width: 0,
						height: 0,
						left: 0,
						top: 0
					});
				}
			}

		},

		refreshPositions: function(fast) {

			//This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
			if (this.offsetParent && this.helper) {
				this.offset.parent = this._getParentOffset();
			}

			var i, item, t, p;

			for (i = this.items.length - 1; i >= 0; i--) {
				item = this.items[i];

				//We ignore calculating positions of all connected containers when we're not over them
				if (item.instance !== this.currentContainer && this.currentContainer && item.item[0] !== this.currentItem[0]) {
					continue;
				}

				t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;

				if (!fast) {
					item.width = t.outerWidth();
					item.height = t.outerHeight();
				}

				p = t.offset();
				item.left = p.left;
				item.top = p.top;
			}

			if (this.options.custom && this.options.custom.refreshContainers) {
				this.options.custom.refreshContainers.call(this);
			} else {
				for (i = this.containers.length - 1; i >= 0; i--) {
					p = this.containers[i].element.offset();
					this.containers[i].containerCache.left = p.left;
					this.containers[i].containerCache.top = p.top;
					this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
					this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
				}
			}

			return this;
		},

		_createPlaceholder: function(that) {
			that = that || this;
			var className,
				o = that.options;

			if (!o.placeholder || o.placeholder.constructor === String) {
				className = o.placeholder;
				o.placeholder = {
					element: function() {

						var nodeName = that.currentItem[0].nodeName.toLowerCase(),
							element = $("<" + nodeName + ">", that.document[0])
								.addClass(className || that.currentItem[0].className + " ui-sortable-placeholder")
								.removeClass("ui-sortable-helper");

						if (nodeName === "tr") {
							that.currentItem.children().each(function() {
								$("<td>&#160;</td>", that.document[0])
									.attr("colspan", $(this).attr("colspan") || 1)
									.appendTo(element);
							});
						} else if (nodeName === "img") {
							element.attr("src", that.currentItem.attr("src"));
						}

						if (!className) {
							element.css("visibility", "hidden");
						}

						return element;
					},
					update: function(container, p) {

						// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
						// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
						if (className && !o.forcePlaceholderSize) {
							return;
						}

						//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
						if (!p.height()) {
							p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css("paddingTop") || 0, 10) - parseInt(that.currentItem.css("paddingBottom") || 0, 10));
						}
						if (!p.width()) {
							p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css("paddingLeft") || 0, 10) - parseInt(that.currentItem.css("paddingRight") || 0, 10));
						}
					}
				};
			}

			//Create the placeholder
			that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem));

			//Append it after the actual current item
			that.currentItem.after(that.placeholder);

			//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
			o.placeholder.update(that, that.placeholder);

		},

		_contactContainers: function(event) {
			var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, base, cur, nearBottom, floating,
				innermostContainer = null,
				innermostIndex = null;

			// get innermost container that intersects with item
			for (i = this.containers.length - 1; i >= 0; i--) {

				// never consider a container that's located within the item itself
				if ($.contains(this.currentItem[0], this.containers[i].element[0])) {
					continue;
				}

				if (this._intersectsWith(this.containers[i].containerCache)) {

					// if we've already found a container and it's more "inner" than this, then continue
					if (innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) {
						continue;
					}

					innermostContainer = this.containers[i];
					innermostIndex = i;

				} else {
					// container doesn't intersect. trigger "out" event if necessary
					if (this.containers[i].containerCache.over) {
						this.containers[i]._trigger("out", event, this._uiHash(this));
						this.containers[i].containerCache.over = 0;
					}
				}

			}

			// if no intersecting containers found, return
			if (!innermostContainer) {
				return;
			}

			// move the item into the container if it's not there already
			if (this.containers.length === 1) {
				if (!this.containers[innermostIndex].containerCache.over) {
					this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
					this.containers[innermostIndex].containerCache.over = 1;
				}
			} else {

				//When entering a new container, we will find the item with the least distance and append our item near it
				dist = 10000;
				itemWithLeastDistance = null;
				floating = innermostContainer.floating || isFloating(this.currentItem);
				posProperty = floating ? "left" : "top";
				sizeProperty = floating ? "width" : "height";
				base = this.positionAbs[posProperty] + this.offset.click[posProperty];
				for (j = this.items.length - 1; j >= 0; j--) {
					if (!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) {
						continue;
					}
					if (this.items[j].item[0] === this.currentItem[0]) {
						continue;
					}
					if (floating && !isOverAxis(this.positionAbs.top + this.offset.click.top, this.items[j].top, this.items[j].height)) {
						continue;
					}
					cur = this.items[j].item.offset()[posProperty];
					nearBottom = false;
					if (Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)) {
						nearBottom = true;
						cur += this.items[j][sizeProperty];
					}

					if (Math.abs(cur - base) < dist) {
						dist = Math.abs(cur - base);
						itemWithLeastDistance = this.items[j];
						this.direction = nearBottom ? "up" : "down";
					}
				}

				//Check if dropOnEmpty is enabled
				if (!itemWithLeastDistance && !this.options.dropOnEmpty) {
					return;
				}

				if (this.currentContainer === this.containers[innermostIndex]) {
					return;
				}

				itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
				this._trigger("change", event, this._uiHash());
				this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
				this.currentContainer = this.containers[innermostIndex];

				//Update the placeholder
				this.options.placeholder.update(this.currentContainer, this.placeholder);

				this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
				this.containers[innermostIndex].containerCache.over = 1;
			}


		},

		_createHelper: function(event) {

			var o = this.options,
				helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper === "clone" ? this.currentItem.clone() : this.currentItem);

			//Add the helper to the DOM if that didn't happen already
			if (!helper.parents("body").length) {
				$(o.appendTo !== "parent" ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
			}

			if (helper[0] === this.currentItem[0]) {
				this._storedCSS = {
					width: this.currentItem[0].style.width,
					height: this.currentItem[0].style.height,
					position: this.currentItem.css("position"),
					top: this.currentItem.css("top"),
					left: this.currentItem.css("left")
				};
			}

			if (!helper[0].style.width || o.forceHelperSize) {
				helper.width(this.currentItem.width());
			}
			if (!helper[0].style.height || o.forceHelperSize) {
				helper.height(this.currentItem.height());
			}

			return helper;

		},

		_adjustOffsetFromHelper: function(obj) {
			if (typeof obj === "string") {
				obj = obj.split(" ");
			}
			if ($.isArray(obj)) {
				obj = {
					left: +obj[0],
					top: +obj[1] || 0
				};
			}
			if ("left" in obj) {
				this.offset.click.left = obj.left + this.margins.left;
			}
			if ("right" in obj) {
				this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
			}
			if ("top" in obj) {
				this.offset.click.top = obj.top + this.margins.top;
			}
			if ("bottom" in obj) {
				this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
			}
		},

		_getParentOffset: function() {


			//Get the offsetParent and cache its position
			this.offsetParent = this.helper.offsetParent();
			var po = this.offsetParent.offset();

			// This is a special case where we need to modify a offset calculated on start, since the following happened:
			// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
			// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
			//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
			if (this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
				po.left += this.scrollParent.scrollLeft();
				po.top += this.scrollParent.scrollTop();
			}

			// This needs to be actually done for all browsers, since pageX/pageY includes this information
			// with an ugly IE fix
			if (this.offsetParent[0] === document.body || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
				po = {
					top: 0,
					left: 0
				};
			}

			return {
				top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
				left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
			};

		},

		_getRelativeOffset: function() {

			if (this.cssPosition === "relative") {
				var p = this.currentItem.position();
				return {
					top: p.top - (parseInt(this.helper.css("top"), 10) || 0) + this.scrollParent.scrollTop(),
					left: p.left - (parseInt(this.helper.css("left"), 10) || 0) + this.scrollParent.scrollLeft()
				};
			} else {
				return {
					top: 0,
					left: 0
				};
			}

		},

		_cacheMargins: function() {
			this.margins = {
				left: (parseInt(this.currentItem.css("marginLeft"), 10) || 0),
				top: (parseInt(this.currentItem.css("marginTop"), 10) || 0)
			};
		},

		_cacheHelperProportions: function() {
			this.helperProportions = {
				width: this.helper.outerWidth(),
				height: this.helper.outerHeight()
			};
		},

		_setContainment: function() {

			var ce, co, over,
				o = this.options;
			if (o.containment === "parent") {
				o.containment = this.helper[0].parentNode;
			}
			if (o.containment === "document" || o.containment === "window") {
				this.containment = [
					0 - this.offset.relative.left - this.offset.parent.left,
					0 - this.offset.relative.top - this.offset.parent.top,
					$(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left, ($(o.containment === "document" ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
				];
			}

			if (!(/^(document|window|parent)$/).test(o.containment)) {
				ce = $(o.containment)[0];
				co = $(o.containment).offset();
				over = ($(ce).css("overflow") !== "hidden");

				this.containment = [
					co.left + (parseInt($(ce).css("borderLeftWidth"), 10) || 0) + (parseInt($(ce).css("paddingLeft"), 10) || 0) - this.margins.left,
					co.top + (parseInt($(ce).css("borderTopWidth"), 10) || 0) + (parseInt($(ce).css("paddingTop"), 10) || 0) - this.margins.top,
					co.left + (over ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"), 10) || 0) - (parseInt($(ce).css("paddingRight"), 10) || 0) - this.helperProportions.width - this.margins.left,
					co.top + (over ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"), 10) || 0) - (parseInt($(ce).css("paddingBottom"), 10) || 0) - this.helperProportions.height - this.margins.top
				];
			}

		},

		_convertPositionTo: function(d, pos) {

			if (!pos) {
				pos = this.position;
			}
			var mod = d === "absolute" ? 1 : -1,
				scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
				scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);

			return {
				top: (
					pos.top + // The absolute mouse position
					this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
					((this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : (scrollIsRootNode ? 0 : scroll.scrollTop())) * mod)
				),
				left: (
					pos.left + // The absolute mouse position
					this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
					((this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft()) * mod)
				)
			};

		},

		_generatePosition: function(event) {

			var top, left,
				o = this.options,
				pageX = event.pageX,
				pageY = event.pageY,
				scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
				scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);

			// This is another very weird special case that only happens for relative elements:
			// 1. If the css position is relative
			// 2. and the scroll parent is the document or similar to the offset parent
			// we have to refresh the relative offset during the scroll so there are no jumps
			if (this.cssPosition === "relative" && !(this.scrollParent[0] !== document && this.scrollParent[0] !== this.offsetParent[0])) {
				this.offset.relative = this._getRelativeOffset();
			}

			/*
			 * - Position constraining -
			 * Constrain the position to a mix of grid, containment.
			 */

			if (this.originalPosition) { //If we are not dragging yet, we won't check for options

				if (this.containment) {
					if (event.pageX - this.offset.click.left < this.containment[0]) {
						pageX = this.containment[0] + this.offset.click.left;
					}
					if (event.pageY - this.offset.click.top < this.containment[1]) {
						pageY = this.containment[1] + this.offset.click.top;
					}
					if (event.pageX - this.offset.click.left > this.containment[2]) {
						pageX = this.containment[2] + this.offset.click.left;
					}
					if (event.pageY - this.offset.click.top > this.containment[3]) {
						pageY = this.containment[3] + this.offset.click.top;
					}
				}

				if (o.grid) {
					top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
					pageY = this.containment ? ((top - this.offset.click.top >= this.containment[1] && top - this.offset.click.top <= this.containment[3]) ? top : ((top - this.offset.click.top >= this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;

					left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
					pageX = this.containment ? ((left - this.offset.click.left >= this.containment[0] && left - this.offset.click.left <= this.containment[2]) ? left : ((left - this.offset.click.left >= this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
				}

			}

			return {
				top: (
					pageY - // The absolute mouse position
					this.offset.click.top - // Click offset (relative to the element)
					this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
					((this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : (scrollIsRootNode ? 0 : scroll.scrollTop())))
				),
				left: (
					pageX - // The absolute mouse position
					this.offset.click.left - // Click offset (relative to the element)
					this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
					this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
					((this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft()))
				)
			};

		},

		_rearrange: function(event, i, a, hardRefresh) {

			a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction === "down" ? i.item[0] : i.item[0].nextSibling));

			//Various things done here to improve the performance:
			// 1. we create a setTimeout, that calls refreshPositions
			// 2. on the instance, we have a counter variable, that get's higher after every append
			// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
			// 4. this lets only the last addition to the timeout stack through
			this.counter = this.counter ? ++this.counter : 1;
			var counter = this.counter;

			this._delay(function() {
				if (counter === this.counter) {
					this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
				}
			});

		},

		_clear: function(event, noPropagation) {

			this.reverting = false;
			// We delay all events that have to be triggered to after the point where the placeholder has been removed and
			// everything else normalized again
			var i,
				delayedTriggers = [];

			// We first have to update the dom position of the actual currentItem
			// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
			if (!this._noFinalSort && this.currentItem.parent().length) {
				this.placeholder.before(this.currentItem);
			}
			this._noFinalSort = null;

			if (this.helper[0] === this.currentItem[0]) {
				for (i in this._storedCSS) {
					if (this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") {
						this._storedCSS[i] = "";
					}
				}
				this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
			} else {
				this.currentItem.show();
			}

			if (this.fromOutside && !noPropagation) {
				delayedTriggers.push(function(event) {
					this._trigger("receive", event, this._uiHash(this.fromOutside));
				});
			}
			if ((this.fromOutside || this.domPosition.prev !== this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) {
				delayedTriggers.push(function(event) {
					this._trigger("update", event, this._uiHash());
				}); //Trigger update callback if the DOM position has changed
			}

			// Check if the items Container has Changed and trigger appropriate
			// events.
			if (this !== this.currentContainer) {
				if (!noPropagation) {
					delayedTriggers.push(function(event) {
						this._trigger("remove", event, this._uiHash());
					});
					delayedTriggers.push((function(c) {
						return function(event) {
							c._trigger("receive", event, this._uiHash(this));
						};
					}).call(this, this.currentContainer));
					delayedTriggers.push((function(c) {
						return function(event) {
							c._trigger("update", event, this._uiHash(this));
						};
					}).call(this, this.currentContainer));
				}
			}


			//Post events to containers
			for (i = this.containers.length - 1; i >= 0; i--) {
				if (!noPropagation) {
					delayedTriggers.push((function(c) {
						return function(event) {
							c._trigger("deactivate", event, this._uiHash(this));
						};
					}).call(this, this.containers[i]));
				}
				if (this.containers[i].containerCache.over) {
					delayedTriggers.push((function(c) {
						return function(event) {
							c._trigger("out", event, this._uiHash(this));
						};
					}).call(this, this.containers[i]));
					this.containers[i].containerCache.over = 0;
				}
			}

			//Do what was originally in plugins
			if (this.storedCursor) {
				this.document.find("body").css("cursor", this.storedCursor);
				this.storedStylesheet.remove();
			}
			if (this._storedOpacity) {
				this.helper.css("opacity", this._storedOpacity);
			}
			if (this._storedZIndex) {
				this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex);
			}

			this.dragging = false;
			if (this.cancelHelperRemoval) {
				if (!noPropagation) {
					this._trigger("beforeStop", event, this._uiHash());
					for (i = 0; i < delayedTriggers.length; i++) {
						delayedTriggers[i].call(this, event);
					} //Trigger all delayed events
					this._trigger("stop", event, this._uiHash());
				}

				this.fromOutside = false;
				return false;
			}

			if (!noPropagation) {
				this._trigger("beforeStop", event, this._uiHash());
			}

			//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
			this.placeholder[0].parentNode.removeChild(this.placeholder[0]);

			if (this.helper[0] !== this.currentItem[0]) {
				this.helper.remove();
			}
			this.helper = null;

			if (!noPropagation) {
				for (i = 0; i < delayedTriggers.length; i++) {
					delayedTriggers[i].call(this, event);
				} //Trigger all delayed events
				this._trigger("stop", event, this._uiHash());
			}

			this.fromOutside = false;
			return true;

		},

		_trigger: function() {
			if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
				this.cancel();
			}
		},

		_uiHash: function(_inst) {
			var inst = _inst || this;
			return {
				helper: inst.helper,
				placeholder: inst.placeholder || $([]),
				position: inst.position,
				originalPosition: inst.originalPosition,
				offset: inst.positionAbs,
				item: inst.currentItem,
				sender: _inst ? _inst.element : null
			};
		}

	});

})(jQuery);

(function($, undefined) {

	var dataSpace = "ui-effects-";

	$.effects = {
		effect: {}
	};

	/*!
	 * jQuery Color Animations v2.1.2
	 * https://github.com/jquery/jquery-color
	 *
	 * Copyright 2013 jQuery Foundation and other contributors
	 * Released under the MIT license.
	 * http://jquery.org/license
	 *
	 * Date: Wed Jan 16 08:47:09 2013 -0600
	 */
	(function(jQuery, undefined) {

		var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",

			// plusequals test for += 100 -= 100
			rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
			// a set of RE's that can match strings and generate color tuples.
			stringParsers = [{
				re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
				parse: function(execResult) {
					return [
						execResult[1],
						execResult[2],
						execResult[3],
						execResult[4]
					];
				}
			}, {
				re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
				parse: function(execResult) {
					return [
						execResult[1] * 2.55,
						execResult[2] * 2.55,
						execResult[3] * 2.55,
						execResult[4]
					];
				}
			}, {
				// this regex ignores A-F because it's compared against an already lowercased string
				re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
				parse: function(execResult) {
					return [
						parseInt(execResult[1], 16),
						parseInt(execResult[2], 16),
						parseInt(execResult[3], 16)
					];
				}
			}, {
				// this regex ignores A-F because it's compared against an already lowercased string
				re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
				parse: function(execResult) {
					return [
						parseInt(execResult[1] + execResult[1], 16),
						parseInt(execResult[2] + execResult[2], 16),
						parseInt(execResult[3] + execResult[3], 16)
					];
				}
			}, {
				re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
				space: "hsla",
				parse: function(execResult) {
					return [
						execResult[1],
						execResult[2] / 100,
						execResult[3] / 100,
						execResult[4]
					];
				}
			}],

			// jQuery.Color( )
			color = jQuery.Color = function(color, green, blue, alpha) {
				return new jQuery.Color.fn.parse(color, green, blue, alpha);
			},
			spaces = {
				rgba: {
					props: {
						red: {
							idx: 0,
							type: "byte"
						},
						green: {
							idx: 1,
							type: "byte"
						},
						blue: {
							idx: 2,
							type: "byte"
						}
					}
				},

				hsla: {
					props: {
						hue: {
							idx: 0,
							type: "degrees"
						},
						saturation: {
							idx: 1,
							type: "percent"
						},
						lightness: {
							idx: 2,
							type: "percent"
						}
					}
				}
			},
			propTypes = {
				"byte": {
					floor: true,
					max: 255
				},
				"percent": {
					max: 1
				},
				"degrees": {
					mod: 360,
					floor: true
				}
			},
			support = color.support = {},

			// element for support tests
			supportElem = jQuery("<p>")[0],

			// colors = jQuery.Color.names
			colors,

			// local aliases of functions called often
			each = jQuery.each;

		// determine rgba support immediately
		supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
		support.rgba = supportElem.style.backgroundColor.indexOf("rgba") > -1;

		// define cache name and alpha properties
		// for rgba and hsla spaces
		each(spaces, function(spaceName, space) {
			space.cache = "_" + spaceName;
			space.props.alpha = {
				idx: 3,
				type: "percent",
				def: 1
			};
		});

		function clamp(value, prop, allowEmpty) {
			var type = propTypes[prop.type] || {};

			if (value == null) {
				return (allowEmpty || !prop.def) ? null : prop.def;
			}

			// ~~ is an short way of doing floor for positive numbers
			value = type.floor ? ~~value : parseFloat(value);

			// IE will pass in empty strings as value for alpha,
			// which will hit this case
			if (isNaN(value)) {
				return prop.def;
			}

			if (type.mod) {
				// we add mod before modding to make sure that negatives values
				// get converted properly: -10 -> 350
				return (value + type.mod) % type.mod;
			}

			// for now all property types without mod have min and max
			return 0 > value ? 0 : type.max < value ? type.max : value;
		}

		function stringParse(string) {
			var inst = color(),
				rgba = inst._rgba = [];

			string = string.toLowerCase();

			each(stringParsers, function(i, parser) {
				var parsed,
					match = parser.re.exec(string),
					values = match && parser.parse(match),
					spaceName = parser.space || "rgba";

				if (values) {
					parsed = inst[spaceName](values);

					// if this was an rgba parse the assignment might happen twice
					// oh well....
					inst[spaces[spaceName].cache] = parsed[spaces[spaceName].cache];
					rgba = inst._rgba = parsed._rgba;

					// exit each( stringParsers ) here because we matched
					return false;
				}
			});

			// Found a stringParser that handled it
			if (rgba.length) {

				// if this came from a parsed string, force "transparent" when alpha is 0
				// chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
				if (rgba.join() === "0,0,0,0") {
					jQuery.extend(rgba, colors.transparent);
				}
				return inst;
			}

			// named colors
			return colors[string];
		}

		color.fn = jQuery.extend(color.prototype, {
			parse: function(red, green, blue, alpha) {
				if (red === undefined) {
					this._rgba = [null, null, null, null];
					return this;
				}
				if (red.jquery || red.nodeType) {
					red = jQuery(red).css(green);
					green = undefined;
				}

				var inst = this,
					type = jQuery.type(red),
					rgba = this._rgba = [];

				// more than 1 argument specified - assume ( red, green, blue, alpha )
				if (green !== undefined) {
					red = [red, green, blue, alpha];
					type = "array";
				}

				if (type === "string") {
					return this.parse(stringParse(red) || colors._default);
				}

				if (type === "array") {
					each(spaces.rgba.props, function(key, prop) {
						rgba[prop.idx] = clamp(red[prop.idx], prop);
					});
					return this;
				}

				if (type === "object") {
					if (red instanceof color) {
						each(spaces, function(spaceName, space) {
							if (red[space.cache]) {
								inst[space.cache] = red[space.cache].slice();
							}
						});
					} else {
						each(spaces, function(spaceName, space) {
							var cache = space.cache;
							each(space.props, function(key, prop) {

								// if the cache doesn't exist, and we know how to convert
								if (!inst[cache] && space.to) {

									// if the value was null, we don't need to copy it
									// if the key was alpha, we don't need to copy it either
									if (key === "alpha" || red[key] == null) {
										return;
									}
									inst[cache] = space.to(inst._rgba);
								}

								// this is the only case where we allow nulls for ALL properties.
								// call clamp with alwaysAllowEmpty
								inst[cache][prop.idx] = clamp(red[key], prop, true);
							});

							// everything defined but alpha?
							if (inst[cache] && jQuery.inArray(null, inst[cache].slice(0, 3)) < 0) {
								// use the default of 1
								inst[cache][3] = 1;
								if (space.from) {
									inst._rgba = space.from(inst[cache]);
								}
							}
						});
					}
					return this;
				}
			},
			is: function(compare) {
				var is = color(compare),
					same = true,
					inst = this;

				each(spaces, function(_, space) {
					var localCache,
						isCache = is[space.cache];
					if (isCache) {
						localCache = inst[space.cache] || space.to && space.to(inst._rgba) || [];
						each(space.props, function(_, prop) {
							if (isCache[prop.idx] != null) {
								same = (isCache[prop.idx] === localCache[prop.idx]);
								return same;
							}
						});
					}
					return same;
				});
				return same;
			},
			_space: function() {
				var used = [],
					inst = this;
				each(spaces, function(spaceName, space) {
					if (inst[space.cache]) {
						used.push(spaceName);
					}
				});
				return used.pop();
			},
			transition: function(other, distance) {
				var end = color(other),
					spaceName = end._space(),
					space = spaces[spaceName],
					startColor = this.alpha() === 0 ? color("transparent") : this,
					start = startColor[space.cache] || space.to(startColor._rgba),
					result = start.slice();

				end = end[space.cache];
				each(space.props, function(key, prop) {
					var index = prop.idx,
						startValue = start[index],
						endValue = end[index],
						type = propTypes[prop.type] || {};

					// if null, don't override start value
					if (endValue === null) {
						return;
					}
					// if null - use end
					if (startValue === null) {
						result[index] = endValue;
					} else {
						if (type.mod) {
							if (endValue - startValue > type.mod / 2) {
								startValue += type.mod;
							} else if (startValue - endValue > type.mod / 2) {
								startValue -= type.mod;
							}
						}
						result[index] = clamp((endValue - startValue) * distance + startValue, prop);
					}
				});
				return this[spaceName](result);
			},
			blend: function(opaque) {
				// if we are already opaque - return ourself
				if (this._rgba[3] === 1) {
					return this;
				}

				var rgb = this._rgba.slice(),
					a = rgb.pop(),
					blend = color(opaque)._rgba;

				return color(jQuery.map(rgb, function(v, i) {
					return (1 - a) * blend[i] + a * v;
				}));
			},
			toRgbaString: function() {
				var prefix = "rgba(",
					rgba = jQuery.map(this._rgba, function(v, i) {
						return v == null ? (i > 2 ? 1 : 0) : v;
					});

				if (rgba[3] === 1) {
					rgba.pop();
					prefix = "rgb(";
				}

				return prefix + rgba.join() + ")";
			},
			toHslaString: function() {
				var prefix = "hsla(",
					hsla = jQuery.map(this.hsla(), function(v, i) {
						if (v == null) {
							v = i > 2 ? 1 : 0;
						}

						// catch 1 and 2
						if (i && i < 3) {
							v = Math.round(v * 100) + "%";
						}
						return v;
					});

				if (hsla[3] === 1) {
					hsla.pop();
					prefix = "hsl(";
				}
				return prefix + hsla.join() + ")";
			},
			toHexString: function(includeAlpha) {
				var rgba = this._rgba.slice(),
					alpha = rgba.pop();

				if (includeAlpha) {
					rgba.push(~~(alpha * 255));
				}

				return "#" + jQuery.map(rgba, function(v) {

					// default to 0 when nulls exist
					v = (v || 0).toString(16);
					return v.length === 1 ? "0" + v : v;
				}).join("");
			},
			toString: function() {
				return this._rgba[3] === 0 ? "transparent" : this.toRgbaString();
			}
		});
		color.fn.parse.prototype = color.fn;

		// hsla conversions adapted from:
		// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021

		function hue2rgb(p, q, h) {
			h = (h + 1) % 1;
			if (h * 6 < 1) {
				return p + (q - p) * h * 6;
			}
			if (h * 2 < 1) {
				return q;
			}
			if (h * 3 < 2) {
				return p + (q - p) * ((2 / 3) - h) * 6;
			}
			return p;
		}

		spaces.hsla.to = function(rgba) {
			if (rgba[0] == null || rgba[1] == null || rgba[2] == null) {
				return [null, null, null, rgba[3]];
			}
			var r = rgba[0] / 255,
				g = rgba[1] / 255,
				b = rgba[2] / 255,
				a = rgba[3],
				max = Math.max(r, g, b),
				min = Math.min(r, g, b),
				diff = max - min,
				add = max + min,
				l = add * 0.5,
				h, s;

			if (min === max) {
				h = 0;
			} else if (r === max) {
				h = (60 * (g - b) / diff) + 360;
			} else if (g === max) {
				h = (60 * (b - r) / diff) + 120;
			} else {
				h = (60 * (r - g) / diff) + 240;
			}

			// chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
			// otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
			if (diff === 0) {
				s = 0;
			} else if (l <= 0.5) {
				s = diff / add;
			} else {
				s = diff / (2 - add);
			}
			return [Math.round(h) % 360, s, l, a == null ? 1 : a];
		};

		spaces.hsla.from = function(hsla) {
			if (hsla[0] == null || hsla[1] == null || hsla[2] == null) {
				return [null, null, null, hsla[3]];
			}
			var h = hsla[0] / 360,
				s = hsla[1],
				l = hsla[2],
				a = hsla[3],
				q = l <= 0.5 ? l * (1 + s) : l + s - l * s,
				p = 2 * l - q;

			return [
				Math.round(hue2rgb(p, q, h + (1 / 3)) * 255),
				Math.round(hue2rgb(p, q, h) * 255),
				Math.round(hue2rgb(p, q, h - (1 / 3)) * 255),
				a
			];
		};


		each(spaces, function(spaceName, space) {
			var props = space.props,
				cache = space.cache,
				to = space.to,
				from = space.from;

			// makes rgba() and hsla()
			color.fn[spaceName] = function(value) {

				// generate a cache for this space if it doesn't exist
				if (to && !this[cache]) {
					this[cache] = to(this._rgba);
				}
				if (value === undefined) {
					return this[cache].slice();
				}

				var ret,
					type = jQuery.type(value),
					arr = (type === "array" || type === "object") ? value : arguments,
					local = this[cache].slice();

				each(props, function(key, prop) {
					var val = arr[type === "object" ? key : prop.idx];
					if (val == null) {
						val = local[prop.idx];
					}
					local[prop.idx] = clamp(val, prop);
				});

				if (from) {
					ret = color(from(local));
					ret[cache] = local;
					return ret;
				} else {
					return color(local);
				}
			};

			// makes red() green() blue() alpha() hue() saturation() lightness()
			each(props, function(key, prop) {
				// alpha is included in more than one space
				if (color.fn[key]) {
					return;
				}
				color.fn[key] = function(value) {
					var vtype = jQuery.type(value),
						fn = (key === "alpha" ? (this._hsla ? "hsla" : "rgba") : spaceName),
						local = this[fn](),
						cur = local[prop.idx],
						match;

					if (vtype === "undefined") {
						return cur;
					}

					if (vtype === "function") {
						value = value.call(this, cur);
						vtype = jQuery.type(value);
					}
					if (value == null && prop.empty) {
						return this;
					}
					if (vtype === "string") {
						match = rplusequals.exec(value);
						if (match) {
							value = cur + parseFloat(match[2]) * (match[1] === "+" ? 1 : -1);
						}
					}
					local[prop.idx] = value;
					return this[fn](local);
				};
			});
		});

		// add cssHook and .fx.step function for each named hook.
		// accept a space separated string of properties
		color.hook = function(hook) {
			var hooks = hook.split(" ");
			each(hooks, function(i, hook) {
				jQuery.cssHooks[hook] = {
					set: function(elem, value) {
						var parsed, curElem,
							backgroundColor = "";

						if (value !== "transparent" && (jQuery.type(value) !== "string" || (parsed = stringParse(value)))) {
							value = color(parsed || value);
							if (!support.rgba && value._rgba[3] !== 1) {
								curElem = hook === "backgroundColor" ? elem.parentNode : elem;
								while (
									(backgroundColor === "" || backgroundColor === "transparent") &&
									curElem && curElem.style
								) {
									try {
										backgroundColor = jQuery.css(curElem, "backgroundColor");
										curElem = curElem.parentNode;
									} catch (e) {}
								}

								value = value.blend(backgroundColor && backgroundColor !== "transparent" ?
									backgroundColor :
									"_default");
							}

							value = value.toRgbaString();
						}
						try {
							elem.style[hook] = value;
						} catch (e) {
							// wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit'
						}
					}
				};
				jQuery.fx.step[hook] = function(fx) {
					if (!fx.colorInit) {
						fx.start = color(fx.elem, hook);
						fx.end = color(fx.end);
						fx.colorInit = true;
					}
					jQuery.cssHooks[hook].set(fx.elem, fx.start.transition(fx.end, fx.pos));
				};
			});

		};

		color.hook(stepHooks);

		jQuery.cssHooks.borderColor = {
			expand: function(value) {
				var expanded = {};

				each(["Top", "Right", "Bottom", "Left"], function(i, part) {
					expanded["border" + part + "Color"] = value;
				});
				return expanded;
			}
		};

		// Basic color names only.
		// Usage of any of the other color names requires adding yourself or including
		// jquery.color.svg-names.js.
		colors = jQuery.Color.names = {
			// 4.1. Basic color keywords
			aqua: "#00ffff",
			black: "#000000",
			blue: "#0000ff",
			fuchsia: "#ff00ff",
			gray: "#808080",
			green: "#008000",
			lime: "#00ff00",
			maroon: "#800000",
			navy: "#000080",
			olive: "#808000",
			purple: "#800080",
			red: "#ff0000",
			silver: "#c0c0c0",
			teal: "#008080",
			white: "#ffffff",
			yellow: "#ffff00",

			// 4.2.3. "transparent" color keyword
			transparent: [null, null, null, 0],

			_default: "#ffffff"
		};

	})(jQuery);


	/******************************************************************************/
	/****************************** CLASS ANIMATIONS ******************************/
	/******************************************************************************/
	(function() {

		var classAnimationActions = ["add", "remove", "toggle"],
			shorthandStyles = {
				border: 1,
				borderBottom: 1,
				borderColor: 1,
				borderLeft: 1,
				borderRight: 1,
				borderTop: 1,
				borderWidth: 1,
				margin: 1,
				padding: 1
			};

		$.each(["borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle"], function(_, prop) {
			$.fx.step[prop] = function(fx) {
				if (fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr) {
					jQuery.style(fx.elem, prop, fx.end);
					fx.setAttr = true;
				}
			};
		});

		function getElementStyles(elem) {
			var key, len,
				style = elem.ownerDocument.defaultView ?
					elem.ownerDocument.defaultView.getComputedStyle(elem, null) :
					elem.currentStyle,
				styles = {};

			if (style && style.length && style[0] && style[style[0]]) {
				len = style.length;
				while (len--) {
					key = style[len];
					if (typeof style[key] === "string") {
						styles[$.camelCase(key)] = style[key];
					}
				}
				// support: Opera, IE <9
			} else {
				for (key in style) {
					if (typeof style[key] === "string") {
						styles[key] = style[key];
					}
				}
			}

			return styles;
		}


		function styleDifference(oldStyle, newStyle) {
			var diff = {},
				name, value;

			for (name in newStyle) {
				value = newStyle[name];
				if (oldStyle[name] !== value) {
					if (!shorthandStyles[name]) {
						if ($.fx.step[name] || !isNaN(parseFloat(value))) {
							diff[name] = value;
						}
					}
				}
			}

			return diff;
		}

		// support: jQuery <1.8
		if (!$.fn.addBack) {
			$.fn.addBack = function(selector) {
				return this.add(selector == null ?
					this.prevObject : this.prevObject.filter(selector)
				);
			};
		}

		$.effects.animateClass = function(value, duration, easing, callback) {
			var o = $.speed(duration, easing, callback);

			return this.queue(function() {
				var animated = $(this),
					baseClass = animated.attr("class") || "",
					applyClassChange,
					allAnimations = o.children ? animated.find("*").addBack() : animated;

				// map the animated objects to store the original styles.
				allAnimations = allAnimations.map(function() {
					var el = $(this);
					return {
						el: el,
						start: getElementStyles(this)
					};
				});

				// apply class change
				applyClassChange = function() {
					$.each(classAnimationActions, function(i, action) {
						if (value[action]) {
							animated[action + "Class"](value[action]);
						}
					});
				};
				applyClassChange();

				// map all animated objects again - calculate new styles and diff
				allAnimations = allAnimations.map(function() {
					this.end = getElementStyles(this.el[0]);
					this.diff = styleDifference(this.start, this.end);
					return this;
				});

				// apply original class
				animated.attr("class", baseClass);

				// map all animated objects again - this time collecting a promise
				allAnimations = allAnimations.map(function() {
					var styleInfo = this,
						dfd = $.Deferred(),
						opts = $.extend({}, o, {
							queue: false,
							complete: function() {
								dfd.resolve(styleInfo);
							}
						});

					this.el.animate(this.diff, opts);
					return dfd.promise();
				});

				// once all animations have completed:
				$.when.apply($, allAnimations.get()).done(function() {

					// set the final class
					applyClassChange();

					// for each animated element,
					// clear all css properties that were animated
					$.each(arguments, function() {
						var el = this.el;
						$.each(this.diff, function(key) {
							el.css(key, "");
						});
					});

					// this is guarnteed to be there if you use jQuery.speed()
					// it also handles dequeuing the next anim...
					o.complete.call(animated[0]);
				});
			});
		};

		$.fn.extend({
			addClass: (function(orig) {
				return function(classNames, speed, easing, callback) {
					return speed ?
						$.effects.animateClass.call(this, {
							add: classNames
						}, speed, easing, callback) :
						orig.apply(this, arguments);
				};
			})($.fn.addClass),

			removeClass: (function(orig) {
				return function(classNames, speed, easing, callback) {
					return arguments.length > 1 ?
						$.effects.animateClass.call(this, {
							remove: classNames
						}, speed, easing, callback) :
						orig.apply(this, arguments);
				};
			})($.fn.removeClass),

			toggleClass: (function(orig) {
				return function(classNames, force, speed, easing, callback) {
					if (typeof force === "boolean" || force === undefined) {
						if (!speed) {
							// without speed parameter
							return orig.apply(this, arguments);
						} else {
							return $.effects.animateClass.call(this, (force ? {
									add: classNames
								} : {
									remove: classNames
								}),
								speed, easing, callback);
						}
					} else {
						// without force parameter
						return $.effects.animateClass.call(this, {
							toggle: classNames
						}, force, speed, easing);
					}
				};
			})($.fn.toggleClass),

			switchClass: function(remove, add, speed, easing, callback) {
				return $.effects.animateClass.call(this, {
					add: add,
					remove: remove
				}, speed, easing, callback);
			}
		});

	})();

	/******************************************************************************/
	/*********************************** EFFECTS **********************************/
	/******************************************************************************/

	(function() {

		$.extend($.effects, {
			version: "1.10.3",

			// Saves a set of properties in a data storage
			save: function(element, set) {
				for (var i = 0; i < set.length; i++) {
					if (set[i] !== null) {
						element.data(dataSpace + set[i], element[0].style[set[i]]);
					}
				}
			},

			// Restores a set of previously saved properties from a data storage
			restore: function(element, set) {
				var val, i;
				for (i = 0; i < set.length; i++) {
					if (set[i] !== null) {
						val = element.data(dataSpace + set[i]);
						// support: jQuery 1.6.2
						// http://bugs.jquery.com/ticket/9917
						// jQuery 1.6.2 incorrectly returns undefined for any falsy value.
						// We can't differentiate between "" and 0 here, so we just assume
						// empty string since it's likely to be a more common value...
						if (val === undefined) {
							val = "";
						}
						element.css(set[i], val);
					}
				}
			},

			setMode: function(el, mode) {
				if (mode === "toggle") {
					mode = el.is(":hidden") ? "show" : "hide";
				}
				return mode;
			},

			// Translates a [top,left] array into a baseline value
			// this should be a little more flexible in the future to handle a string & hash
			getBaseline: function(origin, original) {
				var y, x;
				switch (origin[0]) {
					case "top":
						y = 0;
						break;
					case "middle":
						y = 0.5;
						break;
					case "bottom":
						y = 1;
						break;
					default:
						y = origin[0] / original.height;
				}
				switch (origin[1]) {
					case "left":
						x = 0;
						break;
					case "center":
						x = 0.5;
						break;
					case "right":
						x = 1;
						break;
					default:
						x = origin[1] / original.width;
				}
				return {
					x: x,
					y: y
				};
			},

			// Wraps the element around a wrapper that copies position properties
			createWrapper: function(element) {

				// if the element is already wrapped, return it
				if (element.parent().is(".ui-effects-wrapper")) {
					return element.parent();
				}

				// wrap the element
				var props = {
					width: element.outerWidth(true),
					height: element.outerHeight(true),
					"float": element.css("float")
				},
					wrapper = $("<div></div>")
						.addClass("ui-effects-wrapper")
						.css({
							fontSize: "100%",
							background: "transparent",
							border: "none",
							margin: 0,
							padding: 0
						}),
					// Store the size in case width/height are defined in % - Fixes #5245
					size = {
						width: element.width(),
						height: element.height()
					},
					active = document.activeElement;

				// support: Firefox
				// Firefox incorrectly exposes anonymous content
				// https://bugzilla.mozilla.org/show_bug.cgi?id=561664
				try {
					active.id;
				} catch (e) {
					active = document.body;
				}

				element.wrap(wrapper);

				// Fixes #7595 - Elements lose focus when wrapped.
				if (element[0] === active || $.contains(element[0], active)) {
					$(active).focus();
				}

				wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element

				// transfer positioning properties to the wrapper
				if (element.css("position") === "static") {
					wrapper.css({
						position: "relative"
					});
					element.css({
						position: "relative"
					});
				} else {
					$.extend(props, {
						position: element.css("position"),
						zIndex: element.css("z-index")
					});
					$.each(["top", "left", "bottom", "right"], function(i, pos) {
						props[pos] = element.css(pos);
						if (isNaN(parseInt(props[pos], 10))) {
							props[pos] = "auto";
						}
					});
					element.css({
						position: "relative",
						top: 0,
						left: 0,
						right: "auto",
						bottom: "auto"
					});
				}
				element.css(size);

				return wrapper.css(props).show();
			},

			removeWrapper: function(element) {
				var active = document.activeElement;

				if (element.parent().is(".ui-effects-wrapper")) {
					element.parent().replaceWith(element);

					// Fixes #7595 - Elements lose focus when wrapped.
					if (element[0] === active || $.contains(element[0], active)) {
						$(active).focus();
					}
				}


				return element;
			},

			setTransition: function(element, list, factor, value) {
				value = value || {};
				$.each(list, function(i, x) {
					var unit = element.cssUnit(x);
					if (unit[0] > 0) {
						value[x] = unit[0] * factor + unit[1];
					}
				});
				return value;
			}
		});

		// return an effect options object for the given parameters:

		function _normalizeArguments(effect, options, speed, callback) {

			// allow passing all options as the first parameter
			if ($.isPlainObject(effect)) {
				options = effect;
				effect = effect.effect;
			}

			// convert to an object
			effect = {
				effect: effect
			};

			// catch (effect, null, ...)
			if (options == null) {
				options = {};
			}

			// catch (effect, callback)
			if ($.isFunction(options)) {
				callback = options;
				speed = null;
				options = {};
			}

			// catch (effect, speed, ?)
			if (typeof options === "number" || $.fx.speeds[options]) {
				callback = speed;
				speed = options;
				options = {};
			}

			// catch (effect, options, callback)
			if ($.isFunction(speed)) {
				callback = speed;
				speed = null;
			}

			// add options to effect
			if (options) {
				$.extend(effect, options);
			}

			speed = speed || options.duration;
			effect.duration = $.fx.off ? 0 :
				typeof speed === "number" ? speed :
				speed in $.fx.speeds ? $.fx.speeds[speed] :
				$.fx.speeds._default;

			effect.complete = callback || options.complete;

			return effect;
		}

		function standardAnimationOption(option) {
			// Valid standard speeds (nothing, number, named speed)
			if (!option || typeof option === "number" || $.fx.speeds[option]) {
				return true;
			}

			// Invalid strings - treat as "normal" speed
			if (typeof option === "string" && !$.effects.effect[option]) {
				return true;
			}

			// Complete callback
			if ($.isFunction(option)) {
				return true;
			}

			// Options hash (but not naming an effect)
			if (typeof option === "object" && !option.effect) {
				return true;
			}

			// Didn't match any standard API
			return false;
		}

		$.fn.extend({
			effect: function( /* effect, options, speed, callback */ ) {
				var args = _normalizeArguments.apply(this, arguments),
					mode = args.mode,
					queue = args.queue,
					effectMethod = $.effects.effect[args.effect];

				if ($.fx.off || !effectMethod) {
					// delegate to the original method (e.g., .show()) if possible
					if (mode) {
						return this[mode](args.duration, args.complete);
					} else {
						return this.each(function() {
							if (args.complete) {
								args.complete.call(this);
							}
						});
					}
				}

				function run(next) {
					var elem = $(this),
						complete = args.complete,
						mode = args.mode;

					function done() {
						if ($.isFunction(complete)) {
							complete.call(elem[0]);
						}
						if ($.isFunction(next)) {
							next();
						}
					}

					// If the element already has the correct final state, delegate to
					// the core methods so the internal tracking of "olddisplay" works.
					if (elem.is(":hidden") ? mode === "hide" : mode === "show") {
						elem[mode]();
						done();
					} else {
						effectMethod.call(elem[0], args, done);
					}
				}

				return queue === false ? this.each(run) : this.queue(queue || "fx", run);
			},

			show: (function(orig) {
				return function(option) {
					if (standardAnimationOption(option)) {
						return orig.apply(this, arguments);
					} else {
						var args = _normalizeArguments.apply(this, arguments);
						args.mode = "show";
						return this.effect.call(this, args);
					}
				};
			})($.fn.show),

			hide: (function(orig) {
				return function(option) {
					if (standardAnimationOption(option)) {
						return orig.apply(this, arguments);
					} else {
						var args = _normalizeArguments.apply(this, arguments);
						args.mode = "hide";
						return this.effect.call(this, args);
					}
				};
			})($.fn.hide),

			toggle: (function(orig) {
				return function(option) {
					if (standardAnimationOption(option) || typeof option === "boolean") {
						return orig.apply(this, arguments);
					} else {
						var args = _normalizeArguments.apply(this, arguments);
						args.mode = "toggle";
						return this.effect.call(this, args);
					}
				};
			})($.fn.toggle),

			// helper functions
			cssUnit: function(key) {
				var style = this.css(key),
					val = [];

				$.each(["em", "px", "%", "pt"], function(i, unit) {
					if (style.indexOf(unit) > 0) {
						val = [parseFloat(style), unit];
					}
				});
				return val;
			}
		});

	})();

	/******************************************************************************/
	/*********************************** EASING ***********************************/
	/******************************************************************************/

	(function() {

		// based on easing equations from Robert Penner (http://www.robertpenner.com/easing)

		var baseEasings = {};

		$.each(["Quad", "Cubic", "Quart", "Quint", "Expo"], function(i, name) {
			baseEasings[name] = function(p) {
				return Math.pow(p, i + 2);
			};
		});

		$.extend(baseEasings, {
			Sine: function(p) {
				return 1 - Math.cos(p * Math.PI / 2);
			},
			Circ: function(p) {
				return 1 - Math.sqrt(1 - p * p);
			},
			Elastic: function(p) {
				return p === 0 || p === 1 ? p : -Math.pow(2, 8 * (p - 1)) * Math.sin(((p - 1) * 80 - 7.5) * Math.PI / 15);
			},
			Back: function(p) {
				return p * p * (3 * p - 2);
			},
			Bounce: function(p) {
				var pow2,
					bounce = 4;

				while (p < ((pow2 = Math.pow(2, --bounce)) - 1) / 11) {}
				return 1 / Math.pow(4, 3 - bounce) - 7.5625 * Math.pow((pow2 * 3 - 2) / 22 - p, 2);
			}
		});

		$.each(baseEasings, function(name, easeIn) {
			$.easing["easeIn" + name] = easeIn;
			$.easing["easeOut" + name] = function(p) {
				return 1 - easeIn(1 - p);
			};
			$.easing["easeInOut" + name] = function(p) {
				return p < 0.5 ?
					easeIn(p * 2) / 2 :
					1 - easeIn(p * -2 + 2) / 2;
			};
		});

	})();

})(jQuery);

(function($, undefined) {

	var uid = 0,
		hideProps = {},
		showProps = {};

	hideProps.height = hideProps.paddingTop = hideProps.paddingBottom =
		hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide";
	showProps.height = showProps.paddingTop = showProps.paddingBottom =
		showProps.borderTopWidth = showProps.borderBottomWidth = "show";

	$.widget("ui.accordion", {
		version: "1.10.3",
		options: {
			active: 0,
			animate: {},
			collapsible: false,
			event: "click",
			header: "> li > :first-child,> :not(li):even",
			heightStyle: "auto",
			icons: {
				activeHeader: "ui-icon-triangle-1-s",
				header: "ui-icon-triangle-1-e"
			},

			// callbacks
			activate: null,
			beforeActivate: null
		},

		_create: function() {
			var options = this.options;
			this.prevShow = this.prevHide = $();
			this.element.addClass("ui-accordion ui-widget ui-helper-reset")
			// ARIA
			.attr("role", "tablist");

			// don't allow collapsible: false and active: false / null
			if (!options.collapsible && (options.active === false || options.active == null)) {
				options.active = 0;
			}

			this._processPanels();
			// handle negative values
			if (options.active < 0) {
				options.active += this.headers.length;
			}
			this._refresh();
		},

		_getCreateEventData: function() {
			return {
				header: this.active,
				panel: !this.active.length ? $() : this.active.next(),
				content: !this.active.length ? $() : this.active.next()
			};
		},

		_createIcons: function() {
			var icons = this.options.icons;
			if (icons) {
				$("<span>")
					.addClass("ui-accordion-header-icon ui-icon " + icons.header)
					.prependTo(this.headers);
				this.active.children(".ui-accordion-header-icon")
					.removeClass(icons.header)
					.addClass(icons.activeHeader);
				this.headers.addClass("ui-accordion-icons");
			}
		},

		_destroyIcons: function() {
			this.headers
				.removeClass("ui-accordion-icons")
				.children(".ui-accordion-header-icon")
				.remove();
		},

		_destroy: function() {
			var contents;

			// clean up main element
			this.element
				.removeClass("ui-accordion ui-widget ui-helper-reset")
				.removeAttr("role");

			// clean up headers
			this.headers
				.removeClass("ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top")
				.removeAttr("role")
				.removeAttr("aria-selected")
				.removeAttr("aria-controls")
				.removeAttr("tabIndex")
				.each(function() {
					if (/^ui-accordion/.test(this.id)) {
						this.removeAttribute("id");
					}
				});
			this._destroyIcons();

			// clean up content panels
			contents = this.headers.next()
				.css("display", "")
				.removeAttr("role")
				.removeAttr("aria-expanded")
				.removeAttr("aria-hidden")
				.removeAttr("aria-labelledby")
				.removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled")
				.each(function() {
					if (/^ui-accordion/.test(this.id)) {
						this.removeAttribute("id");
					}
				});
			if (this.options.heightStyle !== "content") {
				contents.css("height", "");
			}
		},

		_setOption: function(key, value) {
			if (key === "active") {
				// _activate() will handle invalid values and update this.options
				this._activate(value);
				return;
			}

			if (key === "event") {
				if (this.options.event) {
					this._off(this.headers, this.options.event);
				}
				this._setupEvents(value);
			}

			this._super(key, value);

			// setting collapsible: false while collapsed; open first panel
			if (key === "collapsible" && !value && this.options.active === false) {
				this._activate(0);
			}

			if (key === "icons") {
				this._destroyIcons();
				if (value) {
					this._createIcons();
				}
			}

			// #5332 - opacity doesn't cascade to positioned elements in IE
			// so we need to add the disabled class to the headers and panels
			if (key === "disabled") {
				this.headers.add(this.headers.next())
					.toggleClass("ui-state-disabled", !! value);
			}
		},

		_keydown: function(event) {
			/*jshint maxcomplexity:15*/
			if (event.altKey || event.ctrlKey) {
				return;
			}

			var keyCode = $.ui.keyCode,
				length = this.headers.length,
				currentIndex = this.headers.index(event.target),
				toFocus = false;

			switch (event.keyCode) {
				case keyCode.RIGHT:
				case keyCode.DOWN:
					toFocus = this.headers[(currentIndex + 1) % length];
					break;
				case keyCode.LEFT:
				case keyCode.UP:
					toFocus = this.headers[(currentIndex - 1 + length) % length];
					break;
				case keyCode.SPACE:
				case keyCode.ENTER:
					this._eventHandler(event);
					break;
				case keyCode.HOME:
					toFocus = this.headers[0];
					break;
				case keyCode.END:
					toFocus = this.headers[length - 1];
					break;
			}

			if (toFocus) {
				$(event.target).attr("tabIndex", -1);
				$(toFocus).attr("tabIndex", 0);
				toFocus.focus();
				event.preventDefault();
			}
		},

		_panelKeyDown: function(event) {
			if (event.keyCode === $.ui.keyCode.UP && event.ctrlKey) {
				$(event.currentTarget).prev().focus();
			}
		},

		refresh: function() {
			var options = this.options;
			this._processPanels();

			// was collapsed or no panel
			if ((options.active === false && options.collapsible === true) || !this.headers.length) {
				options.active = false;
				this.active = $();
				// active false only when collapsible is true
			} else if (options.active === false) {
				this._activate(0);
				// was active, but active panel is gone
			} else if (this.active.length && !$.contains(this.element[0], this.active[0])) {
				// all remaining panel are disabled
				if (this.headers.length === this.headers.find(".ui-state-disabled").length) {
					options.active = false;
					this.active = $();
					// activate previous panel
				} else {
					this._activate(Math.max(0, options.active - 1));
				}
				// was active, active panel still exists
			} else {
				// make sure active index is correct
				options.active = this.headers.index(this.active);
			}

			this._destroyIcons();

			this._refresh();
		},

		_processPanels: function() {
			this.headers = this.element.find(this.options.header)
				.addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all");

			this.headers.next()
				.addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom")
				.filter(":not(.ui-accordion-content-active)")
				.hide();
		},

		_refresh: function() {
			var maxHeight,
				options = this.options,
				heightStyle = options.heightStyle,
				parent = this.element.parent(),
				accordionId = this.accordionId = "ui-accordion-" +
					(this.element.attr("id") || ++uid);

			this.active = this._findActive(options.active)
				.addClass("ui-accordion-header-active ui-state-active ui-corner-top")
				.removeClass("ui-corner-all");
			this.active.next()
				.addClass("ui-accordion-content-active")
				.show();

			this.headers
				.attr("role", "tab")
				.each(function(i) {
					var header = $(this),
						headerId = header.attr("id"),
						panel = header.next(),
						panelId = panel.attr("id");
					if (!headerId) {
						headerId = accordionId + "-header-" + i;
						header.attr("id", headerId);
					}
					if (!panelId) {
						panelId = accordionId + "-panel-" + i;
						panel.attr("id", panelId);
					}
					header.attr("aria-controls", panelId);
					panel.attr("aria-labelledby", headerId);
				})
				.next()
				.attr("role", "tabpanel");

			this.headers
				.not(this.active)
				.attr({
					"aria-selected": "false",
					tabIndex: -1
				})
				.next()
				.attr({
					"aria-expanded": "false",
					"aria-hidden": "true"
				})
				.hide();

			// make sure at least one header is in the tab order
			if (!this.active.length) {
				this.headers.eq(0).attr("tabIndex", 0);
			} else {
				this.active.attr({
					"aria-selected": "true",
					tabIndex: 0
				})
					.next()
					.attr({
						"aria-expanded": "true",
						"aria-hidden": "false"
					});
			}

			this._createIcons();

			this._setupEvents(options.event);

			if (heightStyle === "fill") {
				maxHeight = parent.height();
				this.element.siblings(":visible").each(function() {
					var elem = $(this),
						position = elem.css("position");

					if (position === "absolute" || position === "fixed") {
						return;
					}
					maxHeight -= elem.outerHeight(true);
				});

				this.headers.each(function() {
					maxHeight -= $(this).outerHeight(true);
				});

				this.headers.next()
					.each(function() {
						$(this).height(Math.max(0, maxHeight -
							$(this).innerHeight() + $(this).height()));
					})
					.css("overflow", "auto");
			} else if (heightStyle === "auto") {
				maxHeight = 0;
				this.headers.next()
					.each(function() {
						maxHeight = Math.max(maxHeight, $(this).css("height", "").height());
					})
					.height(maxHeight);
			}
		},

		_activate: function(index) {
			var active = this._findActive(index)[0];

			// trying to activate the already active panel
			if (active === this.active[0]) {
				return;
			}

			// trying to collapse, simulate a click on the currently active header
			active = active || this.active[0];

			this._eventHandler({
				target: active,
				currentTarget: active,
				preventDefault: $.noop
			});
		},

		_findActive: function(selector) {
			return typeof selector === "number" ? this.headers.eq(selector) : $();
		},

		_setupEvents: function(event) {
			var events = {
				keydown: "_keydown"
			};
			if (event) {
				$.each(event.split(" "), function(index, eventName) {
					events[eventName] = "_eventHandler";
				});
			}

			this._off(this.headers.add(this.headers.next()));
			this._on(this.headers, events);
			this._on(this.headers.next(), {
				keydown: "_panelKeyDown"
			});
			this._hoverable(this.headers);
			this._focusable(this.headers);
		},

		_eventHandler: function(event) {
			var options = this.options,
				active = this.active,
				clicked = $(event.currentTarget),
				clickedIsActive = clicked[0] === active[0],
				collapsing = clickedIsActive && options.collapsible,
				toShow = collapsing ? $() : clicked.next(),
				toHide = active.next(),
				eventData = {
					oldHeader: active,
					oldPanel: toHide,
					newHeader: collapsing ? $() : clicked,
					newPanel: toShow
				};

			event.preventDefault();

			if (
				// click on active header, but not collapsible
				(clickedIsActive && !options.collapsible) ||
				// allow canceling activation
				(this._trigger("beforeActivate", event, eventData) === false)) {
				return;
			}

			options.active = collapsing ? false : this.headers.index(clicked);

			// when the call to ._toggle() comes after the class changes
			// it causes a very odd bug in IE 8 (see #6720)
			this.active = clickedIsActive ? $() : clicked;
			this._toggle(eventData);

			// switch classes
			// corner classes on the previously active header stay after the animation
			active.removeClass("ui-accordion-header-active ui-state-active");
			if (options.icons) {
				active.children(".ui-accordion-header-icon")
					.removeClass(options.icons.activeHeader)
					.addClass(options.icons.header);
			}

			if (!clickedIsActive) {
				clicked
					.removeClass("ui-corner-all")
					.addClass("ui-accordion-header-active ui-state-active ui-corner-top");
				if (options.icons) {
					clicked.children(".ui-accordion-header-icon")
						.removeClass(options.icons.header)
						.addClass(options.icons.activeHeader);
				}

				clicked
					.next()
					.addClass("ui-accordion-content-active");
			}
		},

		_toggle: function(data) {
			var toShow = data.newPanel,
				toHide = this.prevShow.length ? this.prevShow : data.oldPanel;

			// handle activating a panel during the animation for another activation
			this.prevShow.add(this.prevHide).stop(true, true);
			this.prevShow = toShow;
			this.prevHide = toHide;

			if (this.options.animate) {
				this._animate(toShow, toHide, data);
			} else {
				toHide.hide();
				toShow.show();
				this._toggleComplete(data);
			}

			toHide.attr({
				"aria-expanded": "false",
				"aria-hidden": "true"
			});
			toHide.prev().attr("aria-selected", "false");
			// if we're switching panels, remove the old header from the tab order
			// if we're opening from collapsed state, remove the previous header from the tab order
			// if we're collapsing, then keep the collapsing header in the tab order
			if (toShow.length && toHide.length) {
				toHide.prev().attr("tabIndex", -1);
			} else if (toShow.length) {
				this.headers.filter(function() {
					return $(this).attr("tabIndex") === 0;
				})
					.attr("tabIndex", -1);
			}

			toShow
				.attr({
					"aria-expanded": "true",
					"aria-hidden": "false"
				})
				.prev()
				.attr({
					"aria-selected": "true",
					tabIndex: 0
				});
		},

		_animate: function(toShow, toHide, data) {
			var total, easing, duration,
				that = this,
				adjust = 0,
				down = toShow.length &&
					(!toHide.length || (toShow.index() < toHide.index())),
				animate = this.options.animate || {},
				options = down && animate.down || animate,
				complete = function() {
					that._toggleComplete(data);
				};

			if (typeof options === "number") {
				duration = options;
			}
			if (typeof options === "string") {
				easing = options;
			}
			// fall back from options to animation in case of partial down settings
			easing = easing || options.easing || animate.easing;
			duration = duration || options.duration || animate.duration;

			if (!toHide.length) {
				return toShow.animate(showProps, duration, easing, complete);
			}
			if (!toShow.length) {
				return toHide.animate(hideProps, duration, easing, complete);
			}

			total = toShow.show().outerHeight();
			toHide.animate(hideProps, {
				duration: duration,
				easing: easing,
				step: function(now, fx) {
					fx.now = Math.round(now);
				}
			});
			toShow
				.hide()
				.animate(showProps, {
					duration: duration,
					easing: easing,
					complete: complete,
					step: function(now, fx) {
						fx.now = Math.round(now);
						if (fx.prop !== "height") {
							adjust += fx.now;
						} else if (that.options.heightStyle !== "content") {
							fx.now = Math.round(total - toHide.outerHeight() - adjust);
							adjust = 0;
						}
					}
				});
		},

		_toggleComplete: function(data) {
			var toHide = data.oldPanel;

			toHide
				.removeClass("ui-accordion-content-active")
				.prev()
				.removeClass("ui-corner-top")
				.addClass("ui-corner-all");

			// Work around for rendering bug in IE (#5421)
			if (toHide.length) {
				toHide.parent()[0].className = toHide.parent()[0].className;
			}

			this._trigger("activate", null, data);
		}
	});

})(jQuery);

(function($, undefined) {

	// used to prevent race conditions with remote data sources
	var requestIndex = 0;

	$.widget("ui.autocomplete", {
		version: "1.10.3",
		defaultElement: "<input>",
		options: {
			appendTo: null,
			autoFocus: false,
			delay: 300,
			minLength: 1,
			position: {
				my: "left top",
				at: "left bottom",
				collision: "none"
			},
			source: null,

			// callbacks
			change: null,
			close: null,
			focus: null,
			open: null,
			response: null,
			search: null,
			select: null
		},

		pending: 0,

		_create: function() {
			// Some browsers only repeat keydown events, not keypress events,
			// so we use the suppressKeyPress flag to determine if we've already
			// handled the keydown event. #7269
			// Unfortunately the code for & in keypress is the same as the up arrow,
			// so we use the suppressKeyPressRepeat flag to avoid handling keypress
			// events when we know the keydown event was used to modify the
			// search term. #7799
			var suppressKeyPress, suppressKeyPressRepeat, suppressInput,
				nodeName = this.element[0].nodeName.toLowerCase(),
				isTextarea = nodeName === "textarea",
				isInput = nodeName === "input";

			this.isMultiLine =
			// Textareas are always multi-line
			isTextarea ? true :
			// Inputs are always single-line, even if inside a contentEditable element
			// IE also treats inputs as contentEditable
			isInput ? false :
			// All other element types are determined by whether or not they're contentEditable
			this.element.prop("isContentEditable");

			this.valueMethod = this.element[isTextarea || isInput ? "val" : "text"];
			this.isNewMenu = true;

			this.element
				.addClass("ui-autocomplete-input")
				.attr("autocomplete", "off");

			this._on(this.element, {
				keydown: function(event) {
					/*jshint maxcomplexity:15*/
					if (this.element.prop("readOnly")) {
						suppressKeyPress = true;
						suppressInput = true;
						suppressKeyPressRepeat = true;
						return;
					}

					suppressKeyPress = false;
					suppressInput = false;
					suppressKeyPressRepeat = false;
					var keyCode = $.ui.keyCode;
					switch (event.keyCode) {
						case keyCode.PAGE_UP:
							suppressKeyPress = true;
							this._move("previousPage", event);
							break;
						case keyCode.PAGE_DOWN:
							suppressKeyPress = true;
							this._move("nextPage", event);
							break;
						case keyCode.UP:
							suppressKeyPress = true;
							this._keyEvent("previous", event);
							break;
						case keyCode.DOWN:
							suppressKeyPress = true;
							this._keyEvent("next", event);
							break;
						case keyCode.ENTER:
						case keyCode.NUMPAD_ENTER:
							// when menu is open and has focus
							if (this.menu.active) {
								// #6055 - Opera still allows the keypress to occur
								// which causes forms to submit
								suppressKeyPress = true;
								event.preventDefault();
								this.menu.select(event);
							}
							break;
						case keyCode.TAB:
							if (this.menu.active) {
								this.menu.select(event);
							}
							break;
						case keyCode.ESCAPE:
							if (this.menu.element.is(":visible")) {
								this._value(this.term);
								this.close(event);
								// Different browsers have different default behavior for escape
								// Single press can mean undo or clear
								// Double press in IE means clear the whole form
								event.preventDefault();
							}
							break;
						default:
							suppressKeyPressRepeat = true;
							// search timeout should be triggered before the input value is changed
							this._searchTimeout(event);
							break;
					}
				},
				keypress: function(event) {
					if (suppressKeyPress) {
						suppressKeyPress = false;
						if (!this.isMultiLine || this.menu.element.is(":visible")) {
							event.preventDefault();
						}
						return;
					}
					if (suppressKeyPressRepeat) {
						return;
					}

					// replicate some key handlers to allow them to repeat in Firefox and Opera
					var keyCode = $.ui.keyCode;
					switch (event.keyCode) {
						case keyCode.PAGE_UP:
							this._move("previousPage", event);
							break;
						case keyCode.PAGE_DOWN:
							this._move("nextPage", event);
							break;
						case keyCode.UP:
							this._keyEvent("previous", event);
							break;
						case keyCode.DOWN:
							this._keyEvent("next", event);
							break;
					}
				},
				input: function(event) {
					if (suppressInput) {
						suppressInput = false;
						event.preventDefault();
						return;
					}
					this._searchTimeout(event);
				},
				focus: function() {
					this.selectedItem = null;
					this.previous = this._value();
				},
				blur: function(event) {
					if (this.cancelBlur) {
						delete this.cancelBlur;
						return;
					}

					clearTimeout(this.searching);
					this.close(event);
					this._change(event);
				}
			});

			this._initSource();
			this.menu = $("<ul>")
				.addClass("ui-autocomplete ui-front")
				.appendTo(this._appendTo())
				.menu({
					// disable ARIA support, the live region takes care of that
					role: null
				})
				.hide()
				.data("ui-menu");

			this._on(this.menu.element, {
				mousedown: function(event) {
					// prevent moving focus out of the text field
					event.preventDefault();

					// IE doesn't prevent moving focus even with event.preventDefault()
					// so we set a flag to know when we should ignore the blur event
					this.cancelBlur = true;
					this._delay(function() {
						delete this.cancelBlur;
					});

					// clicking on the scrollbar causes focus to shift to the body
					// but we can't detect a mouseup or a click immediately afterward
					// so we have to track the next mousedown and close the menu if
					// the user clicks somewhere outside of the autocomplete
					var menuElement = this.menu.element[0];
					if (!$(event.target).closest(".ui-menu-item").length) {
						this._delay(function() {
							var that = this;
							this.document.one("mousedown", function(event) {
								if (event.target !== that.element[0] &&
									event.target !== menuElement && !$.contains(menuElement, event.target)) {
									that.close();
								}
							});
						});
					}
				},
				menufocus: function(event, ui) {
					// support: Firefox
					// Prevent accidental activation of menu items in Firefox (#7024 #9118)
					if (this.isNewMenu) {
						this.isNewMenu = false;
						if (event.originalEvent && /^mouse/.test(event.originalEvent.type)) {
							this.menu.blur();

							this.document.one("mousemove", function() {
								$(event.target).trigger(event.originalEvent);
							});

							return;
						}
					}

					var item = ui.item.data("ui-autocomplete-item");
					if (false !== this._trigger("focus", event, {
						item: item
					})) {
						// use value to match what will end up in the input, if it was a key event
						if (event.originalEvent && /^key/.test(event.originalEvent.type)) {
							this._value(item.value);
						}
					} else {
						// Normally the input is populated with the item's value as the
						// menu is navigated, causing screen readers to notice a change and
						// announce the item. Since the focus event was canceled, this doesn't
						// happen, so we update the live region so that screen readers can
						// still notice the change and announce it.
						this.liveRegion.text(item.value);
					}
				},
				menuselect: function(event, ui) {
					var item = ui.item.data("ui-autocomplete-item"),
						previous = this.previous;

					// only trigger when focus was lost (click on menu)
					if (this.element[0] !== this.document[0].activeElement) {
						this.element.focus();
						this.previous = previous;
						// #6109 - IE triggers two focus events and the second
						// is asynchronous, so we need to reset the previous
						// term synchronously and asynchronously :-(
						this._delay(function() {
							this.previous = previous;
							this.selectedItem = item;
						});
					}

					if (false !== this._trigger("select", event, {
						item: item
					})) {
						this._value(item.value);
					}
					// reset the term after the select event
					// this allows custom select handling to work properly
					this.term = this._value();

					this.close(event);
					this.selectedItem = item;
				}
			});

			this.liveRegion = $("<span>", {
				role: "status",
				"aria-live": "polite"
			})
				.addClass("ui-helper-hidden-accessible")
				.insertBefore(this.element);

			// turning off autocomplete prevents the browser from remembering the
			// value when navigating through history, so we re-enable autocomplete
			// if the page is unloaded before the widget is destroyed. #7790
			this._on(this.window, {
				beforeunload: function() {
					this.element.removeAttr("autocomplete");
				}
			});
		},

		_destroy: function() {
			clearTimeout(this.searching);
			this.element
				.removeClass("ui-autocomplete-input")
				.removeAttr("autocomplete");
			this.menu.element.remove();
			this.liveRegion.remove();
		},

		_setOption: function(key, value) {
			this._super(key, value);
			if (key === "source") {
				this._initSource();
			}
			if (key === "appendTo") {
				this.menu.element.appendTo(this._appendTo());
			}
			if (key === "disabled" && value && this.xhr) {
				this.xhr.abort();
			}
		},

		_appendTo: function() {
			var element = this.options.appendTo;

			if (element) {
				element = element.jquery || element.nodeType ?
					$(element) :
					this.document.find(element).eq(0);
			}

			if (!element) {
				element = this.element.closest(".ui-front");
			}

			if (!element.length) {
				element = this.document[0].body;
			}

			return element;
		},

		_initSource: function() {
			var array, url,
				that = this;
			if ($.isArray(this.options.source)) {
				array = this.options.source;
				this.source = function(request, response) {
					response($.ui.autocomplete.filter(array, request.term));
				};
			} else if (typeof this.options.source === "string") {
				url = this.options.source;
				this.source = function(request, response) {
					if (that.xhr) {
						that.xhr.abort();
					}
					that.xhr = $.ajax({
						url: url,
						data: request,
						dataType: "json",
						success: function(data) {
							response(data);
						},
						error: function() {
							response([]);
						}
					});
				};
			} else {
				this.source = this.options.source;
			}
		},

		_searchTimeout: function(event) {
			clearTimeout(this.searching);
			this.searching = this._delay(function() {
				// only search if the value has changed
				if (this.term !== this._value()) {
					this.selectedItem = null;
					this.search(null, event);
				}
			}, this.options.delay);
		},

		search: function(value, event) {
			value = value != null ? value : this._value();

			// always save the actual value, not the one passed as an argument
			this.term = this._value();

			if (value.length < this.options.minLength) {
				return this.close(event);
			}

			if (this._trigger("search", event) === false) {
				return;
			}

			return this._search(value);
		},

		_search: function(value) {
			this.pending++;
			this.element.addClass("ui-autocomplete-loading");
			this.cancelSearch = false;

			this.source({
				term: value
			}, this._response());
		},

		_response: function() {
			var that = this,
				index = ++requestIndex;

			return function(content) {
				if (index === requestIndex) {
					that.__response(content);
				}

				that.pending--;
				if (!that.pending) {
					that.element.removeClass("ui-autocomplete-loading");
				}
			};
		},

		__response: function(content) {
			if (content) {
				content = this._normalize(content);
			}
			this._trigger("response", null, {
				content: content
			});
			if (!this.options.disabled && content && content.length && !this.cancelSearch) {
				this._suggest(content);
				this._trigger("open");
			} else {
				// use ._close() instead of .close() so we don't cancel future searches
				this._close();
			}
		},

		close: function(event) {
			this.cancelSearch = true;
			this._close(event);
		},

		_close: function(event) {
			if (this.menu.element.is(":visible")) {
				this.menu.element.hide();
				this.menu.blur();
				this.isNewMenu = true;
				this._trigger("close", event);
			}
		},

		_change: function(event) {
			if (this.previous !== this._value()) {
				this._trigger("change", event, {
					item: this.selectedItem
				});
			}
		},

		_normalize: function(items) {
			// assume all items have the right format when the first item is complete
			if (items.length && items[0].label && items[0].value) {
				return items;
			}
			return $.map(items, function(item) {
				if (typeof item === "string") {
					return {
						label: item,
						value: item
					};
				}
				return $.extend({
					label: item.label || item.value,
					value: item.value || item.label
				}, item);
			});
		},

		_suggest: function(items) {
			var ul = this.menu.element.empty();
			this._renderMenu(ul, items);
			this.isNewMenu = true;
			this.menu.refresh();

			// size and position menu
			ul.show();
			this._resizeMenu();
			ul.position($.extend({
				of: this.element
			}, this.options.position));

			if (this.options.autoFocus) {
				this.menu.next();
			}
		},

		_resizeMenu: function() {
			var ul = this.menu.element;
			ul.outerWidth(Math.max(
				// Firefox wraps long text (possibly a rounding bug)
				// so we add 1px to avoid the wrapping (#7513)
				ul.width("").outerWidth() + 1,
				this.element.outerWidth()
			));
		},

		_renderMenu: function(ul, items) {
			var that = this;
			$.each(items, function(index, item) {
				that._renderItemData(ul, item);
			});
		},

		_renderItemData: function(ul, item) {
			return this._renderItem(ul, item).data("ui-autocomplete-item", item);
		},

		_renderItem: function(ul, item) {
			return $("<li>")
				.append($("<a>").text(item.label))
				.appendTo(ul);
		},

		_move: function(direction, event) {
			if (!this.menu.element.is(":visible")) {
				this.search(null, event);
				return;
			}
			if (this.menu.isFirstItem() && /^previous/.test(direction) ||
				this.menu.isLastItem() && /^next/.test(direction)) {
				this._value(this.term);
				this.menu.blur();
				return;
			}
			this.menu[direction](event);
		},

		widget: function() {
			return this.menu.element;
		},

		_value: function() {
			return this.valueMethod.apply(this.element, arguments);
		},

		_keyEvent: function(keyEvent, event) {
			if (!this.isMultiLine || this.menu.element.is(":visible")) {
				this._move(keyEvent, event);

				// prevents moving cursor to beginning/end of the text field in some browsers
				event.preventDefault();
			}
		}
	});

	$.extend($.ui.autocomplete, {
		escapeRegex: function(value) {
			return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&");
		},
		filter: function(array, term) {
			var matcher = new RegExp($.ui.autocomplete.escapeRegex(term), "i");
			return $.grep(array, function(value) {
				return matcher.test(value.label || value.value || value);
			});
		}
	});


	// live region extension, adding a `messages` option
	// NOTE: This is an experimental API. We are still investigating
	// a full solution for string manipulation and internationalization.
	$.widget("ui.autocomplete", $.ui.autocomplete, {
		options: {
			messages: {
				noResults: "No search results.",
				results: function(amount) {
					return amount + (amount > 1 ? " results are" : " result is") +
						" available, use up and down arrow keys to navigate.";
				}
			}
		},

		__response: function(content) {
			var message;
			this._superApply(arguments);
			if (this.options.disabled || this.cancelSearch) {
				return;
			}
			if (content && content.length) {
				message = this.options.messages.results(content.length);
			} else {
				message = this.options.messages.noResults;
			}
			this.liveRegion.text(message);
		}
	});

}(jQuery));

(function($, undefined) {

	var lastActive, startXPos, startYPos, clickDragged,
		baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
		stateClasses = "ui-state-hover ui-state-active ",
		typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
		formResetHandler = function() {
			var form = $(this);
			setTimeout(function() {
				form.find(":ui-button").button("refresh");
			}, 1);
		},
		radioGroup = function(radio) {
			var name = radio.name,
				form = radio.form,
				radios = $([]);
			if (name) {
				name = name.replace(/'/g, "\\'");
				if (form) {
					radios = $(form).find("[name='" + name + "']");
				} else {
					radios = $("[name='" + name + "']", radio.ownerDocument)
						.filter(function() {
							return !this.form;
						});
				}
			}
			return radios;
		};

	$.widget("ui.button", {
		version: "1.10.3",
		defaultElement: "<button>",
		options: {
			disabled: null,
			text: true,
			label: null,
			icons: {
				primary: null,
				secondary: null
			}
		},
		_create: function() {
			this.element.closest("form")
				.unbind("reset" + this.eventNamespace)
				.bind("reset" + this.eventNamespace, formResetHandler);

			if (typeof this.options.disabled !== "boolean") {
				this.options.disabled = !! this.element.prop("disabled");
			} else {
				this.element.prop("disabled", this.options.disabled);
			}

			this._determineButtonType();
			this.hasTitle = !! this.buttonElement.attr("title");

			var that = this,
				options = this.options,
				toggleButton = this.type === "checkbox" || this.type === "radio",
				activeClass = !toggleButton ? "ui-state-active" : "",
				focusClass = "ui-state-focus";

			if (options.label === null) {
				options.label = (this.type === "input" ? this.buttonElement.val() : this.buttonElement.html());
			}

			this._hoverable(this.buttonElement);

			this.buttonElement
				.addClass(baseClasses)
				.attr("role", "button")
				.bind("mouseenter" + this.eventNamespace, function() {
					if (options.disabled) {
						return;
					}
					if (this === lastActive) {
						$(this).addClass("ui-state-active");
					}
				})
				.bind("mouseleave" + this.eventNamespace, function() {
					if (options.disabled) {
						return;
					}
					$(this).removeClass(activeClass);
				})
				.bind("click" + this.eventNamespace, function(event) {
					if (options.disabled) {
						event.preventDefault();
						event.stopImmediatePropagation();
					}
				});

			this.element
				.bind("focus" + this.eventNamespace, function() {
					// no need to check disabled, focus won't be triggered anyway
					that.buttonElement.addClass(focusClass);
				})
				.bind("blur" + this.eventNamespace, function() {
					that.buttonElement.removeClass(focusClass);
				});

			if (toggleButton) {
				this.element.bind("change" + this.eventNamespace, function() {
					if (clickDragged) {
						return;
					}
					that.refresh();
				});
				// if mouse moves between mousedown and mouseup (drag) set clickDragged flag
				// prevents issue where button state changes but checkbox/radio checked state
				// does not in Firefox (see ticket #6970)
				this.buttonElement
					.bind("mousedown" + this.eventNamespace, function(event) {
						if (options.disabled) {
							return;
						}
						clickDragged = false;
						startXPos = event.pageX;
						startYPos = event.pageY;
					})
					.bind("mouseup" + this.eventNamespace, function(event) {
						if (options.disabled) {
							return;
						}
						if (startXPos !== event.pageX || startYPos !== event.pageY) {
							clickDragged = true;
						}
					});
			}

			if (this.type === "checkbox") {
				this.buttonElement.bind("click" + this.eventNamespace, function() {
					if (options.disabled || clickDragged) {
						return false;
					}
				});
			} else if (this.type === "radio") {
				this.buttonElement.bind("click" + this.eventNamespace, function() {
					if (options.disabled || clickDragged) {
						return false;
					}
					$(this).addClass("ui-state-active");
					that.buttonElement.attr("aria-pressed", "true");

					var radio = that.element[0];
					radioGroup(radio)
						.not(radio)
						.map(function() {
							return $(this).button("widget")[0];
						})
						.removeClass("ui-state-active")
						.attr("aria-pressed", "false");
				});
			} else {
				this.buttonElement
					.bind("mousedown" + this.eventNamespace, function() {
						if (options.disabled) {
							return false;
						}
						$(this).addClass("ui-state-active");
						lastActive = this;
						that.document.one("mouseup", function() {
							lastActive = null;
						});
					})
					.bind("mouseup" + this.eventNamespace, function() {
						if (options.disabled) {
							return false;
						}
						$(this).removeClass("ui-state-active");
					})
					.bind("keydown" + this.eventNamespace, function(event) {
						if (options.disabled) {
							return false;
						}
						if (event.keyCode === $.ui.keyCode.SPACE || event.keyCode === $.ui.keyCode.ENTER) {
							$(this).addClass("ui-state-active");
						}
					})
				// see #8559, we bind to blur here in case the button element loses
				// focus between keydown and keyup, it would be left in an "active" state
				.bind("keyup" + this.eventNamespace + " blur" + this.eventNamespace, function() {
					$(this).removeClass("ui-state-active");
				});

				if (this.buttonElement.is("a")) {
					this.buttonElement.keyup(function(event) {
						if (event.keyCode === $.ui.keyCode.SPACE) {
							// TODO pass through original event correctly (just as 2nd argument doesn't work)
							$(this).click();
						}
					});
				}
			}

			// TODO: pull out $.Widget's handling for the disabled option into
			// $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
			// be overridden by individual plugins
			this._setOption("disabled", options.disabled);
			this._resetButton();
		},

		_determineButtonType: function() {
			var ancestor, labelSelector, checked;

			if (this.element.is("[type=checkbox]")) {
				this.type = "checkbox";
			} else if (this.element.is("[type=radio]")) {
				this.type = "radio";
			} else if (this.element.is("input")) {
				this.type = "input";
			} else {
				this.type = "button";
			}

			if (this.type === "checkbox" || this.type === "radio") {
				// we don't search against the document in case the element
				// is disconnected from the DOM
				ancestor = this.element.parents().last();
				labelSelector = "label[for='" + this.element.attr("id") + "']";
				this.buttonElement = ancestor.find(labelSelector);
				if (!this.buttonElement.length) {
					ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
					this.buttonElement = ancestor.filter(labelSelector);
					if (!this.buttonElement.length) {
						this.buttonElement = ancestor.find(labelSelector);
					}
				}
				this.element.addClass("ui-helper-hidden-accessible");

				checked = this.element.is(":checked");
				if (checked) {
					this.buttonElement.addClass("ui-state-active");
				}
				this.buttonElement.prop("aria-pressed", checked);
			} else {
				this.buttonElement = this.element;
			}
		},

		widget: function() {
			return this.buttonElement;
		},

		_destroy: function() {
			this.element
				.removeClass("ui-helper-hidden-accessible");
			this.buttonElement
				.removeClass(baseClasses + " " + stateClasses + " " + typeClasses)
				.removeAttr("role")
				.removeAttr("aria-pressed")
				.html(this.buttonElement.find(".ui-button-text").html());

			if (!this.hasTitle) {
				this.buttonElement.removeAttr("title");
			}
		},

		_setOption: function(key, value) {
			this._super(key, value);
			if (key === "disabled") {
				if (value) {
					this.element.prop("disabled", true);
				} else {
					this.element.prop("disabled", false);
				}
				return;
			}
			this._resetButton();
		},

		refresh: function() {
			//See #8237 & #8828
			var isDisabled = this.element.is("input, button") ? this.element.is(":disabled") : this.element.hasClass("ui-button-disabled");

			if (isDisabled !== this.options.disabled) {
				this._setOption("disabled", isDisabled);
			}
			if (this.type === "radio") {
				radioGroup(this.element[0]).each(function() {
					if ($(this).is(":checked")) {
						$(this).button("widget")
							.addClass("ui-state-active")
							.attr("aria-pressed", "true");
					} else {
						$(this).button("widget")
							.removeClass("ui-state-active")
							.attr("aria-pressed", "false");
					}
				});
			} else if (this.type === "checkbox") {
				if (this.element.is(":checked")) {
					this.buttonElement
						.addClass("ui-state-active")
						.attr("aria-pressed", "true");
				} else {
					this.buttonElement
						.removeClass("ui-state-active")
						.attr("aria-pressed", "false");
				}
			}
		},

		_resetButton: function() {
			if (this.type === "input") {
				if (this.options.label) {
					this.element.val(this.options.label);
				}
				return;
			}
			var buttonElement = this.buttonElement.removeClass(typeClasses),
				buttonText = $("<span></span>", this.document[0])
					.addClass("ui-button-text")
					.html(this.options.label)
					.appendTo(buttonElement.empty())
					.text(),
				icons = this.options.icons,
				multipleIcons = icons.primary && icons.secondary,
				buttonClasses = [];

			if (icons.primary || icons.secondary) {
				if (this.options.text) {
					buttonClasses.push("ui-button-text-icon" + (multipleIcons ? "s" : (icons.primary ? "-primary" : "-secondary")));
				}

				if (icons.primary) {
					buttonElement.prepend("<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>");
				}

				if (icons.secondary) {
					buttonElement.append("<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>");
				}

				if (!this.options.text) {
					buttonClasses.push(multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only");

					if (!this.hasTitle) {
						buttonElement.attr("title", $.trim(buttonText));
					}
				}
			} else {
				buttonClasses.push("ui-button-text-only");
			}
			buttonElement.addClass(buttonClasses.join(" "));
		}
	});

	$.widget("ui.buttonset", {
		version: "1.10.3",
		options: {
			items: "button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(ui-button)"
		},

		_create: function() {
			this.element.addClass("ui-buttonset");
		},

		_init: function() {
			this.refresh();
		},

		_setOption: function(key, value) {
			if (key === "disabled") {
				this.buttons.button("option", key, value);
			}

			this._super(key, value);
		},

		refresh: function() {
			var rtl = this.element.css("direction") === "rtl";

			this.buttons = this.element.find(this.options.items)
				.filter(":ui-button")
				.button("refresh")
				.end()
				.not(":ui-button")
				.button()
				.end()
				.map(function() {
					return $(this).button("widget")[0];
				})
				.removeClass("ui-corner-all ui-corner-left ui-corner-right")
				.filter(":first")
				.addClass(rtl ? "ui-corner-right" : "ui-corner-left")
				.end()
				.filter(":last")
				.addClass(rtl ? "ui-corner-left" : "ui-corner-right")
				.end()
				.end();
		},

		_destroy: function() {
			this.element.removeClass("ui-buttonset");
			this.buttons
				.map(function() {
					return $(this).button("widget")[0];
				})
				.removeClass("ui-corner-left ui-corner-right")
				.end()
				.button("destroy");
		}
	});

}(jQuery));

(function($, undefined) {

	$.extend($.ui, {
		datepicker: {
			version: "1.10.3"
		}
	});

	var PROP_NAME = "datepicker",
		instActive;

	/* Date picker manager.
   Use the singleton instance of this class, $.datepicker, to interact with the date picker.
   Settings for (groups of) date pickers are maintained in an instance object,
   allowing multiple different settings on the same page. */

	function Datepicker() {
		this._curInst = null; // The current instance in use
		this._keyEvent = false; // If the last event was a key event
		this._disabledInputs = []; // List of date picker inputs that have been disabled
		this._datepickerShowing = false; // True if the popup picker is showing , false if not
		this._inDialog = false; // True if showing within a "dialog", false if not
		this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
		this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
		this._appendClass = "ui-datepicker-append"; // The name of the append marker class
		this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
		this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
		this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
		this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
		this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
		this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
		this.regional = []; // Available regional settings, indexed by language code
		this.regional[""] = { // Default regional settings
			closeText: "Done", // Display text for close link
			prevText: "Prev", // Display text for previous month link
			nextText: "Next", // Display text for next month link
			currentText: "Today", // Display text for current month link
    		monthNames: ['Januar', 'Februar', 'M&auml;rz', 'April', 'May', 'Juni', 'Juli', 'August', 'September', 'Oktober', 'November', 'Dezember'],
            monthNamesShort: ['Jan', 'Feb', 'M&auml;r', 'Apr', 'May', 'Jun',  'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
            dayNames: ['Sonntag', 'Montag', 'Dienstag', 'Mittwoch', 'Donnerstag', 'Freitag', 'Samstag'],
            dayNamesShort: ['So', 'Mo', 'Di', 'Mi', 'Do', 'Fr', 'Sa'],
            dayNamesMin: ['So', 'Mo', 'Di', 'Mi', 'Do', 'Fr', 'Sa'],
            weekHeader: "Wk", // Column header for week of the year
			dateFormat: "yy-mm-dd", // See format options on parseDate
			firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
			isRTL: false, // True if right-to-left language, false if left-to-right
			showMonthAfterYear: false, // True if the year select precedes month, false for month then year
			yearSuffix: "" // Additional text to append to the year in the month headers
		};
		this._defaults = { // Global defaults for all the date picker instances
			showOn: "focus", // "focus" for popup on focus,
			// "button" for trigger button, or "both" for either
			showAnim: "fadeIn", // Name of jQuery animation for popup
			showOptions: {}, // Options for enhanced animations
			defaultDate: null, // Used when field is blank: actual date,
			// +/-number for offset from today, null for today
			appendText: "", // Display text following the input box, e.g. showing the format
			buttonText: "...", // Text for trigger button
			buttonImage: "", // URL for trigger button image
			buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
			hideIfNoPrevNext: false, // True to hide next/previous month links
			// if not applicable, false to just disable them
			navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
			gotoCurrent: false, // True if today link goes back to current selection instead
			changeMonth: false, // True if month can be selected directly, false if only prev/next
			changeYear: false, // True if year can be selected directly, false if only prev/next
			yearRange: "c-10:c+10", // Range of years to display in drop-down,
			// either relative to today's year (-nn:+nn), relative to currently displayed year
			// (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
			showOtherMonths: false, // True to show dates in other months, false to leave blank
			selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
			showWeek: false, // True to show week of the year, false to not show it
			calculateWeek: this.iso8601Week, // How to calculate the week of the year,
			// takes a Date and returns the number of the week for it
			shortYearCutoff: "+10", // Short year values < this are in the current century,
			// > this are in the previous century,
			// string value starting with "+" for current year + value
			minDate: null, // The earliest selectable date, or null for no limit
			maxDate: null, // The latest selectable date, or null for no limit
			duration: "fast", // Duration of display/closure
			beforeShowDay: null, // Function that takes a date and returns an array with
			// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
			// [2] = cell title (optional), e.g. $.datepicker.noWeekends
			beforeShow: null, // Function that takes an input field and
			// returns a set of custom settings for the date picker
			onSelect: null, // Define a callback function when a date is selected
			onChangeMonthYear: null, // Define a callback function when the month or year is changed
			onClose: null, // Define a callback function when the datepicker is closed
			numberOfMonths: 1, // Number of months to show at a time
			showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
			stepMonths: 1, // Number of months to step back/forward
			stepBigMonths: 12, // Number of months to step back/forward for the big links
			altField: "", // Selector for an alternate field to store selected dates into
			altFormat: "", // The date format to use for the alternate field
			constrainInput: true, // The input is constrained by the current date format
			showButtonPanel: false, // True to show button panel, false to not show it
			autoSize: false, // True to size the input for the date format, false to leave as is
			disabled: false // The initial disabled state
		};
		$.extend(this._defaults, this.regional[""]);
		this.dpDiv = bindHover($("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"));
	}

	$.extend(Datepicker.prototype, {
		/* Class name added to elements to indicate already configured with a date picker. */
		markerClassName: "hasDatepicker",

		//Keep track of the maximum number of rows displayed (see #7043)
		maxRows: 4,

		// TODO rename to "widget" when switching to widget factory
		_widgetDatepicker: function() {
			return this.dpDiv;
		},

		/* Override the default settings for all instances of the date picker.
		 * @param  settings  object - the new settings to use as defaults (anonymous object)
		 * @return the manager object
		 */
		setDefaults: function(settings) {
			extendRemove(this._defaults, settings || {});
			return this;
		},

		/* Attach the date picker to a jQuery selection.
		 * @param  target   element - the target input field or division or span
		 * @param  settings  object - the new settings to use for this date picker instance (anonymous)
		 */
		_attachDatepicker: function(target, settings) {
			var nodeName, inline, inst;
			nodeName = target.nodeName.toLowerCase();
			inline = (nodeName === "div" || nodeName === "span");
			if (!target.id) {
				this.uuid += 1;
				target.id = "dp" + this.uuid;
			}
			inst = this._newInst($(target), inline);
			inst.settings = $.extend({}, settings || {});
			if (nodeName === "input") {
				this._connectDatepicker(target, inst);
			} else if (inline) {
				this._inlineDatepicker(target, inst);
			}
		},

		/* Create a new instance object. */
		_newInst: function(target, inline) {
			var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1"); // escape jQuery meta chars
			return {
				id: id,
				input: target, // associated target
				selectedDay: 0,
				selectedMonth: 0,
				selectedYear: 0, // current selection
				drawMonth: 0,
				drawYear: 0, // month being drawn
				inline: inline, // is datepicker inline or not
				dpDiv: (!inline ? this.dpDiv : // presentation div
					bindHover($("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")))
			};
		},

		/* Attach the date picker to an input field. */
		_connectDatepicker: function(target, inst) {
			var input = $(target);
			inst.append = $([]);
			inst.trigger = $([]);
			if (input.hasClass(this.markerClassName)) {
				return;
			}
			this._attachments(input, inst);
			input.addClass(this.markerClassName).keydown(this._doKeyDown).
			keypress(this._doKeyPress).keyup(this._doKeyUp);
			this._autoSize(inst);
			$.data(target, PROP_NAME, inst);
			//If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
			if (inst.settings.disabled) {
				this._disableDatepicker(target);
			}
		},

		/* Make attachments based on settings. */
		_attachments: function(input, inst) {
			var showOn, buttonText, buttonImage,
				appendText = this._get(inst, "appendText"),
				isRTL = this._get(inst, "isRTL");

			if (inst.append) {
				inst.append.remove();
			}
			if (appendText) {
				inst.append = $("<span class='" + this._appendClass + "'>" + appendText + "</span>");
				input[isRTL ? "before" : "after"](inst.append);
			}

			input.unbind("focus", this._showDatepicker);

			if (inst.trigger) {
				inst.trigger.remove();
			}

			showOn = this._get(inst, "showOn");
			if (showOn === "focus" || showOn === "both") { // pop-up date picker when in the marked field
				input.focus(this._showDatepicker);
			}
			if (showOn === "button" || showOn === "both") { // pop-up date picker when button clicked
				buttonText = this._get(inst, "buttonText");
				buttonImage = this._get(inst, "buttonImage");
				inst.trigger = $(this._get(inst, "buttonImageOnly") ?
					$("<img/>").addClass(this._triggerClass).attr({
						src: buttonImage,
						alt: buttonText,
						title: buttonText
					}) :
					$("<button type='button'></button>").addClass(this._triggerClass).html(!buttonImage ? buttonText : $("<img/>").attr({
						src: buttonImage,
						alt: buttonText,
						title: buttonText
					})));
				input[isRTL ? "before" : "after"](inst.trigger);
				inst.trigger.click(function() {
					if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) {
						$.datepicker._hideDatepicker();
					} else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) {
						$.datepicker._hideDatepicker();
						$.datepicker._showDatepicker(input[0]);
					} else {
						$.datepicker._showDatepicker(input[0]);
					}
					return false;
				});
			}
		},

		/* Apply the maximum length for the date format. */
		_autoSize: function(inst) {
			if (this._get(inst, "autoSize") && !inst.inline) {
				var findMax, max, maxI, i,
					date = new Date(2009, 12 - 1, 20), // Ensure double digits
					dateFormat = this._get(inst, "dateFormat");

				if (dateFormat.match(/[DM]/)) {
					findMax = function(names) {
						max = 0;
						maxI = 0;
						for (i = 0; i < names.length; i++) {
							if (names[i].length > max) {
								max = names[i].length;
								maxI = i;
							}
						}
						return maxI;
					};
					date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
						"monthNames" : "monthNamesShort"))));
					date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
						"dayNames" : "dayNamesShort"))) + 20 - date.getDay());
				}
				inst.input.attr("size", this._formatDate(inst, date).length);
			}
		},

		/* Attach an inline date picker to a div. */
		_inlineDatepicker: function(target, inst) {
			var divSpan = $(target);
			if (divSpan.hasClass(this.markerClassName)) {
				return;
			}
			divSpan.addClass(this.markerClassName).append(inst.dpDiv);
			$.data(target, PROP_NAME, inst);
			this._setDate(inst, this._getDefaultDate(inst), true);
			this._updateDatepicker(inst);
			this._updateAlternate(inst);
			//If disabled option is true, disable the datepicker before showing it (see ticket #5665)
			if (inst.settings.disabled) {
				this._disableDatepicker(target);
			}
			// Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
			// http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
			inst.dpDiv.css("display", "block");
		},

		/* Pop-up the date picker in a "dialog" box.
		 * @param  input element - ignored
		 * @param  date string or Date - the initial date to display
		 * @param  onSelect  function - the function to call when a date is selected
		 * @param  settings  object - update the dialog date picker instance's settings (anonymous object)
		 * @param  pos int[2] - coordinates for the dialog's position within the screen or
		 *                  event - with x/y coordinates or
		 *                  leave empty for default (screen centre)
		 * @return the manager object
		 */
		_dialogDatepicker: function(input, date, onSelect, settings, pos) {
			var id, browserWidth, browserHeight, scrollX, scrollY,
				inst = this._dialogInst; // internal instance

			if (!inst) {
				this.uuid += 1;
				id = "dp" + this.uuid;
				this._dialogInput = $("<input type='text' id='" + id +
					"' style='position: absolute; top: -100px; width: 0px;'/>");
				this._dialogInput.keydown(this._doKeyDown);
				$("body").append(this._dialogInput);
				inst = this._dialogInst = this._newInst(this._dialogInput, false);
				inst.settings = {};
				$.data(this._dialogInput[0], PROP_NAME, inst);
			}
			extendRemove(inst.settings, settings || {});
			date = (date && date.constructor === Date ? this._formatDate(inst, date) : date);
			this._dialogInput.val(date);

			this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
			if (!this._pos) {
				browserWidth = document.documentElement.clientWidth;
				browserHeight = document.documentElement.clientHeight;
				scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
				scrollY = document.documentElement.scrollTop || document.body.scrollTop;
				this._pos = // should use actual width/height below
				[(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
			}

			// move input on screen for focus, but hidden behind dialog
			this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px");
			inst.settings.onSelect = onSelect;
			this._inDialog = true;
			this.dpDiv.addClass(this._dialogClass);
			this._showDatepicker(this._dialogInput[0]);
			if ($.blockUI) {
				$.blockUI(this.dpDiv);
			}
			$.data(this._dialogInput[0], PROP_NAME, inst);
			return this;
		},

		/* Detach a datepicker from its control.
		 * @param  target   element - the target input field or division or span
		 */
		_destroyDatepicker: function(target) {
			var nodeName,
				$target = $(target),
				inst = $.data(target, PROP_NAME);

			if (!$target.hasClass(this.markerClassName)) {
				return;
			}

			nodeName = target.nodeName.toLowerCase();
			$.removeData(target, PROP_NAME);
			if (nodeName === "input") {
				inst.append.remove();
				inst.trigger.remove();
				$target.removeClass(this.markerClassName).
				unbind("focus", this._showDatepicker).
				unbind("keydown", this._doKeyDown).
				unbind("keypress", this._doKeyPress).
				unbind("keyup", this._doKeyUp);
			} else if (nodeName === "div" || nodeName === "span") {
				$target.removeClass(this.markerClassName).empty();
			}
		},

		/* Enable the date picker to a jQuery selection.
		 * @param  target   element - the target input field or division or span
		 */
		_enableDatepicker: function(target) {
			var nodeName, inline,
				$target = $(target),
				inst = $.data(target, PROP_NAME);

			if (!$target.hasClass(this.markerClassName)) {
				return;
			}

			nodeName = target.nodeName.toLowerCase();
			if (nodeName === "input") {
				target.disabled = false;
				inst.trigger.filter("button").
				each(function() {
					this.disabled = false;
				}).end().
				filter("img").css({
					opacity: "1.0",
					cursor: ""
				});
			} else if (nodeName === "div" || nodeName === "span") {
				inline = $target.children("." + this._inlineClass);
				inline.children().removeClass("ui-state-disabled");
				inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
				prop("disabled", false);
			}
			this._disabledInputs = $.map(this._disabledInputs,
				function(value) {
					return (value === target ? null : value);
				}); // delete entry
		},

		/* Disable the date picker to a jQuery selection.
		 * @param  target   element - the target input field or division or span
		 */
		_disableDatepicker: function(target) {
			var nodeName, inline,
				$target = $(target),
				inst = $.data(target, PROP_NAME);

			if (!$target.hasClass(this.markerClassName)) {
				return;
			}

			nodeName = target.nodeName.toLowerCase();
			if (nodeName === "input") {
				target.disabled = true;
				inst.trigger.filter("button").
				each(function() {
					this.disabled = true;
				}).end().
				filter("img").css({
					opacity: "0.5",
					cursor: "default"
				});
			} else if (nodeName === "div" || nodeName === "span") {
				inline = $target.children("." + this._inlineClass);
				inline.children().addClass("ui-state-disabled");
				inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
				prop("disabled", true);
			}
			this._disabledInputs = $.map(this._disabledInputs,
				function(value) {
					return (value === target ? null : value);
				}); // delete entry
			this._disabledInputs[this._disabledInputs.length] = target;
		},

		/* Is the first field in a jQuery collection disabled as a datepicker?
		 * @param  target   element - the target input field or division or span
		 * @return boolean - true if disabled, false if enabled
		 */
		_isDisabledDatepicker: function(target) {
			if (!target) {
				return false;
			}
			for (var i = 0; i < this._disabledInputs.length; i++) {
				if (this._disabledInputs[i] === target) {
					return true;
				}
			}
			return false;
		},

		/* Retrieve the instance data for the target control.
		 * @param  target  element - the target input field or division or span
		 * @return  object - the associated instance data
		 * @throws  error if a jQuery problem getting data
		 */
		_getInst: function(target) {
			try {
				return $.data(target, PROP_NAME);
			} catch (err) {
				throw "Missing instance data for this datepicker";
			}
		},

		/* Update or retrieve the settings for a date picker attached to an input field or division.
		 * @param  target  element - the target input field or division or span
		 * @param  name object - the new settings to update or
		 *              string - the name of the setting to change or retrieve,
		 *              when retrieving also "all" for all instance settings or
		 *              "defaults" for all global defaults
		 * @param  value   any - the new value for the setting
		 *              (omit if above is an object or to retrieve a value)
		 */
		_optionDatepicker: function(target, name, value) {
			var settings, date, minDate, maxDate,
				inst = this._getInst(target);

			if (arguments.length === 2 && typeof name === "string") {
				return (name === "defaults" ? $.extend({}, $.datepicker._defaults) :
					(inst ? (name === "all" ? $.extend({}, inst.settings) :
						this._get(inst, name)) : null));
			}

			settings = name || {};
			if (typeof name === "string") {
				settings = {};
				settings[name] = value;
			}

			if (inst) {
				if (this._curInst === inst) {
					this._hideDatepicker();
				}

				date = this._getDateDatepicker(target, true);
				minDate = this._getMinMaxDate(inst, "min");
				maxDate = this._getMinMaxDate(inst, "max");
				extendRemove(inst.settings, settings);
				// reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
				if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) {
					inst.settings.minDate = this._formatDate(inst, minDate);
				}
				if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) {
					inst.settings.maxDate = this._formatDate(inst, maxDate);
				}
				if ("disabled" in settings) {
					if (settings.disabled) {
						this._disableDatepicker(target);
					} else {
						this._enableDatepicker(target);
					}
				}
				this._attachments($(target), inst);
				this._autoSize(inst);
				this._setDate(inst, date);
				this._updateAlternate(inst);
				this._updateDatepicker(inst);
			}
		},

		// change method deprecated
		_changeDatepicker: function(target, name, value) {
			this._optionDatepicker(target, name, value);
		},

		/* Redraw the date picker attached to an input field or division.
		 * @param  target  element - the target input field or division or span
		 */
		_refreshDatepicker: function(target) {
			var inst = this._getInst(target);
			if (inst) {
				this._updateDatepicker(inst);
			}
		},

		/* Set the dates for a jQuery selection.
		 * @param  target element - the target input field or division or span
		 * @param  date Date - the new date
		 */
		_setDateDatepicker: function(target, date) {
			var inst = this._getInst(target);
			if (inst) {
				this._setDate(inst, date);
				this._updateDatepicker(inst);
				this._updateAlternate(inst);
			}
		},

		/* Get the date(s) for the first entry in a jQuery selection.
		 * @param  target element - the target input field or division or span
		 * @param  noDefault boolean - true if no default date is to be used
		 * @return Date - the current date
		 */
		_getDateDatepicker: function(target, noDefault) {
			var inst = this._getInst(target);
			if (inst && !inst.inline) {
				this._setDateFromField(inst, noDefault);
			}
			return (inst ? this._getDate(inst) : null);
		},

		/* Handle keystrokes. */
		_doKeyDown: function(event) {
			var onSelect, dateStr, sel,
				inst = $.datepicker._getInst(event.target),
				handled = true,
				isRTL = inst.dpDiv.is(".ui-datepicker-rtl");

			inst._keyEvent = true;
			if ($.datepicker._datepickerShowing) {
				switch (event.keyCode) {
					case 9:
						$.datepicker._hideDatepicker();
						handled = false;
						break; // hide on tab out
					case 13:
						sel = $("td." + $.datepicker._dayOverClass + ":not(." +
							$.datepicker._currentClass + ")", inst.dpDiv);
						if (sel[0]) {
							$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
						}

						onSelect = $.datepicker._get(inst, "onSelect");
						if (onSelect) {
							dateStr = $.datepicker._formatDate(inst);

							// trigger custom callback
							onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
						} else {
							$.datepicker._hideDatepicker();
						}

						return false; // don't submit the form
					case 27:
						$.datepicker._hideDatepicker();
						break; // hide on escape
					case 33:
						$.datepicker._adjustDate(event.target, (event.ctrlKey ? -$.datepicker._get(inst, "stepBigMonths") : -$.datepicker._get(inst, "stepMonths")), "M");
						break; // previous month/year on page up/+ ctrl
					case 34:
						$.datepicker._adjustDate(event.target, (event.ctrlKey ? +$.datepicker._get(inst, "stepBigMonths") : +$.datepicker._get(inst, "stepMonths")), "M");
						break; // next month/year on page down/+ ctrl
					case 35:
						if (event.ctrlKey || event.metaKey) {
							$.datepicker._clearDate(event.target);
						}
						handled = event.ctrlKey || event.metaKey;
						break; // clear on ctrl or command +end
					case 36:
						if (event.ctrlKey || event.metaKey) {
							$.datepicker._gotoToday(event.target);
						}
						handled = event.ctrlKey || event.metaKey;
						break; // current on ctrl or command +home
					case 37:
						if (event.ctrlKey || event.metaKey) {
							$.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D");
						}
						handled = event.ctrlKey || event.metaKey;
						// -1 day on ctrl or command +left
						if (event.originalEvent.altKey) {
							$.datepicker._adjustDate(event.target, (event.ctrlKey ? -$.datepicker._get(inst, "stepBigMonths") : -$.datepicker._get(inst, "stepMonths")), "M");
						}
						// next month/year on alt +left on Mac
						break;
					case 38:
						if (event.ctrlKey || event.metaKey) {
							$.datepicker._adjustDate(event.target, -7, "D");
						}
						handled = event.ctrlKey || event.metaKey;
						break; // -1 week on ctrl or command +up
					case 39:
						if (event.ctrlKey || event.metaKey) {
							$.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D");
						}
						handled = event.ctrlKey || event.metaKey;
						// +1 day on ctrl or command +right
						if (event.originalEvent.altKey) {
							$.datepicker._adjustDate(event.target, (event.ctrlKey ? +$.datepicker._get(inst, "stepBigMonths") : +$.datepicker._get(inst, "stepMonths")), "M");
						}
						// next month/year on alt +right
						break;
					case 40:
						if (event.ctrlKey || event.metaKey) {
							$.datepicker._adjustDate(event.target, +7, "D");
						}
						handled = event.ctrlKey || event.metaKey;
						break; // +1 week on ctrl or command +down
					default:
						handled = false;
				}
			} else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home
				$.datepicker._showDatepicker(this);
			} else {
				handled = false;
			}

			if (handled) {
				event.preventDefault();
				event.stopPropagation();
			}
		},

		/* Filter entered characters - based on date format. */
		_doKeyPress: function(event) {
			var chars, chr,
				inst = $.datepicker._getInst(event.target);

			if ($.datepicker._get(inst, "constrainInput")) {
				chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat"));
				chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode);
				return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1);
			}
		},

		/* Synchronise manual entry and field/alternate field. */
		_doKeyUp: function(event) {
			var date,
				inst = $.datepicker._getInst(event.target);

			if (inst.input.val() !== inst.lastVal) {
				try {
					date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), (inst.input ? inst.input.val() : null),
						$.datepicker._getFormatConfig(inst));

					if (date) { // only if valid
						$.datepicker._setDateFromField(inst);
						$.datepicker._updateAlternate(inst);
						$.datepicker._updateDatepicker(inst);
					}
				} catch (err) {}
			}
			return true;
		},

		/* Pop-up the date picker for a given input field.
		 * If false returned from beforeShow event handler do not show.
		 * @param  input  element - the input field attached to the date picker or
		 *                  event - if triggered by focus
		 */
		_showDatepicker: function(input) {
			input = input.target || input;
			if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger
				input = $("input", input.parentNode)[0];
			}

			if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here
				return;
			}

			var inst, beforeShow, beforeShowSettings, isFixed,
				offset, showAnim, duration;

			inst = $.datepicker._getInst(input);
			if ($.datepicker._curInst && $.datepicker._curInst !== inst) {
				$.datepicker._curInst.dpDiv.stop(true, true);
				if (inst && $.datepicker._datepickerShowing) {
					$.datepicker._hideDatepicker($.datepicker._curInst.input[0]);
				}
			}

			beforeShow = $.datepicker._get(inst, "beforeShow");
			beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
			if (beforeShowSettings === false) {
				return;
			}
			extendRemove(inst.settings, beforeShowSettings);

			inst.lastVal = null;
			$.datepicker._lastInput = input;
			$.datepicker._setDateFromField(inst);

			if ($.datepicker._inDialog) { // hide cursor
				input.value = "";
			}
			if (!$.datepicker._pos) { // position below input
				$.datepicker._pos = $.datepicker._findPos(input);
				$.datepicker._pos[1] += input.offsetHeight; // add the height
			}

			isFixed = false;
			$(input).parents().each(function() {
				isFixed |= $(this).css("position") === "fixed";
				return !isFixed;
			});

			offset = {
				left: $.datepicker._pos[0],
				top: $.datepicker._pos[1]
			};
			$.datepicker._pos = null;
			//to avoid flashes on Firefox
			inst.dpDiv.empty();
			// determine sizing offscreen
			inst.dpDiv.css({
				position: "absolute",
				display: "block",
				top: "-1000px"
			});
			$.datepicker._updateDatepicker(inst);
			// fix width for dynamic number of date pickers
			// and adjust position before showing
			offset = $.datepicker._checkOffset(inst, offset, isFixed);
			inst.dpDiv.css({
				position: ($.datepicker._inDialog && $.blockUI ?
					"static" : (isFixed ? "fixed" : "absolute")),
				display: "none",
				left: offset.left + "px",
				top: offset.top + "px"
			});

			if (!inst.inline) {
				showAnim = $.datepicker._get(inst, "showAnim");
				duration = $.datepicker._get(inst, "duration");
				inst.dpDiv.zIndex($(input).zIndex() + 1);
				$.datepicker._datepickerShowing = true;

				if ($.effects && $.effects.effect[showAnim]) {
					inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration);
				} else {
					inst.dpDiv[showAnim || "show"](showAnim ? duration : null);
				}

				if ($.datepicker._shouldFocusInput(inst)) {
					inst.input.focus();
				}

				$.datepicker._curInst = inst;
			}
		},

		/* Generate the date picker content. */
		_updateDatepicker: function(inst) {
			this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
			instActive = inst; // for delegate hover events
			inst.dpDiv.empty().append(this._generateHTML(inst));
			this._attachHandlers(inst);
			inst.dpDiv.find("." + this._dayOverClass + " a").mouseover();

			var origyearshtml,
				numMonths = this._getNumberOfMonths(inst),
				cols = numMonths[1],
				width = 17;

			inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");
			if (cols > 1) {
				inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em");
			}
			inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") +
				"Class"]("ui-datepicker-multi");
			inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") +
				"Class"]("ui-datepicker-rtl");

			if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput(inst)) {
				inst.input.focus();
			}

			// deffered render of the years select (to avoid flashes on Firefox)
			if (inst.yearshtml) {
				origyearshtml = inst.yearshtml;
				setTimeout(function() {
					//assure that inst.yearshtml didn't change.
					if (origyearshtml === inst.yearshtml && inst.yearshtml) {
						inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml);
					}
					origyearshtml = inst.yearshtml = null;
				}, 0);
			}
		},

		// #6694 - don't focus the input if it's already focused
		// this breaks the change event in IE
		// Support: IE and jQuery <1.9
		_shouldFocusInput: function(inst) {
			return inst.input && inst.input.is(":visible") && !inst.input.is(":disabled") && !inst.input.is(":focus");
		},

		/* Check positioning to remain on screen. */
		_checkOffset: function(inst, offset, isFixed) {
			var dpWidth = inst.dpDiv.outerWidth(),
				dpHeight = inst.dpDiv.outerHeight(),
				inputWidth = inst.input ? inst.input.outerWidth() : 0,
				inputHeight = inst.input ? inst.input.outerHeight() : 0,
				viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()),
				viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop());

			offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0);
			offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0;
			offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;

			// now check if datepicker is showing outside window viewport - move to a better place if so.
			offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
				Math.abs(offset.left + dpWidth - viewWidth) : 0);
			offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
				Math.abs(dpHeight + inputHeight) : 0);

			return offset;
		},

		/* Find an object's position on the screen. */
		_findPos: function(obj) {
			var position,
				inst = this._getInst(obj),
				isRTL = this._get(inst, "isRTL");

			while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) {
				obj = obj[isRTL ? "previousSibling" : "nextSibling"];
			}

			position = $(obj).offset();
			return [position.left, position.top];
		},

		/* Hide the date picker from view.
		 * @param  input  element - the input field attached to the date picker
		 */
		_hideDatepicker: function(input) {
			var showAnim, duration, postProcess, onClose,
				inst = this._curInst;

			if (!inst || (input && inst !== $.data(input, PROP_NAME))) {
				return;
			}

			if (this._datepickerShowing) {
				showAnim = this._get(inst, "showAnim");
				duration = this._get(inst, "duration");
				postProcess = function() {
					$.datepicker._tidyDialog(inst);
				};

				// DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
				if ($.effects && ($.effects.effect[showAnim] || $.effects[showAnim])) {
					inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess);
				} else {
					inst.dpDiv[(showAnim === "slideDown" ? "slideUp" :
						(showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess);
				}

				if (!showAnim) {
					postProcess();
				}
				this._datepickerShowing = false;

				onClose = this._get(inst, "onClose");
				if (onClose) {
					onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]);
				}

				this._lastInput = null;
				if (this._inDialog) {
					this._dialogInput.css({
						position: "absolute",
						left: "0",
						top: "-100px"
					});
					if ($.blockUI) {
						$.unblockUI();
						$("body").append(this.dpDiv);
					}
				}
				this._inDialog = false;
			}
		},

		/* Tidy up after a dialog display. */
		_tidyDialog: function(inst) {
			inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar");
		},

		/* Close date picker if clicked elsewhere. */
		_checkExternalClick: function(event) {
			if (!$.datepicker._curInst) {
				return;
			}

			var $target = $(event.target),
				inst = $.datepicker._getInst($target[0]);

			if ((($target[0].id !== $.datepicker._mainDivId &&
					$target.parents("#" + $.datepicker._mainDivId).length === 0 && !$target.hasClass($.datepicker.markerClassName) && !$target.closest("." + $.datepicker._triggerClass).length &&
					$.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))) ||
				($target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst)) {
				$.datepicker._hideDatepicker();
			}
		},

		/* Adjust one of the date sub-fields. */
		_adjustDate: function(id, offset, period) {
			var target = $(id),
				inst = this._getInst(target[0]);

			if (this._isDisabledDatepicker(target[0])) {
				return;
			}
			this._adjustInstDate(inst, offset +
				(period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning
				period);
			this._updateDatepicker(inst);
		},

		/* Action for current link. */
		_gotoToday: function(id) {
			var date,
				target = $(id),
				inst = this._getInst(target[0]);

			if (this._get(inst, "gotoCurrent") && inst.currentDay) {
				inst.selectedDay = inst.currentDay;
				inst.drawMonth = inst.selectedMonth = inst.currentMonth;
				inst.drawYear = inst.selectedYear = inst.currentYear;
			} else {
				date = new Date();
				inst.selectedDay = date.getDate();
				inst.drawMonth = inst.selectedMonth = date.getMonth();
				inst.drawYear = inst.selectedYear = date.getFullYear();
			}
			this._notifyChange(inst);
			this._adjustDate(target);
		},

		/* Action for selecting a new month/year. */
		_selectMonthYear: function(id, select, period) {
			var target = $(id),
				inst = this._getInst(target[0]);

			inst["selected" + (period === "M" ? "Month" : "Year")] =
				inst["draw" + (period === "M" ? "Month" : "Year")] =
				parseInt(select.options[select.selectedIndex].value, 10);

			this._notifyChange(inst);
			this._adjustDate(target);
		},

		/* Action for selecting a day. */
		_selectDay: function(id, month, year, td) {
			var inst,
				target = $(id);

			if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
				return;
			}

			inst = this._getInst(target[0]);
			inst.selectedDay = inst.currentDay = $("a", td).html();
			inst.selectedMonth = inst.currentMonth = month;
			inst.selectedYear = inst.currentYear = year;
			this._selectDate(id, this._formatDate(inst,
				inst.currentDay, inst.currentMonth, inst.currentYear));
		},

		/* Erase the input field and hide the date picker. */
		_clearDate: function(id) {
			var target = $(id);
			this._selectDate(target, "");
		},

		/* Update the input field with the selected date. */
		_selectDate: function(id, dateStr) {
			var onSelect,
				target = $(id),
				inst = this._getInst(target[0]);

			dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
			if (inst.input) {
				inst.input.val(dateStr);
			}
			this._updateAlternate(inst);

			onSelect = this._get(inst, "onSelect");
			if (onSelect) {
				onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
			} else if (inst.input) {
				inst.input.trigger("change"); // fire the change event
			}

			if (inst.inline) {
				this._updateDatepicker(inst);
			} else {
				this._hideDatepicker();
				this._lastInput = inst.input[0];
				if (typeof(inst.input[0]) !== "object") {
					inst.input.focus(); // restore focus
				}
				this._lastInput = null;
			}
		},

		/* Update any alternate field to synchronise with the main field. */
		_updateAlternate: function(inst) {
			var altFormat, date, dateStr,
				altField = this._get(inst, "altField");

			if (altField) { // update alternate field too
				altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat");
				date = this._getDate(inst);
				dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
				$(altField).each(function() {
					$(this).val(dateStr);
				});
			}
		},

		/* Set as beforeShowDay function to prevent selection of weekends.
		 * @param  date  Date - the date to customise
		 * @return [boolean, string] - is this date selectable?, what is its CSS class?
		 */
		noWeekends: function(date) {
			var day = date.getDay();
			return [(day > 0 && day < 6), ""];
		},

		/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
		 * @param  date  Date - the date to get the week for
		 * @return  number - the number of the week within the year that contains this date
		 */
		iso8601Week: function(date) {
			var time,
				checkDate = new Date(date.getTime());

			// Find Thursday of this week starting on Monday
			checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));

			time = checkDate.getTime();
			checkDate.setMonth(0); // Compare with Jan 1
			checkDate.setDate(1);
			return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
		},

		/* Parse a string value into a date object.
		 * See formatDate below for the possible formats.
		 *
		 * @param  format string - the expected format of the date
		 * @param  value string - the date in the above format
		 * @param  settings Object - attributes include:
		 *                  shortYearCutoff  number - the cutoff year for determining the century (optional)
		 *                  dayNamesShort   string[7] - abbreviated names of the days from Sunday (optional)
		 *                  dayNames        string[7] - names of the days from Sunday (optional)
		 *                  monthNamesShort string[12] - abbreviated names of the months (optional)
		 *                  monthNames      string[12] - names of the months (optional)
		 * @return  Date - the extracted date value or null if value is blank
		 */
		parseDate: function(format, value, settings) {
			if (format == null || value == null) {
				throw "Invalid arguments";
			}

			value = (typeof value === "object" ? value.toString() : value + "");
			if (value === "") {
				return null;
			}

			var iFormat, dim, extra,
				iValue = 0,
				shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff,
				shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
					new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)),
				dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
				dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
				monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
				monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
				year = -1,
				month = -1,
				day = -1,
				doy = -1,
				literal = false,
				date,
				// Check whether a format character is doubled
				lookAhead = function(match) {
					var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
					if (matches) {
						iFormat++;
					}
					return matches;
				},
				// Extract a number from the string value
				getNumber = function(match) {
					var isDoubled = lookAhead(match),
						size = (match === "@" ? 14 : (match === "!" ? 20 :
							(match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))),
						digits = new RegExp("^\\d{1," + size + "}"),
						num = value.substring(iValue).match(digits);
					if (!num) {
						throw "Missing number at position " + iValue;
					}
					iValue += num[0].length;
					return parseInt(num[0], 10);
				},
				// Extract a name from the string value and convert to an index
				getName = function(match, shortNames, longNames) {
					var index = -1,
						names = $.map(lookAhead(match) ? longNames : shortNames, function(v, k) {
							return [[k, v]];
						}).sort(function(a, b) {
							return -(a[1].length - b[1].length);
						});

					$.each(names, function(i, pair) {
						var name = pair[1];
						if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) {
							index = pair[0];
							iValue += name.length;
							return false;
						}
					});
					if (index !== -1) {
						return index + 1;
					} else {
						throw "Unknown name at position " + iValue;
					}
				},
				// Confirm that a literal character matches the string value
				checkLiteral = function() {
					if (value.charAt(iValue) !== format.charAt(iFormat)) {
						throw "Unexpected literal at position " + iValue;
					}
					iValue++;
				};

			for (iFormat = 0; iFormat < format.length; iFormat++) {
				if (literal) {
					if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
						literal = false;
					} else {
						checkLiteral();
					}
				} else {
					switch (format.charAt(iFormat)) {
						case "d":
							day = getNumber("d");
							break;
						case "D":
							getName("D", dayNamesShort, dayNames);
							break;
						case "o":
							doy = getNumber("o");
							break;
						case "m":
							month = getNumber("m");
							break;
						case "M":
							month = getName("M", monthNamesShort, monthNames);
							break;
						case "y":
							year = getNumber("y");
							break;
						case "@":
							date = new Date(getNumber("@"));
							year = date.getFullYear();
							month = date.getMonth() + 1;
							day = date.getDate();
							break;
						case "!":
							date = new Date((getNumber("!") - this._ticksTo1970) / 10000);
							year = date.getFullYear();
							month = date.getMonth() + 1;
							day = date.getDate();
							break;
						case "'":
							if (lookAhead("'")) {
								checkLiteral();
							} else {
								literal = true;
							}
							break;
						default:
							checkLiteral();
					}
				}
			}

			if (iValue < value.length) {
				extra = value.substr(iValue);
				if (!/^\s+/.test(extra)) {
					throw "Extra/unparsed characters found in date: " + extra;
				}
			}

			if (year === -1) {
				year = new Date().getFullYear();
			} else if (year < 100) {
				year += new Date().getFullYear() - new Date().getFullYear() % 100 +
					(year <= shortYearCutoff ? 0 : -100);
			}

			if (doy > -1) {
				month = 1;
				day = doy;
				do {
					dim = this._getDaysInMonth(year, month - 1);
					if (day <= dim) {
						break;
					}
					month++;
					day -= dim;
				} while (true);
			}

			date = this._daylightSavingAdjust(new Date(year, month - 1, day));
			if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) {
				throw "Invalid date"; // E.g. 31/02/00
			}
			return date;
		},

		/* Standard date formats. */
		ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
		COOKIE: "D, dd M yy",
		ISO_8601: "yy-mm-dd",
		RFC_822: "D, d M y",
		RFC_850: "DD, dd-M-y",
		RFC_1036: "D, d M y",
		RFC_1123: "D, d M yy",
		RFC_2822: "D, d M yy",
		RSS: "D, d M y", // RFC 822
		TICKS: "!",
		TIMESTAMP: "@",
		W3C: "yy-mm-dd", // ISO 8601

		_ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
			Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),

		/* Format a date object into a string value.
		 * The format can be combinations of the following:
		 * d  - day of month (no leading zero)
		 * dd - day of month (two digit)
		 * o  - day of year (no leading zeros)
		 * oo - day of year (three digit)
		 * D  - day name short
		 * DD - day name long
		 * m  - month of year (no leading zero)
		 * mm - month of year (two digit)
		 * M  - month name short
		 * MM - month name long
		 * y  - year (two digit)
		 * yy - year (four digit)
		 * @ - Unix timestamp (ms since 01/01/1970)
		 * ! - Windows ticks (100ns since 01/01/0001)
		 * "..." - literal text
		 * '' - single quote
		 *
		 * @param  format string - the desired format of the date
		 * @param  date Date - the date value to format
		 * @param  settings Object - attributes include:
		 *                  dayNamesShort   string[7] - abbreviated names of the days from Sunday (optional)
		 *                  dayNames        string[7] - names of the days from Sunday (optional)
		 *                  monthNamesShort string[12] - abbreviated names of the months (optional)
		 *                  monthNames      string[12] - names of the months (optional)
		 * @return  string - the date in the above format
		 */
		formatDate: function(format, date, settings) {
			if (!date) {
				return "";
			}

			var iFormat,
				dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
				dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
				monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
				monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
				// Check whether a format character is doubled
				lookAhead = function(match) {
					var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
					if (matches) {
						iFormat++;
					}
					return matches;
				},
				// Format a number, with leading zero if necessary
				formatNumber = function(match, value, len) {
					var num = "" + value;
					if (lookAhead(match)) {
						while (num.length < len) {
							num = "0" + num;
						}
					}
					return num;
				},
				// Format a name, short or long as requested
				formatName = function(match, value, shortNames, longNames) {
					return (lookAhead(match) ? longNames[value] : shortNames[value]);
				},
				output = "",
				literal = false;

			if (date) {
				for (iFormat = 0; iFormat < format.length; iFormat++) {
					if (literal) {
						if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
							literal = false;
						} else {
							output += format.charAt(iFormat);
						}
					} else {
						switch (format.charAt(iFormat)) {
							case "d":
								output += formatNumber("d", date.getDate(), 2);
								break;
							case "D":
								output += formatName("D", date.getDay(), dayNamesShort, dayNames);
								break;
							case "o":
								output += formatNumber("o",
									Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
								break;
							case "m":
								output += formatNumber("m", date.getMonth() + 1, 2);
								break;
							case "M":
								output += formatName("M", date.getMonth(), monthNamesShort, monthNames);
								break;
							case "y":
								output += (lookAhead("y") ? date.getFullYear() :
									(date.getYear() % 100 < 10 ? "0" : "") + date.getYear() % 100);
								break;
							case "@":
								output += date.getTime();
								break;
							case "!":
								output += date.getTime() * 10000 + this._ticksTo1970;
								break;
							case "'":
								if (lookAhead("'")) {
									output += "'";
								} else {
									literal = true;
								}
								break;
							default:
								output += format.charAt(iFormat);
						}
					}
				}
			}
			return output;
		},

		/* Extract all possible characters from the date format. */
		_possibleChars: function(format) {
			var iFormat,
				chars = "",
				literal = false,
				// Check whether a format character is doubled
				lookAhead = function(match) {
					var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
					if (matches) {
						iFormat++;
					}
					return matches;
				};

			for (iFormat = 0; iFormat < format.length; iFormat++) {
				if (literal) {
					if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
						literal = false;
					} else {
						chars += format.charAt(iFormat);
					}
				} else {
					switch (format.charAt(iFormat)) {
						case "d":
						case "m":
						case "y":
						case "@":
							chars += "0123456789";
							break;
						case "D":
						case "M":
							return null; // Accept anything
						case "'":
							if (lookAhead("'")) {
								chars += "'";
							} else {
								literal = true;
							}
							break;
						default:
							chars += format.charAt(iFormat);
					}
				}
			}
			return chars;
		},

		/* Get a setting value, defaulting if necessary. */
		_get: function(inst, name) {
			return inst.settings[name] !== undefined ?
				inst.settings[name] : this._defaults[name];
		},

		/* Parse existing date and initialise date picker. */
		_setDateFromField: function(inst, noDefault) {
			if (inst.input.val() === inst.lastVal) {
				return;
			}

			var dateFormat = this._get(inst, "dateFormat"),
				dates = inst.lastVal = inst.input ? inst.input.val() : null,
				defaultDate = this._getDefaultDate(inst),
				date = defaultDate,
				settings = this._getFormatConfig(inst);

			try {
				date = this.parseDate(dateFormat, dates, settings) || defaultDate;
			} catch (event) {
				dates = (noDefault ? "" : dates);
			}
			inst.selectedDay = date.getDate();
			inst.drawMonth = inst.selectedMonth = date.getMonth();
			inst.drawYear = inst.selectedYear = date.getFullYear();
			inst.currentDay = (dates ? date.getDate() : 0);
			inst.currentMonth = (dates ? date.getMonth() : 0);
			inst.currentYear = (dates ? date.getFullYear() : 0);
			this._adjustInstDate(inst);
		},

		/* Retrieve the default date shown on opening. */
		_getDefaultDate: function(inst) {
			return this._restrictMinMax(inst,
				this._determineDate(inst, this._get(inst, "defaultDate"), new Date()));
		},

		/* A date may be specified as an exact value or a relative one. */
		_determineDate: function(inst, date, defaultDate) {
			var offsetNumeric = function(offset) {
				var date = new Date();
				date.setDate(date.getDate() + offset);
				return date;
			},
				offsetString = function(offset) {
					try {
						return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
							offset, $.datepicker._getFormatConfig(inst));
					} catch (e) {
						// Ignore
					}

					var date = (offset.toLowerCase().match(/^c/) ?
						$.datepicker._getDate(inst) : null) || new Date(),
						year = date.getFullYear(),
						month = date.getMonth(),
						day = date.getDate(),
						pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
						matches = pattern.exec(offset);

					while (matches) {
						switch (matches[2] || "d") {
							case "d":
							case "D":
								day += parseInt(matches[1], 10);
								break;
							case "w":
							case "W":
								day += parseInt(matches[1], 10) * 7;
								break;
							case "m":
							case "M":
								month += parseInt(matches[1], 10);
								day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
								break;
							case "y":
							case "Y":
								year += parseInt(matches[1], 10);
								day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
								break;
						}
						matches = pattern.exec(offset);
					}
					return new Date(year, month, day);
				},
				newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) :
					(typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));

			newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate);
			if (newDate) {
				newDate.setHours(0);
				newDate.setMinutes(0);
				newDate.setSeconds(0);
				newDate.setMilliseconds(0);
			}
			return this._daylightSavingAdjust(newDate);
		},

		/* Handle switch to/from daylight saving.
		 * Hours may be non-zero on daylight saving cut-over:
		 * > 12 when midnight changeover, but then cannot generate
		 * midnight datetime, so jump to 1AM, otherwise reset.
		 * @param  date  (Date) the date to check
		 * @return  (Date) the corrected date
		 */
		_daylightSavingAdjust: function(date) {
			if (!date) {
				return null;
			}
			date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
			return date;
		},

		/* Set the date(s) directly. */
		_setDate: function(inst, date, noChange) {
			var clear = !date,
				origMonth = inst.selectedMonth,
				origYear = inst.selectedYear,
				newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));

			inst.selectedDay = inst.currentDay = newDate.getDate();
			inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
			inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
			if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) {
				this._notifyChange(inst);
			}
			this._adjustInstDate(inst);
			if (inst.input) {
				inst.input.val(clear ? "" : this._formatDate(inst));
			}
		},

		/* Retrieve the date(s) directly. */
		_getDate: function(inst) {
			var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null :
				this._daylightSavingAdjust(new Date(
					inst.currentYear, inst.currentMonth, inst.currentDay)));
			return startDate;
		},

		/* Attach the onxxx handlers.  These are declared statically so
		 * they work with static code transformers like Caja.
		 */
		_attachHandlers: function(inst) {
			var stepMonths = this._get(inst, "stepMonths"),
				id = "#" + inst.id.replace(/\\\\/g, "\\");
			inst.dpDiv.find("[data-handler]").map(function() {
				var handler = {
					prev: function() {
						$.datepicker._adjustDate(id, -stepMonths, "M");
					},
					next: function() {
						$.datepicker._adjustDate(id, +stepMonths, "M");
					},
					hide: function() {
						$.datepicker._hideDatepicker();
					},
					today: function() {
						$.datepicker._gotoToday(id);
					},
					selectDay: function() {
						$.datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this);
						return false;
					},
					selectMonth: function() {
						$.datepicker._selectMonthYear(id, this, "M");
						return false;
					},
					selectYear: function() {
						$.datepicker._selectMonthYear(id, this, "Y");
						return false;
					}
				};
				$(this).bind(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]);
			});
		},

		/* Generate the HTML for the current state of the date picker. */
		_generateHTML: function(inst) {
			var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
				controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
				monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
				selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
				cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
				printDate, dRow, tbody, daySettings, otherMonth, unselectable,
				tempDate = new Date(),
				today = this._daylightSavingAdjust(
					new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time
				isRTL = this._get(inst, "isRTL"),
				showButtonPanel = this._get(inst, "showButtonPanel"),
				hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"),
				navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"),
				numMonths = this._getNumberOfMonths(inst),
				showCurrentAtPos = this._get(inst, "showCurrentAtPos"),
				stepMonths = this._get(inst, "stepMonths"),
				isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1),
				currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
					new Date(inst.currentYear, inst.currentMonth, inst.currentDay))),
				minDate = this._getMinMaxDate(inst, "min"),
				maxDate = this._getMinMaxDate(inst, "max"),
				drawMonth = inst.drawMonth - showCurrentAtPos,
				drawYear = inst.drawYear;

			if (drawMonth < 0) {
				drawMonth += 12;
				drawYear--;
			}
			if (maxDate) {
				maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
					maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
				maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
				while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
					drawMonth--;
					if (drawMonth < 0) {
						drawMonth = 11;
						drawYear--;
					}
				}
			}
			inst.drawMonth = drawMonth;
			inst.drawYear = drawYear;

			prevText = this._get(inst, "prevText");
			prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
				this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
				this._getFormatConfig(inst)));

			prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
				"<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
				" title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "e" : "w") + "'>" + prevText + "</span></a>" :
				(hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "e" : "w") + "'>" + prevText + "</span></a>"));

			nextText = this._get(inst, "nextText");
			nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
				this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
				this._getFormatConfig(inst)));

			next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
				"<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
				" title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "w" : "e") + "'>" + nextText + "</span></a>" :
				(hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "w" : "e") + "'>" + nextText + "</span></a>"));

			currentText = this._get(inst, "currentText");
			gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today);
			currentText = (!navigationAsDateFormat ? currentText :
				this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));

			controls = (!inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
				this._get(inst, "closeText") + "</button>" : "");

			buttonPanel = (showButtonPanel) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + (isRTL ? controls : "") +
				(this._isInRange(inst, gotoDate) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
				">" + currentText + "</button>" : "") + (isRTL ? "" : controls) + "</div>" : "";

			firstDay = parseInt(this._get(inst, "firstDay"), 10);
			firstDay = (isNaN(firstDay) ? 0 : firstDay);

			showWeek = this._get(inst, "showWeek");
			dayNames = this._get(inst, "dayNames");
			dayNamesMin = this._get(inst, "dayNamesMin");
			monthNames = this._get(inst, "monthNames");
			monthNamesShort = this._get(inst, "monthNamesShort");
			beforeShowDay = this._get(inst, "beforeShowDay");
			showOtherMonths = this._get(inst, "showOtherMonths");
			selectOtherMonths = this._get(inst, "selectOtherMonths");
			defaultDate = this._getDefaultDate(inst);
			html = "";
			dow;
			for (row = 0; row < numMonths[0]; row++) {
				group = "";
				this.maxRows = 4;
				for (col = 0; col < numMonths[1]; col++) {
					selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
					cornerClass = " ui-corner-all";
					calender = "";
					if (isMultiMonth) {
						calender += "<div class='ui-datepicker-group";
						if (numMonths[1] > 1) {
							switch (col) {
								case 0:
									calender += " ui-datepicker-group-first";
									cornerClass = " ui-corner-" + (isRTL ? "right" : "left");
									break;
								case numMonths[1] - 1:
									calender += " ui-datepicker-group-last";
									cornerClass = " ui-corner-" + (isRTL ? "left" : "right");
									break;
								default:
									calender += " ui-datepicker-group-middle";
									cornerClass = "";
									break;
							}
						}
						calender += "'>";
					}
					calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" +
						(/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") +
						(/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") +
						this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
							row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
					"</div><table class='ui-datepicker-calendar'><thead>" +
						"<tr>";
					thead = (showWeek ? "<th class='ui-datepicker-week-col'>" + this._get(inst, "weekHeader") + "</th>" : "");
					for (dow = 0; dow < 7; dow++) { // days of the week
						day = (dow + firstDay) % 7;
						thead += "<th" + ((dow + firstDay + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "") + ">" +
							"<span title='" + dayNames[day] + "'>" + dayNamesMin[day] + "</span></th>";
					}
					calender += thead + "</tr></thead><tbody>";
					daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
					if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) {
						inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
					}
					leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
					curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
					numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
					this.maxRows = numRows;
					printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
					for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows
						calender += "<tr>";
						tbody = (!showWeek ? "" : "<td class='ui-datepicker-week-col'>" +
							this._get(inst, "calculateWeek")(printDate) + "</td>");
						for (dow = 0; dow < 7; dow++) { // create date picker days
							daySettings = (beforeShowDay ?
								beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]);
							otherMonth = (printDate.getMonth() !== drawMonth);
							unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
								(minDate && printDate < minDate) || (maxDate && printDate > maxDate);
							tbody += "<td class='" +
								((dow + firstDay + 6) % 7 >= 5 ? " ui-datepicker-week-end" : "") + // highlight weekends
							(otherMonth ? " ui-datepicker-other-month" : "") + // highlight days from other months
							((printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent) || // user pressed key
								(defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime()) ?
								// or defaultDate is current printedDate and defaultDate is selectedDate
								" " + this._dayOverClass : "") + // highlight selected day
							(unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "") + // highlight unselectable days
							(otherMonth && !showOtherMonths ? "" : " " + daySettings[1] + // highlight custom dates
								(printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "") + // highlight selected day
								(printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "")) + "'" + // highlight today (if different)
							((!otherMonth || showOtherMonths) && daySettings[2] ? " title='" + daySettings[2].replace(/'/g, "&#39;") + "'" : "") + // cell title
							(unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'") + ">" + // actions
							(otherMonth && !showOtherMonths ? "&#xa0;" : // display for other months
								(unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" +
									(printDate.getTime() === today.getTime() ? " ui-state-highlight" : "") +
									(printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "") + // highlight selected day
									(otherMonth ? " ui-priority-secondary" : "") + // distinguish dates from other months
									"' href='#'>" + printDate.getDate() + "</a>")) + "</td>"; // display selectable date
							printDate.setDate(printDate.getDate() + 1);
							printDate = this._daylightSavingAdjust(printDate);
						}
						calender += tbody + "</tr>";
					}
					drawMonth++;
					if (drawMonth > 11) {
						drawMonth = 0;
						drawYear++;
					}
					calender += "</tbody></table>" + (isMultiMonth ? "</div>" +
						((numMonths[0] > 0 && col === numMonths[1] - 1) ? "<div class='ui-datepicker-row-break'></div>" : "") : "");
					group += calender;
				}
				html += group;
			}
			html += buttonPanel;
			inst._keyEvent = false;
			return html;
		},

		/* Generate the month and year header. */
		_generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
			secondary, monthNames, monthNamesShort) {

			var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
				changeMonth = this._get(inst, "changeMonth"),
				changeYear = this._get(inst, "changeYear"),
				showMonthAfterYear = this._get(inst, "showMonthAfterYear"),
				html = "<div class='ui-datepicker-title'>",
				monthHtml = "";

			// month selection
			if (secondary || !changeMonth) {
				monthHtml += "<span class='ui-datepicker-month'>" + monthNames[drawMonth] + "</span>";
			} else {
				inMinYear = (minDate && minDate.getFullYear() === drawYear);
				inMaxYear = (maxDate && maxDate.getFullYear() === drawYear);
				monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
				for (month = 0; month < 12; month++) {
					if ((!inMinYear || month >= minDate.getMonth()) && (!inMaxYear || month <= maxDate.getMonth())) {
						monthHtml += "<option value='" + month + "'" +
							(month === drawMonth ? " selected='selected'" : "") +
							">" + monthNamesShort[month] + "</option>";
					}
				}
				monthHtml += "</select>";
			}

			if (!showMonthAfterYear) {
				html += monthHtml + (secondary || !(changeMonth && changeYear) ? "&#xa0;" : "");
			}

			// year selection
			if (!inst.yearshtml) {
				inst.yearshtml = "";
				if (secondary || !changeYear) {
					html += "<span class='ui-datepicker-year'>" + drawYear + "</span>";
				} else {
					// determine range of years to display
					years = this._get(inst, "yearRange").split(":");
					thisYear = new Date().getFullYear();
					determineYear = function(value) {
						var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) :
							(value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) :
								parseInt(value, 10)));
						return (isNaN(year) ? thisYear : year);
					};
					year = determineYear(years[0]);
					endYear = Math.max(year, determineYear(years[1] || ""));
					year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
					endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
					inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
					for (; year <= endYear; year++) {
						inst.yearshtml += "<option value='" + year + "'" +
							(year === drawYear ? " selected='selected'" : "") +
							">" + year + "</option>";
					}
					inst.yearshtml += "</select>";

					html += inst.yearshtml;
					inst.yearshtml = null;
				}
			}

			html += this._get(inst, "yearSuffix");
			if (showMonthAfterYear) {
				html += (secondary || !(changeMonth && changeYear) ? "&#xa0;" : "") + monthHtml;
			}
			html += "</div>"; // Close datepicker_header
			return html;
		},

		/* Adjust one of the date sub-fields. */
		_adjustInstDate: function(inst, offset, period) {
			var year = inst.drawYear + (period === "Y" ? offset : 0),
				month = inst.drawMonth + (period === "M" ? offset : 0),
				day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0),
				date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day)));

			inst.selectedDay = date.getDate();
			inst.drawMonth = inst.selectedMonth = date.getMonth();
			inst.drawYear = inst.selectedYear = date.getFullYear();
			if (period === "M" || period === "Y") {
				this._notifyChange(inst);
			}
		},

		/* Ensure a date is within any min/max bounds. */
		_restrictMinMax: function(inst, date) {
			var minDate = this._getMinMaxDate(inst, "min"),
				maxDate = this._getMinMaxDate(inst, "max"),
				newDate = (minDate && date < minDate ? minDate : date);
			return (maxDate && newDate > maxDate ? maxDate : newDate);
		},

		/* Notify change of month/year. */
		_notifyChange: function(inst) {
			var onChange = this._get(inst, "onChangeMonthYear");
			if (onChange) {
				onChange.apply((inst.input ? inst.input[0] : null), [inst.selectedYear, inst.selectedMonth + 1, inst]);
			}
		},

		/* Determine the number of months to show. */
		_getNumberOfMonths: function(inst) {
			var numMonths = this._get(inst, "numberOfMonths");
			return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths));
		},

		/* Determine the current maximum date - ensure no time components are set. */
		_getMinMaxDate: function(inst, minMax) {
			return this._determineDate(inst, this._get(inst, minMax + "Date"), null);
		},

		/* Find the number of days in a given month. */
		_getDaysInMonth: function(year, month) {
			return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
		},

		/* Find the day of the week of the first of a month. */
		_getFirstDayOfMonth: function(year, month) {
			return new Date(year, month, 1).getDay();
		},

		/* Determines if we should allow a "next/prev" month display change. */
		_canAdjustMonth: function(inst, offset, curYear, curMonth) {
			var numMonths = this._getNumberOfMonths(inst),
				date = this._daylightSavingAdjust(new Date(curYear,
					curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));

			if (offset < 0) {
				date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
			}
			return this._isInRange(inst, date);
		},

		/* Is the given date in the accepted range? */
		_isInRange: function(inst, date) {
			var yearSplit, currentYear,
				minDate = this._getMinMaxDate(inst, "min"),
				maxDate = this._getMinMaxDate(inst, "max"),
				minYear = null,
				maxYear = null,
				years = this._get(inst, "yearRange");
			if (years) {
				yearSplit = years.split(":");
				currentYear = new Date().getFullYear();
				minYear = parseInt(yearSplit[0], 10);
				maxYear = parseInt(yearSplit[1], 10);
				if (yearSplit[0].match(/[+\-].*/)) {
					minYear += currentYear;
				}
				if (yearSplit[1].match(/[+\-].*/)) {
					maxYear += currentYear;
				}
			}

			return ((!minDate || date.getTime() >= minDate.getTime()) &&
				(!maxDate || date.getTime() <= maxDate.getTime()) &&
				(!minYear || date.getFullYear() >= minYear) &&
				(!maxYear || date.getFullYear() <= maxYear));
		},

		/* Provide the configuration settings for formatting/parsing. */
		_getFormatConfig: function(inst) {
			var shortYearCutoff = this._get(inst, "shortYearCutoff");
			shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff :
				new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
			return {
				shortYearCutoff: shortYearCutoff,
				dayNamesShort: this._get(inst, "dayNamesShort"),
				dayNames: this._get(inst, "dayNames"),
				monthNamesShort: this._get(inst, "monthNamesShort"),
				monthNames: this._get(inst, "monthNames")
			};
		},

		/* Format the given date for display. */
		_formatDate: function(inst, day, month, year) {
			if (!day) {
				inst.currentDay = inst.selectedDay;
				inst.currentMonth = inst.selectedMonth;
				inst.currentYear = inst.selectedYear;
			}
			var date = (day ? (typeof day === "object" ? day :
					this._daylightSavingAdjust(new Date(year, month, day))) :
				this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
			return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst));
		}
	});

	/*
	 * Bind hover events for datepicker elements.
	 * Done via delegate so the binding only occurs once in the lifetime of the parent div.
	 * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
	 */

	function bindHover(dpDiv) {
		var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
		return dpDiv.delegate(selector, "mouseout", function() {
			$(this).removeClass("ui-state-hover");
			if (this.className.indexOf("ui-datepicker-prev") !== -1) {
				$(this).removeClass("ui-datepicker-prev-hover");
			}
			if (this.className.indexOf("ui-datepicker-next") !== -1) {
				$(this).removeClass("ui-datepicker-next-hover");
			}
		})
			.delegate(selector, "mouseover", function() {
				if (!$.datepicker._isDisabledDatepicker(instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) {
					$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
					$(this).addClass("ui-state-hover");
					if (this.className.indexOf("ui-datepicker-prev") !== -1) {
						$(this).addClass("ui-datepicker-prev-hover");
					}
					if (this.className.indexOf("ui-datepicker-next") !== -1) {
						$(this).addClass("ui-datepicker-next-hover");
					}
				}
			});
	}

	/* jQuery extend now ignores nulls! */

	function extendRemove(target, props) {
		$.extend(target, props);
		for (var name in props) {
			if (props[name] == null) {
				target[name] = props[name];
			}
		}
		return target;
	}

	/* Invoke the datepicker functionality.
   @param  options  string - a command, optionally followed by additional parameters or
                    Object - settings for attaching new datepicker functionality
   @return  jQuery object */
	$.fn.datepicker = function(options) {

		/* Verify an empty collection wasn't passed - Fixes #6976 */
		if (!this.length) {
			return this;
		}

		/* Initialise the date picker. */
		if (!$.datepicker.initialized) {
			$(document).mousedown($.datepicker._checkExternalClick);
			$.datepicker.initialized = true;
		}

		/* Append datepicker main container to body if not exist. */
		if ($("#" + $.datepicker._mainDivId).length === 0) {
			$("body").append($.datepicker.dpDiv);
		}

		var otherArgs = Array.prototype.slice.call(arguments, 1);
		if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) {
			return $.datepicker["_" + options + "Datepicker"].
			apply($.datepicker, [this[0]].concat(otherArgs));
		}
		if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") {
			return $.datepicker["_" + options + "Datepicker"].
			apply($.datepicker, [this[0]].concat(otherArgs));
		}
		return this.each(function() {
			typeof options === "string" ?
				$.datepicker["_" + options + "Datepicker"].
			apply($.datepicker, [this].concat(otherArgs)) :
				$.datepicker._attachDatepicker(this, options);
		});
	};

	$.datepicker = new Datepicker(); // singleton instance
	$.datepicker.initialized = false;
	$.datepicker.uuid = new Date().getTime();
	$.datepicker.version = "1.10.3";

})(jQuery);

(function($, undefined) {

	var sizeRelatedOptions = {
		buttons: true,
		height: true,
		maxHeight: true,
		maxWidth: true,
		minHeight: true,
		minWidth: true,
		width: true
	},
		resizableRelatedOptions = {
			maxHeight: true,
			maxWidth: true,
			minHeight: true,
			minWidth: true
		};

	$.widget("ui.dialog", {
		version: "1.10.3",
		options: {
			appendTo: "body",
			autoOpen: true,
			buttons: [],
			closeOnEscape: true,
			closeText: "close",
			dialogClass: "",
			draggable: true,
			hide: null,
			height: "auto",
			maxHeight: null,
			maxWidth: null,
			minHeight: 150,
			minWidth: 150,
			modal: false,
			position: {
				my: "center",
				at: "center",
				of: window,
				collision: "fit",
				// Ensure the titlebar is always visible
				using: function(pos) {
					var topOffset = $(this).css(pos).offset().top;
					if (topOffset < 0) {
						$(this).css("top", pos.top - topOffset);
					}
				}
			},
			resizable: true,
			show: null,
			title: null,
			width: 300,

			// callbacks
			beforeClose: null,
			close: null,
			drag: null,
			dragStart: null,
			dragStop: null,
			focus: null,
			open: null,
			resize: null,
			resizeStart: null,
			resizeStop: null
		},

		_create: function() {
			this.originalCss = {
				display: this.element[0].style.display,
				width: this.element[0].style.width,
				minHeight: this.element[0].style.minHeight,
				maxHeight: this.element[0].style.maxHeight,
				height: this.element[0].style.height
			};
			this.originalPosition = {
				parent: this.element.parent(),
				index: this.element.parent().children().index(this.element)
			};
			this.originalTitle = this.element.attr("title");
			this.options.title = this.options.title || this.originalTitle;

			this._createWrapper();

			this.element
				.show()
				.removeAttr("title")
				.addClass("ui-dialog-content ui-widget-content")
				.appendTo(this.uiDialog);

			this._createTitlebar();
			this._createButtonPane();

			if (this.options.draggable && $.fn.draggable) {
				this._makeDraggable();
			}
			if (this.options.resizable && $.fn.resizable) {
				this._makeResizable();
			}

			this._isOpen = false;
		},

		_init: function() {
			if (this.options.autoOpen) {
				this.open();
			}
		},

		_appendTo: function() {
			var element = this.options.appendTo;
			if (element && (element.jquery || element.nodeType)) {
				return $(element);
			}
			return this.document.find(element || "body").eq(0);
		},

		_destroy: function() {
			var next,
				originalPosition = this.originalPosition;

			this._destroyOverlay();

			this.element
				.removeUniqueId()
				.removeClass("ui-dialog-content ui-widget-content")
				.css(this.originalCss)
			// Without detaching first, the following becomes really slow
			.detach();

			this.uiDialog.stop(true, true).remove();

			if (this.originalTitle) {
				this.element.attr("title", this.originalTitle);
			}

			next = originalPosition.parent.children().eq(originalPosition.index);
			// Don't try to place the dialog next to itself (#8613)
			if (next.length && next[0] !== this.element[0]) {
				next.before(this.element);
			} else {
				originalPosition.parent.append(this.element);
			}
		},

		widget: function() {
			return this.uiDialog;
		},

		disable: $.noop,
		enable: $.noop,

		close: function(event) {
			var that = this;

			if (!this._isOpen || this._trigger("beforeClose", event) === false) {
				return;
			}

			this._isOpen = false;
			this._destroyOverlay();

			if (!this.opener.filter(":focusable").focus().length) {
				// Hiding a focused element doesn't trigger blur in WebKit
				// so in case we have nothing to focus on, explicitly blur the active element
				// https://bugs.webkit.org/show_bug.cgi?id=47182
				$(this.document[0].activeElement).blur();
			}

			this._hide(this.uiDialog, this.options.hide, function() {
				that._trigger("close", event);
			});
		},

		isOpen: function() {
			return this._isOpen;
		},

		moveToTop: function() {
			this._moveToTop();
		},

		_moveToTop: function(event, silent) {
			var moved = !! this.uiDialog.nextAll(":visible").insertBefore(this.uiDialog).length;
			if (moved && !silent) {
				this._trigger("focus", event);
			}
			return moved;
		},

		open: function() {
			var that = this;
			if (this._isOpen) {
				if (this._moveToTop()) {
					this._focusTabbable();
				}
				return;
			}

			this._isOpen = true;
			this.opener = $(this.document[0].activeElement);

			this._size();
			this._position();
			this._createOverlay();
			this._moveToTop(null, true);
			this._show(this.uiDialog, this.options.show, function() {
				that._focusTabbable();
				that._trigger("focus");
			});

			this._trigger("open");
		},

		_focusTabbable: function() {
			// Set focus to the first match:
			// 1. First element inside the dialog matching [autofocus]
			// 2. Tabbable element inside the content element
			// 3. Tabbable element inside the buttonpane
			// 4. The close button
			// 5. The dialog itself
			var hasFocus = this.element.find("[autofocus]");
			if (!hasFocus.length) {
				hasFocus = this.element.find(":tabbable");
			}
			if (!hasFocus.length) {
				hasFocus = this.uiDialogButtonPane.find(":tabbable");
			}
			if (!hasFocus.length) {
				hasFocus = this.uiDialogTitlebarClose.filter(":tabbable");
			}
			if (!hasFocus.length) {
				hasFocus = this.uiDialog;
			}
			hasFocus.eq(0).focus();
		},

		_keepFocus: function(event) {
			function checkFocus() {
				var activeElement = this.document[0].activeElement,
					isActive = this.uiDialog[0] === activeElement ||
						$.contains(this.uiDialog[0], activeElement);
				if (!isActive) {
					this._focusTabbable();
				}
			}
			event.preventDefault();
			checkFocus.call(this);
			// support: IE
			// IE <= 8 doesn't prevent moving focus even with event.preventDefault()
			// so we check again later
			this._delay(checkFocus);
		},

		_createWrapper: function() {
			this.uiDialog = $("<div>")
				.addClass("ui-dialog ui-widget ui-widget-content ui-corner-all ui-front " +
					this.options.dialogClass)
				.hide()
				.attr({
					// Setting tabIndex makes the div focusable
					tabIndex: -1,
					role: "dialog"
				})
				.appendTo(this._appendTo());

			this._on(this.uiDialog, {
				keydown: function(event) {
					if (this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
						event.keyCode === $.ui.keyCode.ESCAPE) {
						event.preventDefault();
						this.close(event);
						return;
					}

					// prevent tabbing out of dialogs
					if (event.keyCode !== $.ui.keyCode.TAB) {
						return;
					}
					var tabbables = this.uiDialog.find(":tabbable"),
						first = tabbables.filter(":first"),
						last = tabbables.filter(":last");

					if ((event.target === last[0] || event.target === this.uiDialog[0]) && !event.shiftKey) {
						first.focus(1);
						event.preventDefault();
					} else if ((event.target === first[0] || event.target === this.uiDialog[0]) && event.shiftKey) {
						last.focus(1);
						event.preventDefault();
					}
				},
				mousedown: function(event) {
					if (this._moveToTop(event)) {
						this._focusTabbable();
					}
				}
			});

			// We assume that any existing aria-describedby attribute means
			// that the dialog content is marked up properly
			// otherwise we brute force the content as the description
			if (!this.element.find("[aria-describedby]").length) {
				this.uiDialog.attr({
					"aria-describedby": this.element.uniqueId().attr("id")
				});
			}
		},

		_createTitlebar: function() {
			var uiDialogTitle;

			this.uiDialogTitlebar = $("<div>")
				.addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix")
				.prependTo(this.uiDialog);
			this._on(this.uiDialogTitlebar, {
				mousedown: function(event) {
					// Don't prevent click on close button (#8838)
					// Focusing a dialog that is partially scrolled out of view
					// causes the browser to scroll it into view, preventing the click event
					if (!$(event.target).closest(".ui-dialog-titlebar-close")) {
						// Dialog isn't getting focus when dragging (#8063)
						this.uiDialog.focus();
					}
				}
			});

			this.uiDialogTitlebarClose = $("<button></button>")
				.button({
					label: this.options.closeText,
					icons: {
						primary: "ui-icon-closethick"
					},
					text: false
				})
				.addClass("ui-dialog-titlebar-close")
				.appendTo(this.uiDialogTitlebar);
			this._on(this.uiDialogTitlebarClose, {
				click: function(event) {
					event.preventDefault();
					this.close(event);
				}
			});

			uiDialogTitle = $("<span>")
				.uniqueId()
				.addClass("ui-dialog-title")
				.prependTo(this.uiDialogTitlebar);
			this._title(uiDialogTitle);

			this.uiDialog.attr({
				"aria-labelledby": uiDialogTitle.attr("id")
			});
		},

		_title: function(title) {
			if (!this.options.title) {
				title.html("&#160;");
			}
			title.text(this.options.title);
		},

		_createButtonPane: function() {
			this.uiDialogButtonPane = $("<div>")
				.addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");

			this.uiButtonSet = $("<div>")
				.addClass("ui-dialog-buttonset")
				.appendTo(this.uiDialogButtonPane);

			this._createButtons();
		},

		_createButtons: function() {
			var that = this,
				buttons = this.options.buttons;

			// if we already have a button pane, remove it
			this.uiDialogButtonPane.remove();
			this.uiButtonSet.empty();

			if ($.isEmptyObject(buttons) || ($.isArray(buttons) && !buttons.length)) {
				this.uiDialog.removeClass("ui-dialog-buttons");
				return;
			}

			$.each(buttons, function(name, props) {
				var click, buttonOptions;
				props = $.isFunction(props) ? {
					click: props,
					text: name
				} :
					props;
				// Default to a non-submitting button
				props = $.extend({
					type: "button"
				}, props);
				// Change the context for the click callback to be the main element
				click = props.click;
				props.click = function() {
					click.apply(that.element[0], arguments);
				};
				buttonOptions = {
					icons: props.icons,
					text: props.showText
				};
				delete props.icons;
				delete props.showText;
				$("<button></button>", props)
					.button(buttonOptions)
					.appendTo(that.uiButtonSet);
			});
			this.uiDialog.addClass("ui-dialog-buttons");
			this.uiDialogButtonPane.appendTo(this.uiDialog);
		},

		_makeDraggable: function() {
			var that = this,
				options = this.options;

			function filteredUi(ui) {
				return {
					position: ui.position,
					offset: ui.offset
				};
			}

			this.uiDialog.draggable({
				cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
				handle: ".ui-dialog-titlebar",
				containment: "document",
				start: function(event, ui) {
					$(this).addClass("ui-dialog-dragging");
					that._blockFrames();
					that._trigger("dragStart", event, filteredUi(ui));
				},
				drag: function(event, ui) {
					that._trigger("drag", event, filteredUi(ui));
				},
				stop: function(event, ui) {
					options.position = [
						ui.position.left - that.document.scrollLeft(),
						ui.position.top - that.document.scrollTop()
					];
					$(this).removeClass("ui-dialog-dragging");
					that._unblockFrames();
					that._trigger("dragStop", event, filteredUi(ui));
				}
			});
		},

		_makeResizable: function() {
			var that = this,
				options = this.options,
				handles = options.resizable,
				// .ui-resizable has position: relative defined in the stylesheet
				// but dialogs have to use absolute or fixed positioning
				position = this.uiDialog.css("position"),
				resizeHandles = typeof handles === "string" ?
					handles :
					"n,e,s,w,se,sw,ne,nw";

			function filteredUi(ui) {
				return {
					originalPosition: ui.originalPosition,
					originalSize: ui.originalSize,
					position: ui.position,
					size: ui.size
				};
			}

			this.uiDialog.resizable({
				cancel: ".ui-dialog-content",
				containment: "document",
				alsoResize: this.element,
				maxWidth: options.maxWidth,
				maxHeight: options.maxHeight,
				minWidth: options.minWidth,
				minHeight: this._minHeight(),
				handles: resizeHandles,
				start: function(event, ui) {
					$(this).addClass("ui-dialog-resizing");
					that._blockFrames();
					that._trigger("resizeStart", event, filteredUi(ui));
				},
				resize: function(event, ui) {
					that._trigger("resize", event, filteredUi(ui));
				},
				stop: function(event, ui) {
					options.height = $(this).height();
					options.width = $(this).width();
					$(this).removeClass("ui-dialog-resizing");
					that._unblockFrames();
					that._trigger("resizeStop", event, filteredUi(ui));
				}
			})
				.css("position", position);
		},

		_minHeight: function() {
			var options = this.options;

			return options.height === "auto" ?
				options.minHeight :
				Math.min(options.minHeight, options.height);
		},

		_position: function() {
			// Need to show the dialog to get the actual offset in the position plugin
			var isVisible = this.uiDialog.is(":visible");
			if (!isVisible) {
				this.uiDialog.show();
			}
			this.uiDialog.position(this.options.position);
			if (!isVisible) {
				this.uiDialog.hide();
			}
		},

		_setOptions: function(options) {
			var that = this,
				resize = false,
				resizableOptions = {};

			$.each(options, function(key, value) {
				that._setOption(key, value);

				if (key in sizeRelatedOptions) {
					resize = true;
				}
				if (key in resizableRelatedOptions) {
					resizableOptions[key] = value;
				}
			});

			if (resize) {
				this._size();
				this._position();
			}
			if (this.uiDialog.is(":data(ui-resizable)")) {
				this.uiDialog.resizable("option", resizableOptions);
			}
		},

		_setOption: function(key, value) {
			/*jshint maxcomplexity:15*/
			var isDraggable, isResizable,
				uiDialog = this.uiDialog;

			if (key === "dialogClass") {
				uiDialog
					.removeClass(this.options.dialogClass)
					.addClass(value);
			}

			if (key === "disabled") {
				return;
			}

			this._super(key, value);

			if (key === "appendTo") {
				this.uiDialog.appendTo(this._appendTo());
			}

			if (key === "buttons") {
				this._createButtons();
			}

			if (key === "closeText") {
				this.uiDialogTitlebarClose.button({
					// Ensure that we always pass a string
					label: "" + value
				});
			}

			if (key === "draggable") {
				isDraggable = uiDialog.is(":data(ui-draggable)");
				if (isDraggable && !value) {
					uiDialog.draggable("destroy");
				}

				if (!isDraggable && value) {
					this._makeDraggable();
				}
			}

			if (key === "position") {
				this._position();
			}

			if (key === "resizable") {
				// currently resizable, becoming non-resizable
				isResizable = uiDialog.is(":data(ui-resizable)");
				if (isResizable && !value) {
					uiDialog.resizable("destroy");
				}

				// currently resizable, changing handles
				if (isResizable && typeof value === "string") {
					uiDialog.resizable("option", "handles", value);
				}

				// currently non-resizable, becoming resizable
				if (!isResizable && value !== false) {
					this._makeResizable();
				}
			}

			if (key === "title") {
				this._title(this.uiDialogTitlebar.find(".ui-dialog-title"));
			}
		},

		_size: function() {
			// If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
			// divs will both have width and height set, so we need to reset them
			var nonContentHeight, minContentHeight, maxContentHeight,
				options = this.options;

			// Reset content sizing
			this.element.show().css({
				width: "auto",
				minHeight: 0,
				maxHeight: "none",
				height: 0
			});

			if (options.minWidth > options.width) {
				options.width = options.minWidth;
			}

			// reset wrapper sizing
			// determine the height of all the non-content elements
			nonContentHeight = this.uiDialog.css({
				height: "auto",
				width: options.width
			})
				.outerHeight();
			minContentHeight = Math.max(0, options.minHeight - nonContentHeight);
			maxContentHeight = typeof options.maxHeight === "number" ?
				Math.max(0, options.maxHeight - nonContentHeight) :
				"none";

			if (options.height === "auto") {
				this.element.css({
					minHeight: minContentHeight,
					maxHeight: maxContentHeight,
					height: "auto"
				});
			} else {
				this.element.height(Math.max(0, options.height - nonContentHeight));
			}

			if (this.uiDialog.is(":data(ui-resizable)")) {
				this.uiDialog.resizable("option", "minHeight", this._minHeight());
			}
		},

		_blockFrames: function() {
			this.iframeBlocks = this.document.find("iframe").map(function() {
				var iframe = $(this);

				return $("<div>")
					.css({
						position: "absolute",
						width: iframe.outerWidth(),
						height: iframe.outerHeight()
					})
					.appendTo(iframe.parent())
					.offset(iframe.offset())[0];
			});
		},

		_unblockFrames: function() {
			if (this.iframeBlocks) {
				this.iframeBlocks.remove();
				delete this.iframeBlocks;
			}
		},

		_allowInteraction: function(event) {
			if ($(event.target).closest(".ui-dialog").length) {
				return true;
			}

			// TODO: Remove hack when datepicker implements
			// the .ui-front logic (#8989)
			return !!$(event.target).closest(".ui-datepicker").length;
		},

		_createOverlay: function() {
			if (!this.options.modal) {
				return;
			}

			var that = this,
				widgetFullName = this.widgetFullName;
			if (!$.ui.dialog.overlayInstances) {
				// Prevent use of anchors and inputs.
				// We use a delay in case the overlay is created from an
				// event that we're going to be cancelling. (#2804)
				this._delay(function() {
					// Handle .dialog().dialog("close") (#4065)
					if ($.ui.dialog.overlayInstances) {
						this.document.bind("focusin.dialog", function(event) {
							if (!that._allowInteraction(event)) {
								event.preventDefault();
								$(".ui-dialog:visible:last .ui-dialog-content")
									.data(widgetFullName)._focusTabbable();
							}
						});
					}
				});
			}

			this.overlay = $("<div>")
				.addClass("ui-widget-overlay ui-front")
				.appendTo(this._appendTo());
			this._on(this.overlay, {
				mousedown: "_keepFocus"
			});
			$.ui.dialog.overlayInstances++;
		},

		_destroyOverlay: function() {
			if (!this.options.modal) {
				return;
			}

			if (this.overlay) {
				$.ui.dialog.overlayInstances--;

				if (!$.ui.dialog.overlayInstances) {
					this.document.unbind("focusin.dialog");
				}
				this.overlay.remove();
				this.overlay = null;
			}
		}
	});

	$.ui.dialog.overlayInstances = 0;

	// DEPRECATED
	if ($.uiBackCompat !== false) {
		// position option with array notation
		// just override with old implementation
		$.widget("ui.dialog", $.ui.dialog, {
			_position: function() {
				var position = this.options.position,
					myAt = [],
					offset = [0, 0],
					isVisible;

				if (position) {
					if (typeof position === "string" || (typeof position === "object" && "0" in position)) {
						myAt = position.split ? position.split(" ") : [position[0], position[1]];
						if (myAt.length === 1) {
							myAt[1] = myAt[0];
						}

						$.each(["left", "top"], function(i, offsetPosition) {
							if (+myAt[i] === myAt[i]) {
								offset[i] = myAt[i];
								myAt[i] = offsetPosition;
							}
						});

						position = {
							my: myAt[0] + (offset[0] < 0 ? offset[0] : "+" + offset[0]) + " " + myAt[1] + (offset[1] < 0 ? offset[1] : "+" + offset[1]),
							at: myAt.join(" ")
						};
					}

					position = $.extend({}, $.ui.dialog.prototype.options.position, position);
				} else {
					position = $.ui.dialog.prototype.options.position;
				}

				// need to show the dialog to get the actual offset in the position plugin
				isVisible = this.uiDialog.is(":visible");
				if (!isVisible) {
					this.uiDialog.show();
				}
				this.uiDialog.position(position);
				if (!isVisible) {
					this.uiDialog.hide();
				}
			}
		});
	}

}(jQuery));

(function($, undefined) {

	var rvertical = /up|down|vertical/,
		rpositivemotion = /up|left|vertical|horizontal/;

	$.effects.effect.blind = function(o, done) {
		// Create element
		var el = $(this),
			props = ["position", "top", "bottom", "left", "right", "height", "width"],
			mode = $.effects.setMode(el, o.mode || "hide"),
			direction = o.direction || "up",
			vertical = rvertical.test(direction),
			ref = vertical ? "height" : "width",
			ref2 = vertical ? "top" : "left",
			motion = rpositivemotion.test(direction),
			animation = {},
			show = mode === "show",
			wrapper, distance, margin;

		// if already wrapped, the wrapper's properties are my property. #6245
		if (el.parent().is(".ui-effects-wrapper")) {
			$.effects.save(el.parent(), props);
		} else {
			$.effects.save(el, props);
		}
		el.show();
		wrapper = $.effects.createWrapper(el).css({
			overflow: "hidden"
		});

		distance = wrapper[ref]();
		margin = parseFloat(wrapper.css(ref2)) || 0;

		animation[ref] = show ? distance : 0;
		if (!motion) {
			el
				.css(vertical ? "bottom" : "right", 0)
				.css(vertical ? "top" : "left", "auto")
				.css({
					position: "absolute"
				});

			animation[ref2] = show ? margin : distance + margin;
		}

		// start at 0 if we are showing
		if (show) {
			wrapper.css(ref, 0);
			if (!motion) {
				wrapper.css(ref2, margin + distance);
			}
		}

		// Animate
		wrapper.animate(animation, {
			duration: o.duration,
			easing: o.easing,
			queue: false,
			complete: function() {
				if (mode === "hide") {
					el.hide();
				}
				$.effects.restore(el, props);
				$.effects.removeWrapper(el);
				done();
			}
		});

	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.bounce = function(o, done) {
		var el = $(this),
			props = ["position", "top", "bottom", "left", "right", "height", "width"],

			// defaults:
			mode = $.effects.setMode(el, o.mode || "effect"),
			hide = mode === "hide",
			show = mode === "show",
			direction = o.direction || "up",
			distance = o.distance,
			times = o.times || 5,

			// number of internal animations
			anims = times * 2 + (show || hide ? 1 : 0),
			speed = o.duration / anims,
			easing = o.easing,

			// utility:
			ref = (direction === "up" || direction === "down") ? "top" : "left",
			motion = (direction === "up" || direction === "left"),
			i,
			upAnim,
			downAnim,

			// we will need to re-assemble the queue to stack our animations in place
			queue = el.queue(),
			queuelen = queue.length;

		// Avoid touching opacity to prevent clearType and PNG issues in IE
		if (show || hide) {
			props.push("opacity");
		}

		$.effects.save(el, props);
		el.show();
		$.effects.createWrapper(el); // Create Wrapper

		// default distance for the BIGGEST bounce is the outer Distance / 3
		if (!distance) {
			distance = el[ref === "top" ? "outerHeight" : "outerWidth"]() / 3;
		}

		if (show) {
			downAnim = {
				opacity: 1
			};
			downAnim[ref] = 0;

			// if we are showing, force opacity 0 and set the initial position
			// then do the "first" animation
			el.css("opacity", 0)
				.css(ref, motion ? -distance * 2 : distance * 2)
				.animate(downAnim, speed, easing);
		}

		// start at the smallest distance if we are hiding
		if (hide) {
			distance = distance / Math.pow(2, times - 1);
		}

		downAnim = {};
		downAnim[ref] = 0;
		// Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
		for (i = 0; i < times; i++) {
			upAnim = {};
			upAnim[ref] = (motion ? "-=" : "+=") + distance;

			el.animate(upAnim, speed, easing)
				.animate(downAnim, speed, easing);

			distance = hide ? distance * 2 : distance / 2;
		}

		// Last Bounce when Hiding
		if (hide) {
			upAnim = {
				opacity: 0
			};
			upAnim[ref] = (motion ? "-=" : "+=") + distance;

			el.animate(upAnim, speed, easing);
		}

		el.queue(function() {
			if (hide) {
				el.hide();
			}
			$.effects.restore(el, props);
			$.effects.removeWrapper(el);
			done();
		});

		// inject all the animations we just queued to be first in line (after "inprogress")
		if (queuelen > 1) {
			queue.splice.apply(queue, [1, 0].concat(queue.splice(queuelen, anims + 1)));
		}
		el.dequeue();

	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.clip = function(o, done) {
		// Create element
		var el = $(this),
			props = ["position", "top", "bottom", "left", "right", "height", "width"],
			mode = $.effects.setMode(el, o.mode || "hide"),
			show = mode === "show",
			direction = o.direction || "vertical",
			vert = direction === "vertical",
			size = vert ? "height" : "width",
			position = vert ? "top" : "left",
			animation = {},
			wrapper, animate, distance;

		// Save & Show
		$.effects.save(el, props);
		el.show();

		// Create Wrapper
		wrapper = $.effects.createWrapper(el).css({
			overflow: "hidden"
		});
		animate = (el[0].tagName === "IMG") ? wrapper : el;
		distance = animate[size]();

		// Shift
		if (show) {
			animate.css(size, 0);
			animate.css(position, distance / 2);
		}

		// Create Animation Object:
		animation[size] = show ? distance : 0;
		animation[position] = show ? 0 : distance / 2;

		// Animate
		animate.animate(animation, {
			queue: false,
			duration: o.duration,
			easing: o.easing,
			complete: function() {
				if (!show) {
					el.hide();
				}
				$.effects.restore(el, props);
				$.effects.removeWrapper(el);
				done();
			}
		});

	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.drop = function(o, done) {

		var el = $(this),
			props = ["position", "top", "bottom", "left", "right", "opacity", "height", "width"],
			mode = $.effects.setMode(el, o.mode || "hide"),
			show = mode === "show",
			direction = o.direction || "left",
			ref = (direction === "up" || direction === "down") ? "top" : "left",
			motion = (direction === "up" || direction === "left") ? "pos" : "neg",
			animation = {
				opacity: show ? 1 : 0
			},
			distance;

		// Adjust
		$.effects.save(el, props);
		el.show();
		$.effects.createWrapper(el);

		distance = o.distance || el[ref === "top" ? "outerHeight" : "outerWidth"](true) / 2;

		if (show) {
			el
				.css("opacity", 0)
				.css(ref, motion === "pos" ? -distance : distance);
		}

		// Animation
		animation[ref] = (show ?
			(motion === "pos" ? "+=" : "-=") :
			(motion === "pos" ? "-=" : "+=")) +
			distance;

		// Animate
		el.animate(animation, {
			queue: false,
			duration: o.duration,
			easing: o.easing,
			complete: function() {
				if (mode === "hide") {
					el.hide();
				}
				$.effects.restore(el, props);
				$.effects.removeWrapper(el);
				done();
			}
		});
	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.explode = function(o, done) {

		var rows = o.pieces ? Math.round(Math.sqrt(o.pieces)) : 3,
			cells = rows,
			el = $(this),
			mode = $.effects.setMode(el, o.mode || "hide"),
			show = mode === "show",

			// show and then visibility:hidden the element before calculating offset
			offset = el.show().css("visibility", "hidden").offset(),

			// width and height of a piece
			width = Math.ceil(el.outerWidth() / cells),
			height = Math.ceil(el.outerHeight() / rows),
			pieces = [],

			// loop
			i, j, left, top, mx, my;

		// children animate complete:

		function childComplete() {
			pieces.push(this);
			if (pieces.length === rows * cells) {
				animComplete();
			}
		}

		// clone the element for each row and cell.
		for (i = 0; i < rows; i++) { // ===>
			top = offset.top + i * height;
			my = i - (rows - 1) / 2;

			for (j = 0; j < cells; j++) { // |||
				left = offset.left + j * width;
				mx = j - (cells - 1) / 2;

				// Create a clone of the now hidden main element that will be absolute positioned
				// within a wrapper div off the -left and -top equal to size of our pieces
				el
					.clone()
					.appendTo("body")
					.wrap("<div></div>")
					.css({
						position: "absolute",
						visibility: "visible",
						left: -j * width,
						top: -i * height
					})

				// select the wrapper - make it overflow: hidden and absolute positioned based on
				// where the original was located +left and +top equal to the size of pieces
				.parent()
					.addClass("ui-effects-explode")
					.css({
						position: "absolute",
						overflow: "hidden",
						width: width,
						height: height,
						left: left + (show ? mx * width : 0),
						top: top + (show ? my * height : 0),
						opacity: show ? 0 : 1
					}).animate({
						left: left + (show ? 0 : mx * width),
						top: top + (show ? 0 : my * height),
						opacity: show ? 1 : 0
					}, o.duration || 500, o.easing, childComplete);
			}
		}

		function animComplete() {
			el.css({
				visibility: "visible"
			});
			$(pieces).remove();
			if (!show) {
				el.hide();
			}
			done();
		}
	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.fade = function(o, done) {
		var el = $(this),
			mode = $.effects.setMode(el, o.mode || "toggle");

		el.animate({
			opacity: mode
		}, {
			queue: false,
			duration: o.duration,
			easing: o.easing,
			complete: done
		});
	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.fold = function(o, done) {

		// Create element
		var el = $(this),
			props = ["position", "top", "bottom", "left", "right", "height", "width"],
			mode = $.effects.setMode(el, o.mode || "hide"),
			show = mode === "show",
			hide = mode === "hide",
			size = o.size || 15,
			percent = /([0-9]+)%/.exec(size),
			horizFirst = !! o.horizFirst,
			widthFirst = show !== horizFirst,
			ref = widthFirst ? ["width", "height"] : ["height", "width"],
			duration = o.duration / 2,
			wrapper, distance,
			animation1 = {},
			animation2 = {};

		$.effects.save(el, props);
		el.show();

		// Create Wrapper
		wrapper = $.effects.createWrapper(el).css({
			overflow: "hidden"
		});
		distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];

		if (percent) {
			size = parseInt(percent[1], 10) / 100 * distance[hide ? 0 : 1];
		}
		if (show) {
			wrapper.css(horizFirst ? {
				height: 0,
				width: size
			} : {
				height: size,
				width: 0
			});
		}

		// Animation
		animation1[ref[0]] = show ? distance[0] : size;
		animation2[ref[1]] = show ? distance[1] : 0;

		// Animate
		wrapper
			.animate(animation1, duration, o.easing)
			.animate(animation2, duration, o.easing, function() {
				if (hide) {
					el.hide();
				}
				$.effects.restore(el, props);
				$.effects.removeWrapper(el);
				done();
			});

	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.highlight = function(o, done) {
		var elem = $(this),
			props = ["backgroundImage", "backgroundColor", "opacity"],
			mode = $.effects.setMode(elem, o.mode || "show"),
			animation = {
				backgroundColor: elem.css("backgroundColor")
			};

		if (mode === "hide") {
			animation.opacity = 0;
		}

		$.effects.save(elem, props);

		elem
			.show()
			.css({
				backgroundImage: "none",
				backgroundColor: o.color || "#ffff99"
			})
			.animate(animation, {
				queue: false,
				duration: o.duration,
				easing: o.easing,
				complete: function() {
					if (mode === "hide") {
						elem.hide();
					}
					$.effects.restore(elem, props);
					done();
				}
			});
	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.pulsate = function(o, done) {
		var elem = $(this),
			mode = $.effects.setMode(elem, o.mode || "show"),
			show = mode === "show",
			hide = mode === "hide",
			showhide = (show || mode === "hide"),

			// showing or hiding leaves of the "last" animation
			anims = ((o.times || 5) * 2) + (showhide ? 1 : 0),
			duration = o.duration / anims,
			animateTo = 0,
			queue = elem.queue(),
			queuelen = queue.length,
			i;

		if (show || !elem.is(":visible")) {
			elem.css("opacity", 0).show();
			animateTo = 1;
		}

		// anims - 1 opacity "toggles"
		for (i = 1; i < anims; i++) {
			elem.animate({
				opacity: animateTo
			}, duration, o.easing);
			animateTo = 1 - animateTo;
		}

		elem.animate({
			opacity: animateTo
		}, duration, o.easing);

		elem.queue(function() {
			if (hide) {
				elem.hide();
			}
			done();
		});

		// We just queued up "anims" animations, we need to put them next in the queue
		if (queuelen > 1) {
			queue.splice.apply(queue, [1, 0].concat(queue.splice(queuelen, anims + 1)));
		}
		elem.dequeue();
	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.puff = function(o, done) {
		var elem = $(this),
			mode = $.effects.setMode(elem, o.mode || "hide"),
			hide = mode === "hide",
			percent = parseInt(o.percent, 10) || 150,
			factor = percent / 100,
			original = {
				height: elem.height(),
				width: elem.width(),
				outerHeight: elem.outerHeight(),
				outerWidth: elem.outerWidth()
			};

		$.extend(o, {
			effect: "scale",
			queue: false,
			fade: true,
			mode: mode,
			complete: done,
			percent: hide ? percent : 100,
			from: hide ? original : {
				height: original.height * factor,
				width: original.width * factor,
				outerHeight: original.outerHeight * factor,
				outerWidth: original.outerWidth * factor
			}
		});

		elem.effect(o);
	};

	$.effects.effect.scale = function(o, done) {

		// Create element
		var el = $(this),
			options = $.extend(true, {}, o),
			mode = $.effects.setMode(el, o.mode || "effect"),
			percent = parseInt(o.percent, 10) ||
				(parseInt(o.percent, 10) === 0 ? 0 : (mode === "hide" ? 0 : 100)),
			direction = o.direction || "both",
			origin = o.origin,
			original = {
				height: el.height(),
				width: el.width(),
				outerHeight: el.outerHeight(),
				outerWidth: el.outerWidth()
			},
			factor = {
				y: direction !== "horizontal" ? (percent / 100) : 1,
				x: direction !== "vertical" ? (percent / 100) : 1
			};

		// We are going to pass this effect to the size effect:
		options.effect = "size";
		options.queue = false;
		options.complete = done;

		// Set default origin and restore for show/hide
		if (mode !== "effect") {
			options.origin = origin || ["middle", "center"];
			options.restore = true;
		}

		options.from = o.from || (mode === "show" ? {
			height: 0,
			width: 0,
			outerHeight: 0,
			outerWidth: 0
		} : original);
		options.to = {
			height: original.height * factor.y,
			width: original.width * factor.x,
			outerHeight: original.outerHeight * factor.y,
			outerWidth: original.outerWidth * factor.x
		};

		// Fade option to support puff
		if (options.fade) {
			if (mode === "show") {
				options.from.opacity = 0;
				options.to.opacity = 1;
			}
			if (mode === "hide") {
				options.from.opacity = 1;
				options.to.opacity = 0;
			}
		}

		// Animate
		el.effect(options);

	};

	$.effects.effect.size = function(o, done) {

		// Create element
		var original, baseline, factor,
			el = $(this),
			props0 = ["position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity"],

			// Always restore
			props1 = ["position", "top", "bottom", "left", "right", "overflow", "opacity"],

			// Copy for children
			props2 = ["width", "height", "overflow"],
			cProps = ["fontSize"],
			vProps = ["borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom"],
			hProps = ["borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight"],

			// Set options
			mode = $.effects.setMode(el, o.mode || "effect"),
			restore = o.restore || mode !== "effect",
			scale = o.scale || "both",
			origin = o.origin || ["middle", "center"],
			position = el.css("position"),
			props = restore ? props0 : props1,
			zero = {
				height: 0,
				width: 0,
				outerHeight: 0,
				outerWidth: 0
			};

		if (mode === "show") {
			el.show();
		}
		original = {
			height: el.height(),
			width: el.width(),
			outerHeight: el.outerHeight(),
			outerWidth: el.outerWidth()
		};

		if (o.mode === "toggle" && mode === "show") {
			el.from = o.to || zero;
			el.to = o.from || original;
		} else {
			el.from = o.from || (mode === "show" ? zero : original);
			el.to = o.to || (mode === "hide" ? zero : original);
		}

		// Set scaling factor
		factor = {
			from: {
				y: el.from.height / original.height,
				x: el.from.width / original.width
			},
			to: {
				y: el.to.height / original.height,
				x: el.to.width / original.width
			}
		};

		// Scale the css box
		if (scale === "box" || scale === "both") {

			// Vertical props scaling
			if (factor.from.y !== factor.to.y) {
				props = props.concat(vProps);
				el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
				el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
			}

			// Horizontal props scaling
			if (factor.from.x !== factor.to.x) {
				props = props.concat(hProps);
				el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
				el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
			}
		}

		// Scale the content
		if (scale === "content" || scale === "both") {

			// Vertical props scaling
			if (factor.from.y !== factor.to.y) {
				props = props.concat(cProps).concat(props2);
				el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
				el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
			}
		}

		$.effects.save(el, props);
		el.show();
		$.effects.createWrapper(el);
		el.css("overflow", "hidden").css(el.from);

		// Adjust
		if (origin) { // Calculate baseline shifts
			baseline = $.effects.getBaseline(origin, original);
			el.from.top = (original.outerHeight - el.outerHeight()) * baseline.y;
			el.from.left = (original.outerWidth - el.outerWidth()) * baseline.x;
			el.to.top = (original.outerHeight - el.to.outerHeight) * baseline.y;
			el.to.left = (original.outerWidth - el.to.outerWidth) * baseline.x;
		}
		el.css(el.from); // set top & left

		// Animate
		if (scale === "content" || scale === "both") { // Scale the children

			// Add margins/font-size
			vProps = vProps.concat(["marginTop", "marginBottom"]).concat(cProps);
			hProps = hProps.concat(["marginLeft", "marginRight"]);
			props2 = props0.concat(vProps).concat(hProps);

			el.find("*[width]").each(function() {
				var child = $(this),
					c_original = {
						height: child.height(),
						width: child.width(),
						outerHeight: child.outerHeight(),
						outerWidth: child.outerWidth()
					};
				if (restore) {
					$.effects.save(child, props2);
				}

				child.from = {
					height: c_original.height * factor.from.y,
					width: c_original.width * factor.from.x,
					outerHeight: c_original.outerHeight * factor.from.y,
					outerWidth: c_original.outerWidth * factor.from.x
				};
				child.to = {
					height: c_original.height * factor.to.y,
					width: c_original.width * factor.to.x,
					outerHeight: c_original.height * factor.to.y,
					outerWidth: c_original.width * factor.to.x
				};

				// Vertical props scaling
				if (factor.from.y !== factor.to.y) {
					child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
					child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
				}

				// Horizontal props scaling
				if (factor.from.x !== factor.to.x) {
					child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
					child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
				}

				// Animate children
				child.css(child.from);
				child.animate(child.to, o.duration, o.easing, function() {

					// Restore children
					if (restore) {
						$.effects.restore(child, props2);
					}
				});
			});
		}

		// Animate
		el.animate(el.to, {
			queue: false,
			duration: o.duration,
			easing: o.easing,
			complete: function() {
				if (el.to.opacity === 0) {
					el.css("opacity", el.from.opacity);
				}
				if (mode === "hide") {
					el.hide();
				}
				$.effects.restore(el, props);
				if (!restore) {

					// we need to calculate our new positioning based on the scaling
					if (position === "static") {
						el.css({
							position: "relative",
							top: el.to.top,
							left: el.to.left
						});
					} else {
						$.each(["top", "left"], function(idx, pos) {
							el.css(pos, function(_, str) {
								var val = parseInt(str, 10),
									toRef = idx ? el.to.left : el.to.top;

								// if original was "auto", recalculate the new value from wrapper
								if (str === "auto") {
									return toRef + "px";
								}

								return val + toRef + "px";
							});
						});
					}
				}

				$.effects.removeWrapper(el);
				done();
			}
		});

	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.shake = function(o, done) {

		var el = $(this),
			props = ["position", "top", "bottom", "left", "right", "height", "width"],
			mode = $.effects.setMode(el, o.mode || "effect"),
			direction = o.direction || "left",
			distance = o.distance || 20,
			times = o.times || 3,
			anims = times * 2 + 1,
			speed = Math.round(o.duration / anims),
			ref = (direction === "up" || direction === "down") ? "top" : "left",
			positiveMotion = (direction === "up" || direction === "left"),
			animation = {},
			animation1 = {},
			animation2 = {},
			i,

			// we will need to re-assemble the queue to stack our animations in place
			queue = el.queue(),
			queuelen = queue.length;

		$.effects.save(el, props);
		el.show();
		$.effects.createWrapper(el);

		// Animation
		animation[ref] = (positiveMotion ? "-=" : "+=") + distance;
		animation1[ref] = (positiveMotion ? "+=" : "-=") + distance * 2;
		animation2[ref] = (positiveMotion ? "-=" : "+=") + distance * 2;

		// Animate
		el.animate(animation, speed, o.easing);

		// Shakes
		for (i = 1; i < times; i++) {
			el.animate(animation1, speed, o.easing).animate(animation2, speed, o.easing);
		}
		el
			.animate(animation1, speed, o.easing)
			.animate(animation, speed / 2, o.easing)
			.queue(function() {
				if (mode === "hide") {
					el.hide();
				}
				$.effects.restore(el, props);
				$.effects.removeWrapper(el);
				done();
			});

		// inject all the animations we just queued to be first in line (after "inprogress")
		if (queuelen > 1) {
			queue.splice.apply(queue, [1, 0].concat(queue.splice(queuelen, anims + 1)));
		}
		el.dequeue();

	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.slide = function(o, done) {

		// Create element
		var el = $(this),
			props = ["position", "top", "bottom", "left", "right", "width", "height"],
			mode = $.effects.setMode(el, o.mode || "show"),
			show = mode === "show",
			direction = o.direction || "left",
			ref = (direction === "up" || direction === "down") ? "top" : "left",
			positiveMotion = (direction === "up" || direction === "left"),
			distance,
			animation = {};

		// Adjust
		$.effects.save(el, props);
		el.show();
		distance = o.distance || el[ref === "top" ? "outerHeight" : "outerWidth"](true);

		$.effects.createWrapper(el).css({
			overflow: "hidden"
		});

		if (show) {
			el.css(ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance);
		}

		// Animation
		animation[ref] = (show ?
			(positiveMotion ? "+=" : "-=") :
			(positiveMotion ? "-=" : "+=")) +
			distance;

		// Animate
		el.animate(animation, {
			queue: false,
			duration: o.duration,
			easing: o.easing,
			complete: function() {
				if (mode === "hide") {
					el.hide();
				}
				$.effects.restore(el, props);
				$.effects.removeWrapper(el);
				done();
			}
		});
	};

})(jQuery);

(function($, undefined) {

	$.effects.effect.transfer = function(o, done) {
		var elem = $(this),
			target = $(o.to),
			targetFixed = target.css("position") === "fixed",
			body = $("body"),
			fixTop = targetFixed ? body.scrollTop() : 0,
			fixLeft = targetFixed ? body.scrollLeft() : 0,
			endPosition = target.offset(),
			animation = {
				top: endPosition.top - fixTop,
				left: endPosition.left - fixLeft,
				height: target.innerHeight(),
				width: target.innerWidth()
			},
			startPosition = elem.offset(),
			transfer = $("<div class='ui-effects-transfer'></div>")
				.appendTo(document.body)
				.addClass(o.className)
				.css({
					top: startPosition.top - fixTop,
					left: startPosition.left - fixLeft,
					height: elem.innerHeight(),
					width: elem.innerWidth(),
					position: targetFixed ? "fixed" : "absolute"
				})
				.animate(animation, o.duration, o.easing, function() {
					transfer.remove();
					done();
				});
	};

})(jQuery);

(function($, undefined) {

	$.widget("ui.menu", {
		version: "1.10.3",
		defaultElement: "<ul>",
		delay: 300,
		options: {
			icons: {
				submenu: "ui-icon-carat-1-e"
			},
			menus: "ul",
			position: {
				my: "left top",
				at: "right top"
			},
			role: "menu",

			// callbacks
			blur: null,
			focus: null,
			select: null
		},

		_create: function() {
			this.activeMenu = this.element;
			// flag used to prevent firing of the click handler
			// as the event bubbles up through nested menus
			this.mouseHandled = false;
			this.element
				.uniqueId()
				.addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
				.toggleClass("ui-menu-icons", !! this.element.find(".ui-icon").length)
				.attr({
					role: this.options.role,
					tabIndex: 0
				})
			// need to catch all clicks on disabled menu
			// not possible through _on
			.bind("click" + this.eventNamespace, $.proxy(function(event) {
				if (this.options.disabled) {
					event.preventDefault();
				}
			}, this));

			if (this.options.disabled) {
				this.element
					.addClass("ui-state-disabled")
					.attr("aria-disabled", "true");
			}

			this._on({
				// Prevent focus from sticking to links inside menu after clicking
				// them (focus should always stay on UL during navigation).
				"mousedown .ui-menu-item > a": function(event) {
					event.preventDefault();
				},
				"click .ui-state-disabled > a": function(event) {
					event.preventDefault();
				},
				"click .ui-menu-item:has(a)": function(event) {
					var target = $(event.target).closest(".ui-menu-item");
					if (!this.mouseHandled && target.not(".ui-state-disabled").length) {
						this.mouseHandled = true;

						this.select(event);
						// Open submenu on click
						if (target.has(".ui-menu").length) {
							this.expand(event);
						} else if (!this.element.is(":focus")) {
							// Redirect focus to the menu
							this.element.trigger("focus", [true]);

							// If the active item is on the top level, let it stay active.
							// Otherwise, blur the active item since it is no longer visible.
							if (this.active && this.active.parents(".ui-menu").length === 1) {
								clearTimeout(this.timer);
							}
						}
					}
				},
				"mouseenter .ui-menu-item": function(event) {
					var target = $(event.currentTarget);
					// Remove ui-state-active class from siblings of the newly focused menu item
					// to avoid a jump caused by adjacent elements both having a class with a border
					target.siblings().children(".ui-state-active").removeClass("ui-state-active");
					this.focus(event, target);
				},
				mouseleave: "collapseAll",
				"mouseleave .ui-menu": "collapseAll",
				focus: function(event, keepActiveItem) {
					// If there's already an active item, keep it active
					// If not, activate the first item
					var item = this.active || this.element.children(".ui-menu-item").eq(0);

					if (!keepActiveItem) {
						this.focus(event, item);
					}
				},
				blur: function(event) {
					this._delay(function() {
						if (!$.contains(this.element[0], this.document[0].activeElement)) {
							this.collapseAll(event);
						}
					});
				},
				keydown: "_keydown"
			});

			this.refresh();

			// Clicks outside of a menu collapse any open menus
			this._on(this.document, {
				click: function(event) {
					if (!$(event.target).closest(".ui-menu").length) {
						this.collapseAll(event);
					}

					// Reset the mouseHandled flag
					this.mouseHandled = false;
				}
			});
		},

		_destroy: function() {
			// Destroy (sub)menus
			this.element
				.removeAttr("aria-activedescendant")
				.find(".ui-menu").addBack()
				.removeClass("ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons")
				.removeAttr("role")
				.removeAttr("tabIndex")
				.removeAttr("aria-labelledby")
				.removeAttr("aria-expanded")
				.removeAttr("aria-hidden")
				.removeAttr("aria-disabled")
				.removeUniqueId()
				.show();

			// Destroy menu items
			this.element.find(".ui-menu-item")
				.removeClass("ui-menu-item")
				.removeAttr("role")
				.removeAttr("aria-disabled")
				.children("a")
				.removeUniqueId()
				.removeClass("ui-corner-all ui-state-hover")
				.removeAttr("tabIndex")
				.removeAttr("role")
				.removeAttr("aria-haspopup")
				.children().each(function() {
					var elem = $(this);
					if (elem.data("ui-menu-submenu-carat")) {
						elem.remove();
					}
				});

			// Destroy menu dividers
			this.element.find(".ui-menu-divider").removeClass("ui-menu-divider ui-widget-content");
		},

		_keydown: function(event) {
			/*jshint maxcomplexity:20*/
			var match, prev, character, skip, regex,
				preventDefault = true;

			function escape(value) {
				return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&");
			}

			switch (event.keyCode) {
				case $.ui.keyCode.PAGE_UP:
					this.previousPage(event);
					break;
				case $.ui.keyCode.PAGE_DOWN:
					this.nextPage(event);
					break;
				case $.ui.keyCode.HOME:
					this._move("first", "first", event);
					break;
				case $.ui.keyCode.END:
					this._move("last", "last", event);
					break;
				case $.ui.keyCode.UP:
					this.previous(event);
					break;
				case $.ui.keyCode.DOWN:
					this.next(event);
					break;
				case $.ui.keyCode.LEFT:
					this.collapse(event);
					break;
				case $.ui.keyCode.RIGHT:
					if (this.active && !this.active.is(".ui-state-disabled")) {
						this.expand(event);
					}
					break;
				case $.ui.keyCode.ENTER:
				case $.ui.keyCode.SPACE:
					this._activate(event);
					break;
				case $.ui.keyCode.ESCAPE:
					this.collapse(event);
					break;
				default:
					preventDefault = false;
					prev = this.previousFilter || "";
					character = String.fromCharCode(event.keyCode);
					skip = false;

					clearTimeout(this.filterTimer);

					if (character === prev) {
						skip = true;
					} else {
						character = prev + character;
					}

					regex = new RegExp("^" + escape(character), "i");
					match = this.activeMenu.children(".ui-menu-item").filter(function() {
						return regex.test($(this).children("a").text());
					});
					match = skip && match.index(this.active.next()) !== -1 ?
						this.active.nextAll(".ui-menu-item") :
						match;

					// If no matches on the current filter, reset to the last character pressed
					// to move down the menu to the first item that starts with that character
					if (!match.length) {
						character = String.fromCharCode(event.keyCode);
						regex = new RegExp("^" + escape(character), "i");
						match = this.activeMenu.children(".ui-menu-item").filter(function() {
							return regex.test($(this).children("a").text());
						});
					}

					if (match.length) {
						this.focus(event, match);
						if (match.length > 1) {
							this.previousFilter = character;
							this.filterTimer = this._delay(function() {
								delete this.previousFilter;
							}, 1000);
						} else {
							delete this.previousFilter;
						}
					} else {
						delete this.previousFilter;
					}
			}

			if (preventDefault) {
				event.preventDefault();
			}
		},

		_activate: function(event) {
			if (!this.active.is(".ui-state-disabled")) {
				if (this.active.children("a[aria-haspopup='true']").length) {
					this.expand(event);
				} else {
					this.select(event);
				}
			}
		},

		refresh: function() {
			var menus,
				icon = this.options.icons.submenu,
				submenus = this.element.find(this.options.menus);

			// Initialize nested menus
			submenus.filter(":not(.ui-menu)")
				.addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
				.hide()
				.attr({
					role: this.options.role,
					"aria-hidden": "true",
					"aria-expanded": "false"
				})
				.each(function() {
					var menu = $(this),
						item = menu.prev("a"),
						submenuCarat = $("<span>")
							.addClass("ui-menu-icon ui-icon " + icon)
							.data("ui-menu-submenu-carat", true);

					item
						.attr("aria-haspopup", "true")
						.prepend(submenuCarat);
					menu.attr("aria-labelledby", item.attr("id"));
				});

			menus = submenus.add(this.element);

			// Don't refresh list items that are already adapted
			menus.children(":not(.ui-menu-item):has(a)")
				.addClass("ui-menu-item")
				.attr("role", "presentation")
				.children("a")
				.uniqueId()
				.addClass("ui-corner-all")
				.attr({
					tabIndex: -1,
					role: this._itemRole()
				});

			// Initialize unlinked menu-items containing spaces and/or dashes only as dividers
			menus.children(":not(.ui-menu-item)").each(function() {
				var item = $(this);
				// hyphen, em dash, en dash
				if (!/[^\-\u2014\u2013\s]/.test(item.text())) {
					item.addClass("ui-widget-content ui-menu-divider");
				}
			});

			// Add aria-disabled attribute to any disabled menu item
			menus.children(".ui-state-disabled").attr("aria-disabled", "true");

			// If the active item has been removed, blur the menu
			if (this.active && !$.contains(this.element[0], this.active[0])) {
				this.blur();
			}
		},

		_itemRole: function() {
			return {
				menu: "menuitem",
				listbox: "option"
			}[this.options.role];
		},

		_setOption: function(key, value) {
			if (key === "icons") {
				this.element.find(".ui-menu-icon")
					.removeClass(this.options.icons.submenu)
					.addClass(value.submenu);
			}
			this._super(key, value);
		},

		focus: function(event, item) {
			var nested, focused;
			this.blur(event, event && event.type === "focus");

			this._scrollIntoView(item);

			this.active = item.first();
			focused = this.active.children("a").addClass("ui-state-focus");
			// Only update aria-activedescendant if there's a role
			// otherwise we assume focus is managed elsewhere
			if (this.options.role) {
				this.element.attr("aria-activedescendant", focused.attr("id"));
			}

			// Highlight active parent menu item, if any
			this.active
				.parent()
				.closest(".ui-menu-item")
				.children("a:first")
				.addClass("ui-state-active");

			if (event && event.type === "keydown") {
				this._close();
			} else {
				this.timer = this._delay(function() {
					this._close();
				}, this.delay);
			}

			nested = item.children(".ui-menu");
			if (nested.length && (/^mouse/.test(event.type))) {
				this._startOpening(nested);
			}
			this.activeMenu = item.parent();

			this._trigger("focus", event, {
				item: item
			});
		},

		_scrollIntoView: function(item) {
			var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
			if (this._hasScroll()) {
				borderTop = parseFloat($.css(this.activeMenu[0], "borderTopWidth")) || 0;
				paddingTop = parseFloat($.css(this.activeMenu[0], "paddingTop")) || 0;
				offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
				scroll = this.activeMenu.scrollTop();
				elementHeight = this.activeMenu.height();
				itemHeight = item.height();

				if (offset < 0) {
					this.activeMenu.scrollTop(scroll + offset);
				} else if (offset + itemHeight > elementHeight) {
					this.activeMenu.scrollTop(scroll + offset - elementHeight + itemHeight);
				}
			}
		},

		blur: function(event, fromFocus) {
			if (!fromFocus) {
				clearTimeout(this.timer);
			}

			if (!this.active) {
				return;
			}

			this.active.children("a").removeClass("ui-state-focus");
			this.active = null;

			this._trigger("blur", event, {
				item: this.active
			});
		},

		_startOpening: function(submenu) {
			clearTimeout(this.timer);

			// Don't open if already open fixes a Firefox bug that caused a .5 pixel
			// shift in the submenu position when mousing over the carat icon
			if (submenu.attr("aria-hidden") !== "true") {
				return;
			}

			this.timer = this._delay(function() {
				this._close();
				this._open(submenu);
			}, this.delay);
		},

		_open: function(submenu) {
			var position = $.extend({
				of: this.active
			}, this.options.position);

			clearTimeout(this.timer);
			this.element.find(".ui-menu").not(submenu.parents(".ui-menu"))
				.hide()
				.attr("aria-hidden", "true");

			submenu
				.show()
				.removeAttr("aria-hidden")
				.attr("aria-expanded", "true")
				.position(position);
		},

		collapseAll: function(event, all) {
			clearTimeout(this.timer);
			this.timer = this._delay(function() {
				// If we were passed an event, look for the submenu that contains the event
				var currentMenu = all ? this.element :
					$(event && event.target).closest(this.element.find(".ui-menu"));

				// If we found no valid submenu ancestor, use the main menu to close all sub menus anyway
				if (!currentMenu.length) {
					currentMenu = this.element;
				}

				this._close(currentMenu);

				this.blur(event);
				this.activeMenu = currentMenu;
			}, this.delay);
		},

		// With no arguments, closes the currently active menu - if nothing is active
		// it closes all menus.  If passed an argument, it will search for menus BELOW
		_close: function(startMenu) {
			if (!startMenu) {
				startMenu = this.active ? this.active.parent() : this.element;
			}

			startMenu
				.find(".ui-menu")
				.hide()
				.attr("aria-hidden", "true")
				.attr("aria-expanded", "false")
				.end()
				.find("a.ui-state-active")
				.removeClass("ui-state-active");
		},

		collapse: function(event) {
			var newItem = this.active &&
				this.active.parent().closest(".ui-menu-item", this.element);
			if (newItem && newItem.length) {
				this._close();
				this.focus(event, newItem);
			}
		},

		expand: function(event) {
			var newItem = this.active &&
				this.active
				.children(".ui-menu ")
				.children(".ui-menu-item")
				.first();

			if (newItem && newItem.length) {
				this._open(newItem.parent());

				// Delay so Firefox will not hide activedescendant change in expanding submenu from AT
				this._delay(function() {
					this.focus(event, newItem);
				});
			}
		},

		next: function(event) {
			this._move("next", "first", event);
		},

		previous: function(event) {
			this._move("prev", "last", event);
		},

		isFirstItem: function() {
			return this.active && !this.active.prevAll(".ui-menu-item").length;
		},

		isLastItem: function() {
			return this.active && !this.active.nextAll(".ui-menu-item").length;
		},

		_move: function(direction, filter, event) {
			var next;
			if (this.active) {
				if (direction === "first" || direction === "last") {
					next = this.active[direction === "first" ? "prevAll" : "nextAll"](".ui-menu-item")
						.eq(-1);
				} else {
					next = this.active[direction + "All"](".ui-menu-item")
						.eq(0);
				}
			}
			if (!next || !next.length || !this.active) {
				next = this.activeMenu.children(".ui-menu-item")[filter]();
			}

			this.focus(event, next);
		},

		nextPage: function(event) {
			var item, base, height;

			if (!this.active) {
				this.next(event);
				return;
			}
			if (this.isLastItem()) {
				return;
			}
			if (this._hasScroll()) {
				base = this.active.offset().top;
				height = this.element.height();
				this.active.nextAll(".ui-menu-item").each(function() {
					item = $(this);
					return item.offset().top - base - height < 0;
				});

				this.focus(event, item);
			} else {
				this.focus(event, this.activeMenu.children(".ui-menu-item")[!this.active ? "first" : "last"]());
			}
		},

		previousPage: function(event) {
			var item, base, height;
			if (!this.active) {
				this.next(event);
				return;
			}
			if (this.isFirstItem()) {
				return;
			}
			if (this._hasScroll()) {
				base = this.active.offset().top;
				height = this.element.height();
				this.active.prevAll(".ui-menu-item").each(function() {
					item = $(this);
					return item.offset().top - base + height > 0;
				});

				this.focus(event, item);
			} else {
				this.focus(event, this.activeMenu.children(".ui-menu-item").first());
			}
		},

		_hasScroll: function() {
			return this.element.outerHeight() < this.element.prop("scrollHeight");
		},

		select: function(event) {
			// TODO: It should never be possible to not have an active item at this
			// point, but the tests don't trigger mouseenter before click.
			this.active = this.active || $(event.target).closest(".ui-menu-item");
			var ui = {
				item: this.active
			};
			if (!this.active.has(".ui-menu").length) {
				this.collapseAll(event, true);
			}
			this._trigger("select", event, ui);
		}
	});

}(jQuery));

(function($, undefined) {

	$.ui = $.ui || {};

	var cachedScrollbarWidth,
		max = Math.max,
		abs = Math.abs,
		round = Math.round,
		rhorizontal = /left|center|right/,
		rvertical = /top|center|bottom/,
		roffset = /[\+\-]\d+(\.[\d]+)?%?/,
		rposition = /^\w+/,
		rpercent = /%$/,
		_position = $.fn.position;

	function getOffsets(offsets, width, height) {
		return [
			parseFloat(offsets[0]) * (rpercent.test(offsets[0]) ? width / 100 : 1),
			parseFloat(offsets[1]) * (rpercent.test(offsets[1]) ? height / 100 : 1)
		];
	}

	function parseCss(element, property) {
		return parseInt($.css(element, property), 10) || 0;
	}

	function getDimensions(elem) {
		var raw = elem[0];
		if (raw.nodeType === 9) {
			return {
				width: elem.width(),
				height: elem.height(),
				offset: {
					top: 0,
					left: 0
				}
			};
		}
		if ($.isWindow(raw)) {
			return {
				width: elem.width(),
				height: elem.height(),
				offset: {
					top: elem.scrollTop(),
					left: elem.scrollLeft()
				}
			};
		}
		if (raw.preventDefault) {
			return {
				width: 0,
				height: 0,
				offset: {
					top: raw.pageY,
					left: raw.pageX
				}
			};
		}
		return {
			width: elem.outerWidth(),
			height: elem.outerHeight(),
			offset: elem.offset()
		};
	}

	$.position = {
		scrollbarWidth: function() {
			if (cachedScrollbarWidth !== undefined) {
				return cachedScrollbarWidth;
			}
			var w1, w2,
				div = $("<div style='display:block;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>"),
				innerDiv = div.children()[0];

			$("body").append(div);
			w1 = innerDiv.offsetWidth;
			div.css("overflow", "scroll");

			w2 = innerDiv.offsetWidth;

			if (w1 === w2) {
				w2 = div[0].clientWidth;
			}

			div.remove();

			return (cachedScrollbarWidth = w1 - w2);
		},
		getScrollInfo: function(within) {
			var overflowX = within.isWindow ? "" : within.element.css("overflow-x"),
				overflowY = within.isWindow ? "" : within.element.css("overflow-y"),
				hasOverflowX = overflowX === "scroll" ||
					(overflowX === "auto" && within.width < within.element[0].scrollWidth),
				hasOverflowY = overflowY === "scroll" ||
					(overflowY === "auto" && within.height < within.element[0].scrollHeight);
			return {
				width: hasOverflowY ? $.position.scrollbarWidth() : 0,
				height: hasOverflowX ? $.position.scrollbarWidth() : 0
			};
		},
		getWithinInfo: function(element) {
			var withinElement = $(element || window),
				isWindow = $.isWindow(withinElement[0]);
			return {
				element: withinElement,
				isWindow: isWindow,
				offset: withinElement.offset() || {
					left: 0,
					top: 0
				},
				scrollLeft: withinElement.scrollLeft(),
				scrollTop: withinElement.scrollTop(),
				width: isWindow ? withinElement.width() : withinElement.outerWidth(),
				height: isWindow ? withinElement.height() : withinElement.outerHeight()
			};
		}
	};

	$.fn.position = function(options) {
		if (!options || !options.of) {
			return _position.apply(this, arguments);
		}

		// make a copy, we don't want to modify arguments
		options = $.extend({}, options);

		var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
			target = $(options.of),
			within = $.position.getWithinInfo(options.within),
			scrollInfo = $.position.getScrollInfo(within),
			collision = (options.collision || "flip").split(" "),
			offsets = {};

		dimensions = getDimensions(target);
		if (target[0].preventDefault) {
			// force left top to allow flipping
			options.at = "left top";
		}
		targetWidth = dimensions.width;
		targetHeight = dimensions.height;
		targetOffset = dimensions.offset;
		// clone to reuse original targetOffset later
		basePosition = $.extend({}, targetOffset);

		// force my and at to have valid horizontal and vertical positions
		// if a value is missing or invalid, it will be converted to center
		$.each(["my", "at"], function() {
			var pos = (options[this] || "").split(" "),
				horizontalOffset,
				verticalOffset;

			if (pos.length === 1) {
				pos = rhorizontal.test(pos[0]) ?
					pos.concat(["center"]) :
					rvertical.test(pos[0]) ? ["center"].concat(pos) : ["center", "center"];
			}
			pos[0] = rhorizontal.test(pos[0]) ? pos[0] : "center";
			pos[1] = rvertical.test(pos[1]) ? pos[1] : "center";

			// calculate offsets
			horizontalOffset = roffset.exec(pos[0]);
			verticalOffset = roffset.exec(pos[1]);
			offsets[this] = [
				horizontalOffset ? horizontalOffset[0] : 0,
				verticalOffset ? verticalOffset[0] : 0
			];

			// reduce to just the positions without the offsets
			options[this] = [
				rposition.exec(pos[0])[0],
				rposition.exec(pos[1])[0]
			];
		});

		// normalize collision option
		if (collision.length === 1) {
			collision[1] = collision[0];
		}

		if (options.at[0] === "right") {
			basePosition.left += targetWidth;
		} else if (options.at[0] === "center") {
			basePosition.left += targetWidth / 2;
		}

		if (options.at[1] === "bottom") {
			basePosition.top += targetHeight;
		} else if (options.at[1] === "center") {
			basePosition.top += targetHeight / 2;
		}

		atOffset = getOffsets(offsets.at, targetWidth, targetHeight);
		basePosition.left += atOffset[0];
		basePosition.top += atOffset[1];

		return this.each(function() {
			var collisionPosition, using,
				elem = $(this),
				elemWidth = elem.outerWidth(),
				elemHeight = elem.outerHeight(),
				marginLeft = parseCss(this, "marginLeft"),
				marginTop = parseCss(this, "marginTop"),
				collisionWidth = elemWidth + marginLeft + parseCss(this, "marginRight") + scrollInfo.width,
				collisionHeight = elemHeight + marginTop + parseCss(this, "marginBottom") + scrollInfo.height,
				position = $.extend({}, basePosition),
				myOffset = getOffsets(offsets.my, elem.outerWidth(), elem.outerHeight());

			if (options.my[0] === "right") {
				position.left -= elemWidth;
			} else if (options.my[0] === "center") {
				position.left -= elemWidth / 2;
			}

			if (options.my[1] === "bottom") {
				position.top -= elemHeight;
			} else if (options.my[1] === "center") {
				position.top -= elemHeight / 2;
			}

			position.left += myOffset[0];
			position.top += myOffset[1];

			// if the browser doesn't support fractions, then round for consistent results
			if (!$.support.offsetFractions) {
				position.left = round(position.left);
				position.top = round(position.top);
			}

			collisionPosition = {
				marginLeft: marginLeft,
				marginTop: marginTop
			};

			$.each(["left", "top"], function(i, dir) {
				if ($.ui.position[collision[i]]) {
					$.ui.position[collision[i]][dir](position, {
						targetWidth: targetWidth,
						targetHeight: targetHeight,
						elemWidth: elemWidth,
						elemHeight: elemHeight,
						collisionPosition: collisionPosition,
						collisionWidth: collisionWidth,
						collisionHeight: collisionHeight,
						offset: [atOffset[0] + myOffset[0], atOffset[1] + myOffset[1]],
						my: options.my,
						at: options.at,
						within: within,
						elem: elem
					});
				}
			});

			if (options.using) {
				// adds feedback as second argument to using callback, if present
				using = function(props) {
					var left = targetOffset.left - position.left,
						right = left + targetWidth - elemWidth,
						top = targetOffset.top - position.top,
						bottom = top + targetHeight - elemHeight,
						feedback = {
							target: {
								element: target,
								left: targetOffset.left,
								top: targetOffset.top,
								width: targetWidth,
								height: targetHeight
							},
							element: {
								element: elem,
								left: position.left,
								top: position.top,
								width: elemWidth,
								height: elemHeight
							},
							horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
							vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
						};
					if (targetWidth < elemWidth && abs(left + right) < targetWidth) {
						feedback.horizontal = "center";
					}
					if (targetHeight < elemHeight && abs(top + bottom) < targetHeight) {
						feedback.vertical = "middle";
					}
					if (max(abs(left), abs(right)) > max(abs(top), abs(bottom))) {
						feedback.important = "horizontal";
					} else {
						feedback.important = "vertical";
					}
					options.using.call(this, props, feedback);
				};
			}

			elem.offset($.extend(position, {
				using: using
			}));
		});
	};

	$.ui.position = {
		fit: {
			left: function(position, data) {
				var within = data.within,
					withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
					outerWidth = within.width,
					collisionPosLeft = position.left - data.collisionPosition.marginLeft,
					overLeft = withinOffset - collisionPosLeft,
					overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
					newOverRight;

				// element is wider than within
				if (data.collisionWidth > outerWidth) {
					// element is initially over the left side of within
					if (overLeft > 0 && overRight <= 0) {
						newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset;
						position.left += overLeft - newOverRight;
						// element is initially over right side of within
					} else if (overRight > 0 && overLeft <= 0) {
						position.left = withinOffset;
						// element is initially over both left and right sides of within
					} else {
						if (overLeft > overRight) {
							position.left = withinOffset + outerWidth - data.collisionWidth;
						} else {
							position.left = withinOffset;
						}
					}
					// too far left -> align with left edge
				} else if (overLeft > 0) {
					position.left += overLeft;
					// too far right -> align with right edge
				} else if (overRight > 0) {
					position.left -= overRight;
					// adjust based on position and margin
				} else {
					position.left = max(position.left - collisionPosLeft, position.left);
				}
			},
			top: function(position, data) {
				var within = data.within,
					withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
					outerHeight = data.within.height,
					collisionPosTop = position.top - data.collisionPosition.marginTop,
					overTop = withinOffset - collisionPosTop,
					overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
					newOverBottom;

				// element is taller than within
				if (data.collisionHeight > outerHeight) {
					// element is initially over the top of within
					if (overTop > 0 && overBottom <= 0) {
						newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset;
						position.top += overTop - newOverBottom;
						// element is initially over bottom of within
					} else if (overBottom > 0 && overTop <= 0) {
						position.top = withinOffset;
						// element is initially over both top and bottom of within
					} else {
						if (overTop > overBottom) {
							position.top = withinOffset + outerHeight - data.collisionHeight;
						} else {
							position.top = withinOffset;
						}
					}
					// too far up -> align with top
				} else if (overTop > 0) {
					position.top += overTop;
					// too far down -> align with bottom edge
				} else if (overBottom > 0) {
					position.top -= overBottom;
					// adjust based on position and margin
				} else {
					position.top = max(position.top - collisionPosTop, position.top);
				}
			}
		},
		flip: {
			left: function(position, data) {
				var within = data.within,
					withinOffset = within.offset.left + within.scrollLeft,
					outerWidth = within.width,
					offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
					collisionPosLeft = position.left - data.collisionPosition.marginLeft,
					overLeft = collisionPosLeft - offsetLeft,
					overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
					myOffset = data.my[0] === "left" ? -data.elemWidth :
						data.my[0] === "right" ?
						data.elemWidth :
						0,
					atOffset = data.at[0] === "left" ?
						data.targetWidth :
						data.at[0] === "right" ? -data.targetWidth :
						0,
					offset = -2 * data.offset[0],
					newOverRight,
					newOverLeft;

				if (overLeft < 0) {
					newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset;
					if (newOverRight < 0 || newOverRight < abs(overLeft)) {
						position.left += myOffset + atOffset + offset;
					}
				} else if (overRight > 0) {
					newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft;
					if (newOverLeft > 0 || abs(newOverLeft) < overRight) {
						position.left += myOffset + atOffset + offset;
					}
				}
			},
			top: function(position, data) {
				var within = data.within,
					withinOffset = within.offset.top + within.scrollTop,
					outerHeight = within.height,
					offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
					collisionPosTop = position.top - data.collisionPosition.marginTop,
					overTop = collisionPosTop - offsetTop,
					overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
					top = data.my[1] === "top",
					myOffset = top ? -data.elemHeight :
						data.my[1] === "bottom" ?
						data.elemHeight :
						0,
					atOffset = data.at[1] === "top" ?
						data.targetHeight :
						data.at[1] === "bottom" ? -data.targetHeight :
						0,
					offset = -2 * data.offset[1],
					newOverTop,
					newOverBottom;
				if (overTop < 0) {
					newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset;
					if ((position.top + myOffset + atOffset + offset) > overTop && (newOverBottom < 0 || newOverBottom < abs(overTop))) {
						position.top += myOffset + atOffset + offset;
					}
				} else if (overBottom > 0) {
					newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop;
					if ((position.top + myOffset + atOffset + offset) > overBottom && (newOverTop > 0 || abs(newOverTop) < overBottom)) {
						position.top += myOffset + atOffset + offset;
					}
				}
			}
		},
		flipfit: {
			left: function() {
				$.ui.position.flip.left.apply(this, arguments);
				$.ui.position.fit.left.apply(this, arguments);
			},
			top: function() {
				$.ui.position.flip.top.apply(this, arguments);
				$.ui.position.fit.top.apply(this, arguments);
			}
		}
	};

	// fraction support test
	(function() {
		var testElement, testElementParent, testElementStyle, offsetLeft, i,
			body = document.getElementsByTagName("body")[0],
			div = document.createElement("div");

		//Create a "fake body" for testing based on method used in jQuery.support
		testElement = document.createElement(body ? "div" : "body");
		testElementStyle = {
			visibility: "hidden",
			width: 0,
			height: 0,
			border: 0,
			margin: 0,
			background: "none"
		};
		if (body) {
			$.extend(testElementStyle, {
				position: "absolute",
				left: "-1000px",
				top: "-1000px"
			});
		}
		for (i in testElementStyle) {
			testElement.style[i] = testElementStyle[i];
		}
		testElement.appendChild(div);
		testElementParent = body || document.documentElement;
		testElementParent.insertBefore(testElement, testElementParent.firstChild);

		div.style.cssText = "position: absolute; left: 10.7432222px;";

		offsetLeft = $(div).offset().left;
		$.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11;

		testElement.innerHTML = "";
		testElementParent.removeChild(testElement);
	})();

}(jQuery));

(function($, undefined) {

	$.widget("ui.progressbar", {
		version: "1.10.3",
		options: {
			max: 100,
			value: 0,

			change: null,
			complete: null
		},

		min: 0,

		_create: function() {
			// Constrain initial value
			this.oldValue = this.options.value = this._constrainedValue();

			this.element
				.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all")
				.attr({
					// Only set static values, aria-valuenow and aria-valuemax are
					// set inside _refreshValue()
					role: "progressbar",
					"aria-valuemin": this.min
				});

			this.valueDiv = $("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>")
				.appendTo(this.element);

			this._refreshValue();
		},

		_destroy: function() {
			this.element
				.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all")
				.removeAttr("role")
				.removeAttr("aria-valuemin")
				.removeAttr("aria-valuemax")
				.removeAttr("aria-valuenow");

			this.valueDiv.remove();
		},

		value: function(newValue) {
			if (newValue === undefined) {
				return this.options.value;
			}

			this.options.value = this._constrainedValue(newValue);
			this._refreshValue();
		},

		_constrainedValue: function(newValue) {
			if (newValue === undefined) {
				newValue = this.options.value;
			}

			this.indeterminate = newValue === false;

			// sanitize value
			if (typeof newValue !== "number") {
				newValue = 0;
			}

			return this.indeterminate ? false :
				Math.min(this.options.max, Math.max(this.min, newValue));
		},

		_setOptions: function(options) {
			// Ensure "value" option is set after other values (like max)
			var value = options.value;
			delete options.value;

			this._super(options);

			this.options.value = this._constrainedValue(value);
			this._refreshValue();
		},

		_setOption: function(key, value) {
			if (key === "max") {
				// Don't allow a max less than min
				value = Math.max(this.min, value);
			}

			this._super(key, value);
		},

		_percentage: function() {
			return this.indeterminate ? 100 : 100 * (this.options.value - this.min) / (this.options.max - this.min);
		},

		_refreshValue: function() {
			var value = this.options.value,
				percentage = this._percentage();

			this.valueDiv
				.toggle(this.indeterminate || value > this.min)
				.toggleClass("ui-corner-right", value === this.options.max)
				.width(percentage.toFixed(0) + "%");

			this.element.toggleClass("ui-progressbar-indeterminate", this.indeterminate);

			if (this.indeterminate) {
				this.element.removeAttr("aria-valuenow");
				if (!this.overlayDiv) {
					this.overlayDiv = $("<div class='ui-progressbar-overlay'></div>").appendTo(this.valueDiv);
				}
			} else {
				this.element.attr({
					"aria-valuemax": this.options.max,
					"aria-valuenow": value
				});
				if (this.overlayDiv) {
					this.overlayDiv.remove();
					this.overlayDiv = null;
				}
			}

			if (this.oldValue !== value) {
				this.oldValue = value;
				this._trigger("change");
			}
			if (value === this.options.max) {
				this._trigger("complete");
			}
		}
	});

})(jQuery);

(function($, undefined) {

	// number of pages in a slider
	// (how many times can you page up/down to go through the whole range)
	var numPages = 5;

	$.widget("ui.slider", $.ui.mouse, {
		version: "1.10.3",
		widgetEventPrefix: "slide",

		options: {
			animate: false,
			distance: 0,
			max: 100,
			min: 0,
			orientation: "horizontal",
			range: false,
			step: 1,
			value: 0,
			values: null,

			// callbacks
			change: null,
			slide: null,
			start: null,
			stop: null
		},

		_create: function() {
			this._keySliding = false;
			this._mouseSliding = false;
			this._animateOff = true;
			this._handleIndex = null;
			this._detectOrientation();
			this._mouseInit();

			this.element
				.addClass("ui-slider" +
					" ui-slider-" + this.orientation +
					" ui-widget" +
					" ui-widget-content" +
					" ui-corner-all");

			this._refresh();
			this._setOption("disabled", this.options.disabled);

			this._animateOff = false;
		},

		_refresh: function() {
			this._createRange();
			this._createHandles();
			this._setupEvents();
			this._refreshValue();
		},

		_createHandles: function() {
			var i, handleCount,
				options = this.options,
				existingHandles = this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),
				handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
				handles = [];

			handleCount = (options.values && options.values.length) || 1;

			if (existingHandles.length > handleCount) {
				existingHandles.slice(handleCount).remove();
				existingHandles = existingHandles.slice(0, handleCount);
			}

			for (i = existingHandles.length; i < handleCount; i++) {
				handles.push(handle);
			}

			this.handles = existingHandles.add($(handles.join("")).appendTo(this.element));

			this.handle = this.handles.eq(0);

			this.handles.each(function(i) {
				$(this).data("ui-slider-handle-index", i);
			});
		},

		_createRange: function() {
			var options = this.options,
				classes = "";

			if (options.range) {
				if (options.range === true) {
					if (!options.values) {
						options.values = [this._valueMin(), this._valueMin()];
					} else if (options.values.length && options.values.length !== 2) {
						options.values = [options.values[0], options.values[0]];
					} else if ($.isArray(options.values)) {
						options.values = options.values.slice(0);
					}
				}

				if (!this.range || !this.range.length) {
					this.range = $("<div></div>")
						.appendTo(this.element);

					classes = "ui-slider-range" +
					// note: this isn't the most fittingly semantic framework class for this element,
					// but worked best visually with a variety of themes
					" ui-widget-header ui-corner-all";
				} else {
					this.range.removeClass("ui-slider-range-min ui-slider-range-max")
					// Handle range switching from true to min/max
					.css({
						"left": "",
						"bottom": ""
					});
				}

				this.range.addClass(classes +
					((options.range === "min" || options.range === "max") ? " ui-slider-range-" + options.range : ""));
			} else {
				this.range = $([]);
			}
		},

		_setupEvents: function() {
			var elements = this.handles.add(this.range).filter("a");
			this._off(elements);
			this._on(elements, this._handleEvents);
			this._hoverable(elements);
			this._focusable(elements);
		},

		_destroy: function() {
			this.handles.remove();
			this.range.remove();

			this.element
				.removeClass("ui-slider" +
					" ui-slider-horizontal" +
					" ui-slider-vertical" +
					" ui-widget" +
					" ui-widget-content" +
					" ui-corner-all");

			this._mouseDestroy();
		},

		_mouseCapture: function(event) {
			var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
				that = this,
				o = this.options;

			if (o.disabled) {
				return false;
			}

			this.elementSize = {
				width: this.element.outerWidth(),
				height: this.element.outerHeight()
			};
			this.elementOffset = this.element.offset();

			position = {
				x: event.pageX,
				y: event.pageY
			};
			normValue = this._normValueFromMouse(position);
			distance = this._valueMax() - this._valueMin() + 1;
			this.handles.each(function(i) {
				var thisDistance = Math.abs(normValue - that.values(i));
				if ((distance > thisDistance) ||
					(distance === thisDistance &&
						(i === that._lastChangedValue || that.values(i) === o.min))) {
					distance = thisDistance;
					closestHandle = $(this);
					index = i;
				}
			});

			allowed = this._start(event, index);
			if (allowed === false) {
				return false;
			}
			this._mouseSliding = true;

			this._handleIndex = index;

			closestHandle
				.addClass("ui-state-active")
				.focus();

			offset = closestHandle.offset();
			mouseOverHandle = !$(event.target).parents().addBack().is(".ui-slider-handle");
			this._clickOffset = mouseOverHandle ? {
				left: 0,
				top: 0
			} : {
				left: event.pageX - offset.left - (closestHandle.width() / 2),
				top: event.pageY - offset.top - (closestHandle.height() / 2) - (parseInt(closestHandle.css("borderTopWidth"), 10) || 0) - (parseInt(closestHandle.css("borderBottomWidth"), 10) || 0) + (parseInt(closestHandle.css("marginTop"), 10) || 0)
			};

			if (!this.handles.hasClass("ui-state-hover")) {
				this._slide(event, index, normValue);
			}
			this._animateOff = true;
			return true;
		},

		_mouseStart: function() {
			return true;
		},

		_mouseDrag: function(event) {
			var position = {
				x: event.pageX,
				y: event.pageY
			},
				normValue = this._normValueFromMouse(position);

			this._slide(event, this._handleIndex, normValue);

			return false;
		},

		_mouseStop: function(event) {
			this.handles.removeClass("ui-state-active");
			this._mouseSliding = false;

			this._stop(event, this._handleIndex);
			this._change(event, this._handleIndex);

			this._handleIndex = null;
			this._clickOffset = null;
			this._animateOff = false;

			return false;
		},

		_detectOrientation: function() {
			this.orientation = (this.options.orientation === "vertical") ? "vertical" : "horizontal";
		},

		_normValueFromMouse: function(position) {
			var pixelTotal,
				pixelMouse,
				percentMouse,
				valueTotal,
				valueMouse;

			if (this.orientation === "horizontal") {
				pixelTotal = this.elementSize.width;
				pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
			} else {
				pixelTotal = this.elementSize.height;
				pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
			}

			percentMouse = (pixelMouse / pixelTotal);
			if (percentMouse > 1) {
				percentMouse = 1;
			}
			if (percentMouse < 0) {
				percentMouse = 0;
			}
			if (this.orientation === "vertical") {
				percentMouse = 1 - percentMouse;
			}

			valueTotal = this._valueMax() - this._valueMin();
			valueMouse = this._valueMin() + percentMouse * valueTotal;

			return this._trimAlignValue(valueMouse);
		},

		_start: function(event, index) {
			var uiHash = {
				handle: this.handles[index],
				value: this.value()
			};
			if (this.options.values && this.options.values.length) {
				uiHash.value = this.values(index);
				uiHash.values = this.values();
			}
			return this._trigger("start", event, uiHash);
		},

		_slide: function(event, index, newVal) {
			var otherVal,
				newValues,
				allowed;

			if (this.options.values && this.options.values.length) {
				otherVal = this.values(index ? 0 : 1);

				if ((this.options.values.length === 2 && this.options.range === true) &&
					((index === 0 && newVal > otherVal) || (index === 1 && newVal < otherVal))
				) {
					newVal = otherVal;
				}

				if (newVal !== this.values(index)) {
					newValues = this.values();
					newValues[index] = newVal;
					// A slide can be canceled by returning false from the slide callback
					allowed = this._trigger("slide", event, {
						handle: this.handles[index],
						value: newVal,
						values: newValues
					});
					otherVal = this.values(index ? 0 : 1);
					if (allowed !== false) {
						this.values(index, newVal, true);
					}
				}
			} else {
				if (newVal !== this.value()) {
					// A slide can be canceled by returning false from the slide callback
					allowed = this._trigger("slide", event, {
						handle: this.handles[index],
						value: newVal
					});
					if (allowed !== false) {
						this.value(newVal);
					}
				}
			}
		},

		_stop: function(event, index) {
			var uiHash = {
				handle: this.handles[index],
				value: this.value()
			};
			if (this.options.values && this.options.values.length) {
				uiHash.value = this.values(index);
				uiHash.values = this.values();
			}

			this._trigger("stop", event, uiHash);
		},

		_change: function(event, index) {
			if (!this._keySliding && !this._mouseSliding) {
				var uiHash = {
					handle: this.handles[index],
					value: this.value()
				};
				if (this.options.values && this.options.values.length) {
					uiHash.value = this.values(index);
					uiHash.values = this.values();
				}

				//store the last changed value index for reference when handles overlap
				this._lastChangedValue = index;

				this._trigger("change", event, uiHash);
			}
		},

		value: function(newValue) {
			if (arguments.length) {
				this.options.value = this._trimAlignValue(newValue);
				this._refreshValue();
				this._change(null, 0);
				return;
			}

			return this._value();
		},

		values: function(index, newValue) {
			var vals,
				newValues,
				i;

			if (arguments.length > 1) {
				this.options.values[index] = this._trimAlignValue(newValue);
				this._refreshValue();
				this._change(null, index);
				return;
			}

			if (arguments.length) {
				if ($.isArray(arguments[0])) {
					vals = this.options.values;
					newValues = arguments[0];
					for (i = 0; i < vals.length; i += 1) {
						vals[i] = this._trimAlignValue(newValues[i]);
						this._change(null, i);
					}
					this._refreshValue();
				} else {
					if (this.options.values && this.options.values.length) {
						return this._values(index);
					} else {
						return this.value();
					}
				}
			} else {
				return this._values();
			}
		},

		_setOption: function(key, value) {
			var i,
				valsLength = 0;

			if (key === "range" && this.options.range === true) {
				if (value === "min") {
					this.options.value = this._values(0);
					this.options.values = null;
				} else if (value === "max") {
					this.options.value = this._values(this.options.values.length - 1);
					this.options.values = null;
				}
			}

			if ($.isArray(this.options.values)) {
				valsLength = this.options.values.length;
			}

			$.Widget.prototype._setOption.apply(this, arguments);

			switch (key) {
				case "orientation":
					this._detectOrientation();
					this.element
						.removeClass("ui-slider-horizontal ui-slider-vertical")
						.addClass("ui-slider-" + this.orientation);
					this._refreshValue();
					break;
				case "value":
					this._animateOff = true;
					this._refreshValue();
					this._change(null, 0);
					this._animateOff = false;
					break;
				case "values":
					this._animateOff = true;
					this._refreshValue();
					for (i = 0; i < valsLength; i += 1) {
						this._change(null, i);
					}
					this._animateOff = false;
					break;
				case "min":
				case "max":
					this._animateOff = true;
					this._refreshValue();
					this._animateOff = false;
					break;
				case "range":
					this._animateOff = true;
					this._refresh();
					this._animateOff = false;
					break;
			}
		},

		//internal value getter
		// _value() returns value trimmed by min and max, aligned by step
		_value: function() {
			var val = this.options.value;
			val = this._trimAlignValue(val);

			return val;
		},

		//internal values getter
		// _values() returns array of values trimmed by min and max, aligned by step
		// _values( index ) returns single value trimmed by min and max, aligned by step
		_values: function(index) {
			var val,
				vals,
				i;

			if (arguments.length) {
				val = this.options.values[index];
				val = this._trimAlignValue(val);

				return val;
			} else if (this.options.values && this.options.values.length) {
				// .slice() creates a copy of the array
				// this copy gets trimmed by min and max and then returned
				vals = this.options.values.slice();
				for (i = 0; i < vals.length; i += 1) {
					vals[i] = this._trimAlignValue(vals[i]);
				}

				return vals;
			} else {
				return [];
			}
		},

		// returns the step-aligned value that val is closest to, between (inclusive) min and max
		_trimAlignValue: function(val) {
			if (val <= this._valueMin()) {
				return this._valueMin();
			}
			if (val >= this._valueMax()) {
				return this._valueMax();
			}
			var step = (this.options.step > 0) ? this.options.step : 1,
				valModStep = (val - this._valueMin()) % step,
				alignValue = val - valModStep;

			if (Math.abs(valModStep) * 2 >= step) {
				alignValue += (valModStep > 0) ? step : (-step);
			}

			// Since JavaScript has problems with large floats, round
			// the final value to 5 digits after the decimal point (see #4124)
			return parseFloat(alignValue.toFixed(5));
		},

		_valueMin: function() {
			return this.options.min;
		},

		_valueMax: function() {
			return this.options.max;
		},

		_refreshValue: function() {
			var lastValPercent, valPercent, value, valueMin, valueMax,
				oRange = this.options.range,
				o = this.options,
				that = this,
				animate = (!this._animateOff) ? o.animate : false,
				_set = {};

			if (this.options.values && this.options.values.length) {
				this.handles.each(function(i) {
					valPercent = (that.values(i) - that._valueMin()) / (that._valueMax() - that._valueMin()) * 100;
					_set[that.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%";
					$(this).stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);
					if (that.options.range === true) {
						if (that.orientation === "horizontal") {
							if (i === 0) {
								that.range.stop(1, 1)[animate ? "animate" : "css"]({
									left: valPercent + "%"
								}, o.animate);
							}
							if (i === 1) {
								that.range[animate ? "animate" : "css"]({
									width: (valPercent - lastValPercent) + "%"
								}, {
									queue: false,
									duration: o.animate
								});
							}
						} else {
							if (i === 0) {
								that.range.stop(1, 1)[animate ? "animate" : "css"]({
									bottom: (valPercent) + "%"
								}, o.animate);
							}
							if (i === 1) {
								that.range[animate ? "animate" : "css"]({
									height: (valPercent - lastValPercent) + "%"
								}, {
									queue: false,
									duration: o.animate
								});
							}
						}
					}
					lastValPercent = valPercent;
				});
			} else {
				value = this.value();
				valueMin = this._valueMin();
				valueMax = this._valueMax();
				valPercent = (valueMax !== valueMin) ?
					(value - valueMin) / (valueMax - valueMin) * 100 :
					0;
				_set[this.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%";
				this.handle.stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);

				if (oRange === "min" && this.orientation === "horizontal") {
					this.range.stop(1, 1)[animate ? "animate" : "css"]({
						width: valPercent + "%"
					}, o.animate);
				}
				if (oRange === "max" && this.orientation === "horizontal") {
					this.range[animate ? "animate" : "css"]({
						width: (100 - valPercent) + "%"
					}, {
						queue: false,
						duration: o.animate
					});
				}
				if (oRange === "min" && this.orientation === "vertical") {
					this.range.stop(1, 1)[animate ? "animate" : "css"]({
						height: valPercent + "%"
					}, o.animate);
				}
				if (oRange === "max" && this.orientation === "vertical") {
					this.range[animate ? "animate" : "css"]({
						height: (100 - valPercent) + "%"
					}, {
						queue: false,
						duration: o.animate
					});
				}
			}
		},

		_handleEvents: {
			keydown: function(event) {
				/*jshint maxcomplexity:25*/
				var allowed, curVal, newVal, step,
					index = $(event.target).data("ui-slider-handle-index");

				switch (event.keyCode) {
					case $.ui.keyCode.HOME:
					case $.ui.keyCode.END:
					case $.ui.keyCode.PAGE_UP:
					case $.ui.keyCode.PAGE_DOWN:
					case $.ui.keyCode.UP:
					case $.ui.keyCode.RIGHT:
					case $.ui.keyCode.DOWN:
					case $.ui.keyCode.LEFT:
						event.preventDefault();
						if (!this._keySliding) {
							this._keySliding = true;
							$(event.target).addClass("ui-state-active");
							allowed = this._start(event, index);
							if (allowed === false) {
								return;
							}
						}
						break;
				}

				step = this.options.step;
				if (this.options.values && this.options.values.length) {
					curVal = newVal = this.values(index);
				} else {
					curVal = newVal = this.value();
				}

				switch (event.keyCode) {
					case $.ui.keyCode.HOME:
						newVal = this._valueMin();
						break;
					case $.ui.keyCode.END:
						newVal = this._valueMax();
						break;
					case $.ui.keyCode.PAGE_UP:
						newVal = this._trimAlignValue(curVal + ((this._valueMax() - this._valueMin()) / numPages));
						break;
					case $.ui.keyCode.PAGE_DOWN:
						newVal = this._trimAlignValue(curVal - ((this._valueMax() - this._valueMin()) / numPages));
						break;
					case $.ui.keyCode.UP:
					case $.ui.keyCode.RIGHT:
						if (curVal === this._valueMax()) {
							return;
						}
						newVal = this._trimAlignValue(curVal + step);
						break;
					case $.ui.keyCode.DOWN:
					case $.ui.keyCode.LEFT:
						if (curVal === this._valueMin()) {
							return;
						}
						newVal = this._trimAlignValue(curVal - step);
						break;
				}

				this._slide(event, index, newVal);
			},
			click: function(event) {
				event.preventDefault();
			},
			keyup: function(event) {
				var index = $(event.target).data("ui-slider-handle-index");

				if (this._keySliding) {
					this._keySliding = false;
					this._stop(event, index);
					this._change(event, index);
					$(event.target).removeClass("ui-state-active");
				}
			}
		}

	});

}(jQuery));

(function($) {

	function modifier(fn) {
		return function() {
			var previous = this.element.val();
			fn.apply(this, arguments);
			this._refresh();
			if (previous !== this.element.val()) {
				this._trigger("change");
			}
		};
	}

	$.widget("ui.spinner", {
		version: "1.10.3",
		defaultElement: "<input>",
		widgetEventPrefix: "spin",
		options: {
			culture: null,
			icons: {
				down: "ui-icon-triangle-1-s",
				up: "ui-icon-triangle-1-n"
			},
			incremental: true,
			max: null,
			min: null,
			numberFormat: null,
			page: 10,
			step: 1,

			change: null,
			spin: null,
			start: null,
			stop: null
		},

		_create: function() {
			// handle string values that need to be parsed
			this._setOption("max", this.options.max);
			this._setOption("min", this.options.min);
			this._setOption("step", this.options.step);

			// format the value, but don't constrain
			this._value(this.element.val(), true);

			this._draw();
			this._on(this._events);
			this._refresh();

			// turning off autocomplete prevents the browser from remembering the
			// value when navigating through history, so we re-enable autocomplete
			// if the page is unloaded before the widget is destroyed. #7790
			this._on(this.window, {
				beforeunload: function() {
					this.element.removeAttr("autocomplete");
				}
			});
		},

		_getCreateOptions: function() {
			var options = {},
				element = this.element;

			$.each(["min", "max", "step"], function(i, option) {
				var value = element.attr(option);
				if (value !== undefined && value.length) {
					options[option] = value;
				}
			});

			return options;
		},

		_events: {
			keydown: function(event) {
				if (this._start(event) && this._keydown(event)) {
					event.preventDefault();
				}
			},
			keyup: "_stop",
			focus: function() {
				this.previous = this.element.val();
			},
			blur: function(event) {
				if (this.cancelBlur) {
					delete this.cancelBlur;
					return;
				}

				this._stop();
				this._refresh();
				if (this.previous !== this.element.val()) {
					this._trigger("change", event);
				}
			},
			mousewheel: function(event, delta) {
				if (!delta) {
					return;
				}
				if (!this.spinning && !this._start(event)) {
					return false;
				}

				this._spin((delta > 0 ? 1 : -1) * this.options.step, event);
				clearTimeout(this.mousewheelTimer);
				this.mousewheelTimer = this._delay(function() {
					if (this.spinning) {
						this._stop(event);
					}
				}, 100);
				event.preventDefault();
			},
			"mousedown .ui-spinner-button": function(event) {
				var previous;

				// We never want the buttons to have focus; whenever the user is
				// interacting with the spinner, the focus should be on the input.
				// If the input is focused then this.previous is properly set from
				// when the input first received focus. If the input is not focused
				// then we need to set this.previous based on the value before spinning.
				previous = this.element[0] === this.document[0].activeElement ?
					this.previous : this.element.val();

				function checkFocus() {
					var isActive = this.element[0] === this.document[0].activeElement;
					if (!isActive) {
						this.element.focus();
						this.previous = previous;
						// support: IE
						// IE sets focus asynchronously, so we need to check if focus
						// moved off of the input because the user clicked on the button.
						this._delay(function() {
							this.previous = previous;
						});
					}
				}

				// ensure focus is on (or stays on) the text field
				event.preventDefault();
				checkFocus.call(this);

				// support: IE
				// IE doesn't prevent moving focus even with event.preventDefault()
				// so we set a flag to know when we should ignore the blur event
				// and check (again) if focus moved off of the input.
				this.cancelBlur = true;
				this._delay(function() {
					delete this.cancelBlur;
					checkFocus.call(this);
				});

				if (this._start(event) === false) {
					return;
				}

				this._repeat(null, $(event.currentTarget).hasClass("ui-spinner-up") ? 1 : -1, event);
			},
			"mouseup .ui-spinner-button": "_stop",
			"mouseenter .ui-spinner-button": function(event) {
				// button will add ui-state-active if mouse was down while mouseleave and kept down
				if (!$(event.currentTarget).hasClass("ui-state-active")) {
					return;
				}

				if (this._start(event) === false) {
					return false;
				}
				this._repeat(null, $(event.currentTarget).hasClass("ui-spinner-up") ? 1 : -1, event);
			},
			// TODO: do we really want to consider this a stop?
			// shouldn't we just stop the repeater and wait until mouseup before
			// we trigger the stop event?
			"mouseleave .ui-spinner-button": "_stop"
		},

		_draw: function() {
			var uiSpinner = this.uiSpinner = this.element
				.addClass("ui-spinner-input")
				.attr("autocomplete", "off")
				.wrap(this._uiSpinnerHtml())
				.parent()
			// add buttons
			.append(this._buttonHtml());

			this.element.attr("role", "spinbutton");

			// button bindings
			this.buttons = uiSpinner.find(".ui-spinner-button")
				.attr("tabIndex", -1)
				.button()
				.removeClass("ui-corner-all");

			// IE 6 doesn't understand height: 50% for the buttons
			// unless the wrapper has an explicit height
			if (this.buttons.height() > Math.ceil(uiSpinner.height() * 0.5) &&
				uiSpinner.height() > 0) {
				uiSpinner.height(uiSpinner.height());
			}

			// disable spinner if element was already disabled
			if (this.options.disabled) {
				this.disable();
			}
		},

		_keydown: function(event) {
			var options = this.options,
				keyCode = $.ui.keyCode;

			switch (event.keyCode) {
				case keyCode.UP:
					this._repeat(null, 1, event);
					return true;
				case keyCode.DOWN:
					this._repeat(null, -1, event);
					return true;
				case keyCode.PAGE_UP:
					this._repeat(null, options.page, event);
					return true;
				case keyCode.PAGE_DOWN:
					this._repeat(null, -options.page, event);
					return true;
			}

			return false;
		},

		_uiSpinnerHtml: function() {
			return "<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>";
		},

		_buttonHtml: function() {
			return "" +
				"<a class='ui-spinner-button ui-spinner-up ui-corner-tr'>" +
				"<span class='ui-icon " + this.options.icons.up + "'>&#9650;</span>" +
				"</a>" +
				"<a class='ui-spinner-button ui-spinner-down ui-corner-br'>" +
				"<span class='ui-icon " + this.options.icons.down + "'>&#9660;</span>" +
				"</a>";
		},

		_start: function(event) {
			if (!this.spinning && this._trigger("start", event) === false) {
				return false;
			}

			if (!this.counter) {
				this.counter = 1;
			}
			this.spinning = true;
			return true;
		},

		_repeat: function(i, steps, event) {
			i = i || 500;

			clearTimeout(this.timer);
			this.timer = this._delay(function() {
				this._repeat(40, steps, event);
			}, i);

			this._spin(steps * this.options.step, event);
		},

		_spin: function(step, event) {
			var value = this.value() || 0;

			if (!this.counter) {
				this.counter = 1;
			}

			value = this._adjustValue(value + step * this._increment(this.counter));

			if (!this.spinning || this._trigger("spin", event, {
				value: value
			}) !== false) {
				this._value(value);
				this.counter++;
			}
		},

		_increment: function(i) {
			var incremental = this.options.incremental;

			if (incremental) {
				return $.isFunction(incremental) ?
					incremental(i) :
					Math.floor(i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1);
			}

			return 1;
		},

		_precision: function() {
			var precision = this._precisionOf(this.options.step);
			if (this.options.min !== null) {
				precision = Math.max(precision, this._precisionOf(this.options.min));
			}
			return precision;
		},

		_precisionOf: function(num) {
			var str = num.toString(),
				decimal = str.indexOf(".");
			return decimal === -1 ? 0 : str.length - decimal - 1;
		},

		_adjustValue: function(value) {
			var base, aboveMin,
				options = this.options;

			// make sure we're at a valid step
			// - find out where we are relative to the base (min or 0)
			base = options.min !== null ? options.min : 0;
			aboveMin = value - base;
			// - round to the nearest step
			aboveMin = Math.round(aboveMin / options.step) * options.step;
			// - rounding is based on 0, so adjust back to our base
			value = base + aboveMin;

			// fix precision from bad JS floating point math
			value = parseFloat(value.toFixed(this._precision()));

			// clamp the value
			if (options.max !== null && value > options.max) {
				return options.max;
			}
			if (options.min !== null && value < options.min) {
				return options.min;
			}

			return value;
		},

		_stop: function(event) {
			if (!this.spinning) {
				return;
			}

			clearTimeout(this.timer);
			clearTimeout(this.mousewheelTimer);
			this.counter = 0;
			this.spinning = false;
			this._trigger("stop", event);
		},

		_setOption: function(key, value) {
			if (key === "culture" || key === "numberFormat") {
				var prevValue = this._parse(this.element.val());
				this.options[key] = value;
				this.element.val(this._format(prevValue));
				return;
			}

			if (key === "max" || key === "min" || key === "step") {
				if (typeof value === "string") {
					value = this._parse(value);
				}
			}
			if (key === "icons") {
				this.buttons.first().find(".ui-icon")
					.removeClass(this.options.icons.up)
					.addClass(value.up);
				this.buttons.last().find(".ui-icon")
					.removeClass(this.options.icons.down)
					.addClass(value.down);
			}

			this._super(key, value);

			if (key === "disabled") {
				if (value) {
					this.element.prop("disabled", true);
					this.buttons.button("disable");
				} else {
					this.element.prop("disabled", false);
					this.buttons.button("enable");
				}
			}
		},

		_setOptions: modifier(function(options) {
			this._super(options);
			this._value(this.element.val());
		}),

		_parse: function(val) {
			if (typeof val === "string" && val !== "") {
				val = window.Globalize && this.options.numberFormat ?
					Globalize.parseFloat(val, 10, this.options.culture) : +val;
			}
			return val === "" || isNaN(val) ? null : val;
		},

		_format: function(value) {
			if (value === "") {
				return "";
			}
			return window.Globalize && this.options.numberFormat ?
				Globalize.format(value, this.options.numberFormat, this.options.culture) :
				value;
		},

		_refresh: function() {
			this.element.attr({
				"aria-valuemin": this.options.min,
				"aria-valuemax": this.options.max,
				// TODO: what should we do with values that can't be parsed?
				"aria-valuenow": this._parse(this.element.val())
			});
		},

		// update the value without triggering change
		_value: function(value, allowAny) {
			var parsed;
			if (value !== "") {
				parsed = this._parse(value);
				if (parsed !== null) {
					if (!allowAny) {
						parsed = this._adjustValue(parsed);
					}
					value = this._format(parsed);
				}
			}
			this.element.val(value);
			this._refresh();
		},

		_destroy: function() {
			this.element
				.removeClass("ui-spinner-input")
				.prop("disabled", false)
				.removeAttr("autocomplete")
				.removeAttr("role")
				.removeAttr("aria-valuemin")
				.removeAttr("aria-valuemax")
				.removeAttr("aria-valuenow");
			this.uiSpinner.replaceWith(this.element);
		},

		stepUp: modifier(function(steps) {
			this._stepUp(steps);
		}),
		_stepUp: function(steps) {
			if (this._start()) {
				this._spin((steps || 1) * this.options.step);
				this._stop();
			}
		},

		stepDown: modifier(function(steps) {
			this._stepDown(steps);
		}),
		_stepDown: function(steps) {
			if (this._start()) {
				this._spin((steps || 1) * -this.options.step);
				this._stop();
			}
		},

		pageUp: modifier(function(pages) {
			this._stepUp((pages || 1) * this.options.page);
		}),

		pageDown: modifier(function(pages) {
			this._stepDown((pages || 1) * this.options.page);
		}),

		value: function(newVal) {
			if (!arguments.length) {
				return this._parse(this.element.val());
			}
			modifier(this._value).call(this, newVal);
		},

		widget: function() {
			return this.uiSpinner;
		}
	});

}(jQuery));

(function($, undefined) {

	var tabId = 0,
		rhash = /#.*$/;

	function getNextTabId() {
		return ++tabId;
	}

	function isLocal(anchor) {
		return anchor.hash.length > 1 &&
			decodeURIComponent(anchor.href.replace(rhash, "")) ===
			decodeURIComponent(location.href.replace(rhash, ""));
	}

	$.widget("ui.tabs", {
		version: "1.10.3",
		delay: 300,
		options: {
			active: null,
			collapsible: false,
			event: "click",
			heightStyle: "content",
			hide: null,
			show: null,

			// callbacks
			activate: null,
			beforeActivate: null,
			beforeLoad: null,
			load: null
		},

		_create: function() {
			var that = this,
				options = this.options;

			this.running = false;

			this.element
				.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all")
				.toggleClass("ui-tabs-collapsible", options.collapsible)
			// Prevent users from focusing disabled tabs via click
			.delegate(".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function(event) {
				if ($(this).is(".ui-state-disabled")) {
					event.preventDefault();
				}
			})
			// support: IE <9
			// Preventing the default action in mousedown doesn't prevent IE
			// from focusing the element, so if the anchor gets focused, blur.
			// We don't have to worry about focusing the previously focused
			// element since clicking on a non-focusable element should focus
			// the body anyway.
			.delegate(".ui-tabs-anchor", "focus" + this.eventNamespace, function() {
				if ($(this).closest("li").is(".ui-state-disabled")) {
					this.blur();
				}
			});

			this._processTabs();
			options.active = this._initialActive();

			// Take disabling tabs via class attribute from HTML
			// into account and update option properly.
			if ($.isArray(options.disabled)) {
				options.disabled = $.unique(options.disabled.concat(
					$.map(this.tabs.filter(".ui-state-disabled"), function(li) {
						return that.tabs.index(li);
					})
				)).sort();
			}

			// check for length avoids error when initializing empty list
			if (this.options.active !== false && this.anchors.length) {
				this.active = this._findActive(options.active);
			} else {
				this.active = $();
			}

			this._refresh();

			if (this.active.length) {
				this.load(options.active);
			}
		},

		_initialActive: function() {
			var active = this.options.active,
				collapsible = this.options.collapsible,
				locationHash = location.hash.substring(1);

			if (active === null) {
				// check the fragment identifier in the URL
				if (locationHash) {
					this.tabs.each(function(i, tab) {
						if ($(tab).attr("aria-controls") === locationHash) {
							active = i;
							return false;
						}
					});
				}

				// check for a tab marked active via a class
				if (active === null) {
					active = this.tabs.index(this.tabs.filter(".ui-tabs-active"));
				}

				// no active tab, set to false
				if (active === null || active === -1) {
					active = this.tabs.length ? 0 : false;
				}
			}

			// handle numbers: negative, out of range
			if (active !== false) {
				active = this.tabs.index(this.tabs.eq(active));
				if (active === -1) {
					active = collapsible ? false : 0;
				}
			}

			// don't allow collapsible: false and active: false
			if (!collapsible && active === false && this.anchors.length) {
				active = 0;
			}

			return active;
		},

		_getCreateEventData: function() {
			return {
				tab: this.active,
				panel: !this.active.length ? $() : this._getPanelForTab(this.active)
			};
		},

		_tabKeydown: function(event) {
			/*jshint maxcomplexity:15*/
			var focusedTab = $(this.document[0].activeElement).closest("li"),
				selectedIndex = this.tabs.index(focusedTab),
				goingForward = true;

			if (this._handlePageNav(event)) {
				return;
			}

			switch (event.keyCode) {
				case $.ui.keyCode.RIGHT:
				case $.ui.keyCode.DOWN:
					selectedIndex++;
					break;
				case $.ui.keyCode.UP:
				case $.ui.keyCode.LEFT:
					goingForward = false;
					selectedIndex--;
					break;
				case $.ui.keyCode.END:
					selectedIndex = this.anchors.length - 1;
					break;
				case $.ui.keyCode.HOME:
					selectedIndex = 0;
					break;
				case $.ui.keyCode.SPACE:
					// Activate only, no collapsing
					event.preventDefault();
					clearTimeout(this.activating);
					this._activate(selectedIndex);
					return;
				case $.ui.keyCode.ENTER:
					// Toggle (cancel delayed activation, allow collapsing)
					event.preventDefault();
					clearTimeout(this.activating);
					// Determine if we should collapse or activate
					this._activate(selectedIndex === this.options.active ? false : selectedIndex);
					return;
				default:
					return;
			}

			// Focus the appropriate tab, based on which key was pressed
			event.preventDefault();
			clearTimeout(this.activating);
			selectedIndex = this._focusNextTab(selectedIndex, goingForward);

			// Navigating with control key will prevent automatic activation
			if (!event.ctrlKey) {
				// Update aria-selected immediately so that AT think the tab is already selected.
				// Otherwise AT may confuse the user by stating that they need to activate the tab,
				// but the tab will already be activated by the time the announcement finishes.
				focusedTab.attr("aria-selected", "false");
				this.tabs.eq(selectedIndex).attr("aria-selected", "true");

				this.activating = this._delay(function() {
					this.option("active", selectedIndex);
				}, this.delay);
			}
		},

		_panelKeydown: function(event) {
			if (this._handlePageNav(event)) {
				return;
			}

			// Ctrl+up moves focus to the current tab
			if (event.ctrlKey && event.keyCode === $.ui.keyCode.UP) {
				event.preventDefault();
				this.active.focus();
			}
		},

		// Alt+page up/down moves focus to the previous/next tab (and activates)
		_handlePageNav: function(event) {
			if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP) {
				this._activate(this._focusNextTab(this.options.active - 1, false));
				return true;
			}
			if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN) {
				this._activate(this._focusNextTab(this.options.active + 1, true));
				return true;
			}
		},

		_findNextTab: function(index, goingForward) {
			var lastTabIndex = this.tabs.length - 1;

			function constrain() {
				if (index > lastTabIndex) {
					index = 0;
				}
				if (index < 0) {
					index = lastTabIndex;
				}
				return index;
			}

			while ($.inArray(constrain(), this.options.disabled) !== -1) {
				index = goingForward ? index + 1 : index - 1;
			}

			return index;
		},

		_focusNextTab: function(index, goingForward) {
			index = this._findNextTab(index, goingForward);
			this.tabs.eq(index).focus();
			return index;
		},

		_setOption: function(key, value) {
			if (key === "active") {
				// _activate() will handle invalid values and update this.options
				this._activate(value);
				return;
			}

			if (key === "disabled") {
				// don't use the widget factory's disabled handling
				this._setupDisabled(value);
				return;
			}

			this._super(key, value);

			if (key === "collapsible") {
				this.element.toggleClass("ui-tabs-collapsible", value);
				// Setting collapsible: false while collapsed; open first panel
				if (!value && this.options.active === false) {
					this._activate(0);
				}
			}

			if (key === "event") {
				this._setupEvents(value);
			}

			if (key === "heightStyle") {
				this._setupHeightStyle(value);
			}
		},

		_tabId: function(tab) {
			return tab.attr("aria-controls") || "ui-tabs-" + getNextTabId();
		},

		_sanitizeSelector: function(hash) {
			return hash ? hash.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&") : "";
		},

		refresh: function() {
			var options = this.options,
				lis = this.tablist.children(":has(a[href])");

			// get disabled tabs from class attribute from HTML
			// this will get converted to a boolean if needed in _refresh()
			options.disabled = $.map(lis.filter(".ui-state-disabled"), function(tab) {
				return lis.index(tab);
			});

			this._processTabs();

			// was collapsed or no tabs
			if (options.active === false || !this.anchors.length) {
				options.active = false;
				this.active = $();
				// was active, but active tab is gone
			} else if (this.active.length && !$.contains(this.tablist[0], this.active[0])) {
				// all remaining tabs are disabled
				if (this.tabs.length === options.disabled.length) {
					options.active = false;
					this.active = $();
					// activate previous tab
				} else {
					this._activate(this._findNextTab(Math.max(0, options.active - 1), false));
				}
				// was active, active tab still exists
			} else {
				// make sure active index is correct
				options.active = this.tabs.index(this.active);
			}

			this._refresh();
		},

		_refresh: function() {
			this._setupDisabled(this.options.disabled);
			this._setupEvents(this.options.event);
			this._setupHeightStyle(this.options.heightStyle);

			this.tabs.not(this.active).attr({
				"aria-selected": "false",
				tabIndex: -1
			});
			this.panels.not(this._getPanelForTab(this.active))
				.hide()
				.attr({
					"aria-expanded": "false",
					"aria-hidden": "true"
				});

			// Make sure one tab is in the tab order
			if (!this.active.length) {
				this.tabs.eq(0).attr("tabIndex", 0);
			} else {
				this.active
					.addClass("ui-tabs-active ui-state-active")
					.attr({
						"aria-selected": "true",
						tabIndex: 0
					});
				this._getPanelForTab(this.active)
					.show()
					.attr({
						"aria-expanded": "true",
						"aria-hidden": "false"
					});
			}
		},

		_processTabs: function() {
			var that = this;

			this.tablist = this._getList()
				.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all")
				.attr("role", "tablist");

			this.tabs = this.tablist.find("> li:has(a[href])")
				.addClass("ui-state-default ui-corner-top")
				.attr({
					role: "tab",
					tabIndex: -1
				});

			this.anchors = this.tabs.map(function() {
				return $("a", this)[0];
			})
				.addClass("ui-tabs-anchor")
				.attr({
					role: "presentation",
					tabIndex: -1
				});

			this.panels = $();

			this.anchors.each(function(i, anchor) {
				var selector, panel, panelId,
					anchorId = $(anchor).uniqueId().attr("id"),
					tab = $(anchor).closest("li"),
					originalAriaControls = tab.attr("aria-controls");

				// inline tab
				if (isLocal(anchor)) {
					selector = anchor.hash;
					panel = that.element.find(that._sanitizeSelector(selector));
					// remote tab
				} else {
					panelId = that._tabId(tab);
					selector = "#" + panelId;
					panel = that.element.find(selector);
					if (!panel.length) {
						panel = that._createPanel(panelId);
						panel.insertAfter(that.panels[i - 1] || that.tablist);
					}
					panel.attr("aria-live", "polite");
				}

				if (panel.length) {
					that.panels = that.panels.add(panel);
				}
				if (originalAriaControls) {
					tab.data("ui-tabs-aria-controls", originalAriaControls);
				}
				tab.attr({
					"aria-controls": selector.substring(1),
					"aria-labelledby": anchorId
				});
				panel.attr("aria-labelledby", anchorId);
			});

			this.panels
				.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom")
				.attr("role", "tabpanel");
		},

		// allow overriding how to find the list for rare usage scenarios (#7715)
		_getList: function() {
			return this.element.find("ol,ul").eq(0);
		},

		_createPanel: function(id) {
			return $("<div>")
				.attr("id", id)
				.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom")
				.data("ui-tabs-destroy", true);
		},

		_setupDisabled: function(disabled) {
			if ($.isArray(disabled)) {
				if (!disabled.length) {
					disabled = false;
				} else if (disabled.length === this.anchors.length) {
					disabled = true;
				}
			}

			// disable tabs
			for (var i = 0, li;
				(li = this.tabs[i]); i++) {
				if (disabled === true || $.inArray(i, disabled) !== -1) {
					$(li)
						.addClass("ui-state-disabled")
						.attr("aria-disabled", "true");
				} else {
					$(li)
						.removeClass("ui-state-disabled")
						.removeAttr("aria-disabled");
				}
			}

			this.options.disabled = disabled;
		},

		_setupEvents: function(event) {
			var events = {
				click: function(event) {
					event.preventDefault();
				}
			};
			if (event) {
				$.each(event.split(" "), function(index, eventName) {
					events[eventName] = "_eventHandler";
				});
			}

			this._off(this.anchors.add(this.tabs).add(this.panels));
			this._on(this.anchors, events);
			this._on(this.tabs, {
				keydown: "_tabKeydown"
			});
			this._on(this.panels, {
				keydown: "_panelKeydown"
			});

			this._focusable(this.tabs);
			this._hoverable(this.tabs);
		},

		_setupHeightStyle: function(heightStyle) {
			var maxHeight,
				parent = this.element.parent();

			if (heightStyle === "fill") {
				maxHeight = parent.height();
				maxHeight -= this.element.outerHeight() - this.element.height();

				this.element.siblings(":visible").each(function() {
					var elem = $(this),
						position = elem.css("position");

					if (position === "absolute" || position === "fixed") {
						return;
					}
					maxHeight -= elem.outerHeight(true);
				});

				this.element.children().not(this.panels).each(function() {
					maxHeight -= $(this).outerHeight(true);
				});

				this.panels.each(function() {
					$(this).height(Math.max(0, maxHeight -
						$(this).innerHeight() + $(this).height()));
				})
					.css("overflow", "auto");
			} else if (heightStyle === "auto") {
				maxHeight = 0;
				this.panels.each(function() {
					maxHeight = Math.max(maxHeight, $(this).height("").height());
				}).height(maxHeight);
			}
		},

		_eventHandler: function(event) {
			var options = this.options,
				active = this.active,
				anchor = $(event.currentTarget),
				tab = anchor.closest("li"),
				clickedIsActive = tab[0] === active[0],
				collapsing = clickedIsActive && options.collapsible,
				toShow = collapsing ? $() : this._getPanelForTab(tab),
				toHide = !active.length ? $() : this._getPanelForTab(active),
				eventData = {
					oldTab: active,
					oldPanel: toHide,
					newTab: collapsing ? $() : tab,
					newPanel: toShow
				};

			event.preventDefault();

			if (tab.hasClass("ui-state-disabled") ||
				// tab is already loading
				tab.hasClass("ui-tabs-loading") ||
				// can't switch durning an animation
				this.running ||
				// click on active header, but not collapsible
				(clickedIsActive && !options.collapsible) ||
				// allow canceling activation
				(this._trigger("beforeActivate", event, eventData) === false)) {
				return;
			}

			options.active = collapsing ? false : this.tabs.index(tab);

			this.active = clickedIsActive ? $() : tab;
			if (this.xhr) {
				this.xhr.abort();
			}

			if (!toHide.length && !toShow.length) {
				$.error("jQuery UI Tabs: Mismatching fragment identifier.");
			}

			if (toShow.length) {
				this.load(this.tabs.index(tab), event);
			}
			this._toggle(event, eventData);
		},

		// handles show/hide for selecting tabs
		_toggle: function(event, eventData) {
			var that = this,
				toShow = eventData.newPanel,
				toHide = eventData.oldPanel;

			this.running = true;

			function complete() {
				that.running = false;
				that._trigger("activate", event, eventData);
			}

			function show() {
				eventData.newTab.closest("li").addClass("ui-tabs-active ui-state-active");

				if (toShow.length && that.options.show) {
					that._show(toShow, that.options.show, complete);
				} else {
					toShow.show();
					complete();
				}
			}

			// start out by hiding, then showing, then completing
			if (toHide.length && this.options.hide) {
				this._hide(toHide, this.options.hide, function() {
					eventData.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active");
					show();
				});
			} else {
				eventData.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active");
				toHide.hide();
				show();
			}

			toHide.attr({
				"aria-expanded": "false",
				"aria-hidden": "true"
			});
			eventData.oldTab.attr("aria-selected", "false");
			// If we're switching tabs, remove the old tab from the tab order.
			// If we're opening from collapsed state, remove the previous tab from the tab order.
			// If we're collapsing, then keep the collapsing tab in the tab order.
			if (toShow.length && toHide.length) {
				eventData.oldTab.attr("tabIndex", -1);
			} else if (toShow.length) {
				this.tabs.filter(function() {
					return $(this).attr("tabIndex") === 0;
				})
					.attr("tabIndex", -1);
			}

			toShow.attr({
				"aria-expanded": "true",
				"aria-hidden": "false"
			});
			eventData.newTab.attr({
				"aria-selected": "true",
				tabIndex: 0
			});
		},

		_activate: function(index) {
			var anchor,
				active = this._findActive(index);

			// trying to activate the already active panel
			if (active[0] === this.active[0]) {
				return;
			}

			// trying to collapse, simulate a click on the current active header
			if (!active.length) {
				active = this.active;
			}

			anchor = active.find(".ui-tabs-anchor")[0];
			this._eventHandler({
				target: anchor,
				currentTarget: anchor,
				preventDefault: $.noop
			});
		},

		_findActive: function(index) {
			return index === false ? $() : this.tabs.eq(index);
		},

		_getIndex: function(index) {
			// meta-function to give users option to provide a href string instead of a numerical index.
			if (typeof index === "string") {
				index = this.anchors.index(this.anchors.filter("[href$='" + index + "']"));
			}

			return index;
		},

		_destroy: function() {
			if (this.xhr) {
				this.xhr.abort();
			}

			this.element.removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible");

			this.tablist
				.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all")
				.removeAttr("role");

			this.anchors
				.removeClass("ui-tabs-anchor")
				.removeAttr("role")
				.removeAttr("tabIndex")
				.removeUniqueId();

			this.tabs.add(this.panels).each(function() {
				if ($.data(this, "ui-tabs-destroy")) {
					$(this).remove();
				} else {
					$(this)
						.removeClass("ui-state-default ui-state-active ui-state-disabled " +
							"ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel")
						.removeAttr("tabIndex")
						.removeAttr("aria-live")
						.removeAttr("aria-busy")
						.removeAttr("aria-selected")
						.removeAttr("aria-labelledby")
						.removeAttr("aria-hidden")
						.removeAttr("aria-expanded")
						.removeAttr("role");
				}
			});

			this.tabs.each(function() {
				var li = $(this),
					prev = li.data("ui-tabs-aria-controls");
				if (prev) {
					li
						.attr("aria-controls", prev)
						.removeData("ui-tabs-aria-controls");
				} else {
					li.removeAttr("aria-controls");
				}
			});

			this.panels.show();

			if (this.options.heightStyle !== "content") {
				this.panels.css("height", "");
			}
		},

		enable: function(index) {
			var disabled = this.options.disabled;
			if (disabled === false) {
				return;
			}

			if (index === undefined) {
				disabled = false;
			} else {
				index = this._getIndex(index);
				if ($.isArray(disabled)) {
					disabled = $.map(disabled, function(num) {
						return num !== index ? num : null;
					});
				} else {
					disabled = $.map(this.tabs, function(li, num) {
						return num !== index ? num : null;
					});
				}
			}
			this._setupDisabled(disabled);
		},

		disable: function(index) {
			var disabled = this.options.disabled;
			if (disabled === true) {
				return;
			}

			if (index === undefined) {
				disabled = true;
			} else {
				index = this._getIndex(index);
				if ($.inArray(index, disabled) !== -1) {
					return;
				}
				if ($.isArray(disabled)) {
					disabled = $.merge([index], disabled).sort();
				} else {
					disabled = [index];
				}
			}
			this._setupDisabled(disabled);
		},

		load: function(index, event) {
			index = this._getIndex(index);
			var that = this,
				tab = this.tabs.eq(index),
				anchor = tab.find(".ui-tabs-anchor"),
				panel = this._getPanelForTab(tab),
				eventData = {
					tab: tab,
					panel: panel
				};

			// not remote
			if (isLocal(anchor[0])) {
				return;
			}

			this.xhr = $.ajax(this._ajaxSettings(anchor, event, eventData));

			// support: jQuery <1.8
			// jQuery <1.8 returns false if the request is canceled in beforeSend,
			// but as of 1.8, $.ajax() always returns a jqXHR object.
			if (this.xhr && this.xhr.statusText !== "canceled") {
				tab.addClass("ui-tabs-loading");
				panel.attr("aria-busy", "true");

				this.xhr
					.success(function(response) {
						// support: jQuery <1.8
						// http://bugs.jquery.com/ticket/11778
						setTimeout(function() {
							panel.html(response);
							that._trigger("load", event, eventData);
						}, 1);
					})
					.complete(function(jqXHR, status) {
						// support: jQuery <1.8
						// http://bugs.jquery.com/ticket/11778
						setTimeout(function() {
							if (status === "abort") {
								that.panels.stop(false, true);
							}

							tab.removeClass("ui-tabs-loading");
							panel.removeAttr("aria-busy");

							if (jqXHR === that.xhr) {
								delete that.xhr;
							}
						}, 1);
					});
			}
		},

		_ajaxSettings: function(anchor, event, eventData) {
			var that = this;
			return {
				url: anchor.attr("href"),
				beforeSend: function(jqXHR, settings) {
					return that._trigger("beforeLoad", event,
						$.extend({
							jqXHR: jqXHR,
							ajaxSettings: settings
						}, eventData));
				}
			};
		},

		_getPanelForTab: function(tab) {
			var id = $(tab).attr("aria-controls");
			return this.element.find(this._sanitizeSelector("#" + id));
		}
	});

})(jQuery);

(function($) {

	var increments = 0;

	function addDescribedBy(elem, id) {
		var describedby = (elem.attr("aria-describedby") || "").split(/\s+/);
		describedby.push(id);
		elem
			.data("ui-tooltip-id", id)
			.attr("aria-describedby", $.trim(describedby.join(" ")));
	}

	function removeDescribedBy(elem) {
		var id = elem.data("ui-tooltip-id"),
			describedby = (elem.attr("aria-describedby") || "").split(/\s+/),
			index = $.inArray(id, describedby);
		if (index !== -1) {
			describedby.splice(index, 1);
		}

		elem.removeData("ui-tooltip-id");
		describedby = $.trim(describedby.join(" "));
		if (describedby) {
			elem.attr("aria-describedby", describedby);
		} else {
			elem.removeAttr("aria-describedby");
		}
	}

	$.widget("ui.tooltip", {
		version: "1.10.3",
		options: {
			content: function() {
				// support: IE<9, Opera in jQuery <1.7
				// .text() can't accept undefined, so coerce to a string
				var title = $(this).attr("title") || "";
				// Escape title, since we're going from an attribute to raw HTML
				return $("<a>").text(title).html();
			},
			hide: true,
			// Disabled elements have inconsistent behavior across browsers (#8661)
			items: "[title]:not([disabled])",
			position: {
				my: "left top+15",
				at: "left bottom",
				collision: "flipfit flip"
			},
			show: true,
			tooltipClass: null,
			track: false,

			// callbacks
			close: null,
			open: null
		},

		_create: function() {
			this._on({
				mouseover: "open",
				focusin: "open"
			});

			// IDs of generated tooltips, needed for destroy
			this.tooltips = {};
			// IDs of parent tooltips where we removed the title attribute
			this.parents = {};

			if (this.options.disabled) {
				this._disable();
			}
		},

		_setOption: function(key, value) {
			var that = this;

			if (key === "disabled") {
				this[value ? "_disable" : "_enable"]();
				this.options[key] = value;
				// disable element style changes
				return;
			}

			this._super(key, value);

			if (key === "content") {
				$.each(this.tooltips, function(id, element) {
					that._updateContent(element);
				});
			}
		},

		_disable: function() {
			var that = this;

			// close open tooltips
			$.each(this.tooltips, function(id, element) {
				var event = $.Event("blur");
				event.target = event.currentTarget = element[0];
				that.close(event, true);
			});

			// remove title attributes to prevent native tooltips
			this.element.find(this.options.items).addBack().each(function() {
				var element = $(this);
				if (element.is("[title]")) {
					element
						.data("ui-tooltip-title", element.attr("title"))
						.attr("title", "");
				}
			});
		},

		_enable: function() {
			// restore title attributes
			this.element.find(this.options.items).addBack().each(function() {
				var element = $(this);
				if (element.data("ui-tooltip-title")) {
					element.attr("title", element.data("ui-tooltip-title"));
				}
			});
		},

		open: function(event) {
			var that = this,
				target = $(event ? event.target : this.element)
				// we need closest here due to mouseover bubbling,
				// but always pointing at the same event target
				.closest(this.options.items);

			// No element to show a tooltip for or the tooltip is already open
			if (!target.length || target.data("ui-tooltip-id")) {
				return;
			}

			if (target.attr("title")) {
				target.data("ui-tooltip-title", target.attr("title"));
			}

			target.data("ui-tooltip-open", true);

			// kill parent tooltips, custom or native, for hover
			if (event && event.type === "mouseover") {
				target.parents().each(function() {
					var parent = $(this),
						blurEvent;
					if (parent.data("ui-tooltip-open")) {
						blurEvent = $.Event("blur");
						blurEvent.target = blurEvent.currentTarget = this;
						that.close(blurEvent, true);
					}
					if (parent.attr("title")) {
						parent.uniqueId();
						that.parents[this.id] = {
							element: this,
							title: parent.attr("title")
						};
						parent.attr("title", "");
					}
				});
			}

			this._updateContent(target, event);
		},

		_updateContent: function(target, event) {
			var content,
				contentOption = this.options.content,
				that = this,
				eventType = event ? event.type : null;

			if (typeof contentOption === "string") {
				return this._open(event, target, contentOption);
			}

			content = contentOption.call(target[0], function(response) {
				// ignore async response if tooltip was closed already
				if (!target.data("ui-tooltip-open")) {
					return;
				}
				// IE may instantly serve a cached response for ajax requests
				// delay this call to _open so the other call to _open runs first
				that._delay(function() {
					// jQuery creates a special event for focusin when it doesn't
					// exist natively. To improve performance, the native event
					// object is reused and the type is changed. Therefore, we can't
					// rely on the type being correct after the event finished
					// bubbling, so we set it back to the previous value. (#8740)
					if (event) {
						event.type = eventType;
					}
					this._open(event, target, response);
				});
			});
			if (content) {
				this._open(event, target, content);
			}
		},

		_open: function(event, target, content) {
			var tooltip, events, delayedShow,
				positionOption = $.extend({}, this.options.position);

			if (!content) {
				return;
			}

			// Content can be updated multiple times. If the tooltip already
			// exists, then just update the content and bail.
			tooltip = this._find(target);
			if (tooltip.length) {
				tooltip.find(".ui-tooltip-content").html(content);
				return;
			}

			// if we have a title, clear it to prevent the native tooltip
			// we have to check first to avoid defining a title if none exists
			// (we don't want to cause an element to start matching [title])
			//
			// We use removeAttr only for key events, to allow IE to export the correct
			// accessible attributes. For mouse events, set to empty string to avoid
			// native tooltip showing up (happens only when removing inside mouseover).
			if (target.is("[title]")) {
				if (event && event.type === "mouseover") {
					target.attr("title", "");
				} else {
					target.removeAttr("title");
				}
			}

			tooltip = this._tooltip(target);
			addDescribedBy(target, tooltip.attr("id"));
			tooltip.find(".ui-tooltip-content").html(content);

			function position(event) {
				positionOption.of = event;
				if (tooltip.is(":hidden")) {
					return;
				}
				tooltip.position(positionOption);
			}
			if (this.options.track && event && /^mouse/.test(event.type)) {
				this._on(this.document, {
					mousemove: position
				});
				// trigger once to override element-relative positioning
				position(event);
			} else {
				tooltip.position($.extend({
					of: target
				}, this.options.position));
			}

			tooltip.hide();

			this._show(tooltip, this.options.show);
			// Handle tracking tooltips that are shown with a delay (#8644). As soon
			// as the tooltip is visible, position the tooltip using the most recent
			// event.
			if (this.options.show && this.options.show.delay) {
				delayedShow = this.delayedShow = setInterval(function() {
					if (tooltip.is(":visible")) {
						position(positionOption.of);
						clearInterval(delayedShow);
					}
				}, $.fx.interval);
			}

			this._trigger("open", event, {
				tooltip: tooltip
			});

			events = {
				keyup: function(event) {
					if (event.keyCode === $.ui.keyCode.ESCAPE) {
						var fakeEvent = $.Event(event);
						fakeEvent.currentTarget = target[0];
						this.close(fakeEvent, true);
					}
				},
				remove: function() {
					this._removeTooltip(tooltip);
				}
			};
			if (!event || event.type === "mouseover") {
				events.mouseleave = "close";
			}
			if (!event || event.type === "focusin") {
				events.focusout = "close";
			}
			this._on(true, target, events);
		},

		close: function(event) {
			var that = this,
				target = $(event ? event.currentTarget : this.element),
				tooltip = this._find(target);

			// disabling closes the tooltip, so we need to track when we're closing
			// to avoid an infinite loop in case the tooltip becomes disabled on close
			if (this.closing) {
				return;
			}

			// Clear the interval for delayed tracking tooltips
			clearInterval(this.delayedShow);

			// only set title if we had one before (see comment in _open())
			if (target.data("ui-tooltip-title")) {
				target.attr("title", target.data("ui-tooltip-title"));
			}

			removeDescribedBy(target);

			tooltip.stop(true);
			this._hide(tooltip, this.options.hide, function() {
				that._removeTooltip($(this));
			});

			target.removeData("ui-tooltip-open");
			this._off(target, "mouseleave focusout keyup");
			// Remove 'remove' binding only on delegated targets
			if (target[0] !== this.element[0]) {
				this._off(target, "remove");
			}
			this._off(this.document, "mousemove");

			if (event && event.type === "mouseleave") {
				$.each(this.parents, function(id, parent) {
					$(parent.element).attr("title", parent.title);
					delete that.parents[id];
				});
			}

			this.closing = true;
			this._trigger("close", event, {
				tooltip: tooltip
			});
			this.closing = false;
		},

		_tooltip: function(element) {
			var id = "ui-tooltip-" + increments++,
				tooltip = $("<div>")
					.attr({
						id: id,
						role: "tooltip"
					})
					.addClass("ui-tooltip ui-widget ui-corner-all ui-widget-content " +
						(this.options.tooltipClass || ""));
			$("<div>")
				.addClass("ui-tooltip-content")
				.appendTo(tooltip);
			tooltip.appendTo(this.document[0].body);
			this.tooltips[id] = element;
			return tooltip;
		},

		_find: function(target) {
			var id = target.data("ui-tooltip-id");
			return id ? $("#" + id) : $();
		},

		_removeTooltip: function(tooltip) {
			tooltip.remove();
			delete this.tooltips[tooltip.attr("id")];
		},

		_destroy: function() {
			var that = this;

			// close open tooltips
			$.each(this.tooltips, function(id, element) {
				// Delegate to close method to handle common cleanup
				var event = $.Event("blur");
				event.target = event.currentTarget = element[0];
				that.close(event, true);

				// Remove immediately; destroying an open tooltip doesn't use the
				// hide animation
				$("#" + id).remove();

				// Restore the title
				if (element.data("ui-tooltip-title")) {
					element.attr("title", element.data("ui-tooltip-title"));
					element.removeData("ui-tooltip-title");
				}
			});
		}
	});

}(jQuery));









/*!
 * jQuery Cycle Plugin (with Transition Definitions)
 * Examples and documentation at: http://jquery.malsup.com/cycle/
 * Copyright (c) 2007-2013 M. Alsup
 * Version: 3.0.2 (19-APR-2013)
 * Dual licensed under the MIT and GPL licenses.
 * http://jquery.malsup.com/license.html
 * Requires: jQuery v1.7.1 or later
 */
;
(function($, undefined) {
	"use strict";

	var ver = '3.0.2';

	function debug(s) {
		if ($.fn.cycle.debug)
			log(s);
	}

	function log() {
		if (window.console && console.log)
			console.log('[cycle] ' + Array.prototype.join.call(arguments, ' '));
	}
	$.expr[':'].paused = function(el) {
		return el.cyclePause;
	};


	// the options arg can be...
	//   a number  - indicates an immediate transition should occur to the given slide index
	//   a string  - 'pause', 'resume', 'toggle', 'next', 'prev', 'stop', 'destroy' or the name of a transition effect (ie, 'fade', 'zoom', etc)
	//   an object - properties to control the slideshow
	//
	// the arg2 arg can be...
	//   the name of an fx (only used in conjunction with a numeric value for 'options')
	//   the value true (only used in first arg == 'resume') and indicates
	//   that the resume should occur immediately (not wait for next timeout)

	$.fn.cycle = function(options, arg2) {
		var o = {
			s: this.selector,
			c: this.context
		};

		// in 1.3+ we can fix mistakes with the ready state
		if (this.length === 0 && options != 'stop') {
			if (!$.isReady && o.s) {
				log('DOM not ready, queuing slideshow');
				$(function() {
					$(o.s, o.c).cycle(options, arg2);
				});
				return this;
			}
			// is your DOM ready?  http://docs.jquery.com/Tutorials:Introducing_$(document).ready()
			log('terminating; zero elements found by selector' + ($.isReady ? '' : ' (DOM not ready)'));
			return this;
		}

		// iterate the matched nodeset
		return this.each(function() {
			var opts = handleArguments(this, options, arg2);
			if (opts === false)
				return;

			opts.updateActivePagerLink = opts.updateActivePagerLink || $.fn.cycle.updateActivePagerLink;

			// stop existing slideshow for this container (if there is one)
			if (this.cycleTimeout)
				clearTimeout(this.cycleTimeout);
			this.cycleTimeout = this.cyclePause = 0;
			this.cycleStop = 0; // issue #108

			var $cont = $(this);
			var $slides = opts.slideExpr ? $(opts.slideExpr, this) : $cont.children();
			var els = $slides.get();

			if (els.length < 2) {
				log('terminating; too few slides: ' + els.length);
				return;
			}

			var opts2 = buildOptions($cont, $slides, els, opts, o);
			if (opts2 === false)
				return;

			var startTime = opts2.continuous ? 10 : getTimeout(els[opts2.currSlide], els[opts2.nextSlide], opts2, !opts2.backwards);

			// if it's an auto slideshow, kick it off
			if (startTime) {
				startTime += (opts2.delay || 0);
				if (startTime < 10)
					startTime = 10;
				debug('first timeout: ' + startTime);
				this.cycleTimeout = setTimeout(function() {
					go(els, opts2, 0, !opts.backwards);
				}, startTime);
			}
		});
	};

	function triggerPause(cont, byHover, onPager) {
		var opts = $(cont).data('cycle.opts');
		if (!opts)
			return;
		var paused = !! cont.cyclePause;
		if (paused && opts.paused)
			opts.paused(cont, opts, byHover, onPager);
		else if (!paused && opts.resumed)
			opts.resumed(cont, opts, byHover, onPager);
	}

	// process the args that were passed to the plugin fn

	function handleArguments(cont, options, arg2) {
		if (cont.cycleStop === undefined)
			cont.cycleStop = 0;
		if (options === undefined || options === null)
			options = {};
		if (options.constructor == String) {
			switch (options) {
				case 'destroy':
				case 'stop':
					var opts = $(cont).data('cycle.opts');
					if (!opts)
						return false;
					cont.cycleStop++; // callbacks look for change
					if (cont.cycleTimeout)
						clearTimeout(cont.cycleTimeout);
					cont.cycleTimeout = 0;
					if (opts.elements)
						$(opts.elements).stop();
					$(cont).removeData('cycle.opts');
					if (options == 'destroy')
						destroy(cont, opts);
					return false;
				case 'toggle':
					cont.cyclePause = (cont.cyclePause === 1) ? 0 : 1;
					checkInstantResume(cont.cyclePause, arg2, cont);
					triggerPause(cont);
					return false;
				case 'pause':
					cont.cyclePause = 1;
					triggerPause(cont);
					return false;
				case 'resume':
					cont.cyclePause = 0;
					checkInstantResume(false, arg2, cont);
					triggerPause(cont);
					return false;
				case 'prev':
				case 'next':
					opts = $(cont).data('cycle.opts');
					if (!opts) {
						log('options not found, "prev/next" ignored');
						return false;
					}
					if (typeof arg2 == 'string')
						opts.oneTimeFx = arg2;
					$.fn.cycle[options](opts);
					return false;
				default:
					options = {
						fx: options
					};
			}
			return options;
		} else if (options.constructor == Number) {
			// go to the requested slide
			var num = options;
			options = $(cont).data('cycle.opts');
			if (!options) {
				log('options not found, can not advance slide');
				return false;
			}
			if (num < 0 || num >= options.elements.length) {
				log('invalid slide index: ' + num);
				return false;
			}
			options.nextSlide = num;
			if (cont.cycleTimeout) {
				clearTimeout(cont.cycleTimeout);
				cont.cycleTimeout = 0;
			}
			if (typeof arg2 == 'string')
				options.oneTimeFx = arg2;
			go(options.elements, options, 1, num >= options.currSlide);
			return false;
		}
		return options;

		function checkInstantResume(isPaused, arg2, cont) {
			if (!isPaused && arg2 === true) { // resume now!
				var options = $(cont).data('cycle.opts');
				if (!options) {
					log('options not found, can not resume');
					return false;
				}
				if (cont.cycleTimeout) {
					clearTimeout(cont.cycleTimeout);
					cont.cycleTimeout = 0;
				}
				go(options.elements, options, 1, !options.backwards);
			}
		}
	}

	function removeFilter(el, opts) {
		if (!$.support.opacity && opts.cleartype && el.style.filter) {
			try {
				el.style.removeAttribute('filter');
			} catch (smother) {} // handle old opera versions
		}
	}

	// unbind event handlers

	function destroy(cont, opts) {
		if (opts.next)
			$(opts.next).unbind(opts.prevNextEvent);
		if (opts.prev)
			$(opts.prev).unbind(opts.prevNextEvent);

		if (opts.pager || opts.pagerAnchorBuilder)
			$.each(opts.pagerAnchors || [], function() {
				this.unbind().remove();
			});
		opts.pagerAnchors = null;
		$(cont).unbind('mouseenter.cycle mouseleave.cycle');
		if (opts.destroy) // callback
			opts.destroy(opts);
	}

	// one-time initialization

	function buildOptions($cont, $slides, els, options, o) {
		var startingSlideSpecified;
		// support metadata plugin (v1.0 and v2.0)
		var opts = $.extend({}, $.fn.cycle.defaults, options || {}, $.metadata ? $cont.metadata() : $.meta ? $cont.data() : {});
		var meta = $.isFunction($cont.data) ? $cont.data(opts.metaAttr) : null;
		if (meta)
			opts = $.extend(opts, meta);
		if (opts.autostop)
			opts.countdown = opts.autostopCount || els.length;

		var cont = $cont[0];
		$cont.data('cycle.opts', opts);
		opts.$cont = $cont;
		opts.stopCount = cont.cycleStop;
		opts.elements = els;
		opts.before = opts.before ? [opts.before] : [];
		opts.after = opts.after ? [opts.after] : [];

		// push some after callbacks
		if (!$.support.opacity && opts.cleartype)
			opts.after.push(function() {
				removeFilter(this, opts);
			});
		if (opts.continuous)
			opts.after.push(function() {
				go(els, opts, 0, !opts.backwards);
			});

		saveOriginalOpts(opts);

		// clearType corrections
		if (!$.support.opacity && opts.cleartype && !opts.cleartypeNoBg)
			clearTypeFix($slides);

		// container requires non-static position so that slides can be position within
		if ($cont.css('position') == 'static')
			$cont.css('position', 'relative');
		if (opts.width)
			$cont.width(opts.width);
		if (opts.height && opts.height != 'auto')
			$cont.height(opts.height);

		if (opts.startingSlide !== undefined) {
			opts.startingSlide = parseInt(opts.startingSlide, 10);
			if (opts.startingSlide >= els.length || opts.startSlide < 0)
				opts.startingSlide = 0; // catch bogus input
			else
				startingSlideSpecified = true;
		} else if (opts.backwards)
			opts.startingSlide = els.length - 1;
		else
			opts.startingSlide = 0;

		// if random, mix up the slide array
		if (opts.random) {
			opts.randomMap = [];
			for (var i = 0; i < els.length; i++)
				opts.randomMap.push(i);
			opts.randomMap.sort(function(a, b) {
				return Math.random() - 0.5;
			});
			if (startingSlideSpecified) {
				// try to find the specified starting slide and if found set start slide index in the map accordingly
				for (var cnt = 0; cnt < els.length; cnt++) {
					if (opts.startingSlide == opts.randomMap[cnt]) {
						opts.randomIndex = cnt;
					}
				}
			} else {
				opts.randomIndex = 1;
				opts.startingSlide = opts.randomMap[1];
			}
		} else if (opts.startingSlide >= els.length)
			opts.startingSlide = 0; // catch bogus input
		opts.currSlide = opts.startingSlide || 0;
		var first = opts.startingSlide;

		// set position and zIndex on all the slides
		$slides.css({
			position: 'absolute',
			top: 0,
			left: 0
		}).hide().each(function(i) {
			var z;
			if (opts.backwards)
				z = first ? i <= first ? els.length + (i - first) : first - i : els.length - i;
			else
				z = first ? i >= first ? els.length - (i - first) : first - i : els.length - i;
			$(this).css('z-index', z);
		});

		// make sure first slide is visible
		$(els[first]).css('opacity', 1).show(); // opacity bit needed to handle restart use case
		removeFilter(els[first], opts);

		// stretch slides
		if (opts.fit) {
			if (!opts.aspect) {
				if (opts.width)
					$slides.width(opts.width);
				if (opts.height && opts.height != 'auto')
					$slides.height(opts.height);
			} else {
				$slides.each(function() {
					var $slide = $(this);
					var ratio = (opts.aspect === true) ? $slide.width() / $slide.height() : opts.aspect;
					if (opts.width && $slide.width() != opts.width) {
						$slide.width(opts.width);
						$slide.height(opts.width / ratio);
					}

					if (opts.height && $slide.height() < opts.height) {
						$slide.height(opts.height);
						$slide.width(opts.height * ratio);
					}
				});
			}
		}

		if (opts.center && ((!opts.fit) || opts.aspect)) {
			$slides.each(function() {
				var $slide = $(this);
				$slide.css({
					"margin-left": opts.width ? ((opts.width - $slide.width()) / 2) + "px" : 0,
					"margin-top": opts.height ? ((opts.height - $slide.height()) / 2) + "px" : 0
				});
			});
		}

		if (opts.center && !opts.fit && !opts.slideResize) {
			$slides.each(function() {
				var $slide = $(this);
				$slide.css({
					"margin-left": opts.width ? ((opts.width - $slide.width()) / 2) + "px" : 0,
					"margin-top": opts.height ? ((opts.height - $slide.height()) / 2) + "px" : 0
				});
			});
		}

		// stretch container
		var reshape = (opts.containerResize || opts.containerResizeHeight) && $cont.innerHeight() < 1;
		if (reshape) { // do this only if container has no size http://tinyurl.com/da2oa9
			var maxw = 0,
				maxh = 0;
			for (var j = 0; j < els.length; j++) {
				var $e = $(els[j]),
					e = $e[0],
					w = $e.outerWidth(),
					h = $e.outerHeight();
				if (!w) w = e.offsetWidth || e.width || $e.attr('width');
				if (!h) h = e.offsetHeight || e.height || $e.attr('height');
				maxw = w > maxw ? w : maxw;
				maxh = h > maxh ? h : maxh;
			}
			if (opts.containerResize && maxw > 0 && maxh > 0)
				$cont.css({
					width: maxw + 'px',
					height: maxh + 'px'
				});
			if (opts.containerResizeHeight && maxh > 0)
				$cont.css({
					height: maxh + 'px'
				});
		}

		var pauseFlag = false; // https://github.com/malsup/cycle/issues/44
		if (opts.pause)
			$cont.bind('mouseenter.cycle', function() {
				pauseFlag = true;
				this.cyclePause++;
				triggerPause(cont, true);
			}).bind('mouseleave.cycle', function() {
				if (pauseFlag)
					this.cyclePause--;
				triggerPause(cont, true);
			});

		if (supportMultiTransitions(opts) === false)
			return false;

		// apparently a lot of people use image slideshows without height/width attributes on the images.
		// Cycle 2.50+ requires the sizing info for every slide; this block tries to deal with that.
		var requeue = false;
		options.requeueAttempts = options.requeueAttempts || 0;
		$slides.each(function() {
			// try to get height/width of each slide
			var $el = $(this);
			this.cycleH = (opts.fit && opts.height) ? opts.height : ($el.height() || this.offsetHeight || this.height || $el.attr('height') || 0);
			this.cycleW = (opts.fit && opts.width) ? opts.width : ($el.width() || this.offsetWidth || this.width || $el.attr('width') || 0);

			if ($el.is('img')) {
				var loading = (this.cycleH === 0 && this.cycleW === 0 && !this.complete);
				// don't requeue for images that are still loading but have a valid size
				if (loading) {
					if (o.s && opts.requeueOnImageNotLoaded && ++options.requeueAttempts < 100) { // track retry count so we don't loop forever
						log(options.requeueAttempts, ' - img slide not loaded, requeuing slideshow: ', this.src, this.cycleW, this.cycleH);
						setTimeout(function() {
							$(o.s, o.c).cycle(options);
						}, opts.requeueTimeout);
						requeue = true;
						return false; // break each loop
					} else {
						log('could not determine size of image: ' + this.src, this.cycleW, this.cycleH);
					}
				}
			}
			return true;
		});

		if (requeue)
			return false;

		opts.cssBefore = opts.cssBefore || {};
		opts.cssAfter = opts.cssAfter || {};
		opts.cssFirst = opts.cssFirst || {};
		opts.animIn = opts.animIn || {};
		opts.animOut = opts.animOut || {};

		$slides.not(':eq(' + first + ')').css(opts.cssBefore);
		$($slides[first]).css(opts.cssFirst);

		if (opts.timeout) {
			opts.timeout = parseInt(opts.timeout, 10);
			// ensure that timeout and speed settings are sane
			if (opts.speed.constructor == String)
				opts.speed = $.fx.speeds[opts.speed] || parseInt(opts.speed, 10);
			if (!opts.sync)
				opts.speed = opts.speed / 2;

			var buffer = opts.fx == 'none' ? 0 : opts.fx == 'shuffle' ? 500 : 250;
			while ((opts.timeout - opts.speed) < buffer) // sanitize timeout
				opts.timeout += opts.speed;
		}
		if (opts.easing)
			opts.easeIn = opts.easeOut = opts.easing;
		if (!opts.speedIn)
			opts.speedIn = opts.speed;
		if (!opts.speedOut)
			opts.speedOut = opts.speed;

		opts.slideCount = els.length;
		opts.currSlide = opts.lastSlide = first;
		if (opts.random) {
			if (++opts.randomIndex == els.length)
				opts.randomIndex = 0;
			opts.nextSlide = opts.randomMap[opts.randomIndex];
		} else if (opts.backwards)
			opts.nextSlide = opts.startingSlide === 0 ? (els.length - 1) : opts.startingSlide - 1;
		else
			opts.nextSlide = opts.startingSlide >= (els.length - 1) ? 0 : opts.startingSlide + 1;

		// run transition init fn
		if (!opts.multiFx) {
			var init = $.fn.cycle.transitions[opts.fx];
			if ($.isFunction(init))
				init($cont, $slides, opts);
			else if (opts.fx != 'custom' && !opts.multiFx) {
				log('unknown transition: ' + opts.fx, '; slideshow terminating');
				return false;
			}
		}

		// fire artificial events
		var e0 = $slides[first];
		if (!opts.skipInitializationCallbacks) {
			if (opts.before.length)
				opts.before[0].apply(e0, [e0, e0, opts, true]);
			if (opts.after.length)
				opts.after[0].apply(e0, [e0, e0, opts, true]);
		}
		if (opts.next)
			$(opts.next).bind(opts.prevNextEvent, function() {
				return advance(opts, 1);
			});
		if (opts.prev)
			$(opts.prev).bind(opts.prevNextEvent, function() {
				return advance(opts, 0);
			});
		if (opts.pager || opts.pagerAnchorBuilder)
			buildPager(els, opts);

		exposeAddSlide(opts, els);

		return opts;
	}

	// save off original opts so we can restore after clearing state

	function saveOriginalOpts(opts) {
		opts.original = {
			before: [],
			after: []
		};
		opts.original.cssBefore = $.extend({}, opts.cssBefore);
		opts.original.cssAfter = $.extend({}, opts.cssAfter);
		opts.original.animIn = $.extend({}, opts.animIn);
		opts.original.animOut = $.extend({}, opts.animOut);
		$.each(opts.before, function() {
			opts.original.before.push(this);
		});
		$.each(opts.after, function() {
			opts.original.after.push(this);
		});
	}

	function supportMultiTransitions(opts) {
		var i, tx, txs = $.fn.cycle.transitions;
		// look for multiple effects
		if (opts.fx.indexOf(',') > 0) {
			opts.multiFx = true;
			opts.fxs = opts.fx.replace(/\s*/g, '').split(',');
			// discard any bogus effect names
			for (i = 0; i < opts.fxs.length; i++) {
				var fx = opts.fxs[i];
				tx = txs[fx];
				if (!tx || !txs.hasOwnProperty(fx) || !$.isFunction(tx)) {
					log('discarding unknown transition: ', fx);
					opts.fxs.splice(i, 1);
					i--;
				}
			}
			// if we have an empty list then we threw everything away!
			if (!opts.fxs.length) {
				log('No valid transitions named; slideshow terminating.');
				return false;
			}
		} else if (opts.fx == 'all') { // auto-gen the list of transitions
			opts.multiFx = true;
			opts.fxs = [];
			for (var p in txs) {
				if (txs.hasOwnProperty(p)) {
					tx = txs[p];
					if (txs.hasOwnProperty(p) && $.isFunction(tx))
						opts.fxs.push(p);
				}
			}
		}
		if (opts.multiFx && opts.randomizeEffects) {
			// munge the fxs array to make effect selection random
			var r1 = Math.floor(Math.random() * 20) + 30;
			for (i = 0; i < r1; i++) {
				var r2 = Math.floor(Math.random() * opts.fxs.length);
				opts.fxs.push(opts.fxs.splice(r2, 1)[0]);
			}
			debug('randomized fx sequence: ', opts.fxs);
		}
		return true;
	}

	// provide a mechanism for adding slides after the slideshow has started

	function exposeAddSlide(opts, els) {
		opts.addSlide = function(newSlide, prepend) {
			var $s = $(newSlide),
				s = $s[0];
			if (!opts.autostopCount)
				opts.countdown++;
			els[prepend ? 'unshift' : 'push'](s);
			if (opts.els)
				opts.els[prepend ? 'unshift' : 'push'](s); // shuffle needs this
			opts.slideCount = els.length;

			// add the slide to the random map and resort
			if (opts.random) {
				opts.randomMap.push(opts.slideCount - 1);
				opts.randomMap.sort(function(a, b) {
					return Math.random() - 0.5;
				});
			}

			$s.css('position', 'absolute');
			$s[prepend ? 'prependTo' : 'appendTo'](opts.$cont);

			if (prepend) {
				opts.currSlide++;
				opts.nextSlide++;
			}

			if (!$.support.opacity && opts.cleartype && !opts.cleartypeNoBg)
				clearTypeFix($s);

			if (opts.fit && opts.width)
				$s.width(opts.width);
			if (opts.fit && opts.height && opts.height != 'auto')
				$s.height(opts.height);
			s.cycleH = (opts.fit && opts.height) ? opts.height : $s.height();
			s.cycleW = (opts.fit && opts.width) ? opts.width : $s.width();

			$s.css(opts.cssBefore);

			if (opts.pager || opts.pagerAnchorBuilder)
				$.fn.cycle.createPagerAnchor(els.length - 1, s, $(opts.pager), els, opts);

			if ($.isFunction(opts.onAddSlide))
				opts.onAddSlide($s);
			else
				$s.hide(); // default behavior
		};
	}

	// reset internal state; we do this on every pass in order to support multiple effects
	$.fn.cycle.resetState = function(opts, fx) {
		fx = fx || opts.fx;
		opts.before = [];
		opts.after = [];
		opts.cssBefore = $.extend({}, opts.original.cssBefore);
		opts.cssAfter = $.extend({}, opts.original.cssAfter);
		opts.animIn = $.extend({}, opts.original.animIn);
		opts.animOut = $.extend({}, opts.original.animOut);
		opts.fxFn = null;
		$.each(opts.original.before, function() {
			opts.before.push(this);
		});
		$.each(opts.original.after, function() {
			opts.after.push(this);
		});

		// re-init
		var init = $.fn.cycle.transitions[fx];
		if ($.isFunction(init))
			init(opts.$cont, $(opts.elements), opts);
	};

	// this is the main engine fn, it handles the timeouts, callbacks and slide index mgmt

	function go(els, opts, manual, fwd) {
		var p = opts.$cont[0],
			curr = els[opts.currSlide],
			next = els[opts.nextSlide];

		// opts.busy is true if we're in the middle of an animation
		if (manual && opts.busy && opts.manualTrump) {
			// let manual transitions requests trump active ones
			debug('manualTrump in go(), stopping active transition');
			$(els).stop(true, true);
			opts.busy = 0;
			clearTimeout(p.cycleTimeout);
		}

		// don't begin another timeout-based transition if there is one active
		if (opts.busy) {
			debug('transition active, ignoring new tx request');
			return;
		}


		// stop cycling if we have an outstanding stop request
		if (p.cycleStop != opts.stopCount || p.cycleTimeout === 0 && !manual)
			return;

		// check to see if we should stop cycling based on autostop options
		if (!manual && !p.cyclePause && !opts.bounce &&
			((opts.autostop && (--opts.countdown <= 0)) ||
				(opts.nowrap && !opts.random && opts.nextSlide < opts.currSlide))) {
			if (opts.end)
				opts.end(opts);
			return;
		}

		// if slideshow is paused, only transition on a manual trigger
		var changed = false;
		if ((manual || !p.cyclePause) && (opts.nextSlide != opts.currSlide)) {
			changed = true;
			var fx = opts.fx;
			// keep trying to get the slide size if we don't have it yet
			curr.cycleH = curr.cycleH || $(curr).height();
			curr.cycleW = curr.cycleW || $(curr).width();
			next.cycleH = next.cycleH || $(next).height();
			next.cycleW = next.cycleW || $(next).width();

			// support multiple transition types
			if (opts.multiFx) {
				if (fwd && (opts.lastFx === undefined || ++opts.lastFx >= opts.fxs.length))
					opts.lastFx = 0;
				else if (!fwd && (opts.lastFx === undefined || --opts.lastFx < 0))
					opts.lastFx = opts.fxs.length - 1;
				fx = opts.fxs[opts.lastFx];
			}

			// one-time fx overrides apply to:  $('div').cycle(3,'zoom');
			if (opts.oneTimeFx) {
				fx = opts.oneTimeFx;
				opts.oneTimeFx = null;
			}

			$.fn.cycle.resetState(opts, fx);

			// run the before callbacks
			if (opts.before.length)
				$.each(opts.before, function(i, o) {
					if (p.cycleStop != opts.stopCount) return;
					o.apply(next, [curr, next, opts, fwd]);
				});

			// stage the after callacks
			var after = function() {
				opts.busy = 0;
				$.each(opts.after, function(i, o) {
					if (p.cycleStop != opts.stopCount) return;
					o.apply(next, [curr, next, opts, fwd]);
				});
				if (!p.cycleStop) {
					// queue next transition
					queueNext();
				}
			};

			debug('tx firing(' + fx + '); currSlide: ' + opts.currSlide + '; nextSlide: ' + opts.nextSlide);

			// get ready to perform the transition
			opts.busy = 1;
			if (opts.fxFn) // fx function provided?
				opts.fxFn(curr, next, opts, after, fwd, manual && opts.fastOnEvent);
			else if ($.isFunction($.fn.cycle[opts.fx])) // fx plugin ?
				$.fn.cycle[opts.fx](curr, next, opts, after, fwd, manual && opts.fastOnEvent);
			else
				$.fn.cycle.custom(curr, next, opts, after, fwd, manual && opts.fastOnEvent);
		} else {
			queueNext();
		}

		if (changed || opts.nextSlide == opts.currSlide) {
			// calculate the next slide
			var roll;
			opts.lastSlide = opts.currSlide;
			if (opts.random) {
				opts.currSlide = opts.nextSlide;
				if (++opts.randomIndex == els.length) {
					opts.randomIndex = 0;
					opts.randomMap.sort(function(a, b) {
						return Math.random() - 0.5;
					});
				}
				opts.nextSlide = opts.randomMap[opts.randomIndex];
				if (opts.nextSlide == opts.currSlide)
					opts.nextSlide = (opts.currSlide == opts.slideCount - 1) ? 0 : opts.currSlide + 1;
			} else if (opts.backwards) {
				roll = (opts.nextSlide - 1) < 0;
				if (roll && opts.bounce) {
					opts.backwards = !opts.backwards;
					opts.nextSlide = 1;
					opts.currSlide = 0;
				} else {
					opts.nextSlide = roll ? (els.length - 1) : opts.nextSlide - 1;
					opts.currSlide = roll ? 0 : opts.nextSlide + 1;
				}
			} else { // sequence
				roll = (opts.nextSlide + 1) == els.length;
				if (roll && opts.bounce) {
					opts.backwards = !opts.backwards;
					opts.nextSlide = els.length - 2;
					opts.currSlide = els.length - 1;
				} else {
					opts.nextSlide = roll ? 0 : opts.nextSlide + 1;
					opts.currSlide = roll ? els.length - 1 : opts.nextSlide - 1;
				}
			}
		}
		if (changed && opts.pager)
			opts.updateActivePagerLink(opts.pager, opts.currSlide, opts.activePagerClass);

		function queueNext() {
			// stage the next transition
			var ms = 0,
				timeout = opts.timeout;
			if (opts.timeout && !opts.continuous) {
				ms = getTimeout(els[opts.currSlide], els[opts.nextSlide], opts, fwd);
				if (opts.fx == 'shuffle')
					ms -= opts.speedOut;
			} else if (opts.continuous && p.cyclePause) // continuous shows work off an after callback, not this timer logic
				ms = 10;
			if (ms > 0)
				p.cycleTimeout = setTimeout(function() {
					go(els, opts, 0, !opts.backwards);
				}, ms);
		}
	}

	// invoked after transition
	$.fn.cycle.updateActivePagerLink = function(pager, currSlide, clsName) {
		$(pager).each(function() {
			$(this).children().removeClass(clsName).eq(currSlide).addClass(clsName);
		});
	};

	// calculate timeout value for current transition

	function getTimeout(curr, next, opts, fwd) {
		if (opts.timeoutFn) {
			// call user provided calc fn
			var t = opts.timeoutFn.call(curr, curr, next, opts, fwd);
			while (opts.fx != 'none' && (t - opts.speed) < 250) // sanitize timeout
				t += opts.speed;
			debug('calculated timeout: ' + t + '; speed: ' + opts.speed);
			if (t !== false)
				return t;
		}
		return opts.timeout;
	}

	// expose next/prev function, caller must pass in state
	$.fn.cycle.next = function(opts) {
		advance(opts, 1);
	};
	$.fn.cycle.prev = function(opts) {
		advance(opts, 0);
	};

	// advance slide forward or back

	function advance(opts, moveForward) {
		var val = moveForward ? 1 : -1;
		var els = opts.elements;
		var p = opts.$cont[0],
			timeout = p.cycleTimeout;
		if (timeout) {
			clearTimeout(timeout);
			p.cycleTimeout = 0;
		}
		if (opts.random && val < 0) {
			// move back to the previously display slide
			opts.randomIndex--;
			if (--opts.randomIndex == -2)
				opts.randomIndex = els.length - 2;
			else if (opts.randomIndex == -1)
				opts.randomIndex = els.length - 1;
			opts.nextSlide = opts.randomMap[opts.randomIndex];
		} else if (opts.random) {
			opts.nextSlide = opts.randomMap[opts.randomIndex];
		} else {
			opts.nextSlide = opts.currSlide + val;
			if (opts.nextSlide < 0) {
				if (opts.nowrap) return false;
				opts.nextSlide = els.length - 1;
			} else if (opts.nextSlide >= els.length) {
				if (opts.nowrap) return false;
				opts.nextSlide = 0;
			}
		}

		var cb = opts.onPrevNextEvent || opts.prevNextClick; // prevNextClick is deprecated
		if ($.isFunction(cb))
			cb(val > 0, opts.nextSlide, els[opts.nextSlide]);
		go(els, opts, 1, moveForward);
		return false;
	}

	function buildPager(els, opts) {
		var $p = $(opts.pager);
		$.each(els, function(i, o) {
			$.fn.cycle.createPagerAnchor(i, o, $p, els, opts);
		});
		opts.updateActivePagerLink(opts.pager, opts.startingSlide, opts.activePagerClass);
	}

	$.fn.cycle.createPagerAnchor = function(i, el, $p, els, opts) {
		var a;
		if ($.isFunction(opts.pagerAnchorBuilder)) {
			a = opts.pagerAnchorBuilder(i, el);
			debug('pagerAnchorBuilder(' + i + ', el) returned: ' + a);
		} else
			a = '<a href="#">' + (i + 1) + '</a>';

		if (!a)
			return;
		var $a = $(a);
		// don't reparent if anchor is in the dom
		if ($a.parents('body').length === 0) {
			var arr = [];
			if ($p.length > 1) {
				$p.each(function() {
					var $clone = $a.clone(true);
					$(this).append($clone);
					arr.push($clone[0]);
				});
				$a = $(arr);
			} else {
				$a.appendTo($p);
			}
		}

		opts.pagerAnchors = opts.pagerAnchors || [];
		opts.pagerAnchors.push($a);

		var pagerFn = function(e) {
			e.preventDefault();
			opts.nextSlide = i;
			var p = opts.$cont[0],
				timeout = p.cycleTimeout;
			if (timeout) {
				clearTimeout(timeout);
				p.cycleTimeout = 0;
			}
			var cb = opts.onPagerEvent || opts.pagerClick; // pagerClick is deprecated
			if ($.isFunction(cb))
				cb(opts.nextSlide, els[opts.nextSlide]);
			go(els, opts, 1, opts.currSlide < i); // trigger the trans
			//      return false; // <== allow bubble
		};

		if (/mouseenter|mouseover/i.test(opts.pagerEvent)) {
			$a.hover(pagerFn, function() { /* no-op */ });
		} else {
			$a.bind(opts.pagerEvent, pagerFn);
		}

		if (!/^click/.test(opts.pagerEvent) && !opts.allowPagerClickBubble)
			$a.bind('click.cycle', function() {
				return false;
			}); // suppress click

		var cont = opts.$cont[0];
		var pauseFlag = false; // https://github.com/malsup/cycle/issues/44
		if (opts.pauseOnPagerHover) {
			$a.hover(
				function() {
					pauseFlag = true;
					cont.cyclePause++;
					triggerPause(cont, true, true);
				}, function() {
					if (pauseFlag)
						cont.cyclePause--;
					triggerPause(cont, true, true);
				}
			);
		}
	};

	// helper fn to calculate the number of slides between the current and the next
	$.fn.cycle.hopsFromLast = function(opts, fwd) {
		var hops, l = opts.lastSlide,
			c = opts.currSlide;
		if (fwd)
			hops = c > l ? c - l : opts.slideCount - l;
		else
			hops = c < l ? l - c : l + opts.slideCount - c;
		return hops;
	};

	// fix clearType problems in ie6 by setting an explicit bg color
	// (otherwise text slides look horrible during a fade transition)

	function clearTypeFix($slides) {
		debug('applying clearType background-color hack');

		function hex(s) {
			s = parseInt(s, 10).toString(16);
			return s.length < 2 ? '0' + s : s;
		}

		function getBg(e) {
			for (; e && e.nodeName.toLowerCase() != 'html'; e = e.parentNode) {
				var v = $.css(e, 'background-color');
				if (v && v.indexOf('rgb') >= 0) {
					var rgb = v.match(/\d+/g);
					return '#' + hex(rgb[0]) + hex(rgb[1]) + hex(rgb[2]);
				}
				if (v && v != 'transparent')
					return v;
			}
			return '#ffffff';
		}
		$slides.each(function() {
			$(this).css('background-color', getBg(this));
		});
	}

	// reset common props before the next transition
	$.fn.cycle.commonReset = function(curr, next, opts, w, h, rev) {
		$(opts.elements).not(curr).hide();
		if (typeof opts.cssBefore.opacity == 'undefined')
			opts.cssBefore.opacity = 1;
		opts.cssBefore.display = 'block';
		if (opts.slideResize && w !== false && next.cycleW > 0)
			opts.cssBefore.width = next.cycleW;
		if (opts.slideResize && h !== false && next.cycleH > 0)
			opts.cssBefore.height = next.cycleH;
		opts.cssAfter = opts.cssAfter || {};
		opts.cssAfter.display = 'none';
		$(curr).css('zIndex', opts.slideCount + (rev === true ? 1 : 0));
		$(next).css('zIndex', opts.slideCount + (rev === true ? 0 : 1));
	};

	// the actual fn for effecting a transition
	$.fn.cycle.custom = function(curr, next, opts, cb, fwd, speedOverride) {
		var $l = $(curr),
			$n = $(next);
		var speedIn = opts.speedIn,
			speedOut = opts.speedOut,
			easeIn = opts.easeIn,
			easeOut = opts.easeOut;
		$n.css(opts.cssBefore);
		if (speedOverride) {
			if (typeof speedOverride == 'number')
				speedIn = speedOut = speedOverride;
			else
				speedIn = speedOut = 1;
			easeIn = easeOut = null;
		}
		var fn = function() {
			$n.animate(opts.animIn, speedIn, easeIn, function() {
				cb();
			});
		};
		$l.animate(opts.animOut, speedOut, easeOut, function() {
			$l.css(opts.cssAfter);
			if (!opts.sync)
				fn();
		});
		if (opts.sync) fn();
	};

	// transition definitions - only fade is defined here, transition pack defines the rest
	$.fn.cycle.transitions = {
		fade: function($cont, $slides, opts) {
			$slides.not(':eq(' + opts.currSlide + ')').css('opacity', 0);
			opts.before.push(function(curr, next, opts) {
				$.fn.cycle.commonReset(curr, next, opts);
				opts.cssBefore.opacity = 0;
			});
			opts.animIn = {
				opacity: 1
			};
			opts.animOut = {
				opacity: 0
			};
			opts.cssBefore = {
				top: 0,
				left: 0
			};
		}
	};

	$.fn.cycle.ver = function() {
		return ver;
	};

	// override these globally if you like (they are all optional)
	$.fn.cycle.defaults = {
		activePagerClass: 'activeSlide', // class name used for the active pager link
		after: null, // transition callback (scope set to element that was shown):  function(currSlideElement, nextSlideElement, options, forwardFlag)
		allowPagerClickBubble: false, // allows or prevents click event on pager anchors from bubbling
		animIn: null, // properties that define how the slide animates in
		animOut: null, // properties that define how the slide animates out
		aspect: false, // preserve aspect ratio during fit resizing, cropping if necessary (must be used with fit option)
		autostop: 0, // true to end slideshow after X transitions (where X == slide count)
		autostopCount: 0, // number of transitions (optionally used with autostop to define X)
		backwards: false, // true to start slideshow at last slide and move backwards through the stack
		before: null, // transition callback (scope set to element to be shown):     function(currSlideElement, nextSlideElement, options, forwardFlag)
		center: null, // set to true to have cycle add top/left margin to each slide (use with width and height options)
		cleartype: !$.support.opacity, // true if clearType corrections should be applied (for IE)
		cleartypeNoBg: false, // set to true to disable extra cleartype fixing (leave false to force background color setting on slides)
		containerResize: 1, // resize container to fit largest slide
		containerResizeHeight: 0, // resize containers height to fit the largest slide but leave the width dynamic
		continuous: 0, // true to start next transition immediately after current one completes
		cssAfter: null, // properties that defined the state of the slide after transitioning out
		cssBefore: null, // properties that define the initial state of the slide before transitioning in
		delay: 0, // additional delay (in ms) for first transition (hint: can be negative)
		easeIn: null, // easing for "in" transition
		easeOut: null, // easing for "out" transition
		easing: null, // easing method for both in and out transitions
		end: null, // callback invoked when the slideshow terminates (use with autostop or nowrap options): function(options)
		fastOnEvent: 0, // force fast transitions when triggered manually (via pager or prev/next); value == time in ms
		fit: 0, // force slides to fit container
		fx: 'fade', // name of transition effect (or comma separated names, ex: 'fade,scrollUp,shuffle')
		fxFn: null, // function used to control the transition: function(currSlideElement, nextSlideElement, options, afterCalback, forwardFlag)
		height: 'auto', // container height (if the 'fit' option is true, the slides will be set to this height as well)
		manualTrump: true, // causes manual transition to stop an active transition instead of being ignored
		metaAttr: 'cycle', // data- attribute that holds the option data for the slideshow
		next: null, // element, jQuery object, or jQuery selector string for the element to use as event trigger for next slide
		nowrap: 0, // true to prevent slideshow from wrapping
		onPagerEvent: null, // callback fn for pager events: function(zeroBasedSlideIndex, slideElement)
		onPrevNextEvent: null, // callback fn for prev/next events: function(isNext, zeroBasedSlideIndex, slideElement)
		pager: null, // element, jQuery object, or jQuery selector string for the element to use as pager container
		pagerAnchorBuilder: null, // callback fn for building anchor links:  function(index, DOMelement)
		pagerEvent: 'click.cycle', // name of event which drives the pager navigation
		pause: 0, // true to enable "pause on hover"
		pauseOnPagerHover: 0, // true to pause when hovering over pager link
		prev: null, // element, jQuery object, or jQuery selector string for the element to use as event trigger for previous slide
		prevNextEvent: 'click.cycle', // event which drives the manual transition to the previous or next slide
		random: 0, // true for random, false for sequence (not applicable to shuffle fx)
		randomizeEffects: 1, // valid when multiple effects are used; true to make the effect sequence random
		requeueOnImageNotLoaded: true, // requeue the slideshow if any image slides are not yet loaded
		requeueTimeout: 250, // ms delay for requeue
		rev: 0, // causes animations to transition in reverse (for effects that support it such as scrollHorz/scrollVert/shuffle)
		shuffle: null, // coords for shuffle animation, ex: { top:15, left: 200 }
		skipInitializationCallbacks: false, // set to true to disable the first before/after callback that occurs prior to any transition
		slideExpr: null, // expression for selecting slides (if something other than all children is required)
		slideResize: 1, // force slide width/height to fixed size before every transition
		speed: 1000, // speed of the transition (any valid fx speed value)
		speedIn: null, // speed of the 'in' transition
		speedOut: null, // speed of the 'out' transition
		startingSlide: undefined, // zero-based index of the first slide to be displayed
		sync: 1, // true if in/out transitions should occur simultaneously
		timeout: 4000, // milliseconds between slide transitions (0 to disable auto advance)
		timeoutFn: null, // callback for determining per-slide timeout value:  function(currSlideElement, nextSlideElement, options, forwardFlag)
		updateActivePagerLink: null, // callback fn invoked to update the active pager link (adds/removes activePagerClass style)
		width: null // container width (if the 'fit' option is true, the slides will be set to this width as well)
	};

})(jQuery);


/*!
 * jQuery Cycle Plugin Transition Definitions
 * This script is a plugin for the jQuery Cycle Plugin
 * Examples and documentation at: http://malsup.com/jquery/cycle/
 * Copyright (c) 2007-2010 M. Alsup
 * Version:  2.73
 * Dual licensed under the MIT and GPL licenses:
 * http://www.opensource.org/licenses/mit-license.php
 * http://www.gnu.org/licenses/gpl.html
 */
(function($) {
	"use strict";

	//
	// These functions define slide initialization and properties for the named
	// transitions. To save file size feel free to remove any of these that you
	// don't need.
	//
	$.fn.cycle.transitions.none = function($cont, $slides, opts) {
		opts.fxFn = function(curr, next, opts, after) {
			$(next).show();
			$(curr).hide();
			after();
		};
	};

	// not a cross-fade, fadeout only fades out the top slide
	$.fn.cycle.transitions.fadeout = function($cont, $slides, opts) {
		$slides.not(':eq(' + opts.currSlide + ')').css({
			display: 'block',
			'opacity': 1
		});
		opts.before.push(function(curr, next, opts, w, h, rev) {
			$(curr).css('zIndex', opts.slideCount + (rev !== true ? 1 : 0));
			$(next).css('zIndex', opts.slideCount + (rev !== true ? 0 : 1));
		});
		opts.animIn.opacity = 1;
		opts.animOut.opacity = 0;
		opts.cssBefore.opacity = 1;
		opts.cssBefore.display = 'block';
		opts.cssAfter.zIndex = 0;
	};

	// scrollUp/Down/Left/Right
	$.fn.cycle.transitions.scrollUp = function($cont, $slides, opts) {
		$cont.css('overflow', 'hidden');
		opts.before.push($.fn.cycle.commonReset);
		var h = $cont.height();
		opts.cssBefore.top = h;
		opts.cssBefore.left = 0;
		opts.cssFirst.top = 0;
		opts.animIn.top = 0;
		opts.animOut.top = -h;
	};
	$.fn.cycle.transitions.scrollDown = function($cont, $slides, opts) {
		$cont.css('overflow', 'hidden');
		opts.before.push($.fn.cycle.commonReset);
		var h = $cont.height();
		opts.cssFirst.top = 0;
		opts.cssBefore.top = -h;
		opts.cssBefore.left = 0;
		opts.animIn.top = 0;
		opts.animOut.top = h;
	};
	$.fn.cycle.transitions.scrollLeft = function($cont, $slides, opts) {
		$cont.css('overflow', 'hidden');
		opts.before.push($.fn.cycle.commonReset);
		var w = $cont.width();
		opts.cssFirst.left = 0;
		opts.cssBefore.left = w;
		opts.cssBefore.top = 0;
		opts.animIn.left = 0;
		opts.animOut.left = 0 - w;
	};
	$.fn.cycle.transitions.scrollRight = function($cont, $slides, opts) {
		$cont.css('overflow', 'hidden');
		opts.before.push($.fn.cycle.commonReset);
		var w = $cont.width();
		opts.cssFirst.left = 0;
		opts.cssBefore.left = -w;
		opts.cssBefore.top = 0;
		opts.animIn.left = 0;
		opts.animOut.left = w;
	};
	$.fn.cycle.transitions.scrollHorz = function($cont, $slides, opts) {
		$cont.css('overflow', 'hidden').width();
		opts.before.push(function(curr, next, opts, fwd) {
			if (opts.rev)
				fwd = !fwd;
			$.fn.cycle.commonReset(curr, next, opts);
			opts.cssBefore.left = fwd ? (next.cycleW - 1) : (1 - next.cycleW);
			opts.animOut.left = fwd ? -curr.cycleW : curr.cycleW;
		});
		opts.cssFirst.left = 0;
		opts.cssBefore.top = 0;
		opts.animIn.left = 0;
		opts.animOut.top = 0;
	};
	$.fn.cycle.transitions.scrollVert = function($cont, $slides, opts) {
		$cont.css('overflow', 'hidden');
		opts.before.push(function(curr, next, opts, fwd) {
			if (opts.rev)
				fwd = !fwd;
			$.fn.cycle.commonReset(curr, next, opts);
			opts.cssBefore.top = fwd ? (1 - next.cycleH) : (next.cycleH - 1);
			opts.animOut.top = fwd ? curr.cycleH : -curr.cycleH;
		});
		opts.cssFirst.top = 0;
		opts.cssBefore.left = 0;
		opts.animIn.top = 0;
		opts.animOut.left = 0;
	};

	// slideX/slideY
	$.fn.cycle.transitions.slideX = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$(opts.elements).not(curr).hide();
			$.fn.cycle.commonReset(curr, next, opts, false, true);
			opts.animIn.width = next.cycleW;
		});
		opts.cssBefore.left = 0;
		opts.cssBefore.top = 0;
		opts.cssBefore.width = 0;
		opts.animIn.width = 'show';
		opts.animOut.width = 0;
	};
	$.fn.cycle.transitions.slideY = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$(opts.elements).not(curr).hide();
			$.fn.cycle.commonReset(curr, next, opts, true, false);
			opts.animIn.height = next.cycleH;
		});
		opts.cssBefore.left = 0;
		opts.cssBefore.top = 0;
		opts.cssBefore.height = 0;
		opts.animIn.height = 'show';
		opts.animOut.height = 0;
	};

	// shuffle
	$.fn.cycle.transitions.shuffle = function($cont, $slides, opts) {
		var i, w = $cont.css('overflow', 'visible').width();
		$slides.css({
			left: 0,
			top: 0
		});
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, true, true, true);
		});
		// only adjust speed once!
		if (!opts.speedAdjusted) {
			opts.speed = opts.speed / 2; // shuffle has 2 transitions
			opts.speedAdjusted = true;
		}
		opts.random = 0;
		opts.shuffle = opts.shuffle || {
			left: -w,
			top: 15
		};
		opts.els = [];
		for (i = 0; i < $slides.length; i++)
			opts.els.push($slides[i]);

		for (i = 0; i < opts.currSlide; i++)
			opts.els.push(opts.els.shift());

		// custom transition fn (hat tip to Benjamin Sterling for this bit of sweetness!)
		opts.fxFn = function(curr, next, opts, cb, fwd) {
			if (opts.rev)
				fwd = !fwd;
			var $el = fwd ? $(curr) : $(next);
			$(next).css(opts.cssBefore);
			var count = opts.slideCount;
			$el.animate(opts.shuffle, opts.speedIn, opts.easeIn, function() {
				var hops = $.fn.cycle.hopsFromLast(opts, fwd);
				for (var k = 0; k < hops; k++) {
					if (fwd)
						opts.els.push(opts.els.shift());
					else
						opts.els.unshift(opts.els.pop());
				}
				if (fwd) {
					for (var i = 0, len = opts.els.length; i < len; i++)
						$(opts.els[i]).css('z-index', len - i + count);
				} else {
					var z = $(curr).css('z-index');
					$el.css('z-index', parseInt(z, 10) + 1 + count);
				}
				$el.animate({
					left: 0,
					top: 0
				}, opts.speedOut, opts.easeOut, function() {
					$(fwd ? this : curr).hide();
					if (cb) cb();
				});
			});
		};
		$.extend(opts.cssBefore, {
			display: 'block',
			opacity: 1,
			top: 0,
			left: 0
		});
	};

	// turnUp/Down/Left/Right
	$.fn.cycle.transitions.turnUp = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, true, false);
			opts.cssBefore.top = next.cycleH;
			opts.animIn.height = next.cycleH;
			opts.animOut.width = next.cycleW;
		});
		opts.cssFirst.top = 0;
		opts.cssBefore.left = 0;
		opts.cssBefore.height = 0;
		opts.animIn.top = 0;
		opts.animOut.height = 0;
	};
	$.fn.cycle.transitions.turnDown = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, true, false);
			opts.animIn.height = next.cycleH;
			opts.animOut.top = curr.cycleH;
		});
		opts.cssFirst.top = 0;
		opts.cssBefore.left = 0;
		opts.cssBefore.top = 0;
		opts.cssBefore.height = 0;
		opts.animOut.height = 0;
	};
	$.fn.cycle.transitions.turnLeft = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, false, true);
			opts.cssBefore.left = next.cycleW;
			opts.animIn.width = next.cycleW;
		});
		opts.cssBefore.top = 0;
		opts.cssBefore.width = 0;
		opts.animIn.left = 0;
		opts.animOut.width = 0;
	};
	$.fn.cycle.transitions.turnRight = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, false, true);
			opts.animIn.width = next.cycleW;
			opts.animOut.left = curr.cycleW;
		});
		$.extend(opts.cssBefore, {
			top: 0,
			left: 0,
			width: 0
		});
		opts.animIn.left = 0;
		opts.animOut.width = 0;
	};

	// zoom
	$.fn.cycle.transitions.zoom = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, false, false, true);
			opts.cssBefore.top = next.cycleH / 2;
			opts.cssBefore.left = next.cycleW / 2;
			$.extend(opts.animIn, {
				top: 0,
				left: 0,
				width: next.cycleW,
				height: next.cycleH
			});
			$.extend(opts.animOut, {
				width: 0,
				height: 0,
				top: curr.cycleH / 2,
				left: curr.cycleW / 2
			});
		});
		opts.cssFirst.top = 0;
		opts.cssFirst.left = 0;
		opts.cssBefore.width = 0;
		opts.cssBefore.height = 0;
	};

	// fadeZoom
	$.fn.cycle.transitions.fadeZoom = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, false, false);
			opts.cssBefore.left = next.cycleW / 2;
			opts.cssBefore.top = next.cycleH / 2;
			$.extend(opts.animIn, {
				top: 0,
				left: 0,
				width: next.cycleW,
				height: next.cycleH
			});
		});
		opts.cssBefore.width = 0;
		opts.cssBefore.height = 0;
		opts.animOut.opacity = 0;
	};

	// blindX
	$.fn.cycle.transitions.blindX = function($cont, $slides, opts) {
		var w = $cont.css('overflow', 'hidden').width();
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts);
			opts.animIn.width = next.cycleW;
			opts.animOut.left = curr.cycleW;
		});
		opts.cssBefore.left = w;
		opts.cssBefore.top = 0;
		opts.animIn.left = 0;
		opts.animOut.left = w;
	};
	// blindY
	$.fn.cycle.transitions.blindY = function($cont, $slides, opts) {
		var h = $cont.css('overflow', 'hidden').height();
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts);
			opts.animIn.height = next.cycleH;
			opts.animOut.top = curr.cycleH;
		});
		opts.cssBefore.top = h;
		opts.cssBefore.left = 0;
		opts.animIn.top = 0;
		opts.animOut.top = h;
	};
	// blindZ
	$.fn.cycle.transitions.blindZ = function($cont, $slides, opts) {
		var h = $cont.css('overflow', 'hidden').height();
		var w = $cont.width();
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts);
			opts.animIn.height = next.cycleH;
			opts.animOut.top = curr.cycleH;
		});
		opts.cssBefore.top = h;
		opts.cssBefore.left = w;
		opts.animIn.top = 0;
		opts.animIn.left = 0;
		opts.animOut.top = h;
		opts.animOut.left = w;
	};

	// growX - grow horizontally from centered 0 width
	$.fn.cycle.transitions.growX = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, false, true);
			opts.cssBefore.left = this.cycleW / 2;
			opts.animIn.left = 0;
			opts.animIn.width = this.cycleW;
			opts.animOut.left = 0;
		});
		opts.cssBefore.top = 0;
		opts.cssBefore.width = 0;
	};
	// growY - grow vertically from centered 0 height
	$.fn.cycle.transitions.growY = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, true, false);
			opts.cssBefore.top = this.cycleH / 2;
			opts.animIn.top = 0;
			opts.animIn.height = this.cycleH;
			opts.animOut.top = 0;
		});
		opts.cssBefore.height = 0;
		opts.cssBefore.left = 0;
	};

	// curtainX - squeeze in both edges horizontally
	$.fn.cycle.transitions.curtainX = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, false, true, true);
			opts.cssBefore.left = next.cycleW / 2;
			opts.animIn.left = 0;
			opts.animIn.width = this.cycleW;
			opts.animOut.left = curr.cycleW / 2;
			opts.animOut.width = 0;
		});
		opts.cssBefore.top = 0;
		opts.cssBefore.width = 0;
	};
	// curtainY - squeeze in both edges vertically
	$.fn.cycle.transitions.curtainY = function($cont, $slides, opts) {
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, true, false, true);
			opts.cssBefore.top = next.cycleH / 2;
			opts.animIn.top = 0;
			opts.animIn.height = next.cycleH;
			opts.animOut.top = curr.cycleH / 2;
			opts.animOut.height = 0;
		});
		opts.cssBefore.height = 0;
		opts.cssBefore.left = 0;
	};

	// cover - curr slide covered by next slide
	$.fn.cycle.transitions.cover = function($cont, $slides, opts) {
		var d = opts.direction || 'left';
		var w = $cont.css('overflow', 'hidden').width();
		var h = $cont.height();
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts);
			opts.cssAfter.display = '';
			if (d == 'right')
				opts.cssBefore.left = -w;
			else if (d == 'up')
				opts.cssBefore.top = h;
			else if (d == 'down')
				opts.cssBefore.top = -h;
			else
				opts.cssBefore.left = w;
		});
		opts.animIn.left = 0;
		opts.animIn.top = 0;
		opts.cssBefore.top = 0;
		opts.cssBefore.left = 0;
	};

	// uncover - curr slide moves off next slide
	$.fn.cycle.transitions.uncover = function($cont, $slides, opts) {
		var d = opts.direction || 'left';
		var w = $cont.css('overflow', 'hidden').width();
		var h = $cont.height();
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, true, true, true);
			if (d == 'right')
				opts.animOut.left = w;
			else if (d == 'up')
				opts.animOut.top = -h;
			else if (d == 'down')
				opts.animOut.top = h;
			else
				opts.animOut.left = -w;
		});
		opts.animIn.left = 0;
		opts.animIn.top = 0;
		opts.cssBefore.top = 0;
		opts.cssBefore.left = 0;
	};

	// toss - move top slide and fade away
	$.fn.cycle.transitions.toss = function($cont, $slides, opts) {
		var w = $cont.css('overflow', 'visible').width();
		var h = $cont.height();
		opts.before.push(function(curr, next, opts) {
			$.fn.cycle.commonReset(curr, next, opts, true, true, true);
			// provide default toss settings if animOut not provided
			if (!opts.animOut.left && !opts.animOut.top)
				$.extend(opts.animOut, {
					left: w * 2,
					top: -h / 2,
					opacity: 0
				});
			else
				opts.animOut.opacity = 0;
		});
		opts.cssBefore.left = 0;
		opts.cssBefore.top = 0;
		opts.animIn.left = 0;
	};

	// wipe - clip animation
	$.fn.cycle.transitions.wipe = function($cont, $slides, opts) {
		var w = $cont.css('overflow', 'hidden').width();
		var h = $cont.height();
		opts.cssBefore = opts.cssBefore || {};
		var clip;
		if (opts.clip) {
			if (/l2r/.test(opts.clip))
				clip = 'rect(0px 0px ' + h + 'px 0px)';
			else if (/r2l/.test(opts.clip))
				clip = 'rect(0px ' + w + 'px ' + h + 'px ' + w + 'px)';
			else if (/t2b/.test(opts.clip))
				clip = 'rect(0px ' + w + 'px 0px 0px)';
			else if (/b2t/.test(opts.clip))
				clip = 'rect(' + h + 'px ' + w + 'px ' + h + 'px 0px)';
			else if (/zoom/.test(opts.clip)) {
				var top = parseInt(h / 2, 10);
				var left = parseInt(w / 2, 10);
				clip = 'rect(' + top + 'px ' + left + 'px ' + top + 'px ' + left + 'px)';
			}
		}

		opts.cssBefore.clip = opts.cssBefore.clip || clip || 'rect(0px 0px 0px 0px)';

		var d = opts.cssBefore.clip.match(/(\d+)/g);
		var t = parseInt(d[0], 10),
			r = parseInt(d[1], 10),
			b = parseInt(d[2], 10),
			l = parseInt(d[3], 10);

		opts.before.push(function(curr, next, opts) {
			if (curr == next) return;
			var $curr = $(curr),
				$next = $(next);
			$.fn.cycle.commonReset(curr, next, opts, true, true, false);
			opts.cssAfter.display = 'block';

			var step = 1,
				count = parseInt((opts.speedIn / 13), 10) - 1;
			(function f() {
				var tt = t ? t - parseInt(step * (t / count), 10) : 0;
				var ll = l ? l - parseInt(step * (l / count), 10) : 0;
				var bb = b < h ? b + parseInt(step * ((h - b) / count || 1), 10) : h;
				var rr = r < w ? r + parseInt(step * ((w - r) / count || 1), 10) : w;
				$next.css({
					clip: 'rect(' + tt + 'px ' + rr + 'px ' + bb + 'px ' + ll + 'px)'
				});
				(step++ <= count) ? setTimeout(f, 13) : $curr.css('display', 'none');
			})();
		});
		$.extend(opts.cssBefore, {
			display: 'block',
			opacity: 1,
			top: 0,
			left: 0
		});
		opts.animIn = {
			left: 0
		};
		opts.animOut = {
			left: 0
		};
	};

})(jQuery);









/*!
 * iCheck v0.9.1, http://git.io/uhUPMA
 * =================================
 * Powerful jQuery plugin for checkboxes and radio buttons customization
 *
 * (c) 2013 Damir Foy, http://damirfoy.com
 * MIT Licensed
 */

(function($) {

	// Cached vars
	var _iCheck = 'iCheck',
		_iCheckHelper = _iCheck + '-helper',
		_checkbox = 'checkbox',
		_radio = 'radio',
		_checked = 'checked',
		_unchecked = 'un' + _checked,
		_disabled = 'disabled',
		_determinate = 'determinate',
		_indeterminate = 'in' + _determinate,
		_update = 'update',
		_type = 'type',
		_click = 'click',
		_touch = 'touchbegin.i touchend.i',
		_add = 'addClass',
		_remove = 'removeClass',
		_callback = 'trigger',
		_label = 'label',
		_cursor = 'cursor',
		_mobile = /ipad|iphone|ipod|android|blackberry|windows phone|opera mini|silk/i.test(navigator.userAgent);

	// Plugin init
	$.fn[_iCheck] = function(options, fire) {

		// Walker
		var handle = ':' + _checkbox + ', :' + _radio,
			stack = $(),
			walker = function(object) {
				object.each(function() {
					var self = $(this);

					if (self.is(handle)) {
						stack = stack.add(self);
					} else {
						stack = stack.add(self.find(handle));
					};
				});
			};

		// Check if we should operate with some method
		if (/^(check|uncheck|toggle|indeterminate|determinate|disable|enable|update|destroy)$/i.test(options)) {

			// Normalize method's name
			options = options.toLowerCase();

			// Find checkboxes and radio buttons
			walker(this);

			return stack.each(function() {
				if (options == 'destroy') {
					tidy(this, 'ifDestroyed');
				} else {
					operate($(this), true, options);
				};

				// Fire method's callback
				if ($.isFunction(fire)) {
					fire();
				};
			});

			// Customization
		} else if (typeof options == 'object' || !options) {

			// Check if any options were passed
			var settings = $.extend({
				checkedClass: _checked,
				disabledClass: _disabled,
				indeterminateClass: _indeterminate,
				labelHover: true
			}, options),

				selector = settings.handle,
				hoverClass = settings.hoverClass || 'hover',
				focusClass = settings.focusClass || 'focus',
				activeClass = settings.activeClass || 'active',
				labelHover = !! settings.labelHover,
				labelHoverClass = settings.labelHoverClass || 'hover',

				// Setup clickable area
				area = ('' + settings.increaseArea).replace('%', '') | 0;

			// Selector limit
			if (selector == _checkbox || selector == _radio) {
				handle = ':' + selector;
			};

			// Clickable area limit
			if (area < -50) {
				area = -50;
			};

			// Walk around the selector
			walker(this);

			return stack.each(function() {

				// If already customized
				tidy(this);

				var self = $(this),
					node = this,
					id = node.id,

					// Layer styles
					offset = -area + '%',
					size = 100 + (area * 2) + '%',
					layer = {
						position: 'absolute',
						top: offset,
						left: offset,
						display: 'block',
						width: size,
						height: size,
						margin: 0,
						padding: 0,
						background: '#fff',
						border: 0,
						opacity: 0
					},

					// Choose how to hide input
					hide = _mobile ? {
						position: 'absolute',
						visibility: 'hidden'
					} : area ? layer : {
						position: 'absolute',
						opacity: 0
					},

					// Get proper class
					className = node[_type] == _checkbox ? settings.checkboxClass || 'i' + _checkbox : settings.radioClass || 'i' + _radio,

					// Find assigned labels
					label = $(_label + '[for="' + id + '"]').add(self.closest(_label)),

					// Wrap input
					parent = self.wrap('<div class="' + className + '"/>')[_callback]('ifCreated').parent().append(settings.insert),

					// Layer addition
					helper = $('<ins class="' + _iCheckHelper + '"/>').css(layer).appendTo(parent);

				// Finalize customization
				self.data(_iCheck, {
					o: settings,
					s: self.attr('style')
				}).css(hide); !! settings.inheritClass && parent[_add](node.className); !! settings.inheritID && id && parent.attr('id', _iCheck + '-' + id);
				parent.css('position') == 'static' && parent.css('position', 'relative');
				operate(self, true, _update);

				// Label events
				if (label.length) {
					label.on(_click + '.i mouseenter.i mouseleave.i ' + _touch, function(event) {
						var type = event[_type],
							item = $(this);

						// Do nothing if input is disabled
						if (!node[_disabled]) {

							// Click
							if (type == _click) {
								operate(self, false, true);

								// Hover state
							} else if (labelHover) {

								// mouseleave|touchend
								if (/ve|nd/.test(type)) {
									parent[_remove](hoverClass);
									item[_remove](labelHoverClass);
								} else {
									parent[_add](hoverClass);
									item[_add](labelHoverClass);
								};
							};

							if (_mobile) {
								event.stopPropagation();
							} else {
								return false;
							};
						};
					});
				};

				// Input events
				self.on(_click + '.i focus.i blur.i keyup.i keydown.i keypress.i', function(event) {
					var type = event[_type],
						key = event.keyCode;

					// Click
					if (type == _click) {
						return false;

						// Keydown
					} else if (type == 'keydown' && key == 32) {
						if (!(node[_type] == _radio && node[_checked])) {
							if (node[_checked]) {
								off(self, _checked);
							} else {
								on(self, _checked);
							};
						};

						return false;

						// Keyup
					} else if (type == 'keyup' && node[_type] == _radio) {
						!node[_checked] && on(self, _checked);

						// Focus/blur
					} else if (/us|ur/.test(type)) {
						parent[type == 'blur' ? _remove : _add](focusClass);
					};
				});

				// Helper events
				helper.on(_click + ' mousedown mouseup mouseover mouseout ' + _touch, function(event) {
					var type = event[_type],

						// mousedown|mouseup
						toggle = /wn|up/.test(type) ? activeClass : hoverClass;

					// Do nothing if input is disabled
					if (!node[_disabled]) {

						// Click
						if (type == _click) {
							operate(self, false, true);

							// Active and hover states
						} else {

							// State is on
							if (/wn|er|in/.test(type)) {

								// mousedown|mouseover|touchbegin
								parent[_add](toggle);

								// State is off
							} else {
								parent[_remove](toggle + ' ' + activeClass);
							};

							// Label hover
							if (label.length && labelHover && toggle == hoverClass) {

								// mouseout|touchend
								label[/ut|nd/.test(type) ? _remove : _add](labelHoverClass);
							};
						};

						if (_mobile) {
							event.stopPropagation();
						} else {
							return false;
						};
					};
				});
			});
		} else {
			return this;
		};
	};

	// Do something with inputs

	function operate(input, direct, method) {
		var node = input[0];
		state = /er/.test(method) ? _indeterminate : /bl/.test(method) ? _disabled : _checked,
		active = method == _update ? {
			checked: node[_checked],
			disabled: node[_disabled],
			indeterminate: input.attr(_indeterminate) == 'true' || input.attr(_determinate) == 'false'
		} : node[state];

		// Check, disable or indeterminate
		if (/^(ch|di|in)/.test(method) && !active) {
			on(input, state);

			// Uncheck, enable or determinate
		} else if (/^(un|en|de)/.test(method) && active) {
			off(input, state);

			// Update
		} else if (method == _update) {

			// Handle states
			for (var state in active) {
				if (active[state]) {
					on(input, state, true);
				} else {
					off(input, state, true);
				};
			};

		} else if (!direct || method == 'toggle') {

			// Helper or label was clicked
			if (!direct) {
				input[_callback]('ifClicked');
			};

			// Toggle checked state
			if (active) {
				if (node[_type] !== _radio) {
					off(input, state);
				};
			} else {
				on(input, state);
			};
		};
	};

	// Add checked, disabled or indeterminate state

	function on(input, state, keep) {
		var node = input[0],
			parent = input.parent(),
			checked = state == _checked,
			indeterminate = state == _indeterminate,
			callback = indeterminate ? _determinate : checked ? _unchecked : 'enabled',
			regular = option(node, callback + capitalize(node[_type])),
			specific = option(node, state + capitalize(node[_type]));

		// Prevent unnecessary actions
		if (node[state] !== true) {

			// Toggle assigned radio buttons
			if (!keep && state == _checked && node[_type] == _radio && node.name) {
				var form = input.closest('form'),
					inputs = 'input[name="' + node.name + '"]';

				inputs = form.length ? form.find(inputs) : $(inputs);

				inputs.each(function() {
					if (this !== node && $.data(this, _iCheck)) {
						off($(this), state);
					};
				});
			};

			// Indeterminate state
			if (indeterminate) {

				// Add indeterminate state
				node[state] = true;

				// Remove checked state
				if (node[_checked]) {
					off(input, _checked, 'force');
				};

				// Checked or disabled state
			} else {

				// Add checked or disabled state
				if (!keep) {
					node[state] = true;
				};

				// Remove indeterminate state
				if (checked && node[_indeterminate]) {
					off(input, _indeterminate, false);
				};
			};

			// Trigger callbacks
			callbacks(input, checked, state, keep);
		};

		// Add proper cursor
		if (node[_disabled] && !! option(node, _cursor, true)) {
			parent.find('.' + _iCheckHelper).css(_cursor, 'default');
		};

		// Add state class
		parent[_add](specific || option(node, state));

		// Remove regular state class
		parent[_remove](regular || option(node, callback) || '');
	};

	// Remove checked, disabled or indeterminate state

	function off(input, state, keep) {
		var node = input[0],
			parent = input.parent(),
			checked = state == _checked,
			indeterminate = state == _indeterminate,
			callback = indeterminate ? _determinate : checked ? _unchecked : 'enabled',
			regular = option(node, callback + capitalize(node[_type])),
			specific = option(node, state + capitalize(node[_type]));

		// Prevent unnecessary actions
		if (node[state] !== false) {

			// Toggle state
			if (indeterminate || !keep || keep == 'force') {
				node[state] = false;
			};

			// Trigger callbacks
			callbacks(input, checked, callback, keep);
		};

		// Add proper cursor
		if (!node[_disabled] && !! option(node, _cursor, true)) {
			parent.find('.' + _iCheckHelper).css(_cursor, 'pointer');
		};

		// Remove state class
		parent[_remove](specific || option(node, state) || '');

		// Add regular state class
		parent[_add](regular || option(node, callback));
	};

	// Remove all traces

	function tidy(node, callback) {
		if ($.data(node, _iCheck)) {
			var input = $(node);

			// Remove everything except input
			input.parent().html(input.attr('style', $.data(node, _iCheck).s || '')[_callback](callback || ''));

			// Unbind events
			input.off('.i').unwrap();
			$(_label + '[for="' + node.id + '"]').add(input.closest(_label)).off('.i');
		};
	};

	// Get some option

	function option(node, state, regular) {
		if ($.data(node, _iCheck)) {
			return $.data(node, _iCheck).o[state + (regular ? '' : 'Class')];
		};
	};

	// Capitalize some string

	function capitalize(string) {
		return string.charAt(0).toUpperCase() + string.slice(1);
	};

	// Executable handlers

	function callbacks(input, checked, callback, keep) {
		if (!keep) {
			if (checked) {
				input[_callback]('ifToggled');
			};

			input[_callback]('ifChanged')[_callback]('if' + capitalize(callback));
		};
	};
})(jQuery);









// Chosen, a Select Box Enhancer for jQuery and Prototype
// by Patrick Filler for Harvest, http://getharvest.com
//
// Version 1.0.0
// Full source at https://github.com/harvesthq/chosen
// Copyright (c) 2011 Harvest http://getharvest.com

// MIT License, https://github.com/harvesthq/chosen/blob/master/LICENSE.md
// This file is generated by `grunt build`, do not edit it by hand.
(function() {
	var $, AbstractChosen, Chosen, SelectParser, _ref,
		__hasProp = {}.hasOwnProperty,
		__extends = function(child, parent) {
			for (var key in parent) {
				if (__hasProp.call(parent, key)) child[key] = parent[key];
			}

			function ctor() {
				this.constructor = child;
			}
			ctor.prototype = parent.prototype;
			child.prototype = new ctor();
			child.__super__ = parent.prototype;
			return child;
		};

	SelectParser = (function() {
		function SelectParser() {
			this.options_index = 0;
			this.parsed = [];
		}

		SelectParser.prototype.add_node = function(child) {
			if (child.nodeName.toUpperCase() === "OPTGROUP") {
				return this.add_group(child);
			} else {
				return this.add_option(child);
			}
		};

		SelectParser.prototype.add_group = function(group) {
			var group_position, option, _i, _len, _ref, _results;

			group_position = this.parsed.length;
			this.parsed.push({
				array_index: group_position,
				group: true,
				label: this.escapeExpression(group.label),
				children: 0,
				disabled: group.disabled
			});
			_ref = group.childNodes;
			_results = [];
			for (_i = 0, _len = _ref.length; _i < _len; _i++) {
				option = _ref[_i];
				_results.push(this.add_option(option, group_position, group.disabled));
			}
			return _results;
		};

		SelectParser.prototype.add_option = function(option, group_position, group_disabled) {
			if (option.nodeName.toUpperCase() === "OPTION") {
				if (option.text !== "") {
					if (group_position != null) {
						this.parsed[group_position].children += 1;
					}
					this.parsed.push({
						array_index: this.parsed.length,
						options_index: this.options_index,
						value: option.value,
						text: option.text,
						html: option.innerHTML,
						selected: option.selected,
						disabled: group_disabled === true ? group_disabled : option.disabled,
						group_array_index: group_position,
						classes: option.className,
						style: option.style.cssText
					});
				} else {
					this.parsed.push({
						array_index: this.parsed.length,
						options_index: this.options_index,
						empty: true
					});
				}
				return this.options_index += 1;
			}
		};

		SelectParser.prototype.escapeExpression = function(text) {
			var map, unsafe_chars;

			if ((text == null) || text === false) {
				return "";
			}
			if (!/[\&\<\>\"\'\`]/.test(text)) {
				return text;
			}
			map = {
				"<": "&lt;",
				">": "&gt;",
				'"': "&quot;",
				"'": "&#x27;",
				"`": "&#x60;"
			};
			unsafe_chars = /&(?!\w+;)|[\<\>\"\'\`]/g;
			return text.replace(unsafe_chars, function(chr) {
				return map[chr] || "&amp;";
			});
		};

		return SelectParser;

	})();

	SelectParser.select_to_array = function(select) {
		var child, parser, _i, _len, _ref;

		parser = new SelectParser();
		_ref = select.childNodes;
		for (_i = 0, _len = _ref.length; _i < _len; _i++) {
			child = _ref[_i];
			parser.add_node(child);
		}
		return parser.parsed;
	};

	AbstractChosen = (function() {
		function AbstractChosen(form_field, options) {
			this.form_field = form_field;
			this.options = options != null ? options : {};
			if (!AbstractChosen.browser_is_supported()) {
				return;
			}
			this.is_multiple = this.form_field.multiple;
			this.set_default_text();
			this.set_default_values();
			this.setup();
			this.set_up_html();
			this.register_observers();
		}

		AbstractChosen.prototype.set_default_values = function() {
			var _this = this;

			this.click_test_action = function(evt) {
				return _this.test_active_click(evt);
			};
			this.activate_action = function(evt) {
				return _this.activate_field(evt);
			};
			this.active_field = false;
			this.mouse_on_container = false;
			this.results_showing = false;
			this.result_highlighted = null;
			this.result_single_selected = null;
			this.allow_single_deselect = (this.options.allow_single_deselect != null) && (this.form_field.options[0] != null) && this.form_field.options[0].text === "" ? this.options.allow_single_deselect : false;
			this.disable_search_threshold = this.options.disable_search_threshold || 0;
			this.disable_search = this.options.disable_search || false;
			this.enable_split_word_search = this.options.enable_split_word_search != null ? this.options.enable_split_word_search : true;
			this.group_search = this.options.group_search != null ? this.options.group_search : true;
			this.search_contains = this.options.search_contains || false;
			this.single_backstroke_delete = this.options.single_backstroke_delete != null ? this.options.single_backstroke_delete : true;
			this.max_selected_options = this.options.max_selected_options || Infinity;
			this.inherit_select_classes = this.options.inherit_select_classes || false;
			this.display_selected_options = this.options.display_selected_options != null ? this.options.display_selected_options : true;
			return this.display_disabled_options = this.options.display_disabled_options != null ? this.options.display_disabled_options : true;
		};

		AbstractChosen.prototype.set_default_text = function() {
			if (this.form_field.getAttribute("data-placeholder")) {
				this.default_text = this.form_field.getAttribute("data-placeholder");
			} else if (this.is_multiple) {
				this.default_text = this.options.placeholder_text_multiple || this.options.placeholder_text || AbstractChosen.default_multiple_text;
			} else {
				this.default_text = this.options.placeholder_text_single || this.options.placeholder_text || AbstractChosen.default_single_text;
			}
			return this.results_none_found = this.form_field.getAttribute("data-no_results_text") || this.options.no_results_text || AbstractChosen.default_no_result_text;
		};

		AbstractChosen.prototype.mouse_enter = function() {
			return this.mouse_on_container = true;
		};

		AbstractChosen.prototype.mouse_leave = function() {
			return this.mouse_on_container = false;
		};

		AbstractChosen.prototype.input_focus = function(evt) {
			var _this = this;

			if (this.is_multiple) {
				if (!this.active_field) {
					return setTimeout((function() {
						return _this.container_mousedown();
					}), 50);
				}
			} else {
				if (!this.active_field) {
					return this.activate_field();
				}
			}
		};

		AbstractChosen.prototype.input_blur = function(evt) {
			var _this = this;

			if (!this.mouse_on_container) {
				this.active_field = false;
				return setTimeout((function() {
					return _this.blur_test();
				}), 100);
			}
		};

		AbstractChosen.prototype.results_option_build = function(options) {
			var content, data, _i, _len, _ref;

			content = '';
			_ref = this.results_data;
			for (_i = 0, _len = _ref.length; _i < _len; _i++) {
				data = _ref[_i];
				if (data.group) {
					content += this.result_add_group(data);
				} else {
					content += this.result_add_option(data);
				}
				if (options != null ? options.first : void 0) {
					if (data.selected && this.is_multiple) {
						this.choice_build(data);
					} else if (data.selected && !this.is_multiple) {
						this.single_set_selected_text(data.text);
					}
				}
			}
			return content;
		};

		AbstractChosen.prototype.result_add_option = function(option) {
			var classes, style;

			if (!option.search_match) {
				return '';
			}
			if (!this.include_option_in_results(option)) {
				return '';
			}
			classes = [];
			if (!option.disabled && !(option.selected && this.is_multiple)) {
				classes.push("active-result");
			}
			if (option.disabled && !(option.selected && this.is_multiple)) {
				classes.push("disabled-result");
			}
			if (option.selected) {
				classes.push("result-selected");
			}
			if (option.group_array_index != null) {
				classes.push("group-option");
			}
			if (option.classes !== "") {
				classes.push(option.classes);
			}
			style = option.style.cssText !== "" ? " style=\"" + option.style + "\"" : "";
			return "<li class=\"" + (classes.join(' ')) + "\"" + style + " data-option-array-index=\"" + option.array_index + "\">" + option.search_text + "</li>";
		};

		AbstractChosen.prototype.result_add_group = function(group) {
			if (!(group.search_match || group.group_match)) {
				return '';
			}
			if (!(group.active_options > 0)) {
				return '';
			}
			return "<li class=\"group-result\">" + group.search_text + "</li>";
		};

		AbstractChosen.prototype.results_update_field = function() {
			this.set_default_text();
			if (!this.is_multiple) {
				this.results_reset_cleanup();
			}
			this.result_clear_highlight();
			this.result_single_selected = null;
			this.results_build();
			if (this.results_showing) {
				return this.winnow_results();
			}
		};

		AbstractChosen.prototype.results_toggle = function() {
			if (this.results_showing) {
				return this.results_hide();
			} else {
				return this.results_show();
			}
		};

		AbstractChosen.prototype.results_search = function(evt) {
			if (this.results_showing) {
				return this.winnow_results();
			} else {
				return this.results_show();
			}
		};

		AbstractChosen.prototype.winnow_results = function() {
			var escapedSearchText, option, regex, regexAnchor, results, results_group, searchText, startpos, text, zregex, _i, _len, _ref;

			this.no_results_clear();
			results = 0;
			searchText = this.get_search_text();
			escapedSearchText = searchText.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
			regexAnchor = this.search_contains ? "" : "^";
			regex = new RegExp(regexAnchor + escapedSearchText, 'i');
			zregex = new RegExp(escapedSearchText, 'i');
			_ref = this.results_data;
			for (_i = 0, _len = _ref.length; _i < _len; _i++) {
				option = _ref[_i];
				option.search_match = false;
				results_group = null;
				if (this.include_option_in_results(option)) {
					if (option.group) {
						option.group_match = false;
						option.active_options = 0;
					}
					if ((option.group_array_index != null) && this.results_data[option.group_array_index]) {
						results_group = this.results_data[option.group_array_index];
						if (results_group.active_options === 0 && results_group.search_match) {
							results += 1;
						}
						results_group.active_options += 1;
					}
					if (!(option.group && !this.group_search)) {
						option.search_text = option.group ? option.label : option.html;
						option.search_match = this.search_string_match(option.search_text, regex);
						if (option.search_match && !option.group) {
							results += 1;
						}
						if (option.search_match) {
							if (searchText.length) {
								startpos = option.search_text.search(zregex);
								text = option.search_text.substr(0, startpos + searchText.length) + '</em>' + option.search_text.substr(startpos + searchText.length);
								option.search_text = text.substr(0, startpos) + '<em>' + text.substr(startpos);
							}
							if (results_group != null) {
								results_group.group_match = true;
							}
						} else if ((option.group_array_index != null) && this.results_data[option.group_array_index].search_match) {
							option.search_match = true;
						}
					}
				}
			}
			this.result_clear_highlight();
			if (results < 1 && searchText.length) {
				this.update_results_content("");
				return this.no_results(searchText);
			} else {
				this.update_results_content(this.results_option_build());
				return this.winnow_results_set_highlight();
			}
		};

		AbstractChosen.prototype.search_string_match = function(search_string, regex) {
			var part, parts, _i, _len;

			if (regex.test(search_string)) {
				return true;
			} else if (this.enable_split_word_search && (search_string.indexOf(" ") >= 0 || search_string.indexOf("[") === 0)) {
				parts = search_string.replace(/\[|\]/g, "").split(" ");
				if (parts.length) {
					for (_i = 0, _len = parts.length; _i < _len; _i++) {
						part = parts[_i];
						if (regex.test(part)) {
							return true;
						}
					}
				}
			}
		};

		AbstractChosen.prototype.choices_count = function() {
			var option, _i, _len, _ref;

			if (this.selected_option_count != null) {
				return this.selected_option_count;
			}
			this.selected_option_count = 0;
			_ref = this.form_field.options;
			for (_i = 0, _len = _ref.length; _i < _len; _i++) {
				option = _ref[_i];
				if (option.selected) {
					this.selected_option_count += 1;
				}
			}
			return this.selected_option_count;
		};

		AbstractChosen.prototype.choices_click = function(evt) {
			evt.preventDefault();
			if (!(this.results_showing || this.is_disabled)) {
				return this.results_show();
			}
		};

		AbstractChosen.prototype.keyup_checker = function(evt) {
			var stroke, _ref;

			stroke = (_ref = evt.which) != null ? _ref : evt.keyCode;
			this.search_field_scale();
			switch (stroke) {
				case 8:
					if (this.is_multiple && this.backstroke_length < 1 && this.choices_count() > 0) {
						return this.keydown_backstroke();
					} else if (!this.pending_backstroke) {
						this.result_clear_highlight();
						return this.results_search();
					}
					break;
				case 13:
					evt.preventDefault();
					if (this.results_showing) {
						return this.result_select(evt);
					}
					break;
				case 27:
					if (this.results_showing) {
						this.results_hide();
					}
					return true;
				case 9:
				case 38:
				case 40:
				case 16:
				case 91:
				case 17:
					break;
				default:
					return this.results_search();
			}
		};

		AbstractChosen.prototype.container_width = function() {
			if (this.options.width != null) {
				return this.options.width;
			} else {
				return "" + this.form_field.offsetWidth + "px";
			}
		};

		AbstractChosen.prototype.include_option_in_results = function(option) {
			if (this.is_multiple && (!this.display_selected_options && option.selected)) {
				return false;
			}
			if (!this.display_disabled_options && option.disabled) {
				return false;
			}
			if (option.empty) {
				return false;
			}
			return true;
		};

		AbstractChosen.browser_is_supported = function() {
			if (window.navigator.appName === "Microsoft Internet Explorer") {
				return document.documentMode >= 8;
			}
			if (/iP(od|hone)/i.test(window.navigator.userAgent)) {
				return false;
			}
			if (/Android/i.test(window.navigator.userAgent)) {
				if (/Mobile/i.test(window.navigator.userAgent)) {
					return false;
				}
			}
			return true;
		};

		//AbstractChosen.default_multiple_text = "გთხოვთ აირჩიოთ";

		//AbstractChosen.default_single_text = "გთხოვთ აირჩიოთ";

		//AbstractChosen.default_no_result_text = "დამთხვევა ვერ მოიძება";
        AbstractChosen.default_multiple_text = "Text 1";
		AbstractChosen.default_single_text = "Text 2";
		AbstractChosen.default_no_result_text = "შედეგი არ მოიძებნა";
		return AbstractChosen;

	})();

	$ = jQuery;

	$.fn.extend({
		chosen: function(options) {
			if (!AbstractChosen.browser_is_supported()) {
				return this;
			}
			return this.each(function(input_field) {
				var $this, chosen;

				$this = $(this);
				chosen = $this.data('chosen');
				if (options === 'destroy' && chosen) {
					chosen.destroy();
				} else if (!chosen) {
					$this.data('chosen', new Chosen(this, options));
				}
			});
		}
	});

	Chosen = (function(_super) {
		__extends(Chosen, _super);

		function Chosen() {
			_ref = Chosen.__super__.constructor.apply(this, arguments);
			return _ref;
		}

		Chosen.prototype.setup = function() {
			this.form_field_jq = $(this.form_field);
			this.current_selectedIndex = this.form_field.selectedIndex;
			return this.is_rtl = this.form_field_jq.hasClass("chosen-rtl");
		};

		Chosen.prototype.set_up_html = function() {
			var container_classes, container_props;

			container_classes = ["chosen-container"];
			container_classes.push("chosen-container-" + (this.is_multiple ? "multi" : "single"));
			if (this.inherit_select_classes && this.form_field.className) {
				container_classes.push(this.form_field.className);
			}
			if (this.is_rtl) {
				container_classes.push("chosen-rtl");
			}
			container_props = {
				'class': container_classes.join(' '),
				'style': "width: " + (this.container_width()) + ";",
				'title': this.form_field.title
			};
			if (this.form_field.id.length) {
				container_props.id = this.form_field.id.replace(/[^\w]/g, '_') + "_chosen";
			}
			this.container = $("<div />", container_props);
			if (this.is_multiple) {
				this.container.html('<ul class="chosen-choices"><li class="search-field"><input type="text" value="' + this.default_text + '" class="default" autocomplete="off" style="width:25px;" /></li></ul><div class="chosen-drop"><ul class="chosen-results"></ul></div>');
			} else {
				this.container.html('<a class="chosen-single chosen-default" tabindex="-1"><span>' + this.default_text + '</span><div><b></b></div></a><div class="chosen-drop"><div class="chosen-search"><input type="text" autocomplete="off" /></div><ul class="chosen-results"></ul></div>');
			}
			this.form_field_jq.hide().after(this.container);
			this.dropdown = this.container.find('div.chosen-drop').first();
			this.search_field = this.container.find('input').first();
			this.search_results = this.container.find('ul.chosen-results').first();
			this.search_field_scale();
			this.search_no_results = this.container.find('li.no-results').first();
			if (this.is_multiple) {
				this.search_choices = this.container.find('ul.chosen-choices').first();
				this.search_container = this.container.find('li.search-field').first();
			} else {
				this.search_container = this.container.find('div.chosen-search').first();
				this.selected_item = this.container.find('.chosen-single').first();
			}
			this.results_build();
			this.set_tab_index();
			this.set_label_behavior();
			return this.form_field_jq.trigger("chosen:ready", {
				chosen: this
			});
		};

		Chosen.prototype.register_observers = function() {
			var _this = this;

			this.container.bind('mousedown.chosen', function(evt) {
				_this.container_mousedown(evt);
			});
			this.container.bind('mouseup.chosen', function(evt) {
				_this.container_mouseup(evt);
			});
			this.container.bind('mouseenter.chosen', function(evt) {
				_this.mouse_enter(evt);
			});
			this.container.bind('mouseleave.chosen', function(evt) {
				_this.mouse_leave(evt);
			});
			this.search_results.bind('mouseup.chosen', function(evt) {
				_this.search_results_mouseup(evt);
			});
			this.search_results.bind('mouseover.chosen', function(evt) {
				_this.search_results_mouseover(evt);
			});
			this.search_results.bind('mouseout.chosen', function(evt) {
				_this.search_results_mouseout(evt);
			});
			this.search_results.bind('mousewheel.chosen DOMMouseScroll.chosen', function(evt) {
				_this.search_results_mousewheel(evt);
			});
			this.form_field_jq.bind("chosen:updated.chosen", function(evt) {
				_this.results_update_field(evt);
			});
			this.form_field_jq.bind("chosen:activate.chosen", function(evt) {
				_this.activate_field(evt);
			});
			this.form_field_jq.bind("chosen:open.chosen", function(evt) {
				_this.container_mousedown(evt);
			});
			this.search_field.bind('blur.chosen', function(evt) {
				_this.input_blur(evt);
			});
			this.search_field.bind('keyup.chosen', function(evt) {
				_this.keyup_checker(evt);
			});
			this.search_field.bind('keydown.chosen', function(evt) {
				_this.keydown_checker(evt);
			});
			this.search_field.bind('focus.chosen', function(evt) {
				_this.input_focus(evt);
			});
			if (this.is_multiple) {
				return this.search_choices.bind('click.chosen', function(evt) {
					_this.choices_click(evt);
				});
			} else {
				return this.container.bind('click.chosen', function(evt) {
					evt.preventDefault();
				});
			}
		};

		Chosen.prototype.destroy = function() {
			$(document).unbind("click.chosen", this.click_test_action);
			if (this.search_field[0].tabIndex) {
				this.form_field_jq[0].tabIndex = this.search_field[0].tabIndex;
			}
			this.container.remove();
			this.form_field_jq.removeData('chosen');
			return this.form_field_jq.show();
		};

		Chosen.prototype.search_field_disabled = function() {
			this.is_disabled = this.form_field_jq[0].disabled;
			if (this.is_disabled) {
				this.container.addClass('chosen-disabled');
				this.search_field[0].disabled = true;
				if (!this.is_multiple) {
					this.selected_item.unbind("focus.chosen", this.activate_action);
				}
				return this.close_field();
			} else {
				this.container.removeClass('chosen-disabled');
				this.search_field[0].disabled = false;
				if (!this.is_multiple) {
					return this.selected_item.bind("focus.chosen", this.activate_action);
				}
			}
		};

		Chosen.prototype.container_mousedown = function(evt) {
			if (!this.is_disabled) {
				if (evt && evt.type === "mousedown" && !this.results_showing) {
					evt.preventDefault();
				}
				if (!((evt != null) && ($(evt.target)).hasClass("search-choice-close"))) {
					if (!this.active_field) {
						if (this.is_multiple) {
							this.search_field.val("");
						}
						$(document).bind('click.chosen', this.click_test_action);
						this.results_show();
					} else if (!this.is_multiple && evt && (($(evt.target)[0] === this.selected_item[0]) || $(evt.target).parents("a.chosen-single").length)) {
						evt.preventDefault();
						this.results_toggle();
					}
					return this.activate_field();
				}
			}
		};

		Chosen.prototype.container_mouseup = function(evt) {
			if (evt.target.nodeName === "ABBR" && !this.is_disabled) {
				return this.results_reset(evt);
			}
		};

		Chosen.prototype.search_results_mousewheel = function(evt) {
			var delta, _ref1, _ref2;

			delta = -((_ref1 = evt.originalEvent) != null ? _ref1.wheelDelta : void 0) || ((_ref2 = evt.originialEvent) != null ? _ref2.detail : void 0);
			if (delta != null) {
				evt.preventDefault();
				if (evt.type === 'DOMMouseScroll') {
					delta = delta * 40;
				}
				return this.search_results.scrollTop(delta + this.search_results.scrollTop());
			}
		};

		Chosen.prototype.blur_test = function(evt) {
			if (!this.active_field && this.container.hasClass("chosen-container-active")) {
				return this.close_field();
			}
		};

		Chosen.prototype.close_field = function() {
			$(document).unbind("click.chosen", this.click_test_action);
			this.active_field = false;
			this.results_hide();
			this.container.removeClass("chosen-container-active");
			this.clear_backstroke();
			this.show_search_field_default();
			return this.search_field_scale();
		};

		Chosen.prototype.activate_field = function() {
			this.container.addClass("chosen-container-active");
			this.active_field = true;
			this.search_field.val(this.search_field.val());
			return this.search_field.focus();
		};

		Chosen.prototype.test_active_click = function(evt) {
			if (this.container.is($(evt.target).closest('.chosen-container'))) {
				return this.active_field = true;
			} else {
				return this.close_field();
			}
		};

		Chosen.prototype.results_build = function() {
			this.parsing = true;
			this.selected_option_count = null;
			this.results_data = SelectParser.select_to_array(this.form_field);
			if (this.is_multiple) {
				this.search_choices.find("li.search-choice").remove();
			} else if (!this.is_multiple) {
				this.single_set_selected_text();
				if (this.disable_search || this.form_field.options.length <= this.disable_search_threshold) {
					this.search_field[0].readOnly = true;
					this.container.addClass("chosen-container-single-nosearch");
				} else {
					this.search_field[0].readOnly = false;
					this.container.removeClass("chosen-container-single-nosearch");
				}
			}
			this.update_results_content(this.results_option_build({
				first: true
			}));
			this.search_field_disabled();
			this.show_search_field_default();
			this.search_field_scale();
			return this.parsing = false;
		};

		Chosen.prototype.result_do_highlight = function(el) {
			var high_bottom, high_top, maxHeight, visible_bottom, visible_top;

			if (el.length) {
				this.result_clear_highlight();
				this.result_highlight = el;
				this.result_highlight.addClass("highlighted");
				maxHeight = parseInt(this.search_results.css("maxHeight"), 10);
				visible_top = this.search_results.scrollTop();
				visible_bottom = maxHeight + visible_top;
				high_top = this.result_highlight.position().top + this.search_results.scrollTop();
				high_bottom = high_top + this.result_highlight.outerHeight();
				if (high_bottom >= visible_bottom) {
					return this.search_results.scrollTop((high_bottom - maxHeight) > 0 ? high_bottom - maxHeight : 0);
				} else if (high_top < visible_top) {
					return this.search_results.scrollTop(high_top);
				}
			}
		};

		Chosen.prototype.result_clear_highlight = function() {
			if (this.result_highlight) {
				this.result_highlight.removeClass("highlighted");
			}
			return this.result_highlight = null;
		};

		Chosen.prototype.results_show = function() {
			if (this.is_multiple && this.max_selected_options <= this.choices_count()) {
				this.form_field_jq.trigger("chosen:maxselected", {
					chosen: this
				});
				return false;
			}
			this.container.addClass("chosen-with-drop");
			this.form_field_jq.trigger("chosen:showing_dropdown", {
				chosen: this
			});
			this.results_showing = true;
			this.search_field.focus();
			this.search_field.val(this.search_field.val());
			return this.winnow_results();
		};

		Chosen.prototype.update_results_content = function(content) {
			return this.search_results.html(content);
		};

		Chosen.prototype.results_hide = function() {
			if (this.results_showing) {
				this.result_clear_highlight();
				this.container.removeClass("chosen-with-drop");
				this.form_field_jq.trigger("chosen:hiding_dropdown", {
					chosen: this
				});
			}
			return this.results_showing = false;
		};

		Chosen.prototype.set_tab_index = function(el) {
			var ti;

			if (this.form_field.tabIndex) {
				ti = this.form_field.tabIndex;
				this.form_field.tabIndex = -1;
				return this.search_field[0].tabIndex = ti;
			}
		};

		Chosen.prototype.set_label_behavior = function() {
			var _this = this;

			this.form_field_label = this.form_field_jq.parents("label");
			if (!this.form_field_label.length && this.form_field.id.length) {
				this.form_field_label = $("label[for='" + this.form_field.id + "']");
			}
			if (this.form_field_label.length > 0) {
				return this.form_field_label.bind('click.chosen', function(evt) {
					if (_this.is_multiple) {
						return _this.container_mousedown(evt);
					} else {
						return _this.activate_field();
					}
				});
			}
		};

		Chosen.prototype.show_search_field_default = function() {
			if (this.is_multiple && this.choices_count() < 1 && !this.active_field) {
				this.search_field.val(this.default_text);
				return this.search_field.addClass("default");
			} else {
				this.search_field.val("");
				return this.search_field.removeClass("default");
			}
		};

		Chosen.prototype.search_results_mouseup = function(evt) {
			var target;

			target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first();
			if (target.length) {
				this.result_highlight = target;
				this.result_select(evt);
				return this.search_field.focus();
			}
		};

		Chosen.prototype.search_results_mouseover = function(evt) {
			var target;

			target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first();
			if (target) {
				return this.result_do_highlight(target);
			}
		};

		Chosen.prototype.search_results_mouseout = function(evt) {
			if ($(evt.target).hasClass("active-result" || $(evt.target).parents('.active-result').first())) {
				return this.result_clear_highlight();
			}
		};

		Chosen.prototype.choice_build = function(item) {
			var choice, close_link,
				_this = this;

			choice = $('<li />', {
				"class": "search-choice"
			}).html("<span>" + item.html + "</span>");
			if (item.disabled) {
				choice.addClass('search-choice-disabled');
			} else {
				close_link = $('<a />', {
					"class": 'search-choice-close',
					'data-option-array-index': item.array_index
				});
				close_link.bind('click.chosen', function(evt) {
					return _this.choice_destroy_link_click(evt);
				});
				choice.append(close_link);
			}
			return this.search_container.before(choice);
		};

		Chosen.prototype.choice_destroy_link_click = function(evt) {
			evt.preventDefault();
			evt.stopPropagation();
			if (!this.is_disabled) {
				return this.choice_destroy($(evt.target));
			}
		};

		Chosen.prototype.choice_destroy = function(link) {
			if (this.result_deselect(link[0].getAttribute("data-option-array-index"))) {
				this.show_search_field_default();
				if (this.is_multiple && this.choices_count() > 0 && this.search_field.val().length < 1) {
					this.results_hide();
				}
				link.parents('li').first().remove();
				return this.search_field_scale();
			}
		};

		Chosen.prototype.results_reset = function() {
			this.form_field.options[0].selected = true;
			this.selected_option_count = null;
			this.single_set_selected_text();
			this.show_search_field_default();
			this.results_reset_cleanup();
			this.form_field_jq.trigger("change");
			if (this.active_field) {
				return this.results_hide();
			}
		};

		Chosen.prototype.results_reset_cleanup = function() {
			this.current_selectedIndex = this.form_field.selectedIndex;
			return this.selected_item.find("abbr").remove();
		};

		Chosen.prototype.result_select = function(evt) {
			var high, item, selected_index;

			if (this.result_highlight) {
				high = this.result_highlight;
				this.result_clear_highlight();
				if (this.is_multiple && this.max_selected_options <= this.choices_count()) {
					this.form_field_jq.trigger("chosen:maxselected", {
						chosen: this
					});
					return false;
				}
				if (this.is_multiple) {
					high.removeClass("active-result");
				} else {
					if (this.result_single_selected) {
						this.result_single_selected.removeClass("result-selected");
						selected_index = this.result_single_selected[0].getAttribute('data-option-array-index');
						this.results_data[selected_index].selected = false;
					}
					this.result_single_selected = high;
				}
				high.addClass("result-selected");
				item = this.results_data[high[0].getAttribute("data-option-array-index")];
				item.selected = true;
				this.form_field.options[item.options_index].selected = true;
				this.selected_option_count = null;
				if (this.is_multiple) {
					this.choice_build(item);
				} else {
					this.single_set_selected_text(item.text);
				}
				if (!((evt.metaKey || evt.ctrlKey) && this.is_multiple)) {
					this.results_hide();
				}
				this.search_field.val("");
				if (this.is_multiple || this.form_field.selectedIndex !== this.current_selectedIndex) {
					this.form_field_jq.trigger("change", {
						'selected': this.form_field.options[item.options_index].value
					});
				}
				this.current_selectedIndex = this.form_field.selectedIndex;
				return this.search_field_scale();
			}
		};

		Chosen.prototype.single_set_selected_text = function(text) {
			if (text == null) {
				text = this.default_text;
			}
			if (text === this.default_text) {
				this.selected_item.addClass("chosen-default");
			} else {
				this.single_deselect_control_build();
				this.selected_item.removeClass("chosen-default");
			}
			return this.selected_item.find("span").text(text);
		};

		Chosen.prototype.result_deselect = function(pos) {
			var result_data;

			result_data = this.results_data[pos];
			if (!this.form_field.options[result_data.options_index].disabled) {
				result_data.selected = false;
				this.form_field.options[result_data.options_index].selected = false;
				this.selected_option_count = null;
				this.result_clear_highlight();
				if (this.results_showing) {
					this.winnow_results();
				}
				this.form_field_jq.trigger("change", {
					deselected: this.form_field.options[result_data.options_index].value
				});
				this.search_field_scale();
				return true;
			} else {
				return false;
			}
		};

		Chosen.prototype.single_deselect_control_build = function() {
			if (!this.allow_single_deselect) {
				return;
			}
			if (!this.selected_item.find("abbr").length) {
				this.selected_item.find("span").first().after("<abbr class=\"search-choice-close\"></abbr>");
			}
			return this.selected_item.addClass("chosen-single-with-deselect");
		};

		Chosen.prototype.get_search_text = function() {
			if (this.search_field.val() === this.default_text) {
				return "";
			} else {
				return $('<div/>').text($.trim(this.search_field.val())).html();
			}
		};

		Chosen.prototype.winnow_results_set_highlight = function() {
			var do_high, selected_results;

			selected_results = !this.is_multiple ? this.search_results.find(".result-selected.active-result") : [];
			do_high = selected_results.length ? selected_results.first() : this.search_results.find(".active-result").first();
			if (do_high != null) {
				return this.result_do_highlight(do_high);
			}
		};

		Chosen.prototype.no_results = function(terms) {
			var no_results_html;

			no_results_html = $('<li class="no-results">' + this.results_none_found + ' "<span></span>"</li>');
			no_results_html.find("span").first().html(terms);
			return this.search_results.append(no_results_html);
		};

		Chosen.prototype.no_results_clear = function() {
			return this.search_results.find(".no-results").remove();
		};

		Chosen.prototype.keydown_arrow = function() {
			var next_sib;

			if (this.results_showing && this.result_highlight) {
				next_sib = this.result_highlight.nextAll("li.active-result").first();
				if (next_sib) {
					return this.result_do_highlight(next_sib);
				}
			} else {
				return this.results_show();
			}
		};

		Chosen.prototype.keyup_arrow = function() {
			var prev_sibs;

			if (!this.results_showing && !this.is_multiple) {
				return this.results_show();
			} else if (this.result_highlight) {
				prev_sibs = this.result_highlight.prevAll("li.active-result");
				if (prev_sibs.length) {
					return this.result_do_highlight(prev_sibs.first());
				} else {
					if (this.choices_count() > 0) {
						this.results_hide();
					}
					return this.result_clear_highlight();
				}
			}
		};

		Chosen.prototype.keydown_backstroke = function() {
			var next_available_destroy;

			if (this.pending_backstroke) {
				this.choice_destroy(this.pending_backstroke.find("a").first());
				return this.clear_backstroke();
			} else {
				next_available_destroy = this.search_container.siblings("li.search-choice").last();
				if (next_available_destroy.length && !next_available_destroy.hasClass("search-choice-disabled")) {
					this.pending_backstroke = next_available_destroy;
					if (this.single_backstroke_delete) {
						return this.keydown_backstroke();
					} else {
						return this.pending_backstroke.addClass("search-choice-focus");
					}
				}
			}
		};

		Chosen.prototype.clear_backstroke = function() {
			if (this.pending_backstroke) {
				this.pending_backstroke.removeClass("search-choice-focus");
			}
			return this.pending_backstroke = null;
		};

		Chosen.prototype.keydown_checker = function(evt) {
			var stroke, _ref1;

			stroke = (_ref1 = evt.which) != null ? _ref1 : evt.keyCode;
			this.search_field_scale();
			if (stroke !== 8 && this.pending_backstroke) {
				this.clear_backstroke();
			}
			switch (stroke) {
				case 8:
					this.backstroke_length = this.search_field.val().length;
					break;
				case 9:
					if (this.results_showing && !this.is_multiple) {
						this.result_select(evt);
					}
					this.mouse_on_container = false;
					break;
				case 13:
					evt.preventDefault();
					break;
				case 38:
					evt.preventDefault();
					this.keyup_arrow();
					break;
				case 40:
					evt.preventDefault();
					this.keydown_arrow();
					break;
			}
		};

		Chosen.prototype.search_field_scale = function() {
			var div, f_width, h, style, style_block, styles, w, _i, _len;

			if (this.is_multiple) {
				h = 0;
				w = 0;
				style_block = "position:absolute; left: -1000px; top: -1000px; display:none;";
				styles = ['font-size', 'font-style', 'font-weight', 'font-family', 'line-height', 'text-transform', 'letter-spacing'];
				for (_i = 0, _len = styles.length; _i < _len; _i++) {
					style = styles[_i];
					style_block += style + ":" + this.search_field.css(style) + ";";
				}
				div = $('<div />', {
					'style': style_block
				});
				div.text(this.search_field.val());
				$('body').append(div);
				w = div.width() + 25;
				div.remove();
				f_width = this.container.outerWidth();
				if (w > f_width - 10) {
					w = f_width - 10;
				}
				return this.search_field.css({
					'width': w + 'px'
				});
			}
		};

		return Chosen;

	})(AbstractChosen);

}).call(this);









/*!
 * jquery.tagcloud.js
 * A Simple Tag Cloud Plugin for JQuery
 *
 * https://github.com/addywaddy/jquery.tagcloud.js
 * created by Adam Groves
 */
(function($) {

	/*global jQuery*/
	"use strict";

	var compareWeights = function(a, b) {
		return a - b;
	};

	// Converts hex to an RGB array
	var toRGB = function(code) {
		if (code.length === 4) {
			code = code.replace(/(\w)(\w)(\w)/gi, "\$1\$1\$2\$2\$3\$3");
		}
		var hex = /(\w{2})(\w{2})(\w{2})/.exec(code);
		return [parseInt(hex[1], 16), parseInt(hex[2], 16), parseInt(hex[3], 16)];
	};

	// Converts an RGB array to hex
	var toHex = function(ary) {
		return "#" + jQuery.map(ary, function(i) {
			var hex = i.toString(16);
			hex = (hex.length === 1) ? "0" + hex : hex;
			return hex;
		}).join("");
	};

	var colorIncrement = function(color, range) {
		return jQuery.map(toRGB(color.end), function(n, i) {
			return (n - toRGB(color.start)[i]) / range;
		});
	};

	var tagColor = function(color, increment, weighting) {
		var rgb = jQuery.map(toRGB(color.start), function(n, i) {
			var ref = Math.round(n + (increment[i] * weighting));
			if (ref > 255) {
				ref = 255;
			} else {
				if (ref < 0) {
					ref = 0;
				}
			}
			return ref;
		});
		return toHex(rgb);
	};

	$.fn.tagcloud = function(options) {

		var opts = $.extend({}, $.fn.tagcloud.defaults, options);
		var tagWeights = this.map(function() {
			return $(this).attr("rel");
		});
		tagWeights = jQuery.makeArray(tagWeights).sort(compareWeights);
		var lowest = tagWeights[0];
		var highest = tagWeights.pop();
		var range = highest - lowest;
		if (range === 0) {
			range = 1;
		}
		// Sizes
		var fontIncr, colorIncr;
		if (opts.size) {
			fontIncr = (opts.size.end - opts.size.start) / range;
		}
		// Colors
		if (opts.color) {
			colorIncr = colorIncrement(opts.color, range);
		}
		return this.each(function() {
			var weighting = $(this).attr("rel") - lowest;
			if (opts.size) {
				$(this).css({
					"font-size": opts.size.start + (weighting * fontIncr) + opts.size.unit
				});
			}
			if (opts.color) {
				$(this).css({
					"color": tagColor(opts.color, colorIncr, weighting)
				});
			}
		});
	};

	$.fn.tagcloud.defaults = {
		size: {
			start: 14,
			end: 18,
			unit: "pt"
		}
	};

})(jQuery);





/*! Copyright (c) 2011 Piotr Rochala (http://rocha.la)
 * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
 * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
 *
 * Version: 1.3.0
 *
 */
(function($) {

	jQuery.fn.extend({
		slimScroll: function(options) {

			var defaults = {

				// width in pixels of the visible scroll area
				width: 'auto',

				// height in pixels of the visible scroll area
				height: '250px',

				// width in pixels of the scrollbar and rail
				size: '7px',

				// scrollbar color, accepts any hex/color value
				color: '#000',

				// scrollbar position - left/right
				position: 'right',

				// distance in pixels between the side edge and the scrollbar
				distance: '5px',

				// default scroll position on load - top / bottom / $('selector')
				start: 'top',

				// sets scrollbar opacity
				opacity: .4,

				// enables always-on mode for the scrollbar
				alwaysVisible: false,

				// check if we should hide the scrollbar when user is hovering over
				disableFadeOut: false,

				// sets visibility of the rail
				railVisible: false,

				// sets rail color
				railColor: '#333',

				// sets rail opacity
				railOpacity: .2,

				// whether  we should use jQuery UI Draggable to enable bar dragging
				railDraggable: true,

				// defautlt CSS class of the slimscroll rail
				railClass: 'slimScrollRail',

				// defautlt CSS class of the slimscroll bar
				barClass: 'slimScrollBar',

				// defautlt CSS class of the slimscroll wrapper
				wrapperClass: 'slimScrollDiv',

				// check if mousewheel should scroll the window if we reach top/bottom
				allowPageScroll: false,

				// scroll amount applied to each mouse wheel step
				wheelStep: 20,

				// scroll amount applied when user is using gestures
				touchScrollStep: 200
			};

			var o = $.extend(defaults, options);

			// do it for every element that matches selector
			this.each(function() {

				var isOverPanel, isOverBar, isDragg, queueHide, touchDif,
					barHeight, percentScroll, lastScroll,
					divS = '<div></div>',
					minBarHeight = 30,
					releaseScroll = false;

				// used in event handlers and for better minification
				var me = $(this);

				// ensure we are not binding it again
				if (me.parent().hasClass(o.wrapperClass)) {
					// start from last bar position
					var offset = me.scrollTop();

					// find bar and rail
					bar = me.parent().find('.' + o.barClass);
					rail = me.parent().find('.' + o.railClass);

					getBarHeight();

					// check if we should scroll existing instance
					if ($.isPlainObject(options)) {
						// Pass height: auto to an existing slimscroll object to force a resize after contents have changed
						if ('height' in options && options.height == 'auto') {
							me.parent().css('height', 'auto');
							me.css('height', 'auto');
							var height = me.parent().parent().height();
							me.parent().css('height', height);
							me.css('height', height);
						}

						if ('scrollTo' in options) {
							// jump to a static point
							offset = parseInt(o.scrollTo);
						} else if ('scrollBy' in options) {
							// jump by value pixels
							offset += parseInt(o.scrollBy);
						} else if ('destroy' in options) {
							// remove slimscroll elements
							bar.remove();
							rail.remove();
							me.unwrap();
							return;
						}

						// scroll content by the given offset
						scrollContent(offset, false, true);
					}

					return;
				}

				// optionally set height to the parent's height
				o.height = (o.height == 'auto') ? me.parent().height() : o.height;

				// wrap content
				var wrapper = $(divS)
					.addClass(o.wrapperClass)
					.css({
						position: 'relative',
						overflow: 'hidden',
						width: o.width,
						height: o.height
					});

				// update style for the div
				me.css({
					overflow: 'hidden',
					width: o.width,
					height: o.height
				});

				// create scrollbar rail
				var rail = $(divS)
					.addClass(o.railClass)
					.css({
						width: o.size,
						height: '100%',
						position: 'absolute',
						top: 0,
						display: (o.alwaysVisible && o.railVisible) ? 'block' : 'none',
						background: o.railColor,
						opacity: o.railOpacity,
						zIndex: 90
					});

				// create scrollbar
				var bar = $(divS)
					.addClass(o.barClass)
					.css({
						background: o.color,
						width: o.size,
						position: 'absolute',
						top: 0,
						opacity: o.opacity,
						display: o.alwaysVisible ? 'block' : 'none',
						'border-radius': o.borderRadius,
						BorderRadius: o.borderRadius,
						MozBorderRadius: o.borderRadius,
						WebkitBorderRadius: o.borderRadius,
						zIndex: 99
					});

				// set position
				var posCss = (o.position == 'right') ? {
					right: o.distance
				} : {
					left: o.distance
				};
				rail.css(posCss);
				bar.css(posCss);

				// wrap it
				me.wrap(wrapper);

				// append to parent div
				me.parent().append(bar);
				me.parent().append(rail);

				// make it draggable and no longer dependent on the jqueryUI
				if (o.railDraggable) {
					bar.bind("mousedown", function(e) {
						var $doc = $(document);
						isDragg = true;
						t = parseFloat(bar.css('top'));
						pageY = e.pageY;

						$doc.bind("mousemove.slimscroll", function(e) {
							currTop = t + e.pageY - pageY;
							bar.css('top', currTop);
							scrollContent(0, bar.position().top, false); // scroll content
						});

						$doc.bind("mouseup.slimscroll", function(e) {
							isDragg = false;
							hideBar();
							$doc.unbind('.slimscroll');
						});
						return false;
					}).bind("selectstart.slimscroll", function(e) {
						e.stopPropagation();
						e.preventDefault();
						return false;
					});
				}

				// on rail over
				rail.hover(function() {
					showBar();
				}, function() {
					hideBar();
				});

				// on bar over
				bar.hover(function() {
					isOverBar = true;
				}, function() {
					isOverBar = false;
				});

				// show on parent mouseover
				me.hover(function() {
					isOverPanel = true;
					showBar();
					hideBar();
				}, function() {
					isOverPanel = false;
					hideBar();
				});

				// support for mobile
				me.bind('touchstart', function(e, b) {
					if (e.originalEvent.touches.length) {
						// record where touch started
						touchDif = e.originalEvent.touches[0].pageY;
					}
				});

				me.bind('touchmove', function(e) {
					// prevent scrolling the page if necessary
					if (!releaseScroll) {
						e.originalEvent.preventDefault();
					}
					if (e.originalEvent.touches.length) {
						// see how far user swiped
						var diff = (touchDif - e.originalEvent.touches[0].pageY) / o.touchScrollStep;
						// scroll content
						scrollContent(diff, true);
						touchDif = e.originalEvent.touches[0].pageY;
					}
				});

				// set up initial height
				getBarHeight();

				// check start position
				if (o.start === 'bottom') {
					// scroll content to bottom
					bar.css({
						top: me.outerHeight() - bar.outerHeight()
					});
					scrollContent(0, true);
				} else if (o.start !== 'top') {
					// assume jQuery selector
					scrollContent($(o.start).position().top, null, true);

					// make sure bar stays hidden
					if (!o.alwaysVisible) {
						bar.hide();
					}
				}

				// attach scroll events
				attachWheel();

				function _onWheel(e) {
					// use mouse wheel only when mouse is over
					if (!isOverPanel) {
						return;
					}

					var e = e || window.event;

					var delta = 0;
					if (e.wheelDelta) {
						delta = -e.wheelDelta / 120;
					}
					if (e.detail) {
						delta = e.detail / 3;
					}

					var target = e.target || e.srcTarget || e.srcElement;
					if ($(target).closest('.' + o.wrapperClass).is(me.parent())) {
						// scroll content
						scrollContent(delta, true);
					}

					// stop window scroll
					if (e.preventDefault && !releaseScroll) {
						e.preventDefault();
					}
					if (!releaseScroll) {
						e.returnValue = false;
					}
				}

				function scrollContent(y, isWheel, isJump) {
					releaseScroll = false;
					var delta = y;
					var maxTop = me.outerHeight() - bar.outerHeight();

					if (isWheel) {
						// move bar with mouse wheel
						delta = parseInt(bar.css('top')) + y * parseInt(o.wheelStep) / 100 * bar.outerHeight();

						// move bar, make sure it doesn't go out
						delta = Math.min(Math.max(delta, 0), maxTop);

						// if scrolling down, make sure a fractional change to the
						// scroll position isn't rounded away when the scrollbar's CSS is set
						// this flooring of delta would happened automatically when
						// bar.css is set below, but we floor here for clarity
						delta = (y > 0) ? Math.ceil(delta) : Math.floor(delta);

						// scroll the scrollbar
						bar.css({
							top: delta + 'px'
						});
					}

					// calculate actual scroll amount
					percentScroll = parseInt(bar.css('top')) / (me.outerHeight() - bar.outerHeight());
					delta = percentScroll * (me[0].scrollHeight - me.outerHeight());

					if (isJump) {
						delta = y;
						var offsetTop = delta / me[0].scrollHeight * me.outerHeight();
						offsetTop = Math.min(Math.max(offsetTop, 0), maxTop);
						bar.css({
							top: offsetTop + 'px'
						});
					}

					// scroll content
					me.scrollTop(delta);

					// fire scrolling event
					me.trigger('slimscrolling', ~~delta);

					// ensure bar is visible
					showBar();

					// trigger hide when scroll is stopped
					hideBar();
				}

				function attachWheel() {
					if (window.addEventListener) {
						this.addEventListener('DOMMouseScroll', _onWheel, false);
						this.addEventListener('mousewheel', _onWheel, false);
						this.addEventListener('MozMousePixelScroll', _onWheel, false);
					} else {
						document.attachEvent("onmousewheel", _onWheel)
					}
				}

				function getBarHeight() {
					// calculate scrollbar height and make sure it is not too small
					barHeight = Math.max((me.outerHeight() / me[0].scrollHeight) * me.outerHeight(), minBarHeight);
					bar.css({
						height: barHeight + 'px'
					});

					// hide scrollbar if content is not long enough
					var display = barHeight == me.outerHeight() ? 'none' : 'block';
					bar.css({
						display: display
					});
				}

				function showBar() {
					// recalculate bar height
					getBarHeight();
					clearTimeout(queueHide);

					// when bar reached top or bottom
					if (percentScroll == ~~percentScroll) {
						//release wheel
						releaseScroll = o.allowPageScroll;

						// publish approporiate event
						if (lastScroll != percentScroll) {
							var msg = (~~percentScroll == 0) ? 'top' : 'bottom';
							me.trigger('slimscroll', msg);
						}
					} else {
						releaseScroll = false;
					}
					lastScroll = percentScroll;

					// show only when required
					if (barHeight >= me.outerHeight()) {
						//allow window scroll
						releaseScroll = true;
						return;
					}
					bar.stop(true, true).fadeIn('fast');
					if (o.railVisible) {
						rail.stop(true, true).fadeIn('fast');
					}
				}

				function hideBar() {
					// only hide when options allow it
					if (!o.alwaysVisible) {
						queueHide = setTimeout(function() {
							if (!(o.disableFadeOut && isOverPanel) && !isOverBar && !isDragg) {
								bar.fadeOut('slow');
								rail.fadeOut('slow');
							}
						}, 1000);
					}
				}

			});

			// maintain chainability
			return this;
		}
	});

	jQuery.fn.extend({
		slimscroll: jQuery.fn.slimScroll
	});

})(jQuery);

var Order = {

    rooms : false,
    adult : false,
    kids : false,
    total_room : 0,
    total_adult : 0,
    min_form : false,

    init : function(){

        this.rooms =  $('#room_picker');
        this.adult =  $('#adult_picker');
        this.kids  =  $('#kids_picker')
        this.SetEvents();



        this.MoreOptionSwitcher($('#guest_count'));

        $('#guest_count').change(function(){
            Order.MoreOptionSwitcher($(this));
        })



        this.min_form =  $('#rooms_data').children('.min_form').first().clone();


        $('#rooms_data').children('.min_form').first().remove();
        this.min_form.find('.min_form_title b').html(0);
        this.min_form.find('select').change(function(){
            $(this).prev('span').html($(this).val());
        });


        this.total_room = this.adult.val();

        this.CreateRoomRow();

    },

    MoreOptionSwitcher : function(count_select){

        if($(count_select).val()=='more'){
        	console.log("show");
            $(count_select).parent(".option_wrapper").nextAll(".options_block:first").show();
            // $('.options_block').show()
        }else{
        	console.log("hide");
            $(count_select).parent(".option_wrapper").nextAll(".options_block:first").hide();
            // $('.options_block').hide()
        }
    },


    SetEvents : function(){

        var OR = this;
        this.rooms.change(function(){
        	OR.total_room = this.value;
            OR.CreateRoomRow();
        })
        this.adult.change(function(){

            $('#rooms_data .min_form .adult_item').find('option').remove();
            for(i=1;i<=this.value;i++){
                $('<option/>',{
                    'value'  : i
                }).html(i).appendTo($('#rooms_data .min_form .adult_item'));
            }

            $('#rooms_data .min_form .adult_item').chosen('destroy');
            $('#rooms_data .min_form .adult_item').chosen();




        })

        this.kids.change(function(){

            $('#rooms_data .min_form .kids_item').find('option').remove();
            $('<option/>',{
                'value'  : 0
            }).html(0).appendTo($('#rooms_data .min_form .kids_item'));

            for(i=1;i<=this.value;i++){
                $('<option/>',{
                    'value'  : i
                }).html(i).appendTo($('#rooms_data .min_form .kids_item'));
            }

            $('#rooms_data .min_form .kids_item').chosen('destroy');
            $('#rooms_data .min_form .kids_item').chosen();
        })
    },


    CreateRoomRow : function(){

        var OR = this;

        $('#rooms_data').html('');


        //nashti = this.total_adult%this.total_room;
        //ganayofi =  parseInt(this.total_adult/this.total_room);

        for(i=1;i<=this.total_room;i++){



        	adult_item = this.min_form.find('.adult_item');
            kids_item  = this.min_form.find('.kids_item');

			/*adult_item.chosen();
            console.log(adult_item);
            kids_item.chosen();*/

            /*if((this.total_adult-(i*ganayofi))<=nashti){
                adult_item.val(ganayofi+nashti);
            }else{
                adult_item.val(ganayofi);
            }
            adult_item.change(function(){
                OR.UpdateAdultCount();
            });*/

            kids_item.change(function(){
                  OR.CreateKidsForm(this)
            })

            this.min_form.find('.room_number b').html(i);
            //this.min_form.find('select').chosen('destroy');

            this.min_form = this.min_form.appendTo('#rooms_data').clone(true);

            //this.min_form.find('select').chosen();

            adult_item.chosen();
            kids_item.chosen();

            //this.min_form.find('select').chosen();
            this.min_form.find('select').change(function(){

                $(this).prev('span').html($(this).val());
            });

            this.min_form.find('.room_number b').html(i);

        }
    },

    CreateKidsForm : function(KidsSelectItem){

        KidsSelectItem = $(KidsSelectItem);


        var min_form = KidsSelectItem.closest('.min_form');
        var child_wrapper = min_form.find('.child_input_wrapper');
        // debugger;
        child_wrapper.html('');
        for(i=0;i<KidsSelectItem.val();i++){
            $('<input maxlength="2"/>',{
                'type' : 'text',
                'value':'',
                'class' : 'min_form_age',

            }).appendTo(child_wrapper).attr('name','child_age[]').css({
                'height': '26px',
                'width':'25px',
                'padding': '5px',
                'border-radius':'5px',
                'margin-left':'3px',
                'margin-bottom':'3px'
            });

            min_form.find('.child_age').css({'display' : 'block'});
        }

    },

}

var ToursSelect = {
	init: function() {
		$.each($('.custom_select .list a'), function() {

			if ($(this).hasClass('active')) {
				$(this).parents('.custom_select')
					.find('span')
					.html($(this).html())
					.addClass($(this).attr('class'));
			}

			$(this).click(function(e) {

				$(this).parents('.custom_select')
					.find('.chooser span')
					.text($(this).html())
					.removeAttr('class')
					.addClass($(this).attr('class')).css({
						'width': 'auto',
						'font-size': '12px',
					});
				$(this).parents('.custom_select').find('input[type="hidden"]').val($(this).attr('href'));
				$(this).parents('.custom_select').find('.list').css({
					'display': 'none'
				});
				// e.preventDefault();
			});
		});

		this.setEvents();


	},

	setEvents: function() {
		$('.custom_select .chooser span').click(function(e) {


			current_select = $(this).parents('.custom_select');
			var list = current_select.find('.list');


			if (list.css('display') == 'none') {
				$('.custom_select .list').hide();
				list.css({
					'text-decoration': 'none',
					'position': 'absolute'
				}).slideDown(100);
				current_select.addClass("active_custom_select");
				$('body').off('mouseup.custom_select_');
				$('body').on('mouseup.custom_select_', function(e) {
					if ($(e.target).is(list) || $(e.target).is(list.find('*'))) {

					} else {
						list.slideUp(100);
						current_select.removeClass("active_custom_select");
						$('body').off('mouseup.custom_select_');
					}
				});
				// e.stopPropagation();
			} else {
				list.slideUp(100);
			}

		});
	}
};

$(document).ready(function() {
	$("body").attr("class", $("#body").attr("class"));
	$("#body").removeAttr("class");
	if ($("body").hasClass("hotel_mainpage")) {
		Order.init();
	}

	if ($("body").hasClass("paketebi_mainpage") || $("body").hasClass("paketebi_search_result") || $("body").hasClass("paketebi_search_inner")) {

		var script_style = ($("#kids_ages_form").attr("data-scriptstyle") == "0") ? false : true;
		var kids_ages_choser = function(e) {
			var count = Number($(this).val());
			$("#kids_ages_form_w").html("");
			if (count > 0) {
				$("#kids_ages_form").show();
				for (var i = 1; i <= count; i++) {
					var kaf = $("#kid_age_form").clone(true).show();
					kaf.find(".kid_index").html(i);
					kaf.find(".select_chosen_").chosen();
					kaf.find('.chosen-results').slimScroll({
						position: 'right',
						height: '150px',
						railVisible: true,
						alwaysVisible: false
					});
					$("#kids_ages_form_w").append(kaf);
					if (script_style && ((i / 3) % 1 === 0)) {
						kaf.css("margin-right", 0);
						if ((i + 1) <= count) {
							$("#kids_ages_form_w").append(
								$("<div />").addClass("clear").css("height", "15px")
							);
						};
					}
				}
				$("#kids_ages_form_w").append($("<div />").addClass("clear"));
			} else {
				$("#kids_ages_form").hide();
			}
		}
		$("#kids_count").on("change", kids_ages_choser);
		Order.init();
	}

	ToursSelect.init();

	$(".option_type, .visitors, .rooms, .adults, .kids, .select_chosen").chosen();

	$('.option_type_big .chosen-results, .sel_scroll .chosen-results, .option_type .chosen-results').slimScroll({
		// $('.chosen-results').slimScroll({
		position: 'right',
		height: '150px',
		railVisible: true,
		alwaysVisible: false
	});
	$(".set_datepicker").datepicker({
		defaultDate: "+1w",
		changeMonth: true,
		numberOfMonths: 1
	});
	$(".from").datepicker({
		minDate: 0,
		defaultDate: "+1w",
		changeMonth: true,
		numberOfMonths: 1,
		onClose: function(selectedDate) {
			$(".to").datepicker("option", "minDate", selectedDate);
		}
	});
	$(".to").datepicker({
		defaultDate: "+1w",
		changeMonth: true,
		numberOfMonths: 1,
		onClose: function(selectedDate) {
			$(".from").datepicker("option", "maxDate", selectedDate);
		}
	});

	$('.slider_wrapper').cycle({
		timeout: 200,
		pager: '#nav',
		pagerEvent: 'mouseover',
		pagerAnchorBuilder: function(idx, slide) {
			return '<li><a href="#"><img src="' + $(slide).attr('src') + '" width="30" height="30" /></a></li>';
		}
	});

	$('.personalisation .click_event').click(function(e) {
		e.preventDefault();

		var personalize = $(this).parents('.personalisation');
		var active_index = $(this).index();
		var boxes = personalize.find('.box');
		var is_open = boxes[active_index].style.display == "block";

		if (is_open) {
			personalize.find('.click_event')
				.removeClass('active')
				.css("background-image", "");
			boxes.hide();
		} else {
			$(this).prev().css("background-image", "none");
			personalize.find('.click_event').removeClass('active');
			$(this).addClass('active');
			boxes.hide();
			$(boxes[active_index]).show();
		}

		// e.stopPropagation();
		$('body').off('mouseup.auth_menu');

		var _this = this;
		$('body').on('mouseup.auth_menu', function(e) {
			if (!(
				$(e.target).is(_this) ||
				$(e.target).is(boxes) ||
				$(boxes).has(e.target).length
			)) {
				personalize.find('.click_event')
					.removeClass('active')
					.css("background-image", "");
				boxes.hide();
			}
		});

	});

	$('.hotel_mainpage #tagcloud a').tagcloud({
		size: {
			start: 14,
			end: 36,
			unit: 'px'
		},
		color: {
			start: '#7d307d',
			end: '#7d307d'
		}
	});

	$('.tours_mainpage #tagcloud a').tagcloud({
		size: {
			start: 14,
			end: 36,
			unit: 'px'
		},
		color: {
			start: '#1d1d1d',
			end: '#006172'
		}
	});



	$(".wish_list").click(function(e) {
		e.preventDefault();
		$(this).hide();
		$(".wish_list_action").css("display", "block");
	});
	$(".wish_list_action").click(function(e) {
		e.preventDefault();
		$(this).hide();
		$(".wish_list").css("display", "block");
	});

	$('.sorting_tools input, .check').iCheck({
		checkboxClass: 'icheckbox_minimal',
		radioClass: 'iradio_minimal',
		increaseArea: '20%' // optional
	});

	$('.tours_pages .select_service input').on('ifChecked', function(event) {
		$(this).parent().parent('label').addClass('show');
	});

	$('.tours_pages .select_service input').on('ifUnchecked', function(event) {
		$(this).parent().parent('label').removeClass('show');
	});

	$('.active_tab').click(function() {
		if ($(this).hasClass('active')) {
			$(this).removeClass('active');
		} else {
			$(this).addClass('active');
		}
		$(this).next(".sidebar_submenu").slideToggle();
	});

	$(".sortable").sortable();
	$(".sortable").disableSelection();


	function addEditClickEvent() {
		$(".edit").on('click', function(e) {
			e.preventDefault();
			$(this).parents('form').find(".note_body").removeAttr("disabled");
			$(this).removeClass('edit').addClass('mark').val('ჩანიშვნა');
			addMarkClickEvent();
		});
	}
	addEditClickEvent();

	function addMarkClickEvent() {
		$('.mark').click(function(e) {
			e.preventDefault();
			$(this).parents('form').find(".note_body").attr("disabled", "disabled");
			$(this).removeClass('mark').addClass('edit').val('რედაქტირება');
			addEditClickEvent();
		})
	}

	addMarkClickEvent();

 $('.quantity .visitors').change(function(){
        //alert('Start');
    	var total = 0;
    	$.each($('.quantity .visitors'),function(){
    		console.log(this.value);
    		total+=parseInt(this.value);
    	});
        //var elId = $(this).attr('id');
        //var idIndexArray = elId.split("_");
       // var elementIndex = idIndexArray[1];
       // alert(elementIndex);
    	console.log(total);
        //alert(total);
    	$('span.item_costa').html(total);
        $('#hidden_cost').val(total);
        if($('#hidden_cost').val() > 0)
        {
            $('#submit_purple_btn').attr('disabled', false);
        }else{
            $('#submit_purple_btn').attr('disabled', true);
        }
    	//$('span .item_cost').html(total);
    })


	var price_calculator = function(e) {
		window.thisEvent_target = e.target;

		var total = 0;
		$.each($(".select_service"), function() {
			var sector_total = 0;
            //alert(sector_total);
			/*$(this).find('.quantity .visitors').each(function() {
			     alert($(this).val());
			     //alert(Number($(this).val()));
				sector_total += Number($(this).val());
			});
            $.each($('.quantity .visitors'),function(){
                alert($(this).val());
    		console.log(this.value);
    		total+=parseInt(this.value);
    	    });*/
            $('.quantityes .visitors').each(function(){
                //alert($(this).val());
            })
            /* $.each($('.quantity .visitors'),function(){
                alert($(this).val());
    		console.log(this.value);
    		total+=parseInt(this.value);
    	    });*/
			$(this).find(':checkbox').each(function() {
				if ($(this).prop("checked")) {
					sector_total += Number($(this).val());
				}
			});
			$(this).find(".sector_total_plus").text(sector_total);

			if ($("body").hasClass("tours_search_inner")) {
				$(this).next().find("span").first().text(sector_total);
			}
			total += sector_total;
		})
        //alert(total);
		delete window.thisEvent_target;
        
	//	$('.total_price span.item_cost').html(total);
	};
	$('.quantity .visitors').change(price_calculator);
	$(".check_it").on("ifChecked", price_calculator);
	$(".check_it").on("ifUnchecked", price_calculator);


	$(".more_options_dropdown .show_hide").on("click", function(e) {
		$(this).closest(".more_options_dropdown").toggleClass("close")
	});



	$(".tcbl_auto").each(function(i, e) {
		$(this).hide();
		$(this).parent().addClass("tcbl_parent");
		var tcbl = $("<label />");
		tcbl.attr("class", $(this).attr("class"));
		tcbl.addClass("tcbl");
		if ($(this).prop("disabled")) {
			tcbl.addClass("tcbl_disabled");
			$(this).parent().addClass("tcbl_disabled_parent");
		}
		if ($(this).prop("checked")) {
			tcbl.addClass("tcbl_checked");
			$(this).parent().addClass("tcbl_checked_parent");
		}
		tcbl.addClass("tcbl_type_" + $(this).attr("type"));
		if (!$(this).attr("id")) {
			$(this).attr("id", "tcb_" + i);
		}

		tcbl.attr("for", $(this).attr("id"));

		$(this).on("tcbl_change", function() {
			if ($(this).prop("disabled")) {
				$(this)
					.next()
					.addClass("tcbl_disabled")
					.parent()
					.addClass("tcbl_disabled_parent");
			} else {
				$(this)
					.next()
					.removeClass("tcbl_disabled")
					.parent()
					.removeClass("tcbl_disabled_parent");
			}
		});
		$(this).on("change", function(e) {
			var type = $(this).attr("type");
			if (type == "radio") {
				$("input[name=" + $(this).attr("name") + "]").each(function(i, e) {
					$(this)
						.next()
						.removeClass("tcbl_checked")
						.parent()
						.removeClass("tcbl_checked_parent");
				});
				$(this)
					.next()
					.addClass("tcbl_checked")
					.parent()
					.addClass("tcbl_checked_parent");
			} else if (type == "checkbox") {
				$(this)
					.next()
					.toggleClass("tcbl_checked")
					.parent()
					.toggleClass("tcbl_checked_parent");
			}
		});
		$(this).after(tcbl);
	});

	$(".toggler").click(function() {
		var $div = $(this).nextAll(".answer_wrapper");
		$div.toggle();
		$(this).toggleClass('open_view', $div.is(':visible'));

		$(this).toggleClass('close_view', $div.is(':hidden'));
	});



	if ($("body").hasClass("tickets_pages")) {
		function get_radio_val(cont) {
			var radios = cont.find(":radio");
			for (var key in radios) {
				if ($(radios[key]).prop("checked")) {
					return $(radios[key]).val();
				};
			}
			return null;
		}

		$(function() {

			var $w = $("#tickets_form");
			var $charter = $w.find("#charter");
			var $charter_type = $w.find("#charter_type");
			var $charter_type_multi = $("#charter_type_multi");
			var $charter_type_default = $("#charter_type_default");

			var charter_callback = function(e) {
				console.log(")");
				if ($(this).val() == "1") {
					if ($charter_type_multi.prop("checked")) {
						$charter_type_default.prop("checked", true).trigger("change");
					}
					$charter_type_multi.prop("disabled", true).trigger("tcbl_change");
				} else {
					$charter_type_multi.prop("disabled", false).trigger("tcbl_change");
				}
			}
			$("#charter_type_default").prop("checked", true).trigger("change");
			if (get_radio_val($charter) == "0") {
				$charter_type_multi.prop('disabled', false).trigger("tcbl_change");
			} else {
				$charter_type_multi.prop('disabled', true).trigger("tcbl_change");
			}

			$charter.find(":radio").on("change", charter_callback);

			var charter_type_callback = function(e) {
				switch ($(this).val()) {
					case "1": // ცალმხრივი
						to_static();
						$w.find("#return_data").hide();
						break;
					case "2": // ორმხრივი
						to_static();
						$w.find("#return_data").show();
						break;
					case "3": // მულტი–ქალაქი
						to_dinamic();
						break;
				}
			};

			$charter_type.find(":radio").on("change", charter_type_callback);

			var to_dinamic = function() {
				$("#static_").hide();
				$("#dinamic_").show();
				$("#city_forms").html("");
				var cfc = $("#city_form_copy")
					.clone(true)
					.removeAttr("id")
					.show();
				cfc.find(".city_index").html($("#city_forms").find(".city_form_instance").length + 1);
				$("#city_forms").append(cfc);
				cfc.find(".option_type_").chosen();
				cfc.find('.chosen-results').slimScroll({
					position: 'right',
					height: '150px',
					railVisible: true,
					alwaysVisible: false
				});
				cfc.find(".delete_city_btn").on("click", function(e) {
					$(this).parents(".city_form_instance").remove();
					$("#city_forms .city_index").each(function(i, e) {
						$(this).text(i + 1);
					});
				});
			}
			var to_static = function() {
				$("#static_").show();
				$("#dinamic_").hide();
				$("#city_forms").html("");
			}

			$("#add_city").on("click", function(e) {
				var cfc = $("#city_form_copy")
					.clone(true)
					.removeAttr("id")
					.show();
				cfc.find(".city_index").html($("#city_forms").find(".city_form_instance").length + 1);
				$("#city_forms").append(cfc);
				cfc.find(".option_type_").chosen();
				cfc.find(".delete_city_btn").on("click", function(e) {
					$(this).parents(".city_form_instance").remove();
					$("#city_forms .city_index").each(function(i, e) {
						$(this).text(i + 1);
					});
				});
			});

			var script_style = ($("#kids_ages_form").attr("data-scriptstyle") == "0") ? false : true;
			var kids_ages_choser = function(e) {
				var count = Number($(this).val());
				$("#kids_ages_form_w").html("");
				if (count > 0) {
					$("#kids_ages_form").show();
					for (var i = 1; i <= count; i++) {
						var kaf = $("#kid_age_form").clone(true).show();
						kaf.find(".kid_index").html(i);
						kaf.find(".select_chosen_").chosen();
						kaf.find('.chosen-results').slimScroll({
							position: 'right',
							height: '150px',
							railVisible: true,
							alwaysVisible: false
						});
						$("#kids_ages_form_w").append(kaf);
						if (script_style && ((i / 3) % 1 === 0)) {
							kaf.css("margin-right", 0);
							if ((i + 1) <= count) {
								$("#kids_ages_form_w").append(
									$("<div />").addClass("clear").css("height", "15px")
								);
							};
						}
					}
					$("#kids_ages_form_w").append($("<div />").addClass("clear"));
				} else {
					$("#kids_ages_form").hide();
				}
			}
			$("#kids_count").on("change", kids_ages_choser);



			$('.flight_item .show_hide').click(function(e) {
				e.preventDefault();
				$(this).parent().parent().parent().find(".tickets_more").stop().slideToggle();
			});
			$(".flight_item .tickets_close").click(function(e) {
				e.preventDefault();
				$(this).parent().parent().stop().slideToggle();
			});

		});
	}

	if ($("body").hasClass("tours_pages ")) {
		$(function() {
			$("#tour_type").one("change", function(e) {
				$("#tour_end_data")
					.val("")
					.attr("disabled", "disabled")
					.parent().addClass("disabled_data");
			});
		})();
	}

	if ($("body").hasClass("mainpage")) {
		$(".boxes_wrapper").each(function() {
			var w = $(this);
			var w_ul = w.find(".boxes_wrapper_inner");
			var cur_index = 0;
			var last_index = w_ul.find(".boxes_wrapper_section").length - 1;
			var section_width = 1240;
			var speed = 700;

			var slide_left = function(e) {
				e.preventDefault();
				if (w_ul.filter(":animated").length == 0) {
					if (cur_index != 0) {
						cur_index = cur_index - 1;
						w_ul.animate({
							"left": "-" + (cur_index * section_width) + "px"
						}, speed);
					};
				};
			};

			var slide_right = function(e) {
				e.preventDefault();
				if (w_ul.filter(":animated").length == 0) {
					if (cur_index != last_index) {
						cur_index = cur_index + 1;
						w_ul.animate({
							"left": "-" + (cur_index * section_width) + "px"
						}, speed);
					};
				};
			};

			w.find("> .boxes_wrapper_button_left").on("click", slide_left);
			w.find("> .boxes_wrapper_button_right").on("click", slide_right);
		});
	}


	if ($("body").hasClass("usefull_info_page")) {
		$(".img_slider_wrap").each(function() {
			var w = $(this);
			var w_ul = w.find(".img_slider_container");
			var cur_index = 0;
			var last_index = w_ul.find(".about_img").length - 1;
			var section_width = 360;
			var speed = 700;

			var slide_left = function(e) {
				e.preventDefault();
				if (w_ul.filter(":animated").length == 0) {
					if (cur_index != 0) {
						cur_index = cur_index - 1;
						w_ul.animate({
							"left": "-" + (cur_index * section_width) + "px"
						}, speed);
					};
				};
			};

			var slide_right = function(e) {
				e.preventDefault();
				if (w_ul.filter(":animated").length == 0) {
					if (cur_index != last_index) {
						cur_index = cur_index + 1;
						w_ul.animate({
							"left": "-" + (cur_index * section_width) + "px"
						}, speed);
					};
				};
			};

			w.find(" .gallery_button_left").on("click", slide_left);
			w.find(" .gallery_button_right").on("click", slide_right);
		});
	}

	$(".edit_and_close_ico").on("click", function(e) {
		var $this = $(this);
		var $tr = $this.parents("tr");
		var $info_textbody = $tr.find(".info_textbody");
		if ($this.hasClass("edit_ico")) {
			$info_textbody.find(".info_text").hide();
			$info_textbody.find(".edit_form").show();
			$this.removeClass("edit_ico").addClass("close_ico");
		} else {
			$info_textbody.find(".info_text").show();
			$info_textbody.find(".edit_form").hide();
			$this.removeClass("close_ico").addClass("edit_ico");
		}
	});

//////////// inports from script.js start //////////////
$('#hotel_submit_btn').click(function(e){
        e.preventDefault();
        var kids_picker = $('#kids_picker').val();
        var form_submit = true;
        var kids_age = 0;
        for(var i=1; i<=kids_picker; i++)
        {
            kids_age = $('#age_' + i).val();
            try{
                kids_age = parseInt(kids_age);
              } catch(e) {
                alert('˜Child age must be filled');
                form_submit = false;
                break;
                return;
              } 
            if(!kids_age > 0)
            {
               alert('Please fill the age correctly.˜');
               form_submit = false;
               break;
               return; 
            }
            if(kids_age > 12)
            {
               alert( kids_age + ' years old children are the adults already');
               form_submit = false;
               break;
               return; 
            }

        }
        
        if(form_submit)
        {
            $( "#hotel_search_form" ).submit();
        }
    })
    
    
$('#package_submit_btn').click(function(e){
        e.preventDefault();
        var kids_picker = $('#kids_picker').val();
        var form_submit = true;
        var kids_age = 0;
        for(var i=1; i<=kids_picker; i++)
        {
            kids_age = $('#age_' + i).val();
            try{
                kids_age = parseInt(kids_age);
              } catch(e) {
                alert('˜Child age must be filled');
                form_submit = false;
                break;
                return;
              } 
            if(!kids_age > 0)
            {
               alert('Please fill the age correctly.˜');
               form_submit = false;
               break;
               return; 
            }
            if(kids_age > 12)
            {
               alert( kids_age + ' years old children are the adults already');
               form_submit = false;
               break;
               return; 
            }

        }
        
        if(form_submit)
        {
            $( "#package_search_form" ).submit();
        }
    })
    
///-----------------

function calculate_age(birth_date, dateNow)
    {
        //var isoDate = new Date(birth_date);
        //var dateNow = new Date();

        var range = dateNow - birth_date;
        
        var year = Math.floor(range / (365 * 3600 * 24 * 1000));
        return year;
    }
    $('#repeat_info').click(function(){
        
        if($('#repeat_info').is(':checked'))
        {
            $.getJSON( "/data_files/json/get_user_data.php", function( data ) {
                if (data === null && data === undefined) {
                    return;
                }
                data_add_or_remove('_0_0', data, 'add', 0);
            });
        }else{
             var data = new Array();
             data_add_or_remove('_0_0', data, 'remove', 0);
        }
    })
    
    function data_add_or_remove(elementId, data, operation, childs)
    {
        if(typeof data['pin'] == 'undefined')
        {
            return;
        }
        var genders = new Array(1,2);
        var gender_string = new Array('MR', 'MRS');
        var gender_html = '';
        var is_select = '';
        var doc_types = new Array(2,1);
        var doc_types_stirng = new Array('ID Card', 'Pasport');
        var doc_type_html = '';
        var doc_type_select = ''; 
       
        if(childs == 1)
        {
        var id_names = new Array();
            id_names['prdNumber']      = 'childPrdNum';
            id_names['nithDate']       = 'chilsAge';
            id_names['realName']       = 'childName';
            id_names['lastName']       = 'childLastName';
            id_names['email']          = 'email';
            id_names['phone']          = 'phone';
            id_names['documentNumber'] = 'childDocumentNumber';
            id_names['gender']         = 'childGender';
            id_names['documentType']   = 'childDocumentType';
            id_names['documentValid']  = 'documentValid';
             
        }else{
        var id_names = new Array()
            id_names['prdNumber']      = 'prdNumber';
            id_names['nithDate']       = 'nithDate';
            id_names['realName']       = 'realName';
            id_names['lastName']       = 'lastName';
            id_names['email']          = 'email';
            id_names['phone']          = 'phone';
            id_names['documentNumber'] = 'documentNumber';
            id_names['gender']         = 'gender';
            id_names['documentType']   = 'documentType';
            id_names['documentValid']  = 'documentValid';
              
        }
        //alert(id_names['prdNumber']);
        if(operation == 'remove')
        {
            data['pin'] = '';
            data['birthDate'] = '';
            data['firstName'] = '';
            data['lastName'] = '';
            data['email'] = '';
            data['phone'] = '';
            data['docNum'] = '';
            data['gender'] = 0 ;
            data['docType'] = 0 ;
            data['documentValid'] = '';
        }
        
                $('#'+id_names['prdNumber'] + elementId).val(data['pin']);
                $('#'+id_names['nithDate'] + elementId).val(data['birthDate']);
                $('#'+id_names['realName'] + elementId).val(data['firstName']);
                $('#'+id_names['lastName'] + elementId).val(data['lastName']);
                $('#'+id_names['email'] + elementId).val(data['email']);
                $('#'+id_names['phone'] + elementId).val(data['phone']);
                $('#'+id_names['documentNumber'] + elementId).val(data['docNum']);
                $('#'+id_names['documentValid'] + elementId).val(data['pasportExpDate']);
                for(var i=0; i<genders.length; i++)
                {
                    if(data['gender'] == genders[i])
                    {
                        is_select = 'selected="selected"';
                    }else{
                        is_select = '';
                    }
                   gender_html += '<option value="' + genders[i] + '" ' + is_select + '>' + gender_string[i] + '</option>' ;
                }
                $('#'+id_names['gender'] + elementId).html(gender_html).trigger("chosen:updated");
                
                for(var i=0; i<doc_types.length; i++)
                {
                    if(data['docType'] == doc_types[i])
                    {
                        doc_type_select = 'selected="selected"';
                    }else{
                        doc_type_select = '';
                    }
                   doc_type_html += '<option value="' + doc_types[i] + '" ' + doc_type_select + '>' + doc_types_stirng[i] + '</option>' ;
                }
                $('#'+id_names['documentType'] + elementId).html(doc_type_html).trigger("chosen:updated");
    }
    $('#ticket_repeat_info').click(function(){
        
        if($('#ticket_repeat_info').is(':checked'))
        {
            $.getJSON( "/data_files/json/get_user_data.php", function( data ) {
                if (data === null && data === undefined) {
                    return;
                }
                ticket_data_add_or_remove('_1', data, 'add');
            });
        }else{
             var data = new Array();
             ticket_data_add_or_remove('_1', data, 'remove', 0);
        }
    })
    ////////////////////////////////////////////////
    function ticket_data_add_or_remove(elementId, data, operation)
    {
        
        var persons = new Array(1,2,3);
        var persons_string = new Array('', '', '');
        var persons_html = '';
        var persons_select = '';
        var gender= new Array(1,2);
        var gender_stirng = new Array('MR', 'MRS');
        var gender_html = '';
        var gender_select = ''; 

        var id_names = new Array();
            id_names['gender']          = 'gender';
            id_names['personAgeRang']   = 'personAgeRang';
            id_names['documentValid']   = 'documentValid';            
            id_names['prdNumber']       = 'prdNumber';
            id_names['realName']        = 'realName';
            id_names['lastName']        = 'lastName';
            id_names['birthDate']       = 'birthDate';
            id_names['email']           = 'email';
            id_names['phone']           = 'phone';
            id_names['documentNumber']  = 'documentNumber';
            id_names['documentValid']   = 'documentValid'; 

            
            if(operation == 'remove')
            {
                data['pin'] = '';
                data['birthDate'] = '';
                data['documentValid'] = '';
                data['firstName'] = '';
                data['lastName'] = '';
                data['email'] = '';
                data['phone'] = '';
                data['docNum'] = '';
                data['gender'] = 0 ;
                data['docType'] = 0 ;
            }

            $('#'+id_names['prdNumber'] + elementId).val(data['pin']);
            
            $('#'+id_names['realName'] + elementId).val(data['firstName']);
            $('#'+id_names['lastName'] + elementId).val(data['lastName']);
            $('#'+id_names['birthDate'] + elementId).val(data['birthDate']);
            $('#'+id_names['email'] + elementId).val(data['email']);
            $('#'+id_names['phone'] + elementId).val(data['phone']);
            $('#'+id_names['documentNumber'] + elementId).val(data['docNum']);
            $('#'+id_names['documentValid'] + elementId).val(data['pasportExpDate']);
            
            
            for(var i=0; i<gender.length; i++)
                {
                    if(data['gender'] == gender[i])
                    {
                        gender_select = 'selected="selected"';
                    }else{
                        gender_select = '';
                    }
                   gender_html += '<option value="' + gender[i] + '" ' + gender_select + '>' + gender_stirng[i] + '</option>' ;
                }
                $('#'+id_names['gender'] + elementId).html(gender_html).trigger("chosen:updated");

///////////////////////////////////////////////////////
               for(var i=0; i<persons.length; i++)
                {
                    if(data['range'] == persons[i])
                    {
                        persons_select = 'selected="selected"';
                    }else{
                        persons_select = '';
                    }
                   persons_html += '<option value="' + persons[i] + '" ' + persons_select + '>' + persons_string[i] + '</option>' ;
                }

                $('#'+id_names['personAgeRang'] + elementId).html(persons_html).trigger("chosen:updated");
    }
    ////////////////////////////////////////////////
    $('.prd_number').focusout(function(){
		console.log(prd_num);
        var id = $(this).attr('id');
        var prd_num = $(this).val();
        $.getJSON( "/data_files/json/get_user_data.php?pin=" + prd_num , function( data ) {
            if (data === null && data === undefined) {
                    return;
                }
            var id_array = id.split('_');
            data_add_or_remove('_'+ id_array[1] +'_'+ id_array[2], data, 'add', 0);
        })
        
    })
    
    $('.child_prd_number').focusout(function(){
        var id = $(this).attr('id');
        var prd_num = $(this).val();
        $.getJSON( "/data_files/json/get_user_data.php?pin=" + prd_num , function( data ) {
            if (data === null && data === undefined) {
                    return;
                }
            var id_array = id.split('_');
            data_add_or_remove('_'+ id_array[1] +'_'+ id_array[2], data, 'add', 1);
        })
        
    })

     $('.pers_number').focusout(function(){
        var id = $(this).attr('id');
        var prd_num = $(this).val();
        $.getJSON( "/data_files/json/get_user_data.php?pin=" + prd_num , function( data ) {
            if (data === null && data === undefined) {
                    return;
                }
            var id_array = id.split('_');
//alert(data['firstName']);
            ticket_data_add_or_remove('_'+ id_array[1], data, 'add');
        })
        
    })
//////////// inports from script.js end //////////////
    $("#passangersCount").keydown(function (e) {
        // Allow: backspace, delete, tab, escape, enter and .
        if ($.inArray(e.keyCode, [46, 8, 9, 27, 13, 110, 190]) !== -1 ||
             // Allow: Ctrl+A
            (e.keyCode == 65 && e.ctrlKey === true) || 
             // Allow: home, end, left, right
            (e.keyCode >= 35 && e.keyCode <= 39)) {
                 // let it happen, don't do anything
                 return;
        }
        // Ensure that it is a number and stop the keypress
        if ((e.shiftKey || (e.keyCode < 48 || e.keyCode > 57)) && (e.keyCode < 96 || e.keyCode > 105)) {
            e.preventDefault();
        }
    });
    
    $('#passangersCount').keyup(function() {
        var passangers_count = $('#passangersCount').val();
        var event_date = $('#event_date').val();
        var item_id = $('#item_id').val();
        if((passangers_count == 0) || (passangers_count == ''))
        {
            passangers_count = 1;
            $('#passangersCount').val(passangers_count);
        }
        $price = check_other_prd_price(item_id, event_date, passangers_count);
        //$('#item_cost').html('');
        $('#item_cost').html($price);
        
    })
    $('#event_date').change(function() {
        var passangers_count = $('#passangersCount').val();
        var event_date = $('#event_date').val();
        var item_id = $('#item_id').val();
        if((passangers_count == 0) || (passangers_count == ''))
        {
            passangers_count = 1;
            $('#passangersCount').val(passangers_count);
        }
        $price = check_other_prd_price(item_id, event_date, passangers_count);
        //$('#item_cost').html('');
        $('#item_cost').html($price);
        
    })
    
    $('.terms_and_condotions').click(function(e){
        e.preventDefault();
        var in_dex = $(this).attr('id');
        //alert($index);
        $.get( "/data_files/statis_pages.php?doc_id=" + in_dex, function( asdf_file_data ) {
        //$.get( "/data_files/statis_pages.php", function( asdf_file_data ) {
                //alert(asdf_file_data);
                //$('#map_canvas').html('');
                $('#map_canvas').html(asdf_file_data);
                //$( "#modal_content" ).dialog();
                show_modal_window();
            });
    })
    
    $('.room_select_radio').click(function(){
    var price = $(this).attr('id');
    //alert(price);
    $('#total_item_cost').html(price);
    $('#total_item_cost_value').val(price);
    disable_booking_btn_stop_sale();
    })
    
    ////////////////
    
    $('.package_submit_link').click(function(e){
        e.preventDefault();
        var el_id = $(this).attr('id');
        var res = el_id.split("_");
        //alert(res);
        var id_string = 'package_submit_btn_' + res[1];
        $('#' + id_string).trigger('click');
    })
    
    /////////////////////
    
    $('.edit_customer_data').click(function(){

        var custommer_id = $(this).attr('id');
        
        $.get( "/data_files/load_custommer_data.php?cus_id=" + custommer_id, function( cus_data ) {
                $('#map_canvas').html(cus_data);
                show_modal_window();
            });
        
    })
    
    
});

function check_other_prd_price(item_id, event_date, persons)
{     
    var mydata = '0';
        $.ajax({url:"data_files/json/get_other_product_price.php?item_id="+ item_id +"&event_date="+event_date+"&persons="+persons, 
					  success: function(data) {
							mydata = data;
						},
						async:   false
		});
        
        return mydata ;
        
}
//////////////////
 function close_modal(){
        //alert('close');
        $('#mask').fadeOut(150);    
        $('#dialog').fadeOut(150); 
      }
////////////////////////
function disable_booking_btn_stop_sale()
{
    var cost_value = $('#total_item_cost_value').val();
    if(cost_value > 0)
    {
        $('#hotel_detailed_submit_btn').attr('disabled', false);
    }else{
        $('#hotel_detailed_submit_btn').attr('disabled', true);
    }
    
}
////////////////////////
      function show_modal_window()
      {
            var maskHeight = $(document).height();
            var maskWidth = $(window).width();
        
            //Set height and width to mask to fill up the whole screen
            $('#mask').css({'width':maskWidth,'height':maskHeight});
            
            //transition effect        
            //$('#mask').fadeIn(1000);    
            $('#mask').fadeTo("slow",0.8);    
        
            //Get the window height and width
            var winH = $(window).height();
            var winW = $(window).width();
                  
            //Set the popup window to center
            $('#dialog').css('top',  winH/2-$('#dialog').height()/2);
            $('#dialog').css('left', winW/2-$('#dialog').width()/2);
        
            //transition effect
            $('#dialog').fadeIn(150); 
            //$('#dialog').html(mystring);
      }
      /////////////////////

function save_c_e_data(idn, book_idn)
{

    var c_e_pin = $('#c_e_pin').val();
    var c_e_phone = $('#c_e_phone').val();
    var c_e_pasnum = $('#c_e_pasnum').val();
    var c_e_email = $('#c_e_email').val();
    var c_e_pvalid = $('#c_e_pvalid').val();
    var c_e_adress = $('#c_e_adress').val();
    
     $.get( "/data_files/update_custommer_data.php?cus_id=" + idn + "&book_idn=" + book_idn + "&c_e_pin=" + c_e_pin + "&c_e_phone=" + c_e_phone + "&c_e_pasnum=" + c_e_pasnum + "&c_e_email=" + c_e_email + "&c_e_pvalid=" + c_e_pvalid + "&c_e_adress=" + c_e_adress, function( cus_data ) {
                $('#map_canvas').html(cus_data);//.delay( 2500 );
                //show_modal_window();
                //close_modal();
            });
}

/////////////////////
    
    function getAge(dateString) {
              var now = new Date();
              var today = new Date(now.getYear(),now.getMonth(),now.getDate());
            
              var yearNow = now.getYear();
              var monthNow = now.getMonth();
              var dateNow = now.getDate();
            
              var dob = new Date(dateString.substring(6,10),
                                 dateString.substring(0,2)-1,                    
                                 dateString.substring(3,5)                   
                                 );
            
              var yearDob = dob.getYear();
              var monthDob = dob.getMonth();
              var dateDob = dob.getDate();
              var age = {};
              var ageString = "";
              var yearString = "";
              var monthString = "";
              var dayString = "";
            
            
              yearAge = yearNow - yearDob;
            
              if (monthNow >= monthDob)
                var monthAge = monthNow - monthDob;
              else {
                yearAge--;
                var monthAge = 12 + monthNow -monthDob;
              }
            
              if (dateNow >= dateDob)
                var dateAge = dateNow - dateDob;
              else {
                monthAge--;
                var dateAge = 31 + dateNow - dateDob;
            
                if (monthAge < 0) {
                  monthAge = 11;
                  yearAge--;
                }
              }
            
              age = {
                  years: yearAge,
                  months: monthAge,
                  days: dateAge
                  };
            return age.years;
              if ( age.years > 1 ) yearString = " years";
              else yearString = " year";
              if ( age.months> 1 ) monthString = " months";
              else monthString = " month";
              if ( age.days > 1 ) dayString = " days";
              else dayString = " day";
            
            
              if ( (age.years > 0) && (age.months > 0) && (age.days > 0) )
                ageString = age.years + yearString + ", " + age.months + monthString + ", and " + age.days + dayString + " old.";
              else if ( (age.years == 0) && (age.months == 0) && (age.days > 0) )
                ageString = "Only " + age.days + dayString + " old!";
              else if ( (age.years > 0) && (age.months == 0) && (age.days == 0) )
                ageString = age.years + yearString + " old. Happy Birthday!!";
              else if ( (age.years > 0) && (age.months > 0) && (age.days == 0) )
                ageString = age.years + yearString + " and " + age.months + monthString + " old.";
              else if ( (age.years == 0) && (age.months > 0) && (age.days > 0) )
                ageString = age.months + monthString + " and " + age.days + dayString + " old.";
              else if ( (age.years > 0) && (age.months == 0) && (age.days > 0) )
                ageString = age.years + yearString + " and " + age.days + dayString + " old.";
              else if ( (age.years == 0) && (age.months > 0) && (age.days == 0) )
                ageString = age.months + monthString + " old.";
              else ageString = "Oops! Could not calculate age!";
            
              return ageString;
        }